From 1c563937ccb6375fbf33fef9162071d21a4c841a Mon Sep 17 00:00:00 2001 From: javdiaort <javdiaort@alum.us.es> Date: Tue, 18 Mar 2025 12:05:11 +0100 Subject: [PATCH] login,session and todolist started --- node_modules/.bin/bcrypt | 16 + node_modules/.bin/bcrypt.cmd | 17 + node_modules/.bin/bcrypt.ps1 | 28 + node_modules/.package-lock.json | 149 + node_modules/asn1.js/.eslintrc.js | 27 + node_modules/asn1.js/LICENSE | 21 + node_modules/asn1.js/README.md | 100 + node_modules/asn1.js/lib/asn1.js | 11 + node_modules/asn1.js/lib/asn1/api.js | 57 + node_modules/asn1.js/lib/asn1/base/buffer.js | 153 + node_modules/asn1.js/lib/asn1/base/index.js | 8 + node_modules/asn1.js/lib/asn1/base/node.js | 638 ++ .../asn1.js/lib/asn1/base/reporter.js | 123 + .../asn1.js/lib/asn1/constants/der.js | 58 + .../asn1.js/lib/asn1/constants/index.js | 21 + node_modules/asn1.js/lib/asn1/decoders/der.js | 335 + .../asn1.js/lib/asn1/decoders/index.js | 6 + node_modules/asn1.js/lib/asn1/decoders/pem.js | 51 + node_modules/asn1.js/lib/asn1/encoders/der.js | 295 + .../asn1.js/lib/asn1/encoders/index.js | 6 + node_modules/asn1.js/lib/asn1/encoders/pem.js | 23 + node_modules/asn1.js/package.json | 36 + node_modules/bcryptjs/LICENSE | 27 + node_modules/bcryptjs/README.md | 201 + node_modules/bcryptjs/bin/bcrypt | 23 + node_modules/bcryptjs/index.d.ts | 3 + node_modules/bcryptjs/index.js | 1161 +++ node_modules/bcryptjs/package.json | 76 + node_modules/bcryptjs/types.d.ts | 157 + node_modules/bcryptjs/umd/index.d.ts | 3 + node_modules/bcryptjs/umd/index.js | 1221 +++ node_modules/bcryptjs/umd/package.json | 3 + node_modules/bcryptjs/umd/types.d.ts | 157 + node_modules/bn.js/LICENSE | 19 + node_modules/bn.js/README.md | 200 + node_modules/bn.js/lib/bn.js | 3446 ++++++++ node_modules/bn.js/package.json | 36 + node_modules/bn.js/util/genCombMulTo.js | 65 + node_modules/bn.js/util/genCombMulTo10.js | 65 + node_modules/connect-mongo/.commitlintrc.yml | 2 + node_modules/connect-mongo/.editorconfig | 15 + node_modules/connect-mongo/.eslintcache | 1 + node_modules/connect-mongo/.eslintignore | 6 + node_modules/connect-mongo/.eslintrc.yml | 41 + .../connect-mongo/.github/CONTRIBUTING.md | 3 + .../connect-mongo/.github/ISSUE_TEMPLATE.md | 9 + .../.github/PULL_REQUEST_TEMPLATE.md | 12 + node_modules/connect-mongo/.github/stale.yml | 17 + .../.github/workflows/sanity.yml | 40 + node_modules/connect-mongo/.npmignore | 20 + .../a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json | 1 + .../a45b74f9-8ef2-4938-b880-8baaf3d007ab.json | 1 + .../caee767b-c4ce-4448-9074-a8212c1e2643.json | 1 + .../a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json | 1 + .../a45b74f9-8ef2-4938-b880-8baaf3d007ab.json | 1 + .../caee767b-c4ce-4448-9074-a8212c1e2643.json | 1 + .../.nyc_output/processinfo/index.json | 1 + node_modules/connect-mongo/.nycrc.json | 7 + node_modules/connect-mongo/.prettierignore | 2 + .../connect-mongo/.vscode/launch.json | 29 + .../connect-mongo/.vscode/settings.json | 5 + node_modules/connect-mongo/CHANGELOG.md | 385 + node_modules/connect-mongo/LICENSE | 21 + node_modules/connect-mongo/MIGRATION_V4.md | 59 + node_modules/connect-mongo/README.md | 336 + .../connect-mongo/build/main/index.d.ts | 2 + .../connect-mongo/build/main/index.js | 7 + .../build/main/lib/MongoStore.d.ts | 96 + .../build/main/lib/MongoStore.js | 415 + .../build/main/lib/MongoStore.spec.d.ts | 1 + .../build/main/lib/MongoStore.spec.js | 326 + .../build/main/test/integration.spec.d.ts | 6 + .../build/main/test/integration.spec.js | 87 + .../build/main/test/testHelper.d.ts | 38 + .../build/main/test/testHelper.js | 68 + .../connect-mongo/build/tsconfig.tsbuildinfo | 1 + .../connect-mongo/docker-compose.yaml | 11 + node_modules/connect-mongo/example/index.js | 26 + .../example/mongoose-multiple-connections.js | 68 + .../connect-mongo/example/mongoose.js | 34 + .../connect-mongo/example/package.json | 24 + .../connect-mongo/example/ts-example.ts | 32 + .../connect-mongo/example/tsconfig.json | 71 + node_modules/connect-mongo/example/yarn.lock | 666 ++ .../connect-mongo/node_modules/debug/LICENSE | 20 + .../node_modules/debug/README.md | 481 ++ .../node_modules/debug/package.json | 65 + .../node_modules/debug/src/browser.js | 272 + .../node_modules/debug/src/common.js | 292 + .../node_modules/debug/src/index.js | 10 + .../node_modules/debug/src/node.js | 263 + .../connect-mongo/node_modules/ms/index.js | 162 + .../connect-mongo/node_modules/ms/license.md | 21 + .../node_modules/ms/package.json | 38 + .../connect-mongo/node_modules/ms/readme.md | 59 + node_modules/connect-mongo/package.json | 159 + node_modules/connect-mongo/src/index.ts | 2 + .../connect-mongo/src/lib/MongoStore.spec.ts | 330 + .../connect-mongo/src/lib/MongoStore.ts | 545 ++ .../src/test/integration.spec.ts | 105 + .../connect-mongo/src/test/testHelper.ts | 64 + .../connect-mongo/src/types/kruptein.d.ts | 32 + node_modules/connect-mongo/tsconfig.json | 48 + node_modules/connect-mongo/yarn.lock | 7281 +++++++++++++++++ node_modules/express-session/HISTORY.md | 470 ++ node_modules/express-session/LICENSE | 24 + node_modules/express-session/README.md | 1032 +++ node_modules/express-session/index.js | 693 ++ .../node_modules/cookie-signature/History.md | 42 + .../node_modules/cookie-signature/Readme.md | 42 + .../node_modules/cookie-signature/index.js | 51 + .../cookie-signature/package.json | 18 + .../node_modules/cookie/LICENSE | 24 + .../node_modules/cookie/README.md | 317 + .../node_modules/cookie/SECURITY.md | 25 + .../node_modules/cookie/index.js | 335 + .../node_modules/cookie/package.json | 44 + node_modules/express-session/package.json | 47 + .../express-session/session/cookie.js | 152 + .../express-session/session/memory.js | 187 + .../express-session/session/session.js | 143 + node_modules/express-session/session/store.js | 102 + node_modules/kruptein/.test/vanilla.js | 84 + node_modules/kruptein/CONTRIBUTING.md | 107 + node_modules/kruptein/LICENSE | 20 + node_modules/kruptein/README.md | 144 + node_modules/kruptein/SECURITY.md | 18 + node_modules/kruptein/index.js | 7 + node_modules/kruptein/lib/kruptein.js | 416 + node_modules/kruptein/package.json | 53 + node_modules/minimalistic-assert/LICENSE | 13 + node_modules/minimalistic-assert/index.js | 11 + node_modules/minimalistic-assert/package.json | 19 + node_modules/minimalistic-assert/readme.md | 4 + node_modules/on-headers/HISTORY.md | 21 + node_modules/on-headers/LICENSE | 22 + node_modules/on-headers/README.md | 81 + node_modules/on-headers/index.js | 132 + node_modules/on-headers/package.json | 42 + node_modules/random-bytes/HISTORY.md | 4 + node_modules/random-bytes/LICENSE | 21 + node_modules/random-bytes/README.md | 77 + node_modules/random-bytes/index.js | 101 + node_modules/random-bytes/package.json | 36 + node_modules/uid-safe/HISTORY.md | 61 + node_modules/uid-safe/LICENSE | 22 + node_modules/uid-safe/README.md | 77 + node_modules/uid-safe/index.js | 107 + node_modules/uid-safe/package.json | 46 + package-lock.json | 152 + package.json | 3 + src/index.js | 100 +- views/home.ejs | 24 +- 153 files changed, 28042 insertions(+), 18 deletions(-) create mode 100644 node_modules/.bin/bcrypt create mode 100644 node_modules/.bin/bcrypt.cmd create mode 100644 node_modules/.bin/bcrypt.ps1 create mode 100644 node_modules/asn1.js/.eslintrc.js create mode 100644 node_modules/asn1.js/LICENSE create mode 100644 node_modules/asn1.js/README.md create mode 100644 node_modules/asn1.js/lib/asn1.js create mode 100644 node_modules/asn1.js/lib/asn1/api.js create mode 100644 node_modules/asn1.js/lib/asn1/base/buffer.js create mode 100644 node_modules/asn1.js/lib/asn1/base/index.js create mode 100644 node_modules/asn1.js/lib/asn1/base/node.js create mode 100644 node_modules/asn1.js/lib/asn1/base/reporter.js create mode 100644 node_modules/asn1.js/lib/asn1/constants/der.js create mode 100644 node_modules/asn1.js/lib/asn1/constants/index.js create mode 100644 node_modules/asn1.js/lib/asn1/decoders/der.js create mode 100644 node_modules/asn1.js/lib/asn1/decoders/index.js create mode 100644 node_modules/asn1.js/lib/asn1/decoders/pem.js create mode 100644 node_modules/asn1.js/lib/asn1/encoders/der.js create mode 100644 node_modules/asn1.js/lib/asn1/encoders/index.js create mode 100644 node_modules/asn1.js/lib/asn1/encoders/pem.js create mode 100644 node_modules/asn1.js/package.json create mode 100644 node_modules/bcryptjs/LICENSE create mode 100644 node_modules/bcryptjs/README.md create mode 100644 node_modules/bcryptjs/bin/bcrypt create mode 100644 node_modules/bcryptjs/index.d.ts create mode 100644 node_modules/bcryptjs/index.js create mode 100644 node_modules/bcryptjs/package.json create mode 100644 node_modules/bcryptjs/types.d.ts create mode 100644 node_modules/bcryptjs/umd/index.d.ts create mode 100644 node_modules/bcryptjs/umd/index.js create mode 100644 node_modules/bcryptjs/umd/package.json create mode 100644 node_modules/bcryptjs/umd/types.d.ts create mode 100644 node_modules/bn.js/LICENSE create mode 100644 node_modules/bn.js/README.md create mode 100644 node_modules/bn.js/lib/bn.js create mode 100644 node_modules/bn.js/package.json create mode 100644 node_modules/bn.js/util/genCombMulTo.js create mode 100644 node_modules/bn.js/util/genCombMulTo10.js create mode 100644 node_modules/connect-mongo/.commitlintrc.yml create mode 100644 node_modules/connect-mongo/.editorconfig create mode 100644 node_modules/connect-mongo/.eslintcache create mode 100644 node_modules/connect-mongo/.eslintignore create mode 100644 node_modules/connect-mongo/.eslintrc.yml create mode 100644 node_modules/connect-mongo/.github/CONTRIBUTING.md create mode 100644 node_modules/connect-mongo/.github/ISSUE_TEMPLATE.md create mode 100644 node_modules/connect-mongo/.github/PULL_REQUEST_TEMPLATE.md create mode 100644 node_modules/connect-mongo/.github/stale.yml create mode 100644 node_modules/connect-mongo/.github/workflows/sanity.yml create mode 100644 node_modules/connect-mongo/.npmignore create mode 100644 node_modules/connect-mongo/.nyc_output/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json create mode 100644 node_modules/connect-mongo/.nyc_output/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json create mode 100644 node_modules/connect-mongo/.nyc_output/caee767b-c4ce-4448-9074-a8212c1e2643.json create mode 100644 node_modules/connect-mongo/.nyc_output/processinfo/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json create mode 100644 node_modules/connect-mongo/.nyc_output/processinfo/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json create mode 100644 node_modules/connect-mongo/.nyc_output/processinfo/caee767b-c4ce-4448-9074-a8212c1e2643.json create mode 100644 node_modules/connect-mongo/.nyc_output/processinfo/index.json create mode 100644 node_modules/connect-mongo/.nycrc.json create mode 100644 node_modules/connect-mongo/.prettierignore create mode 100644 node_modules/connect-mongo/.vscode/launch.json create mode 100644 node_modules/connect-mongo/.vscode/settings.json create mode 100644 node_modules/connect-mongo/CHANGELOG.md create mode 100644 node_modules/connect-mongo/LICENSE create mode 100644 node_modules/connect-mongo/MIGRATION_V4.md create mode 100644 node_modules/connect-mongo/README.md create mode 100644 node_modules/connect-mongo/build/main/index.d.ts create mode 100644 node_modules/connect-mongo/build/main/index.js create mode 100644 node_modules/connect-mongo/build/main/lib/MongoStore.d.ts create mode 100644 node_modules/connect-mongo/build/main/lib/MongoStore.js create mode 100644 node_modules/connect-mongo/build/main/lib/MongoStore.spec.d.ts create mode 100644 node_modules/connect-mongo/build/main/lib/MongoStore.spec.js create mode 100644 node_modules/connect-mongo/build/main/test/integration.spec.d.ts create mode 100644 node_modules/connect-mongo/build/main/test/integration.spec.js create mode 100644 node_modules/connect-mongo/build/main/test/testHelper.d.ts create mode 100644 node_modules/connect-mongo/build/main/test/testHelper.js create mode 100644 node_modules/connect-mongo/build/tsconfig.tsbuildinfo create mode 100644 node_modules/connect-mongo/docker-compose.yaml create mode 100644 node_modules/connect-mongo/example/index.js create mode 100644 node_modules/connect-mongo/example/mongoose-multiple-connections.js create mode 100644 node_modules/connect-mongo/example/mongoose.js create mode 100644 node_modules/connect-mongo/example/package.json create mode 100644 node_modules/connect-mongo/example/ts-example.ts create mode 100644 node_modules/connect-mongo/example/tsconfig.json create mode 100644 node_modules/connect-mongo/example/yarn.lock create mode 100644 node_modules/connect-mongo/node_modules/debug/LICENSE create mode 100644 node_modules/connect-mongo/node_modules/debug/README.md create mode 100644 node_modules/connect-mongo/node_modules/debug/package.json create mode 100644 node_modules/connect-mongo/node_modules/debug/src/browser.js create mode 100644 node_modules/connect-mongo/node_modules/debug/src/common.js create mode 100644 node_modules/connect-mongo/node_modules/debug/src/index.js create mode 100644 node_modules/connect-mongo/node_modules/debug/src/node.js create mode 100644 node_modules/connect-mongo/node_modules/ms/index.js create mode 100644 node_modules/connect-mongo/node_modules/ms/license.md create mode 100644 node_modules/connect-mongo/node_modules/ms/package.json create mode 100644 node_modules/connect-mongo/node_modules/ms/readme.md create mode 100644 node_modules/connect-mongo/package.json create mode 100644 node_modules/connect-mongo/src/index.ts create mode 100644 node_modules/connect-mongo/src/lib/MongoStore.spec.ts create mode 100644 node_modules/connect-mongo/src/lib/MongoStore.ts create mode 100644 node_modules/connect-mongo/src/test/integration.spec.ts create mode 100644 node_modules/connect-mongo/src/test/testHelper.ts create mode 100644 node_modules/connect-mongo/src/types/kruptein.d.ts create mode 100644 node_modules/connect-mongo/tsconfig.json create mode 100644 node_modules/connect-mongo/yarn.lock create mode 100644 node_modules/express-session/HISTORY.md create mode 100644 node_modules/express-session/LICENSE create mode 100644 node_modules/express-session/README.md create mode 100644 node_modules/express-session/index.js create mode 100644 node_modules/express-session/node_modules/cookie-signature/History.md create mode 100644 node_modules/express-session/node_modules/cookie-signature/Readme.md create mode 100644 node_modules/express-session/node_modules/cookie-signature/index.js create mode 100644 node_modules/express-session/node_modules/cookie-signature/package.json create mode 100644 node_modules/express-session/node_modules/cookie/LICENSE create mode 100644 node_modules/express-session/node_modules/cookie/README.md create mode 100644 node_modules/express-session/node_modules/cookie/SECURITY.md create mode 100644 node_modules/express-session/node_modules/cookie/index.js create mode 100644 node_modules/express-session/node_modules/cookie/package.json create mode 100644 node_modules/express-session/package.json create mode 100644 node_modules/express-session/session/cookie.js create mode 100644 node_modules/express-session/session/memory.js create mode 100644 node_modules/express-session/session/session.js create mode 100644 node_modules/express-session/session/store.js create mode 100644 node_modules/kruptein/.test/vanilla.js create mode 100644 node_modules/kruptein/CONTRIBUTING.md create mode 100644 node_modules/kruptein/LICENSE create mode 100644 node_modules/kruptein/README.md create mode 100644 node_modules/kruptein/SECURITY.md create mode 100644 node_modules/kruptein/index.js create mode 100644 node_modules/kruptein/lib/kruptein.js create mode 100644 node_modules/kruptein/package.json create mode 100644 node_modules/minimalistic-assert/LICENSE create mode 100644 node_modules/minimalistic-assert/index.js create mode 100644 node_modules/minimalistic-assert/package.json create mode 100644 node_modules/minimalistic-assert/readme.md create mode 100644 node_modules/on-headers/HISTORY.md create mode 100644 node_modules/on-headers/LICENSE create mode 100644 node_modules/on-headers/README.md create mode 100644 node_modules/on-headers/index.js create mode 100644 node_modules/on-headers/package.json create mode 100644 node_modules/random-bytes/HISTORY.md create mode 100644 node_modules/random-bytes/LICENSE create mode 100644 node_modules/random-bytes/README.md create mode 100644 node_modules/random-bytes/index.js create mode 100644 node_modules/random-bytes/package.json create mode 100644 node_modules/uid-safe/HISTORY.md create mode 100644 node_modules/uid-safe/LICENSE create mode 100644 node_modules/uid-safe/README.md create mode 100644 node_modules/uid-safe/index.js create mode 100644 node_modules/uid-safe/package.json diff --git a/node_modules/.bin/bcrypt b/node_modules/.bin/bcrypt new file mode 100644 index 0000000..88dd8ed --- /dev/null +++ b/node_modules/.bin/bcrypt @@ -0,0 +1,16 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) + if command -v cygpath > /dev/null 2>&1; then + basedir=`cygpath -w "$basedir"` + fi + ;; +esac + +if [ -x "$basedir/node" ]; then + exec "$basedir/node" "$basedir/../bcryptjs/bin/bcrypt" "$@" +else + exec node "$basedir/../bcryptjs/bin/bcrypt" "$@" +fi diff --git a/node_modules/.bin/bcrypt.cmd b/node_modules/.bin/bcrypt.cmd new file mode 100644 index 0000000..762efef --- /dev/null +++ b/node_modules/.bin/bcrypt.cmd @@ -0,0 +1,17 @@ +@ECHO off +GOTO start +:find_dp0 +SET dp0=%~dp0 +EXIT /b +:start +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\bcryptjs\bin\bcrypt" %* diff --git a/node_modules/.bin/bcrypt.ps1 b/node_modules/.bin/bcrypt.ps1 new file mode 100644 index 0000000..fbe0a31 --- /dev/null +++ b/node_modules/.bin/bcrypt.ps1 @@ -0,0 +1,28 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + # Support pipeline input + if ($MyInvocation.ExpectingInput) { + $input | & "$basedir/node$exe" "$basedir/../bcryptjs/bin/bcrypt" $args + } else { + & "$basedir/node$exe" "$basedir/../bcryptjs/bin/bcrypt" $args + } + $ret=$LASTEXITCODE +} else { + # Support pipeline input + if ($MyInvocation.ExpectingInput) { + $input | & "node$exe" "$basedir/../bcryptjs/bin/bcrypt" $args + } else { + & "node$exe" "$basedir/../bcryptjs/bin/bcrypt" $args + } + $ret=$LASTEXITCODE +} +exit $ret diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json index 50ab287..e3082b0 100644 --- a/node_modules/.package-lock.json +++ b/node_modules/.package-lock.json @@ -165,6 +165,18 @@ "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==", "license": "MIT" }, + "node_modules/asn1.js": { + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", + "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", + "license": "MIT", + "dependencies": { + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + } + }, "node_modules/async": { "version": "3.2.6", "resolved": "https://registry.npmjs.org/async/-/async-3.2.6.tgz", @@ -191,6 +203,15 @@ "node": ">= 10.0.0" } }, + "node_modules/bcryptjs": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/bcryptjs/-/bcryptjs-3.0.2.tgz", + "integrity": "sha512-k38b3XOZKv60C4E2hVsXTolJWfkGRMbILBIe2IBITXciy5bOsTKot5kDrf3ZfufQtQOUN5mXceUEpU1rTl9Uog==", + "license": "BSD-3-Clause", + "bin": { + "bcrypt": "bin/bcrypt" + } + }, "node_modules/binary-extensions": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", @@ -203,6 +224,12 @@ "url": "https://github.com/sponsors/sindresorhus" } }, + "node_modules/bn.js": { + "version": "4.12.1", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.1.tgz", + "integrity": "sha512-k8TVBiPkPJT9uHLdOKfFpqcfprwBFOAAXXozRubr7R7PfIuKvQlzcI4M0pALeqXN09vdaMbUdUj+pass+uULAg==", + "license": "MIT" + }, "node_modules/body-parser": { "version": "1.20.3", "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz", @@ -378,6 +405,46 @@ "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", "license": "MIT" }, + "node_modules/connect-mongo": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/connect-mongo/-/connect-mongo-5.1.0.tgz", + "integrity": "sha512-xT0vxQLqyqoUTxPLzlP9a/u+vir0zNkhiy9uAdHjSCcUUf7TS5b55Icw8lVyYFxfemP3Mf9gdwUOgeF3cxCAhw==", + "license": "MIT", + "dependencies": { + "debug": "^4.3.1", + "kruptein": "^3.0.0" + }, + "engines": { + "node": ">=12.9.0" + }, + "peerDependencies": { + "express-session": "^1.17.1", + "mongodb": ">= 5.1.0 < 7" + } + }, + "node_modules/connect-mongo/node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/connect-mongo/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, "node_modules/console-control-strings": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", @@ -604,6 +671,40 @@ "url": "https://opencollective.com/express" } }, + "node_modules/express-session": { + "version": "1.18.1", + "resolved": "https://registry.npmjs.org/express-session/-/express-session-1.18.1.tgz", + "integrity": "sha512-a5mtTqEaZvBCL9A9aqkrtfz+3SMDhOVUnjafjo+s7A9Txkq+SVX2DLvSp1Zrv4uCXa3lMSK3viWnh9Gg07PBUA==", + "license": "MIT", + "dependencies": { + "cookie": "0.7.2", + "cookie-signature": "1.0.7", + "debug": "2.6.9", + "depd": "~2.0.0", + "on-headers": "~1.0.2", + "parseurl": "~1.3.3", + "safe-buffer": "5.2.1", + "uid-safe": "~2.1.5" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/express-session/node_modules/cookie": { + "version": "0.7.2", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.2.tgz", + "integrity": "sha512-yki5XnKuf750l50uGTllt6kKILY4nQ1eNIQatoXEByZ5dWgnKqbnqmTrBE5B4N7lrMJKQ2ytWMiTO2o0v6Ew/w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express-session/node_modules/cookie-signature": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.7.tgz", + "integrity": "sha512-NXdYc3dLr47pBkpUCHtKSwIOQXLVn8dZEuywboCOJY/osA0wFSLlSawr3KN8qXJEyX66FcONTH8EIlVuK0yyFA==", + "license": "MIT" + }, "node_modules/filelist": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/filelist/-/filelist-1.0.4.tgz", @@ -1037,6 +1138,18 @@ "node": ">=12.0.0" } }, + "node_modules/kruptein": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/kruptein/-/kruptein-3.0.7.tgz", + "integrity": "sha512-vTftnEjfbqFHLqxDUMQCj6gBo5lKqjV4f0JsM8rk8rM3xmvFZ2eSy4YALdaye7E+cDKnEj7eAjFR3vwh8a4PgQ==", + "license": "MIT", + "dependencies": { + "asn1.js": "^5.4.1" + }, + "engines": { + "node": ">8" + } + }, "node_modules/make-dir": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", @@ -1136,6 +1249,12 @@ "node": ">= 0.6" } }, + "node_modules/minimalistic-assert": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", + "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==", + "license": "ISC" + }, "node_modules/minimatch": { "version": "3.1.2", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", @@ -1527,6 +1646,15 @@ "node": ">= 0.8" } }, + "node_modules/on-headers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz", + "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, "node_modules/once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", @@ -1615,6 +1743,15 @@ "url": "https://github.com/sponsors/ljharb" } }, + "node_modules/random-bytes": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/random-bytes/-/random-bytes-1.0.0.tgz", + "integrity": "sha512-iv7LhNVO047HzYR3InF6pUcUsPQiHTM1Qal51DcGSuZFBil1aBBWG5eHPNek7bvILMaYJ/8RU1e8w1AMdHmLQQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, "node_modules/range-parser": { "version": "1.2.1", "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", @@ -2018,6 +2155,18 @@ "node": ">= 0.6" } }, + "node_modules/uid-safe": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-2.1.5.tgz", + "integrity": "sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA==", + "license": "MIT", + "dependencies": { + "random-bytes": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, "node_modules/undefsafe": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz", diff --git a/node_modules/asn1.js/.eslintrc.js b/node_modules/asn1.js/.eslintrc.js new file mode 100644 index 0000000..6b5dc44 --- /dev/null +++ b/node_modules/asn1.js/.eslintrc.js @@ -0,0 +1,27 @@ +module.exports = { + 'env': { + 'browser': false, + 'commonjs': true, + 'es6': true, + 'node': true + }, + 'extends': 'eslint:recommended', + 'rules': { + 'indent': [ + 'error', + 2 + ], + 'linebreak-style': [ + 'error', + 'unix' + ], + 'quotes': [ + 'error', + 'single' + ], + 'semi': [ + 'error', + 'always' + ] + } +}; diff --git a/node_modules/asn1.js/LICENSE b/node_modules/asn1.js/LICENSE new file mode 100644 index 0000000..caaf4f2 --- /dev/null +++ b/node_modules/asn1.js/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Fedor Indutny + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/asn1.js/README.md b/node_modules/asn1.js/README.md new file mode 100644 index 0000000..9f04af7 --- /dev/null +++ b/node_modules/asn1.js/README.md @@ -0,0 +1,100 @@ +# ASN1.js + +ASN.1 DER Encoder/Decoder and DSL. + +## Example + +Define model: + +```javascript +var asn = require('asn1.js'); + +var Human = asn.define('Human', function() { + this.seq().obj( + this.key('firstName').octstr(), + this.key('lastName').octstr(), + this.key('age').int(), + this.key('gender').enum({ 0: 'male', 1: 'female' }), + this.key('bio').seqof(Bio) + ); +}); + +var Bio = asn.define('Bio', function() { + this.seq().obj( + this.key('time').gentime(), + this.key('description').octstr() + ); +}); +``` + +Encode data: + +```javascript +var output = Human.encode({ + firstName: 'Thomas', + lastName: 'Anderson', + age: 28, + gender: 'male', + bio: [ + { + time: +new Date('31 March 1999'), + description: 'freedom of mind' + } + ] +}, 'der'); +``` + +Decode data: + +```javascript +var human = Human.decode(output, 'der'); +console.log(human); +/* +{ firstName: <Buffer 54 68 6f 6d 61 73>, + lastName: <Buffer 41 6e 64 65 72 73 6f 6e>, + age: 28, + gender: 'male', + bio: + [ { time: 922820400000, + description: <Buffer 66 72 65 65 64 6f 6d 20 6f 66 20 6d 69 6e 64> } ] } +*/ +``` + +### Partial decode + +Its possible to parse data without stopping on first error. In order to do it, +you should call: + +```javascript +var human = Human.decode(output, 'der', { partial: true }); +console.log(human); +/* +{ result: { ... }, + errors: [ ... ] } +*/ +``` + +#### LICENSE + +This software is licensed under the MIT License. + +Copyright Fedor Indutny, 2017. + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to permit +persons to whom the Software is furnished to do so, subject to the +following conditions: + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/asn1.js/lib/asn1.js b/node_modules/asn1.js/lib/asn1.js new file mode 100644 index 0000000..c7d70b8 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1.js @@ -0,0 +1,11 @@ +'use strict'; + +const asn1 = exports; + +asn1.bignum = require('bn.js'); + +asn1.define = require('./asn1/api').define; +asn1.base = require('./asn1/base'); +asn1.constants = require('./asn1/constants'); +asn1.decoders = require('./asn1/decoders'); +asn1.encoders = require('./asn1/encoders'); diff --git a/node_modules/asn1.js/lib/asn1/api.js b/node_modules/asn1.js/lib/asn1/api.js new file mode 100644 index 0000000..61e3eb2 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/api.js @@ -0,0 +1,57 @@ +'use strict'; + +const encoders = require('./encoders'); +const decoders = require('./decoders'); +const inherits = require('inherits'); + +const api = exports; + +api.define = function define(name, body) { + return new Entity(name, body); +}; + +function Entity(name, body) { + this.name = name; + this.body = body; + + this.decoders = {}; + this.encoders = {}; +} + +Entity.prototype._createNamed = function createNamed(Base) { + const name = this.name; + + function Generated(entity) { + this._initNamed(entity, name); + } + inherits(Generated, Base); + Generated.prototype._initNamed = function _initNamed(entity, name) { + Base.call(this, entity, name); + }; + + return new Generated(this); +}; + +Entity.prototype._getDecoder = function _getDecoder(enc) { + enc = enc || 'der'; + // Lazily create decoder + if (!this.decoders.hasOwnProperty(enc)) + this.decoders[enc] = this._createNamed(decoders[enc]); + return this.decoders[enc]; +}; + +Entity.prototype.decode = function decode(data, enc, options) { + return this._getDecoder(enc).decode(data, options); +}; + +Entity.prototype._getEncoder = function _getEncoder(enc) { + enc = enc || 'der'; + // Lazily create encoder + if (!this.encoders.hasOwnProperty(enc)) + this.encoders[enc] = this._createNamed(encoders[enc]); + return this.encoders[enc]; +}; + +Entity.prototype.encode = function encode(data, enc, /* internal */ reporter) { + return this._getEncoder(enc).encode(data, reporter); +}; diff --git a/node_modules/asn1.js/lib/asn1/base/buffer.js b/node_modules/asn1.js/lib/asn1/base/buffer.js new file mode 100644 index 0000000..bb5bc06 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/base/buffer.js @@ -0,0 +1,153 @@ +'use strict'; + +const inherits = require('inherits'); +const Reporter = require('../base/reporter').Reporter; +const Buffer = require('safer-buffer').Buffer; + +function DecoderBuffer(base, options) { + Reporter.call(this, options); + if (!Buffer.isBuffer(base)) { + this.error('Input not Buffer'); + return; + } + + this.base = base; + this.offset = 0; + this.length = base.length; +} +inherits(DecoderBuffer, Reporter); +exports.DecoderBuffer = DecoderBuffer; + +DecoderBuffer.isDecoderBuffer = function isDecoderBuffer(data) { + if (data instanceof DecoderBuffer) { + return true; + } + + // Or accept compatible API + const isCompatible = typeof data === 'object' && + Buffer.isBuffer(data.base) && + data.constructor.name === 'DecoderBuffer' && + typeof data.offset === 'number' && + typeof data.length === 'number' && + typeof data.save === 'function' && + typeof data.restore === 'function' && + typeof data.isEmpty === 'function' && + typeof data.readUInt8 === 'function' && + typeof data.skip === 'function' && + typeof data.raw === 'function'; + + return isCompatible; +}; + +DecoderBuffer.prototype.save = function save() { + return { offset: this.offset, reporter: Reporter.prototype.save.call(this) }; +}; + +DecoderBuffer.prototype.restore = function restore(save) { + // Return skipped data + const res = new DecoderBuffer(this.base); + res.offset = save.offset; + res.length = this.offset; + + this.offset = save.offset; + Reporter.prototype.restore.call(this, save.reporter); + + return res; +}; + +DecoderBuffer.prototype.isEmpty = function isEmpty() { + return this.offset === this.length; +}; + +DecoderBuffer.prototype.readUInt8 = function readUInt8(fail) { + if (this.offset + 1 <= this.length) + return this.base.readUInt8(this.offset++, true); + else + return this.error(fail || 'DecoderBuffer overrun'); +}; + +DecoderBuffer.prototype.skip = function skip(bytes, fail) { + if (!(this.offset + bytes <= this.length)) + return this.error(fail || 'DecoderBuffer overrun'); + + const res = new DecoderBuffer(this.base); + + // Share reporter state + res._reporterState = this._reporterState; + + res.offset = this.offset; + res.length = this.offset + bytes; + this.offset += bytes; + return res; +}; + +DecoderBuffer.prototype.raw = function raw(save) { + return this.base.slice(save ? save.offset : this.offset, this.length); +}; + +function EncoderBuffer(value, reporter) { + if (Array.isArray(value)) { + this.length = 0; + this.value = value.map(function(item) { + if (!EncoderBuffer.isEncoderBuffer(item)) + item = new EncoderBuffer(item, reporter); + this.length += item.length; + return item; + }, this); + } else if (typeof value === 'number') { + if (!(0 <= value && value <= 0xff)) + return reporter.error('non-byte EncoderBuffer value'); + this.value = value; + this.length = 1; + } else if (typeof value === 'string') { + this.value = value; + this.length = Buffer.byteLength(value); + } else if (Buffer.isBuffer(value)) { + this.value = value; + this.length = value.length; + } else { + return reporter.error('Unsupported type: ' + typeof value); + } +} +exports.EncoderBuffer = EncoderBuffer; + +EncoderBuffer.isEncoderBuffer = function isEncoderBuffer(data) { + if (data instanceof EncoderBuffer) { + return true; + } + + // Or accept compatible API + const isCompatible = typeof data === 'object' && + data.constructor.name === 'EncoderBuffer' && + typeof data.length === 'number' && + typeof data.join === 'function'; + + return isCompatible; +}; + +EncoderBuffer.prototype.join = function join(out, offset) { + if (!out) + out = Buffer.alloc(this.length); + if (!offset) + offset = 0; + + if (this.length === 0) + return out; + + if (Array.isArray(this.value)) { + this.value.forEach(function(item) { + item.join(out, offset); + offset += item.length; + }); + } else { + if (typeof this.value === 'number') + out[offset] = this.value; + else if (typeof this.value === 'string') + out.write(this.value, offset); + else if (Buffer.isBuffer(this.value)) + this.value.copy(out, offset); + offset += this.length; + } + + return out; +}; diff --git a/node_modules/asn1.js/lib/asn1/base/index.js b/node_modules/asn1.js/lib/asn1/base/index.js new file mode 100644 index 0000000..8b92f20 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/base/index.js @@ -0,0 +1,8 @@ +'use strict'; + +const base = exports; + +base.Reporter = require('./reporter').Reporter; +base.DecoderBuffer = require('./buffer').DecoderBuffer; +base.EncoderBuffer = require('./buffer').EncoderBuffer; +base.Node = require('./node'); diff --git a/node_modules/asn1.js/lib/asn1/base/node.js b/node_modules/asn1.js/lib/asn1/base/node.js new file mode 100644 index 0000000..d676d21 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/base/node.js @@ -0,0 +1,638 @@ +'use strict'; + +const Reporter = require('../base/reporter').Reporter; +const EncoderBuffer = require('../base/buffer').EncoderBuffer; +const DecoderBuffer = require('../base/buffer').DecoderBuffer; +const assert = require('minimalistic-assert'); + +// Supported tags +const tags = [ + 'seq', 'seqof', 'set', 'setof', 'objid', 'bool', + 'gentime', 'utctime', 'null_', 'enum', 'int', 'objDesc', + 'bitstr', 'bmpstr', 'charstr', 'genstr', 'graphstr', 'ia5str', 'iso646str', + 'numstr', 'octstr', 'printstr', 't61str', 'unistr', 'utf8str', 'videostr' +]; + +// Public methods list +const methods = [ + 'key', 'obj', 'use', 'optional', 'explicit', 'implicit', 'def', 'choice', + 'any', 'contains' +].concat(tags); + +// Overrided methods list +const overrided = [ + '_peekTag', '_decodeTag', '_use', + '_decodeStr', '_decodeObjid', '_decodeTime', + '_decodeNull', '_decodeInt', '_decodeBool', '_decodeList', + + '_encodeComposite', '_encodeStr', '_encodeObjid', '_encodeTime', + '_encodeNull', '_encodeInt', '_encodeBool' +]; + +function Node(enc, parent, name) { + const state = {}; + this._baseState = state; + + state.name = name; + state.enc = enc; + + state.parent = parent || null; + state.children = null; + + // State + state.tag = null; + state.args = null; + state.reverseArgs = null; + state.choice = null; + state.optional = false; + state.any = false; + state.obj = false; + state.use = null; + state.useDecoder = null; + state.key = null; + state['default'] = null; + state.explicit = null; + state.implicit = null; + state.contains = null; + + // Should create new instance on each method + if (!state.parent) { + state.children = []; + this._wrap(); + } +} +module.exports = Node; + +const stateProps = [ + 'enc', 'parent', 'children', 'tag', 'args', 'reverseArgs', 'choice', + 'optional', 'any', 'obj', 'use', 'alteredUse', 'key', 'default', 'explicit', + 'implicit', 'contains' +]; + +Node.prototype.clone = function clone() { + const state = this._baseState; + const cstate = {}; + stateProps.forEach(function(prop) { + cstate[prop] = state[prop]; + }); + const res = new this.constructor(cstate.parent); + res._baseState = cstate; + return res; +}; + +Node.prototype._wrap = function wrap() { + const state = this._baseState; + methods.forEach(function(method) { + this[method] = function _wrappedMethod() { + const clone = new this.constructor(this); + state.children.push(clone); + return clone[method].apply(clone, arguments); + }; + }, this); +}; + +Node.prototype._init = function init(body) { + const state = this._baseState; + + assert(state.parent === null); + body.call(this); + + // Filter children + state.children = state.children.filter(function(child) { + return child._baseState.parent === this; + }, this); + assert.equal(state.children.length, 1, 'Root node can have only one child'); +}; + +Node.prototype._useArgs = function useArgs(args) { + const state = this._baseState; + + // Filter children and args + const children = args.filter(function(arg) { + return arg instanceof this.constructor; + }, this); + args = args.filter(function(arg) { + return !(arg instanceof this.constructor); + }, this); + + if (children.length !== 0) { + assert(state.children === null); + state.children = children; + + // Replace parent to maintain backward link + children.forEach(function(child) { + child._baseState.parent = this; + }, this); + } + if (args.length !== 0) { + assert(state.args === null); + state.args = args; + state.reverseArgs = args.map(function(arg) { + if (typeof arg !== 'object' || arg.constructor !== Object) + return arg; + + const res = {}; + Object.keys(arg).forEach(function(key) { + if (key == (key | 0)) + key |= 0; + const value = arg[key]; + res[value] = key; + }); + return res; + }); + } +}; + +// +// Overrided methods +// + +overrided.forEach(function(method) { + Node.prototype[method] = function _overrided() { + const state = this._baseState; + throw new Error(method + ' not implemented for encoding: ' + state.enc); + }; +}); + +// +// Public methods +// + +tags.forEach(function(tag) { + Node.prototype[tag] = function _tagMethod() { + const state = this._baseState; + const args = Array.prototype.slice.call(arguments); + + assert(state.tag === null); + state.tag = tag; + + this._useArgs(args); + + return this; + }; +}); + +Node.prototype.use = function use(item) { + assert(item); + const state = this._baseState; + + assert(state.use === null); + state.use = item; + + return this; +}; + +Node.prototype.optional = function optional() { + const state = this._baseState; + + state.optional = true; + + return this; +}; + +Node.prototype.def = function def(val) { + const state = this._baseState; + + assert(state['default'] === null); + state['default'] = val; + state.optional = true; + + return this; +}; + +Node.prototype.explicit = function explicit(num) { + const state = this._baseState; + + assert(state.explicit === null && state.implicit === null); + state.explicit = num; + + return this; +}; + +Node.prototype.implicit = function implicit(num) { + const state = this._baseState; + + assert(state.explicit === null && state.implicit === null); + state.implicit = num; + + return this; +}; + +Node.prototype.obj = function obj() { + const state = this._baseState; + const args = Array.prototype.slice.call(arguments); + + state.obj = true; + + if (args.length !== 0) + this._useArgs(args); + + return this; +}; + +Node.prototype.key = function key(newKey) { + const state = this._baseState; + + assert(state.key === null); + state.key = newKey; + + return this; +}; + +Node.prototype.any = function any() { + const state = this._baseState; + + state.any = true; + + return this; +}; + +Node.prototype.choice = function choice(obj) { + const state = this._baseState; + + assert(state.choice === null); + state.choice = obj; + this._useArgs(Object.keys(obj).map(function(key) { + return obj[key]; + })); + + return this; +}; + +Node.prototype.contains = function contains(item) { + const state = this._baseState; + + assert(state.use === null); + state.contains = item; + + return this; +}; + +// +// Decoding +// + +Node.prototype._decode = function decode(input, options) { + const state = this._baseState; + + // Decode root node + if (state.parent === null) + return input.wrapResult(state.children[0]._decode(input, options)); + + let result = state['default']; + let present = true; + + let prevKey = null; + if (state.key !== null) + prevKey = input.enterKey(state.key); + + // Check if tag is there + if (state.optional) { + let tag = null; + if (state.explicit !== null) + tag = state.explicit; + else if (state.implicit !== null) + tag = state.implicit; + else if (state.tag !== null) + tag = state.tag; + + if (tag === null && !state.any) { + // Trial and Error + const save = input.save(); + try { + if (state.choice === null) + this._decodeGeneric(state.tag, input, options); + else + this._decodeChoice(input, options); + present = true; + } catch (e) { + present = false; + } + input.restore(save); + } else { + present = this._peekTag(input, tag, state.any); + + if (input.isError(present)) + return present; + } + } + + // Push object on stack + let prevObj; + if (state.obj && present) + prevObj = input.enterObject(); + + if (present) { + // Unwrap explicit values + if (state.explicit !== null) { + const explicit = this._decodeTag(input, state.explicit); + if (input.isError(explicit)) + return explicit; + input = explicit; + } + + const start = input.offset; + + // Unwrap implicit and normal values + if (state.use === null && state.choice === null) { + let save; + if (state.any) + save = input.save(); + const body = this._decodeTag( + input, + state.implicit !== null ? state.implicit : state.tag, + state.any + ); + if (input.isError(body)) + return body; + + if (state.any) + result = input.raw(save); + else + input = body; + } + + if (options && options.track && state.tag !== null) + options.track(input.path(), start, input.length, 'tagged'); + + if (options && options.track && state.tag !== null) + options.track(input.path(), input.offset, input.length, 'content'); + + // Select proper method for tag + if (state.any) { + // no-op + } else if (state.choice === null) { + result = this._decodeGeneric(state.tag, input, options); + } else { + result = this._decodeChoice(input, options); + } + + if (input.isError(result)) + return result; + + // Decode children + if (!state.any && state.choice === null && state.children !== null) { + state.children.forEach(function decodeChildren(child) { + // NOTE: We are ignoring errors here, to let parser continue with other + // parts of encoded data + child._decode(input, options); + }); + } + + // Decode contained/encoded by schema, only in bit or octet strings + if (state.contains && (state.tag === 'octstr' || state.tag === 'bitstr')) { + const data = new DecoderBuffer(result); + result = this._getUse(state.contains, input._reporterState.obj) + ._decode(data, options); + } + } + + // Pop object + if (state.obj && present) + result = input.leaveObject(prevObj); + + // Set key + if (state.key !== null && (result !== null || present === true)) + input.leaveKey(prevKey, state.key, result); + else if (prevKey !== null) + input.exitKey(prevKey); + + return result; +}; + +Node.prototype._decodeGeneric = function decodeGeneric(tag, input, options) { + const state = this._baseState; + + if (tag === 'seq' || tag === 'set') + return null; + if (tag === 'seqof' || tag === 'setof') + return this._decodeList(input, tag, state.args[0], options); + else if (/str$/.test(tag)) + return this._decodeStr(input, tag, options); + else if (tag === 'objid' && state.args) + return this._decodeObjid(input, state.args[0], state.args[1], options); + else if (tag === 'objid') + return this._decodeObjid(input, null, null, options); + else if (tag === 'gentime' || tag === 'utctime') + return this._decodeTime(input, tag, options); + else if (tag === 'null_') + return this._decodeNull(input, options); + else if (tag === 'bool') + return this._decodeBool(input, options); + else if (tag === 'objDesc') + return this._decodeStr(input, tag, options); + else if (tag === 'int' || tag === 'enum') + return this._decodeInt(input, state.args && state.args[0], options); + + if (state.use !== null) { + return this._getUse(state.use, input._reporterState.obj) + ._decode(input, options); + } else { + return input.error('unknown tag: ' + tag); + } +}; + +Node.prototype._getUse = function _getUse(entity, obj) { + + const state = this._baseState; + // Create altered use decoder if implicit is set + state.useDecoder = this._use(entity, obj); + assert(state.useDecoder._baseState.parent === null); + state.useDecoder = state.useDecoder._baseState.children[0]; + if (state.implicit !== state.useDecoder._baseState.implicit) { + state.useDecoder = state.useDecoder.clone(); + state.useDecoder._baseState.implicit = state.implicit; + } + return state.useDecoder; +}; + +Node.prototype._decodeChoice = function decodeChoice(input, options) { + const state = this._baseState; + let result = null; + let match = false; + + Object.keys(state.choice).some(function(key) { + const save = input.save(); + const node = state.choice[key]; + try { + const value = node._decode(input, options); + if (input.isError(value)) + return false; + + result = { type: key, value: value }; + match = true; + } catch (e) { + input.restore(save); + return false; + } + return true; + }, this); + + if (!match) + return input.error('Choice not matched'); + + return result; +}; + +// +// Encoding +// + +Node.prototype._createEncoderBuffer = function createEncoderBuffer(data) { + return new EncoderBuffer(data, this.reporter); +}; + +Node.prototype._encode = function encode(data, reporter, parent) { + const state = this._baseState; + if (state['default'] !== null && state['default'] === data) + return; + + const result = this._encodeValue(data, reporter, parent); + if (result === undefined) + return; + + if (this._skipDefault(result, reporter, parent)) + return; + + return result; +}; + +Node.prototype._encodeValue = function encode(data, reporter, parent) { + const state = this._baseState; + + // Decode root node + if (state.parent === null) + return state.children[0]._encode(data, reporter || new Reporter()); + + let result = null; + + // Set reporter to share it with a child class + this.reporter = reporter; + + // Check if data is there + if (state.optional && data === undefined) { + if (state['default'] !== null) + data = state['default']; + else + return; + } + + // Encode children first + let content = null; + let primitive = false; + if (state.any) { + // Anything that was given is translated to buffer + result = this._createEncoderBuffer(data); + } else if (state.choice) { + result = this._encodeChoice(data, reporter); + } else if (state.contains) { + content = this._getUse(state.contains, parent)._encode(data, reporter); + primitive = true; + } else if (state.children) { + content = state.children.map(function(child) { + if (child._baseState.tag === 'null_') + return child._encode(null, reporter, data); + + if (child._baseState.key === null) + return reporter.error('Child should have a key'); + const prevKey = reporter.enterKey(child._baseState.key); + + if (typeof data !== 'object') + return reporter.error('Child expected, but input is not object'); + + const res = child._encode(data[child._baseState.key], reporter, data); + reporter.leaveKey(prevKey); + + return res; + }, this).filter(function(child) { + return child; + }); + content = this._createEncoderBuffer(content); + } else { + if (state.tag === 'seqof' || state.tag === 'setof') { + // TODO(indutny): this should be thrown on DSL level + if (!(state.args && state.args.length === 1)) + return reporter.error('Too many args for : ' + state.tag); + + if (!Array.isArray(data)) + return reporter.error('seqof/setof, but data is not Array'); + + const child = this.clone(); + child._baseState.implicit = null; + content = this._createEncoderBuffer(data.map(function(item) { + const state = this._baseState; + + return this._getUse(state.args[0], data)._encode(item, reporter); + }, child)); + } else if (state.use !== null) { + result = this._getUse(state.use, parent)._encode(data, reporter); + } else { + content = this._encodePrimitive(state.tag, data); + primitive = true; + } + } + + // Encode data itself + if (!state.any && state.choice === null) { + const tag = state.implicit !== null ? state.implicit : state.tag; + const cls = state.implicit === null ? 'universal' : 'context'; + + if (tag === null) { + if (state.use === null) + reporter.error('Tag could be omitted only for .use()'); + } else { + if (state.use === null) + result = this._encodeComposite(tag, primitive, cls, content); + } + } + + // Wrap in explicit + if (state.explicit !== null) + result = this._encodeComposite(state.explicit, false, 'context', result); + + return result; +}; + +Node.prototype._encodeChoice = function encodeChoice(data, reporter) { + const state = this._baseState; + + const node = state.choice[data.type]; + if (!node) { + assert( + false, + data.type + ' not found in ' + + JSON.stringify(Object.keys(state.choice))); + } + return node._encode(data.value, reporter); +}; + +Node.prototype._encodePrimitive = function encodePrimitive(tag, data) { + const state = this._baseState; + + if (/str$/.test(tag)) + return this._encodeStr(data, tag); + else if (tag === 'objid' && state.args) + return this._encodeObjid(data, state.reverseArgs[0], state.args[1]); + else if (tag === 'objid') + return this._encodeObjid(data, null, null); + else if (tag === 'gentime' || tag === 'utctime') + return this._encodeTime(data, tag); + else if (tag === 'null_') + return this._encodeNull(); + else if (tag === 'int' || tag === 'enum') + return this._encodeInt(data, state.args && state.reverseArgs[0]); + else if (tag === 'bool') + return this._encodeBool(data); + else if (tag === 'objDesc') + return this._encodeStr(data, tag); + else + throw new Error('Unsupported tag: ' + tag); +}; + +Node.prototype._isNumstr = function isNumstr(str) { + return /^[0-9 ]*$/.test(str); +}; + +Node.prototype._isPrintstr = function isPrintstr(str) { + return /^[A-Za-z0-9 '()+,-./:=?]*$/.test(str); +}; diff --git a/node_modules/asn1.js/lib/asn1/base/reporter.js b/node_modules/asn1.js/lib/asn1/base/reporter.js new file mode 100644 index 0000000..d05fe12 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/base/reporter.js @@ -0,0 +1,123 @@ +'use strict'; + +const inherits = require('inherits'); + +function Reporter(options) { + this._reporterState = { + obj: null, + path: [], + options: options || {}, + errors: [] + }; +} +exports.Reporter = Reporter; + +Reporter.prototype.isError = function isError(obj) { + return obj instanceof ReporterError; +}; + +Reporter.prototype.save = function save() { + const state = this._reporterState; + + return { obj: state.obj, pathLen: state.path.length }; +}; + +Reporter.prototype.restore = function restore(data) { + const state = this._reporterState; + + state.obj = data.obj; + state.path = state.path.slice(0, data.pathLen); +}; + +Reporter.prototype.enterKey = function enterKey(key) { + return this._reporterState.path.push(key); +}; + +Reporter.prototype.exitKey = function exitKey(index) { + const state = this._reporterState; + + state.path = state.path.slice(0, index - 1); +}; + +Reporter.prototype.leaveKey = function leaveKey(index, key, value) { + const state = this._reporterState; + + this.exitKey(index); + if (state.obj !== null) + state.obj[key] = value; +}; + +Reporter.prototype.path = function path() { + return this._reporterState.path.join('/'); +}; + +Reporter.prototype.enterObject = function enterObject() { + const state = this._reporterState; + + const prev = state.obj; + state.obj = {}; + return prev; +}; + +Reporter.prototype.leaveObject = function leaveObject(prev) { + const state = this._reporterState; + + const now = state.obj; + state.obj = prev; + return now; +}; + +Reporter.prototype.error = function error(msg) { + let err; + const state = this._reporterState; + + const inherited = msg instanceof ReporterError; + if (inherited) { + err = msg; + } else { + err = new ReporterError(state.path.map(function(elem) { + return '[' + JSON.stringify(elem) + ']'; + }).join(''), msg.message || msg, msg.stack); + } + + if (!state.options.partial) + throw err; + + if (!inherited) + state.errors.push(err); + + return err; +}; + +Reporter.prototype.wrapResult = function wrapResult(result) { + const state = this._reporterState; + if (!state.options.partial) + return result; + + return { + result: this.isError(result) ? null : result, + errors: state.errors + }; +}; + +function ReporterError(path, msg) { + this.path = path; + this.rethrow(msg); +} +inherits(ReporterError, Error); + +ReporterError.prototype.rethrow = function rethrow(msg) { + this.message = msg + ' at: ' + (this.path || '(shallow)'); + if (Error.captureStackTrace) + Error.captureStackTrace(this, ReporterError); + + if (!this.stack) { + try { + // IE only adds stack when thrown + throw new Error(this.message); + } catch (e) { + this.stack = e.stack; + } + } + return this; +}; diff --git a/node_modules/asn1.js/lib/asn1/constants/der.js b/node_modules/asn1.js/lib/asn1/constants/der.js new file mode 100644 index 0000000..2b678aa --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/constants/der.js @@ -0,0 +1,58 @@ +'use strict'; + +// Helper +function reverse(map) { + const res = {}; + + Object.keys(map).forEach(function(key) { + // Convert key to integer if it is stringified + if ((key | 0) == key) + key = key | 0; + + const value = map[key]; + res[value] = key; + }); + + return res; +} + +exports.tagClass = { + 0: 'universal', + 1: 'application', + 2: 'context', + 3: 'private' +}; +exports.tagClassByName = reverse(exports.tagClass); + +exports.tag = { + 0x00: 'end', + 0x01: 'bool', + 0x02: 'int', + 0x03: 'bitstr', + 0x04: 'octstr', + 0x05: 'null_', + 0x06: 'objid', + 0x07: 'objDesc', + 0x08: 'external', + 0x09: 'real', + 0x0a: 'enum', + 0x0b: 'embed', + 0x0c: 'utf8str', + 0x0d: 'relativeOid', + 0x10: 'seq', + 0x11: 'set', + 0x12: 'numstr', + 0x13: 'printstr', + 0x14: 't61str', + 0x15: 'videostr', + 0x16: 'ia5str', + 0x17: 'utctime', + 0x18: 'gentime', + 0x19: 'graphstr', + 0x1a: 'iso646str', + 0x1b: 'genstr', + 0x1c: 'unistr', + 0x1d: 'charstr', + 0x1e: 'bmpstr' +}; +exports.tagByName = reverse(exports.tag); diff --git a/node_modules/asn1.js/lib/asn1/constants/index.js b/node_modules/asn1.js/lib/asn1/constants/index.js new file mode 100644 index 0000000..632cf3d --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/constants/index.js @@ -0,0 +1,21 @@ +'use strict'; + +const constants = exports; + +// Helper +constants._reverse = function reverse(map) { + const res = {}; + + Object.keys(map).forEach(function(key) { + // Convert key to integer if it is stringified + if ((key | 0) == key) + key = key | 0; + + const value = map[key]; + res[value] = key; + }); + + return res; +}; + +constants.der = require('./der'); diff --git a/node_modules/asn1.js/lib/asn1/decoders/der.js b/node_modules/asn1.js/lib/asn1/decoders/der.js new file mode 100644 index 0000000..c5b0515 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/decoders/der.js @@ -0,0 +1,335 @@ +'use strict'; + +const inherits = require('inherits'); + +const bignum = require('bn.js'); +const DecoderBuffer = require('../base/buffer').DecoderBuffer; +const Node = require('../base/node'); + +// Import DER constants +const der = require('../constants/der'); + +function DERDecoder(entity) { + this.enc = 'der'; + this.name = entity.name; + this.entity = entity; + + // Construct base tree + this.tree = new DERNode(); + this.tree._init(entity.body); +} +module.exports = DERDecoder; + +DERDecoder.prototype.decode = function decode(data, options) { + if (!DecoderBuffer.isDecoderBuffer(data)) { + data = new DecoderBuffer(data, options); + } + + return this.tree._decode(data, options); +}; + +// Tree methods + +function DERNode(parent) { + Node.call(this, 'der', parent); +} +inherits(DERNode, Node); + +DERNode.prototype._peekTag = function peekTag(buffer, tag, any) { + if (buffer.isEmpty()) + return false; + + const state = buffer.save(); + const decodedTag = derDecodeTag(buffer, 'Failed to peek tag: "' + tag + '"'); + if (buffer.isError(decodedTag)) + return decodedTag; + + buffer.restore(state); + + return decodedTag.tag === tag || decodedTag.tagStr === tag || + (decodedTag.tagStr + 'of') === tag || any; +}; + +DERNode.prototype._decodeTag = function decodeTag(buffer, tag, any) { + const decodedTag = derDecodeTag(buffer, + 'Failed to decode tag of "' + tag + '"'); + if (buffer.isError(decodedTag)) + return decodedTag; + + let len = derDecodeLen(buffer, + decodedTag.primitive, + 'Failed to get length of "' + tag + '"'); + + // Failure + if (buffer.isError(len)) + return len; + + if (!any && + decodedTag.tag !== tag && + decodedTag.tagStr !== tag && + decodedTag.tagStr + 'of' !== tag) { + return buffer.error('Failed to match tag: "' + tag + '"'); + } + + if (decodedTag.primitive || len !== null) + return buffer.skip(len, 'Failed to match body of: "' + tag + '"'); + + // Indefinite length... find END tag + const state = buffer.save(); + const res = this._skipUntilEnd( + buffer, + 'Failed to skip indefinite length body: "' + this.tag + '"'); + if (buffer.isError(res)) + return res; + + len = buffer.offset - state.offset; + buffer.restore(state); + return buffer.skip(len, 'Failed to match body of: "' + tag + '"'); +}; + +DERNode.prototype._skipUntilEnd = function skipUntilEnd(buffer, fail) { + for (;;) { + const tag = derDecodeTag(buffer, fail); + if (buffer.isError(tag)) + return tag; + const len = derDecodeLen(buffer, tag.primitive, fail); + if (buffer.isError(len)) + return len; + + let res; + if (tag.primitive || len !== null) + res = buffer.skip(len); + else + res = this._skipUntilEnd(buffer, fail); + + // Failure + if (buffer.isError(res)) + return res; + + if (tag.tagStr === 'end') + break; + } +}; + +DERNode.prototype._decodeList = function decodeList(buffer, tag, decoder, + options) { + const result = []; + while (!buffer.isEmpty()) { + const possibleEnd = this._peekTag(buffer, 'end'); + if (buffer.isError(possibleEnd)) + return possibleEnd; + + const res = decoder.decode(buffer, 'der', options); + if (buffer.isError(res) && possibleEnd) + break; + result.push(res); + } + return result; +}; + +DERNode.prototype._decodeStr = function decodeStr(buffer, tag) { + if (tag === 'bitstr') { + const unused = buffer.readUInt8(); + if (buffer.isError(unused)) + return unused; + return { unused: unused, data: buffer.raw() }; + } else if (tag === 'bmpstr') { + const raw = buffer.raw(); + if (raw.length % 2 === 1) + return buffer.error('Decoding of string type: bmpstr length mismatch'); + + let str = ''; + for (let i = 0; i < raw.length / 2; i++) { + str += String.fromCharCode(raw.readUInt16BE(i * 2)); + } + return str; + } else if (tag === 'numstr') { + const numstr = buffer.raw().toString('ascii'); + if (!this._isNumstr(numstr)) { + return buffer.error('Decoding of string type: ' + + 'numstr unsupported characters'); + } + return numstr; + } else if (tag === 'octstr') { + return buffer.raw(); + } else if (tag === 'objDesc') { + return buffer.raw(); + } else if (tag === 'printstr') { + const printstr = buffer.raw().toString('ascii'); + if (!this._isPrintstr(printstr)) { + return buffer.error('Decoding of string type: ' + + 'printstr unsupported characters'); + } + return printstr; + } else if (/str$/.test(tag)) { + return buffer.raw().toString(); + } else { + return buffer.error('Decoding of string type: ' + tag + ' unsupported'); + } +}; + +DERNode.prototype._decodeObjid = function decodeObjid(buffer, values, relative) { + let result; + const identifiers = []; + let ident = 0; + let subident = 0; + while (!buffer.isEmpty()) { + subident = buffer.readUInt8(); + ident <<= 7; + ident |= subident & 0x7f; + if ((subident & 0x80) === 0) { + identifiers.push(ident); + ident = 0; + } + } + if (subident & 0x80) + identifiers.push(ident); + + const first = (identifiers[0] / 40) | 0; + const second = identifiers[0] % 40; + + if (relative) + result = identifiers; + else + result = [first, second].concat(identifiers.slice(1)); + + if (values) { + let tmp = values[result.join(' ')]; + if (tmp === undefined) + tmp = values[result.join('.')]; + if (tmp !== undefined) + result = tmp; + } + + return result; +}; + +DERNode.prototype._decodeTime = function decodeTime(buffer, tag) { + const str = buffer.raw().toString(); + + let year; + let mon; + let day; + let hour; + let min; + let sec; + if (tag === 'gentime') { + year = str.slice(0, 4) | 0; + mon = str.slice(4, 6) | 0; + day = str.slice(6, 8) | 0; + hour = str.slice(8, 10) | 0; + min = str.slice(10, 12) | 0; + sec = str.slice(12, 14) | 0; + } else if (tag === 'utctime') { + year = str.slice(0, 2) | 0; + mon = str.slice(2, 4) | 0; + day = str.slice(4, 6) | 0; + hour = str.slice(6, 8) | 0; + min = str.slice(8, 10) | 0; + sec = str.slice(10, 12) | 0; + if (year < 70) + year = 2000 + year; + else + year = 1900 + year; + } else { + return buffer.error('Decoding ' + tag + ' time is not supported yet'); + } + + return Date.UTC(year, mon - 1, day, hour, min, sec, 0); +}; + +DERNode.prototype._decodeNull = function decodeNull() { + return null; +}; + +DERNode.prototype._decodeBool = function decodeBool(buffer) { + const res = buffer.readUInt8(); + if (buffer.isError(res)) + return res; + else + return res !== 0; +}; + +DERNode.prototype._decodeInt = function decodeInt(buffer, values) { + // Bigint, return as it is (assume big endian) + const raw = buffer.raw(); + let res = new bignum(raw); + + if (values) + res = values[res.toString(10)] || res; + + return res; +}; + +DERNode.prototype._use = function use(entity, obj) { + if (typeof entity === 'function') + entity = entity(obj); + return entity._getDecoder('der').tree; +}; + +// Utility methods + +function derDecodeTag(buf, fail) { + let tag = buf.readUInt8(fail); + if (buf.isError(tag)) + return tag; + + const cls = der.tagClass[tag >> 6]; + const primitive = (tag & 0x20) === 0; + + // Multi-octet tag - load + if ((tag & 0x1f) === 0x1f) { + let oct = tag; + tag = 0; + while ((oct & 0x80) === 0x80) { + oct = buf.readUInt8(fail); + if (buf.isError(oct)) + return oct; + + tag <<= 7; + tag |= oct & 0x7f; + } + } else { + tag &= 0x1f; + } + const tagStr = der.tag[tag]; + + return { + cls: cls, + primitive: primitive, + tag: tag, + tagStr: tagStr + }; +} + +function derDecodeLen(buf, primitive, fail) { + let len = buf.readUInt8(fail); + if (buf.isError(len)) + return len; + + // Indefinite form + if (!primitive && len === 0x80) + return null; + + // Definite form + if ((len & 0x80) === 0) { + // Short form + return len; + } + + // Long form + const num = len & 0x7f; + if (num > 4) + return buf.error('length octect is too long'); + + len = 0; + for (let i = 0; i < num; i++) { + len <<= 8; + const j = buf.readUInt8(fail); + if (buf.isError(j)) + return j; + len |= j; + } + + return len; +} diff --git a/node_modules/asn1.js/lib/asn1/decoders/index.js b/node_modules/asn1.js/lib/asn1/decoders/index.js new file mode 100644 index 0000000..14fb05a --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/decoders/index.js @@ -0,0 +1,6 @@ +'use strict'; + +const decoders = exports; + +decoders.der = require('./der'); +decoders.pem = require('./pem'); diff --git a/node_modules/asn1.js/lib/asn1/decoders/pem.js b/node_modules/asn1.js/lib/asn1/decoders/pem.js new file mode 100644 index 0000000..2b050ef --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/decoders/pem.js @@ -0,0 +1,51 @@ +'use strict'; + +const inherits = require('inherits'); +const Buffer = require('safer-buffer').Buffer; + +const DERDecoder = require('./der'); + +function PEMDecoder(entity) { + DERDecoder.call(this, entity); + this.enc = 'pem'; +} +inherits(PEMDecoder, DERDecoder); +module.exports = PEMDecoder; + +PEMDecoder.prototype.decode = function decode(data, options) { + const lines = data.toString().split(/[\r\n]+/g); + + const label = options.label.toUpperCase(); + + const re = /^-----(BEGIN|END) ([^-]+)-----$/; + let start = -1; + let end = -1; + for (let i = 0; i < lines.length; i++) { + const match = lines[i].match(re); + if (match === null) + continue; + + if (match[2] !== label) + continue; + + if (start === -1) { + if (match[1] !== 'BEGIN') + break; + start = i; + } else { + if (match[1] !== 'END') + break; + end = i; + break; + } + } + if (start === -1 || end === -1) + throw new Error('PEM section not found for: ' + label); + + const base64 = lines.slice(start + 1, end).join(''); + // Remove excessive symbols + base64.replace(/[^a-z0-9+/=]+/gi, ''); + + const input = Buffer.from(base64, 'base64'); + return DERDecoder.prototype.decode.call(this, input, options); +}; diff --git a/node_modules/asn1.js/lib/asn1/encoders/der.js b/node_modules/asn1.js/lib/asn1/encoders/der.js new file mode 100644 index 0000000..55eb435 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/encoders/der.js @@ -0,0 +1,295 @@ +'use strict'; + +const inherits = require('inherits'); +const Buffer = require('safer-buffer').Buffer; +const Node = require('../base/node'); + +// Import DER constants +const der = require('../constants/der'); + +function DEREncoder(entity) { + this.enc = 'der'; + this.name = entity.name; + this.entity = entity; + + // Construct base tree + this.tree = new DERNode(); + this.tree._init(entity.body); +} +module.exports = DEREncoder; + +DEREncoder.prototype.encode = function encode(data, reporter) { + return this.tree._encode(data, reporter).join(); +}; + +// Tree methods + +function DERNode(parent) { + Node.call(this, 'der', parent); +} +inherits(DERNode, Node); + +DERNode.prototype._encodeComposite = function encodeComposite(tag, + primitive, + cls, + content) { + const encodedTag = encodeTag(tag, primitive, cls, this.reporter); + + // Short form + if (content.length < 0x80) { + const header = Buffer.alloc(2); + header[0] = encodedTag; + header[1] = content.length; + return this._createEncoderBuffer([ header, content ]); + } + + // Long form + // Count octets required to store length + let lenOctets = 1; + for (let i = content.length; i >= 0x100; i >>= 8) + lenOctets++; + + const header = Buffer.alloc(1 + 1 + lenOctets); + header[0] = encodedTag; + header[1] = 0x80 | lenOctets; + + for (let i = 1 + lenOctets, j = content.length; j > 0; i--, j >>= 8) + header[i] = j & 0xff; + + return this._createEncoderBuffer([ header, content ]); +}; + +DERNode.prototype._encodeStr = function encodeStr(str, tag) { + if (tag === 'bitstr') { + return this._createEncoderBuffer([ str.unused | 0, str.data ]); + } else if (tag === 'bmpstr') { + const buf = Buffer.alloc(str.length * 2); + for (let i = 0; i < str.length; i++) { + buf.writeUInt16BE(str.charCodeAt(i), i * 2); + } + return this._createEncoderBuffer(buf); + } else if (tag === 'numstr') { + if (!this._isNumstr(str)) { + return this.reporter.error('Encoding of string type: numstr supports ' + + 'only digits and space'); + } + return this._createEncoderBuffer(str); + } else if (tag === 'printstr') { + if (!this._isPrintstr(str)) { + return this.reporter.error('Encoding of string type: printstr supports ' + + 'only latin upper and lower case letters, ' + + 'digits, space, apostrophe, left and rigth ' + + 'parenthesis, plus sign, comma, hyphen, ' + + 'dot, slash, colon, equal sign, ' + + 'question mark'); + } + return this._createEncoderBuffer(str); + } else if (/str$/.test(tag)) { + return this._createEncoderBuffer(str); + } else if (tag === 'objDesc') { + return this._createEncoderBuffer(str); + } else { + return this.reporter.error('Encoding of string type: ' + tag + + ' unsupported'); + } +}; + +DERNode.prototype._encodeObjid = function encodeObjid(id, values, relative) { + if (typeof id === 'string') { + if (!values) + return this.reporter.error('string objid given, but no values map found'); + if (!values.hasOwnProperty(id)) + return this.reporter.error('objid not found in values map'); + id = values[id].split(/[\s.]+/g); + for (let i = 0; i < id.length; i++) + id[i] |= 0; + } else if (Array.isArray(id)) { + id = id.slice(); + for (let i = 0; i < id.length; i++) + id[i] |= 0; + } + + if (!Array.isArray(id)) { + return this.reporter.error('objid() should be either array or string, ' + + 'got: ' + JSON.stringify(id)); + } + + if (!relative) { + if (id[1] >= 40) + return this.reporter.error('Second objid identifier OOB'); + id.splice(0, 2, id[0] * 40 + id[1]); + } + + // Count number of octets + let size = 0; + for (let i = 0; i < id.length; i++) { + let ident = id[i]; + for (size++; ident >= 0x80; ident >>= 7) + size++; + } + + const objid = Buffer.alloc(size); + let offset = objid.length - 1; + for (let i = id.length - 1; i >= 0; i--) { + let ident = id[i]; + objid[offset--] = ident & 0x7f; + while ((ident >>= 7) > 0) + objid[offset--] = 0x80 | (ident & 0x7f); + } + + return this._createEncoderBuffer(objid); +}; + +function two(num) { + if (num < 10) + return '0' + num; + else + return num; +} + +DERNode.prototype._encodeTime = function encodeTime(time, tag) { + let str; + const date = new Date(time); + + if (tag === 'gentime') { + str = [ + two(date.getUTCFullYear()), + two(date.getUTCMonth() + 1), + two(date.getUTCDate()), + two(date.getUTCHours()), + two(date.getUTCMinutes()), + two(date.getUTCSeconds()), + 'Z' + ].join(''); + } else if (tag === 'utctime') { + str = [ + two(date.getUTCFullYear() % 100), + two(date.getUTCMonth() + 1), + two(date.getUTCDate()), + two(date.getUTCHours()), + two(date.getUTCMinutes()), + two(date.getUTCSeconds()), + 'Z' + ].join(''); + } else { + this.reporter.error('Encoding ' + tag + ' time is not supported yet'); + } + + return this._encodeStr(str, 'octstr'); +}; + +DERNode.prototype._encodeNull = function encodeNull() { + return this._createEncoderBuffer(''); +}; + +DERNode.prototype._encodeInt = function encodeInt(num, values) { + if (typeof num === 'string') { + if (!values) + return this.reporter.error('String int or enum given, but no values map'); + if (!values.hasOwnProperty(num)) { + return this.reporter.error('Values map doesn\'t contain: ' + + JSON.stringify(num)); + } + num = values[num]; + } + + // Bignum, assume big endian + if (typeof num !== 'number' && !Buffer.isBuffer(num)) { + const numArray = num.toArray(); + if (!num.sign && numArray[0] & 0x80) { + numArray.unshift(0); + } + num = Buffer.from(numArray); + } + + if (Buffer.isBuffer(num)) { + let size = num.length; + if (num.length === 0) + size++; + + const out = Buffer.alloc(size); + num.copy(out); + if (num.length === 0) + out[0] = 0; + return this._createEncoderBuffer(out); + } + + if (num < 0x80) + return this._createEncoderBuffer(num); + + if (num < 0x100) + return this._createEncoderBuffer([0, num]); + + let size = 1; + for (let i = num; i >= 0x100; i >>= 8) + size++; + + const out = new Array(size); + for (let i = out.length - 1; i >= 0; i--) { + out[i] = num & 0xff; + num >>= 8; + } + if(out[0] & 0x80) { + out.unshift(0); + } + + return this._createEncoderBuffer(Buffer.from(out)); +}; + +DERNode.prototype._encodeBool = function encodeBool(value) { + return this._createEncoderBuffer(value ? 0xff : 0); +}; + +DERNode.prototype._use = function use(entity, obj) { + if (typeof entity === 'function') + entity = entity(obj); + return entity._getEncoder('der').tree; +}; + +DERNode.prototype._skipDefault = function skipDefault(dataBuffer, reporter, parent) { + const state = this._baseState; + let i; + if (state['default'] === null) + return false; + + const data = dataBuffer.join(); + if (state.defaultBuffer === undefined) + state.defaultBuffer = this._encodeValue(state['default'], reporter, parent).join(); + + if (data.length !== state.defaultBuffer.length) + return false; + + for (i=0; i < data.length; i++) + if (data[i] !== state.defaultBuffer[i]) + return false; + + return true; +}; + +// Utility methods + +function encodeTag(tag, primitive, cls, reporter) { + let res; + + if (tag === 'seqof') + tag = 'seq'; + else if (tag === 'setof') + tag = 'set'; + + if (der.tagByName.hasOwnProperty(tag)) + res = der.tagByName[tag]; + else if (typeof tag === 'number' && (tag | 0) === tag) + res = tag; + else + return reporter.error('Unknown tag: ' + tag); + + if (res >= 0x1f) + return reporter.error('Multi-octet tag encoding unsupported'); + + if (!primitive) + res |= 0x20; + + res |= (der.tagClassByName[cls || 'universal'] << 6); + + return res; +} diff --git a/node_modules/asn1.js/lib/asn1/encoders/index.js b/node_modules/asn1.js/lib/asn1/encoders/index.js new file mode 100644 index 0000000..bb8ea34 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/encoders/index.js @@ -0,0 +1,6 @@ +'use strict'; + +const encoders = exports; + +encoders.der = require('./der'); +encoders.pem = require('./pem'); diff --git a/node_modules/asn1.js/lib/asn1/encoders/pem.js b/node_modules/asn1.js/lib/asn1/encoders/pem.js new file mode 100644 index 0000000..77fbdb4 --- /dev/null +++ b/node_modules/asn1.js/lib/asn1/encoders/pem.js @@ -0,0 +1,23 @@ +'use strict'; + +const inherits = require('inherits'); + +const DEREncoder = require('./der'); + +function PEMEncoder(entity) { + DEREncoder.call(this, entity); + this.enc = 'pem'; +} +inherits(PEMEncoder, DEREncoder); +module.exports = PEMEncoder; + +PEMEncoder.prototype.encode = function encode(data, options) { + const buf = DEREncoder.prototype.encode.call(this, data); + + const p = buf.toString('base64'); + const out = [ '-----BEGIN ' + options.label + '-----' ]; + for (let i = 0; i < p.length; i += 64) + out.push(p.slice(i, i + 64)); + out.push('-----END ' + options.label + '-----'); + return out.join('\n'); +}; diff --git a/node_modules/asn1.js/package.json b/node_modules/asn1.js/package.json new file mode 100644 index 0000000..7b7d053 --- /dev/null +++ b/node_modules/asn1.js/package.json @@ -0,0 +1,36 @@ +{ + "name": "asn1.js", + "version": "5.4.1", + "description": "ASN.1 encoder and decoder", + "main": "lib/asn1.js", + "scripts": { + "lint-2560": "eslint --fix rfc/2560/*.js rfc/2560/test/*.js", + "lint-5280": "eslint --fix rfc/5280/*.js rfc/5280/test/*.js", + "lint": "eslint --fix lib/*.js lib/**/*.js lib/**/**/*.js && npm run lint-2560 && npm run lint-5280", + "test": "mocha --reporter spec test/*-test.js && cd rfc/2560 && npm i && npm test && cd ../../rfc/5280 && npm i && npm test && cd ../../ && npm run lint" + }, + "repository": { + "type": "git", + "url": "git@github.com:indutny/asn1.js" + }, + "keywords": [ + "asn.1", + "der" + ], + "author": "Fedor Indutny", + "license": "MIT", + "bugs": { + "url": "https://github.com/indutny/asn1.js/issues" + }, + "homepage": "https://github.com/indutny/asn1.js", + "devDependencies": { + "eslint": "^4.10.0", + "mocha": "^7.0.0" + }, + "dependencies": { + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + } +} diff --git a/node_modules/bcryptjs/LICENSE b/node_modules/bcryptjs/LICENSE new file mode 100644 index 0000000..6ffc6d9 --- /dev/null +++ b/node_modules/bcryptjs/LICENSE @@ -0,0 +1,27 @@ +bcrypt.js +--------- +Copyright (c) 2012 Nevins Bartolomeo <nevins.bartolomeo@gmail.com> +Copyright (c) 2012 Shane Girish <shaneGirish@gmail.com> +Copyright (c) 2025 Daniel Wirtz <dcode@dcode.io> + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions +are met: +1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. +2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. +3. The name of the author may not be used to endorse or promote products + derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR +IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES +OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. +IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/bcryptjs/README.md b/node_modules/bcryptjs/README.md new file mode 100644 index 0000000..15546c4 --- /dev/null +++ b/node_modules/bcryptjs/README.md @@ -0,0 +1,201 @@ +# bcrypt.js + +Optimized bcrypt in JavaScript with zero dependencies, with TypeScript support. Compatible to the C++ +[bcrypt](https://npmjs.org/package/bcrypt) binding on Node.js and also working in the browser. + +[](https://github.com/dcodeIO/bcrypt.js/actions/workflows/test.yml) [](https://github.com/dcodeIO/bcrypt.js/actions/workflows/publish.yml) [](https://www.npmjs.com/package/bcryptjs) + +## Security considerations + +Besides incorporating a salt to protect against rainbow table attacks, bcrypt is an adaptive function: over time, the +iteration count can be increased to make it slower, so it remains resistant to brute-force search attacks even with +increasing computation power. ([see](http://en.wikipedia.org/wiki/Bcrypt)) + +While bcrypt.js is compatible to the C++ bcrypt binding, it is written in pure JavaScript and thus slower ([about 30%](https://github.com/dcodeIO/bcrypt.js/wiki/Benchmark)), effectively reducing the number of iterations that can be +processed in an equal time span. + +The maximum input length is 72 bytes (note that UTF-8 encoded characters use up to 4 bytes) and the length of generated +hashes is 60 characters. Note that maximum input length is not implicitly checked by the library for compatibility with +the C++ binding on Node.js, but should be checked with `bcrypt.truncates(password)` where necessary. + +## Usage + +The package exports an ECMAScript module with an UMD fallback. + +``` +$> npm install bcryptjs +``` + +```ts +import bcrypt from "bcryptjs"; +``` + +### Usage with a CDN + +- From GitHub via [jsDelivr](https://www.jsdelivr.com):<br /> + `https://cdn.jsdelivr.net/gh/dcodeIO/bcrypt.js@TAG/index.js` (ESM) +- From npm via [jsDelivr](https://www.jsdelivr.com):<br /> + `https://cdn.jsdelivr.net/npm/bcryptjs@VERSION/index.js` (ESM)<br /> + `https://cdn.jsdelivr.net/npm/bcryptjs@VERSION/umd/index.js` (UMD) +- From npm via [unpkg](https://unpkg.com):<br /> + `https://unpkg.com/bcryptjs@VERSION/index.js` (ESM)<br /> + `https://unpkg.com/bcryptjs@VERSION/umd/index.js` (UMD) + +Replace `TAG` respectively `VERSION` with a [specific version](https://github.com/dcodeIO/bcrypt.js/releases) or omit it (not recommended in production) to use latest. + +When using the ESM variant in a browser, the `crypto` import needs to be stubbed out, for example using an [import map](https://developer.mozilla.org/en-US/docs/Web/HTML/Element/script/type/importmap). Bundlers should omit it automatically. + +### Usage - Sync + +To hash a password: + +```ts +const salt = bcrypt.genSaltSync(10); +const hash = bcrypt.hashSync("B4c0/\/", salt); +// Store hash in your password DB +``` + +To check a password: + +```ts +// Load hash from your password DB +bcrypt.compareSync("B4c0/\/", hash); // true +bcrypt.compareSync("not_bacon", hash); // false +``` + +Auto-gen a salt and hash: + +```ts +const hash = bcrypt.hashSync("bacon", 10); +``` + +### Usage - Async + +To hash a password: + +```ts +const salt = await bcrypt.genSalt(10); +const hash = await bcrypt.hash("B4c0/\/", salt); +// Store hash in your password DB +``` + +```ts +bcrypt.genSalt(10, (err, salt) => { + bcrypt.hash("B4c0/\/", salt, function (err, hash) { + // Store hash in your password DB + }); +}); +``` + +To check a password: + +```ts +// Load hash from your password DB +await bcrypt.compare("B4c0/\/", hash); // true +await bcrypt.compare("not_bacon", hash); // false +``` + +```ts +// Load hash from your password DB +bcrypt.compare("B4c0/\/", hash, (err, res) => { + // res === true +}); +bcrypt.compare("not_bacon", hash, (err, res) => { + // res === false +}); +``` + +Auto-gen a salt and hash: + +```ts +await bcrypt.hash("B4c0/\/", 10); +// Store hash in your password DB +``` + +```ts +bcrypt.hash("B4c0/\/", 10, (err, hash) => { + // Store hash in your password DB +}); +``` + +**Note:** Under the hood, asynchronous APIs split an operation into small chunks. After the completion of a chunk, the execution of the next chunk is placed on the back of the [JS event queue](https://developer.mozilla.org/en/docs/Web/JavaScript/EventLoop), efficiently yielding for other computation to execute. + +### Usage - Command Line + +``` +Usage: bcrypt <input> [rounds|salt] +``` + +## API + +### Callback types + +- **Callback<`T`>**: `(err: Error | null, result?: T) => void`<br /> + Called with an error on failure or a value of type `T` upon success. + +- **ProgressCallback**: `(percentage: number) => void`<br /> + Called with the percentage of rounds completed (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. + +- **RandomFallback**: `(length: number) => number[]`<br /> + Called to obtain random bytes when both [Web Crypto API](http://www.w3.org/TR/WebCryptoAPI/) and Node.js + [crypto](http://nodejs.org/api/crypto.html) are not available. + +### Functions + +- bcrypt.**genSaltSync**(rounds?: `number`): `string`<br /> + Synchronously generates a salt. Number of rounds defaults to 10 when omitted. + +- bcrypt.**genSalt**(rounds?: `number`): `Promise<string>`<br /> + Asynchronously generates a salt. Number of rounds defaults to 10 when omitted. + +- bcrypt.**genSalt**([rounds: `number`, ]callback: `Callback<string>`): `void`<br /> + Asynchronously generates a salt. Number of rounds defaults to 10 when omitted. + +- bcrypt.**truncates**(password: `string`): `boolean`<br /> + Tests if a password will be truncated when hashed, that is its length is greater than 72 bytes when converted to UTF-8. + +- bcrypt.**hashSync**(password: `string`, salt?: `number | string`): `string` + Synchronously generates a hash for the given password. Number of rounds defaults to 10 when omitted. + +- bcrypt.**hash**(password: `string`, salt: `number | string`): `Promise<string>`<br /> + Asynchronously generates a hash for the given password. + +- bcrypt.**hash**(password: `string`, salt: `number | string`, callback: `Callback<string>`, progressCallback?: `ProgressCallback`): `void`<br /> + Asynchronously generates a hash for the given password. + +- bcrypt.**compareSync**(password: `string`, hash: `string`): `boolean`<br /> + Synchronously tests a password against a hash. + +- bcrypt.**compare**(password: `string`, hash: `string`): `Promise<boolean>`<br /> + Asynchronously compares a password against a hash. + +- bcrypt.**compare**(password: `string`, hash: `string`, callback: `Callback<boolean>`, progressCallback?: `ProgressCallback`)<br /> + Asynchronously compares a password against a hash. + +- bcrypt.**getRounds**(hash: `string`): `number`<br /> + Gets the number of rounds used to encrypt the specified hash. + +- bcrypt.**getSalt**(hash: `string`): `string`<br /> + Gets the salt portion from a hash. Does not validate the hash. + +- bcrypt.**setRandomFallback**(random: `RandomFallback`): `void`<br /> + Sets the pseudo random number generator to use as a fallback if neither [Web Crypto API](http://www.w3.org/TR/WebCryptoAPI/) nor Node.js [crypto](http://nodejs.org/api/crypto.html) are available. Please note: It is highly important that the PRNG used is cryptographically secure and that it is seeded properly! + +## Building + +Building the UMD fallback: + +``` +$> npm run build +``` + +Running the [tests](./tests): + +``` +$> npm test +``` + +## Credits + +Based on work started by Shane Girish at [bcrypt-nodejs](https://github.com/shaneGirish/bcrypt-nodejs), which is itself +based on [javascript-bcrypt](http://code.google.com/p/javascript-bcrypt/) (New BSD-licensed). diff --git a/node_modules/bcryptjs/bin/bcrypt b/node_modules/bcryptjs/bin/bcrypt new file mode 100644 index 0000000..5c72e0f --- /dev/null +++ b/node_modules/bcryptjs/bin/bcrypt @@ -0,0 +1,23 @@ +#!/usr/bin/env node + +import path from "node:path"; +import bcrypt from "../index.js"; + +if (process.argv.length < 3) { + console.log( + "Usage: " + path.basename(process.argv[1]) + " <input> [rounds|salt]", + ); + process.exit(1); +} else { + var salt; + if (process.argv.length > 3) { + salt = process.argv[3]; + var rounds = parseInt(salt, 10); + if (rounds == salt) { + salt = bcrypt.genSaltSync(rounds); + } + } else { + salt = bcrypt.genSaltSync(); + } + console.log(bcrypt.hashSync(process.argv[2], salt)); +} diff --git a/node_modules/bcryptjs/index.d.ts b/node_modules/bcryptjs/index.d.ts new file mode 100644 index 0000000..3ae838f --- /dev/null +++ b/node_modules/bcryptjs/index.d.ts @@ -0,0 +1,3 @@ +import * as bcrypt from "./types.js"; +export * from "./types.js"; +export default bcrypt; diff --git a/node_modules/bcryptjs/index.js b/node_modules/bcryptjs/index.js new file mode 100644 index 0000000..f91fff4 --- /dev/null +++ b/node_modules/bcryptjs/index.js @@ -0,0 +1,1161 @@ +/* + Copyright (c) 2012 Nevins Bartolomeo <nevins.bartolomeo@gmail.com> + Copyright (c) 2012 Shane Girish <shaneGirish@gmail.com> + Copyright (c) 2025 Daniel Wirtz <dcode@dcode.io> + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + 3. The name of the author may not be used to endorse or promote products + derived from this software without specific prior written permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +// The Node.js crypto module is used as a fallback for the Web Crypto API. When +// building for the browser, inclusion of the crypto module should be disabled, +// which the package hints at in its package.json for bundlers that support it. +import nodeCrypto from "crypto"; + +/** + * The random implementation to use as a fallback. + * @type {?function(number):!Array.<number>} + * @inner + */ +var randomFallback = null; + +/** + * Generates cryptographically secure random bytes. + * @function + * @param {number} len Bytes length + * @returns {!Array.<number>} Random bytes + * @throws {Error} If no random implementation is available + * @inner + */ +function randomBytes(len) { + // Web Crypto API. Globally available in the browser and in Node.js >=23. + try { + return crypto.getRandomValues(new Uint8Array(len)); + } catch {} + // Node.js crypto module for non-browser environments. + try { + return nodeCrypto.randomBytes(len); + } catch {} + // Custom fallback specified with `setRandomFallback`. + if (!randomFallback) { + throw Error( + "Neither WebCryptoAPI nor a crypto module is available. Use bcrypt.setRandomFallback to set an alternative", + ); + } + return randomFallback(len); +} + +/** + * Sets the pseudo random number generator to use as a fallback if neither node's `crypto` module nor the Web Crypto + * API is available. Please note: It is highly important that the PRNG used is cryptographically secure and that it + * is seeded properly! + * @param {?function(number):!Array.<number>} random Function taking the number of bytes to generate as its + * sole argument, returning the corresponding array of cryptographically secure random byte values. + * @see http://nodejs.org/api/crypto.html + * @see http://www.w3.org/TR/WebCryptoAPI/ + */ +export function setRandomFallback(random) { + randomFallback = random; +} + +/** + * Synchronously generates a salt. + * @param {number=} rounds Number of rounds to use, defaults to 10 if omitted + * @param {number=} seed_length Not supported. + * @returns {string} Resulting salt + * @throws {Error} If a random fallback is required but not set + */ +export function genSaltSync(rounds, seed_length) { + rounds = rounds || GENSALT_DEFAULT_LOG2_ROUNDS; + if (typeof rounds !== "number") + throw Error( + "Illegal arguments: " + typeof rounds + ", " + typeof seed_length, + ); + if (rounds < 4) rounds = 4; + else if (rounds > 31) rounds = 31; + var salt = []; + salt.push("$2b$"); + if (rounds < 10) salt.push("0"); + salt.push(rounds.toString()); + salt.push("$"); + salt.push(base64_encode(randomBytes(BCRYPT_SALT_LEN), BCRYPT_SALT_LEN)); // May throw + return salt.join(""); +} + +/** + * Asynchronously generates a salt. + * @param {(number|function(Error, string=))=} rounds Number of rounds to use, defaults to 10 if omitted + * @param {(number|function(Error, string=))=} seed_length Not supported. + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting salt + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ +export function genSalt(rounds, seed_length, callback) { + if (typeof seed_length === "function") + (callback = seed_length), (seed_length = undefined); // Not supported. + if (typeof rounds === "function") (callback = rounds), (rounds = undefined); + if (typeof rounds === "undefined") rounds = GENSALT_DEFAULT_LOG2_ROUNDS; + else if (typeof rounds !== "number") + throw Error("illegal arguments: " + typeof rounds); + + function _async(callback) { + nextTick(function () { + // Pretty thin, but salting is fast enough + try { + callback(null, genSaltSync(rounds)); + } catch (err) { + callback(err); + } + }); + } + + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); +} + +/** + * Synchronously generates a hash for the given password. + * @param {string} password Password to hash + * @param {(number|string)=} salt Salt length to generate or salt to use, default to 10 + * @returns {string} Resulting hash + */ +export function hashSync(password, salt) { + if (typeof salt === "undefined") salt = GENSALT_DEFAULT_LOG2_ROUNDS; + if (typeof salt === "number") salt = genSaltSync(salt); + if (typeof password !== "string" || typeof salt !== "string") + throw Error("Illegal arguments: " + typeof password + ", " + typeof salt); + return _hash(password, salt); +} + +/** + * Asynchronously generates a hash for the given password. + * @param {string} password Password to hash + * @param {number|string} salt Salt length to generate or salt to use + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash + * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed + * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ +export function hash(password, salt, callback, progressCallback) { + function _async(callback) { + if (typeof password === "string" && typeof salt === "number") + genSalt(salt, function (err, salt) { + _hash(password, salt, callback, progressCallback); + }); + else if (typeof password === "string" && typeof salt === "string") + _hash(password, salt, callback, progressCallback); + else + nextTick( + callback.bind( + this, + Error("Illegal arguments: " + typeof password + ", " + typeof salt), + ), + ); + } + + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); +} + +/** + * Compares two strings of the same length in constant time. + * @param {string} known Must be of the correct length + * @param {string} unknown Must be the same length as `known` + * @returns {boolean} + * @inner + */ +function safeStringCompare(known, unknown) { + var diff = known.length ^ unknown.length; + for (var i = 0; i < known.length; ++i) { + diff |= known.charCodeAt(i) ^ unknown.charCodeAt(i); + } + return diff === 0; +} + +/** + * Synchronously tests a password against a hash. + * @param {string} password Password to compare + * @param {string} hash Hash to test against + * @returns {boolean} true if matching, otherwise false + * @throws {Error} If an argument is illegal + */ +export function compareSync(password, hash) { + if (typeof password !== "string" || typeof hash !== "string") + throw Error("Illegal arguments: " + typeof password + ", " + typeof hash); + if (hash.length !== 60) return false; + return safeStringCompare( + hashSync(password, hash.substring(0, hash.length - 31)), + hash, + ); +} + +/** + * Asynchronously tests a password against a hash. + * @param {string} password Password to compare + * @param {string} hashValue Hash to test against + * @param {function(Error, boolean)=} callback Callback receiving the error, if any, otherwise the result + * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed + * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ +export function compare(password, hashValue, callback, progressCallback) { + function _async(callback) { + if (typeof password !== "string" || typeof hashValue !== "string") { + nextTick( + callback.bind( + this, + Error( + "Illegal arguments: " + typeof password + ", " + typeof hashValue, + ), + ), + ); + return; + } + if (hashValue.length !== 60) { + nextTick(callback.bind(this, null, false)); + return; + } + hash( + password, + hashValue.substring(0, 29), + function (err, comp) { + if (err) callback(err); + else callback(null, safeStringCompare(comp, hashValue)); + }, + progressCallback, + ); + } + + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); +} + +/** + * Gets the number of rounds used to encrypt the specified hash. + * @param {string} hash Hash to extract the used number of rounds from + * @returns {number} Number of rounds used + * @throws {Error} If `hash` is not a string + */ +export function getRounds(hash) { + if (typeof hash !== "string") + throw Error("Illegal arguments: " + typeof hash); + return parseInt(hash.split("$")[2], 10); +} + +/** + * Gets the salt portion from a hash. Does not validate the hash. + * @param {string} hash Hash to extract the salt from + * @returns {string} Extracted salt part + * @throws {Error} If `hash` is not a string or otherwise invalid + */ +export function getSalt(hash) { + if (typeof hash !== "string") + throw Error("Illegal arguments: " + typeof hash); + if (hash.length !== 60) + throw Error("Illegal hash length: " + hash.length + " != 60"); + return hash.substring(0, 29); +} + +/** + * Tests if a password will be truncated when hashed, that is its length is + * greater than 72 bytes when converted to UTF-8. + * @param {string} password The password to test + * @returns {boolean} `true` if truncated, otherwise `false` + */ +export function truncates(password) { + if (typeof password !== "string") + throw Error("Illegal arguments: " + typeof password); + return utf8Length(password) > 72; +} + +/** + * Continues with the callback on the next tick. + * @function + * @param {function(...[*])} callback Callback to execute + * @inner + */ +var nextTick = + typeof process !== "undefined" && + process && + typeof process.nextTick === "function" + ? typeof setImmediate === "function" + ? setImmediate + : process.nextTick + : setTimeout; + +/** Calculates the byte length of a string encoded as UTF8. */ +function utf8Length(string) { + var len = 0, + c = 0; + for (var i = 0; i < string.length; ++i) { + c = string.charCodeAt(i); + if (c < 128) len += 1; + else if (c < 2048) len += 2; + else if ( + (c & 0xfc00) === 0xd800 && + (string.charCodeAt(i + 1) & 0xfc00) === 0xdc00 + ) { + ++i; + len += 4; + } else len += 3; + } + return len; +} + +/** Converts a string to an array of UTF8 bytes. */ +function utf8Array(string) { + var offset = 0, + c1, + c2; + var buffer = new Array(utf8Length(string)); + for (var i = 0, k = string.length; i < k; ++i) { + c1 = string.charCodeAt(i); + if (c1 < 128) { + buffer[offset++] = c1; + } else if (c1 < 2048) { + buffer[offset++] = (c1 >> 6) | 192; + buffer[offset++] = (c1 & 63) | 128; + } else if ( + (c1 & 0xfc00) === 0xd800 && + ((c2 = string.charCodeAt(i + 1)) & 0xfc00) === 0xdc00 + ) { + c1 = 0x10000 + ((c1 & 0x03ff) << 10) + (c2 & 0x03ff); + ++i; + buffer[offset++] = (c1 >> 18) | 240; + buffer[offset++] = ((c1 >> 12) & 63) | 128; + buffer[offset++] = ((c1 >> 6) & 63) | 128; + buffer[offset++] = (c1 & 63) | 128; + } else { + buffer[offset++] = (c1 >> 12) | 224; + buffer[offset++] = ((c1 >> 6) & 63) | 128; + buffer[offset++] = (c1 & 63) | 128; + } + } + return buffer; +} + +// A base64 implementation for the bcrypt algorithm. This is partly non-standard. + +/** + * bcrypt's own non-standard base64 dictionary. + * @type {!Array.<string>} + * @const + * @inner + **/ +var BASE64_CODE = + "./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789".split(""); + +/** + * @type {!Array.<number>} + * @const + * @inner + **/ +var BASE64_INDEX = [ + -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, + -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, + -1, -1, -1, -1, -1, -1, -1, -1, 0, 1, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, + -1, -1, -1, -1, -1, -1, -1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, + 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, -1, -1, -1, -1, -1, -1, 28, + 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, + 48, 49, 50, 51, 52, 53, -1, -1, -1, -1, -1, +]; + +/** + * Encodes a byte array to base64 with up to len bytes of input. + * @param {!Array.<number>} b Byte array + * @param {number} len Maximum input length + * @returns {string} + * @inner + */ +function base64_encode(b, len) { + var off = 0, + rs = [], + c1, + c2; + if (len <= 0 || len > b.length) throw Error("Illegal len: " + len); + while (off < len) { + c1 = b[off++] & 0xff; + rs.push(BASE64_CODE[(c1 >> 2) & 0x3f]); + c1 = (c1 & 0x03) << 4; + if (off >= len) { + rs.push(BASE64_CODE[c1 & 0x3f]); + break; + } + c2 = b[off++] & 0xff; + c1 |= (c2 >> 4) & 0x0f; + rs.push(BASE64_CODE[c1 & 0x3f]); + c1 = (c2 & 0x0f) << 2; + if (off >= len) { + rs.push(BASE64_CODE[c1 & 0x3f]); + break; + } + c2 = b[off++] & 0xff; + c1 |= (c2 >> 6) & 0x03; + rs.push(BASE64_CODE[c1 & 0x3f]); + rs.push(BASE64_CODE[c2 & 0x3f]); + } + return rs.join(""); +} + +/** + * Decodes a base64 encoded string to up to len bytes of output. + * @param {string} s String to decode + * @param {number} len Maximum output length + * @returns {!Array.<number>} + * @inner + */ +function base64_decode(s, len) { + var off = 0, + slen = s.length, + olen = 0, + rs = [], + c1, + c2, + c3, + c4, + o, + code; + if (len <= 0) throw Error("Illegal len: " + len); + while (off < slen - 1 && olen < len) { + code = s.charCodeAt(off++); + c1 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + code = s.charCodeAt(off++); + c2 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + if (c1 == -1 || c2 == -1) break; + o = (c1 << 2) >>> 0; + o |= (c2 & 0x30) >> 4; + rs.push(String.fromCharCode(o)); + if (++olen >= len || off >= slen) break; + code = s.charCodeAt(off++); + c3 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + if (c3 == -1) break; + o = ((c2 & 0x0f) << 4) >>> 0; + o |= (c3 & 0x3c) >> 2; + rs.push(String.fromCharCode(o)); + if (++olen >= len || off >= slen) break; + code = s.charCodeAt(off++); + c4 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + o = ((c3 & 0x03) << 6) >>> 0; + o |= c4; + rs.push(String.fromCharCode(o)); + ++olen; + } + var res = []; + for (off = 0; off < olen; off++) res.push(rs[off].charCodeAt(0)); + return res; +} + +/** + * @type {number} + * @const + * @inner + */ +var BCRYPT_SALT_LEN = 16; + +/** + * @type {number} + * @const + * @inner + */ +var GENSALT_DEFAULT_LOG2_ROUNDS = 10; + +/** + * @type {number} + * @const + * @inner + */ +var BLOWFISH_NUM_ROUNDS = 16; + +/** + * @type {number} + * @const + * @inner + */ +var MAX_EXECUTION_TIME = 100; + +/** + * @type {Array.<number>} + * @const + * @inner + */ +var P_ORIG = [ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, 0xa4093822, 0x299f31d0, + 0x082efa98, 0xec4e6c89, 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, 0x9216d5d9, 0x8979fb1b, +]; + +/** + * @type {Array.<number>} + * @const + * @inner + */ +var S_ORIG = [ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, 0xb8e1afed, 0x6a267e96, + 0xba7c9045, 0xf12c7f99, 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, 0x0d95748f, 0x728eb658, + 0x718bcd58, 0x82154aee, 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, 0x8e79dcb0, 0x603a180e, + 0x6c9e0e8b, 0xb01e8a3e, 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, 0x55ca396a, 0x2aab10b6, + 0xb4cc5c34, 0x1141e8ce, 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, 0xafd6ba33, 0x6c24cf5c, + 0x7a325381, 0x28958677, 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, 0xef845d5d, 0xe98575b1, + 0xdc262302, 0xeb651b88, 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, 0x21c66842, 0xf6e96c9a, + 0x670c9c61, 0xabd388f0, 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, 0xa1f1651d, 0x39af0176, + 0x66ca593e, 0x82430e88, 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, 0x4ed3aa62, 0x363f7706, + 0x1bfedf72, 0x429b023d, 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, 0xe3fe501a, 0xb6794c3b, + 0x976ce0bd, 0x04c006ba, 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, 0x6dfc511f, 0x9b30952c, + 0xcc814544, 0xaf5ebd09, 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, 0x5579c0bd, 0x1a60320a, + 0xd6a100c6, 0x402c7279, 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, 0x323db5fa, 0xfd238760, + 0x53317b48, 0x3e00df82, 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, 0x695b27b0, 0xbbca58c8, + 0xe1ffa35d, 0xb8f011a0, 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, 0xe1ddf2da, 0xa4cb7e33, + 0x62fb1341, 0xcee4c6e8, 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, 0xd08ed1d0, 0xafc725e0, + 0x8e3c5b2f, 0x8e7594b7, 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, 0x2f2f2218, 0xbe0e1777, + 0xea752dfe, 0x8b021fa1, 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, 0x165fa266, 0x80957705, + 0x93cc7314, 0x211a1477, 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, 0x00250e2d, 0x2071b35e, + 0x226800bb, 0x57b8e0af, 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, 0x83260376, 0x6295cfa9, + 0x11c81968, 0x4e734a41, 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, 0x08ba6fb5, 0x571be91f, + 0xf296ec6b, 0x2a0dd915, 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a, 0x4b7a70e9, 0xb5b32944, + 0xdb75092e, 0xc4192623, 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, 0x193602a5, 0x75094c29, + 0xa0591340, 0xe4183a3e, 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, 0x4cdd2086, 0x8470eb26, + 0x6382e9c6, 0x021ecc5e, 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, 0x3e07841c, 0x7fdeae5c, + 0x8e7d44ec, 0x5716f2b8, 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, 0xd19113f9, 0x7ca92ff6, + 0x94324773, 0x22f54701, 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, 0xe238cd99, 0x3bea0e2f, + 0x3280bba1, 0x183eb331, 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, 0xde9a771f, 0xd9930810, + 0xb38bae12, 0xdccf3f2e, 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, 0xec7aec3a, 0xdb851dfa, + 0x63094366, 0xc464c3d2, 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, 0x71dff89e, 0x10314e55, + 0x81ac77d6, 0x5f11199b, 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, 0x86e34570, 0xeae96fb1, + 0x860e5e0a, 0x5a3e2ab3, 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, 0xc6150eba, 0x94e2ea78, + 0xa5fc3c53, 0x1e0a2df4, 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, 0xe3bc4595, 0xa67bc883, + 0xb17f37d1, 0x018cff28, 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, 0x1521b628, 0x29076170, + 0xecdd4775, 0x619f1510, 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, 0xeecc86bc, 0x60622ca7, + 0x9cab5cab, 0xb2f3846e, 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, 0x9b540b19, 0x875fa099, + 0x95f7997e, 0x623d7da8, 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, 0x57f584a5, 0x1b227263, + 0x9b83c3ff, 0x1ac24696, 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, 0x5d4a14d9, 0xe864b7e3, + 0x42105d14, 0x203e13e0, 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, 0xd81e799e, 0x86854dc7, + 0xe44b476a, 0x3d816250, 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, 0x095bbf00, 0xad19489d, + 0x1462b174, 0x23820e00, 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, 0x7cde3759, 0xcbee7460, + 0x4085f2a7, 0xce77326e, 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, 0x9e447a2e, 0xc3453484, + 0xfdd56705, 0x0e1e9ec9, 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, 0x153e21e7, 0x8fb03d4a, + 0xe6e39f2b, 0xdb83adf7, 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, 0xd4082471, 0x3320f46a, + 0x43b7d4b7, 0x500061af, 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, 0xbfbc09ec, 0x03bd9785, + 0x7fac6dd0, 0x31cb8504, 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, 0x68dc1462, 0xd7486900, + 0x680ec0a4, 0x27a18dee, 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, 0x20fe9e35, 0xd9f385b9, + 0xee39d7ab, 0x3b124e8b, 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, 0xfb0af54e, 0xd8feb397, + 0x454056ac, 0xba489527, 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, 0xa62a4a56, 0x3f3125f9, + 0x5ef47e1c, 0x9029317c, 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, 0x07f9c9ee, 0x41041f0f, + 0x404779a4, 0x5d886e17, 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, 0x0e12b4c2, 0x02e1329e, + 0xaf664fd1, 0xcad18115, 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, 0xd0127845, 0x95b794fd, + 0x647d0862, 0xe7ccf5f0, 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, 0xa812dc60, 0xa1ebddf8, + 0x991be14c, 0xdb6e6b0d, 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, 0x667b9ffb, 0xcedb7d9c, + 0xa091cf0b, 0xd9155ea3, 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, 0x6842ada7, 0xc66a2b3b, + 0x12754ccc, 0x782ef11c, 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, 0x44421659, 0x0a121386, + 0xd90cec6e, 0xd5abea2a, 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, 0xd1fd8346, 0xf6381fb0, + 0x7745ae04, 0xd736fccc, 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, 0x4e58f48f, 0xf2ddfda2, + 0xf474ef38, 0x8789bdc2, 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, 0x466e598e, 0x20b45770, + 0x8cd55591, 0xc902de4c, 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, 0xe85a1f02, 0x09f0be8c, + 0x4a99a025, 0x1d6efe10, 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, 0x50115e01, 0xa70683fa, + 0xa002b5c4, 0x0de6d027, 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, 0x11e69ed7, 0x2338ea63, + 0x53c2dd94, 0xc2c21634, 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, 0x86e3725f, 0x724d9db9, + 0x1ac15bb4, 0xd39eb8fc, 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, 0x6fd5c7e7, 0x56e14ec4, + 0x362abfce, 0xddc6c837, 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0, + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, 0x5cb0679e, 0x4fa33742, + 0xd3822740, 0x99bc9bbe, 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, 0x5748ab2f, 0xbc946e79, + 0xc6a376d2, 0x6549c2c8, 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, 0xa1fad5f0, 0x6a2d519a, + 0x63ef8ce2, 0x9a86ee22, 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, 0x2826a2f9, 0xa73a3ae1, + 0x4ba99586, 0xef5562e9, 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, 0xe990fd5a, 0x9e34d797, + 0x2cf0b7d9, 0x022b8b51, 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, 0xe029ac71, 0xe019a5e6, + 0x47b0acfd, 0xed93fa9b, 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, 0x15056dd4, 0x88f46dba, + 0x03a16125, 0x0564f0bd, 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, 0x7533d928, 0xb155fdf5, + 0x03563482, 0x8aba3cbb, 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, 0xea7a90c2, 0xfb3e7bce, + 0x5121ce64, 0x774fbe32, 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, 0xb39a460a, 0x6445c0dd, + 0x586cdecf, 0x1c20c8ae, 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, 0x72eacea8, 0xfa6484bb, + 0x8d6612ae, 0xbf3c6f47, 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, 0x4040cb08, 0x4eb4e2cc, + 0x34d2466a, 0x0115af84, 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, 0x611560b1, 0xe7933fdc, + 0xbb3a792b, 0x344525bd, 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, 0x1a908749, 0xd44fbd9a, + 0xd0dadecb, 0xd50ada38, 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, 0xbf97222c, 0x15e6fc2a, + 0x0f91fc71, 0x9b941525, 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, 0xe0ec6e0e, 0x1698db3b, + 0x4c98a0be, 0x3278e964, 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, 0xdf359f8d, 0x9b992f2e, + 0xe60b6f47, 0x0fe3f11d, 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, 0xf523f357, 0xa6327623, + 0x93a83531, 0x56cccd02, 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, 0xe6c6c7bd, 0x327a140a, + 0x45e1d006, 0xc3f27b9a, 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, 0x53113ec0, 0x1640e3d3, + 0x38abbd60, 0x2547adf0, 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, 0x1948c25c, 0x02fb8a8c, + 0x01c36ae4, 0xd6ebe1f9, 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6, +]; + +/** + * @type {Array.<number>} + * @const + * @inner + */ +var C_ORIG = [ + 0x4f727068, 0x65616e42, 0x65686f6c, 0x64657253, 0x63727944, 0x6f756274, +]; + +/** + * @param {Array.<number>} lr + * @param {number} off + * @param {Array.<number>} P + * @param {Array.<number>} S + * @returns {Array.<number>} + * @inner + */ +function _encipher(lr, off, P, S) { + // This is our bottleneck: 1714/1905 ticks / 90% - see profile.txt + var n, + l = lr[off], + r = lr[off + 1]; + + l ^= P[0]; + + /* + for (var i=0, k=BLOWFISH_NUM_ROUNDS-2; i<=k;) + // Feistel substitution on left word + n = S[l >>> 24], + n += S[0x100 | ((l >> 16) & 0xff)], + n ^= S[0x200 | ((l >> 8) & 0xff)], + n += S[0x300 | (l & 0xff)], + r ^= n ^ P[++i], + // Feistel substitution on right word + n = S[r >>> 24], + n += S[0x100 | ((r >> 16) & 0xff)], + n ^= S[0x200 | ((r >> 8) & 0xff)], + n += S[0x300 | (r & 0xff)], + l ^= n ^ P[++i]; + */ + + //The following is an unrolled version of the above loop. + //Iteration 0 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[1]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[2]; + //Iteration 1 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[3]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[4]; + //Iteration 2 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[5]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[6]; + //Iteration 3 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[7]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[8]; + //Iteration 4 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[9]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[10]; + //Iteration 5 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[11]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[12]; + //Iteration 6 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[13]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[14]; + //Iteration 7 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[15]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[16]; + + lr[off] = r ^ P[BLOWFISH_NUM_ROUNDS + 1]; + lr[off + 1] = l; + return lr; +} + +/** + * @param {Array.<number>} data + * @param {number} offp + * @returns {{key: number, offp: number}} + * @inner + */ +function _streamtoword(data, offp) { + for (var i = 0, word = 0; i < 4; ++i) + (word = (word << 8) | (data[offp] & 0xff)), + (offp = (offp + 1) % data.length); + return { key: word, offp: offp }; +} + +/** + * @param {Array.<number>} key + * @param {Array.<number>} P + * @param {Array.<number>} S + * @inner + */ +function _key(key, P, S) { + var offset = 0, + lr = [0, 0], + plen = P.length, + slen = S.length, + sw; + for (var i = 0; i < plen; i++) + (sw = _streamtoword(key, offset)), + (offset = sw.offp), + (P[i] = P[i] ^ sw.key); + for (i = 0; i < plen; i += 2) + (lr = _encipher(lr, 0, P, S)), (P[i] = lr[0]), (P[i + 1] = lr[1]); + for (i = 0; i < slen; i += 2) + (lr = _encipher(lr, 0, P, S)), (S[i] = lr[0]), (S[i + 1] = lr[1]); +} + +/** + * Expensive key schedule Blowfish. + * @param {Array.<number>} data + * @param {Array.<number>} key + * @param {Array.<number>} P + * @param {Array.<number>} S + * @inner + */ +function _ekskey(data, key, P, S) { + var offp = 0, + lr = [0, 0], + plen = P.length, + slen = S.length, + sw; + for (var i = 0; i < plen; i++) + (sw = _streamtoword(key, offp)), (offp = sw.offp), (P[i] = P[i] ^ sw.key); + offp = 0; + for (i = 0; i < plen; i += 2) + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[0] ^= sw.key), + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[1] ^= sw.key), + (lr = _encipher(lr, 0, P, S)), + (P[i] = lr[0]), + (P[i + 1] = lr[1]); + for (i = 0; i < slen; i += 2) + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[0] ^= sw.key), + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[1] ^= sw.key), + (lr = _encipher(lr, 0, P, S)), + (S[i] = lr[0]), + (S[i + 1] = lr[1]); +} + +/** + * Internaly crypts a string. + * @param {Array.<number>} b Bytes to crypt + * @param {Array.<number>} salt Salt bytes to use + * @param {number} rounds Number of rounds + * @param {function(Error, Array.<number>=)=} callback Callback receiving the error, if any, and the resulting bytes. If + * omitted, the operation will be performed synchronously. + * @param {function(number)=} progressCallback Callback called with the current progress + * @returns {!Array.<number>|undefined} Resulting bytes if callback has been omitted, otherwise `undefined` + * @inner + */ +function _crypt(b, salt, rounds, callback, progressCallback) { + var cdata = C_ORIG.slice(), + clen = cdata.length, + err; + + // Validate + if (rounds < 4 || rounds > 31) { + err = Error("Illegal number of rounds (4-31): " + rounds); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + if (salt.length !== BCRYPT_SALT_LEN) { + err = Error( + "Illegal salt length: " + salt.length + " != " + BCRYPT_SALT_LEN, + ); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + rounds = (1 << rounds) >>> 0; + + var P, + S, + i = 0, + j; + + //Use typed arrays when available - huge speedup! + if (typeof Int32Array === "function") { + P = new Int32Array(P_ORIG); + S = new Int32Array(S_ORIG); + } else { + P = P_ORIG.slice(); + S = S_ORIG.slice(); + } + + _ekskey(salt, b, P, S); + + /** + * Calcualtes the next round. + * @returns {Array.<number>|undefined} Resulting array if callback has been omitted, otherwise `undefined` + * @inner + */ + function next() { + if (progressCallback) progressCallback(i / rounds); + if (i < rounds) { + var start = Date.now(); + for (; i < rounds; ) { + i = i + 1; + _key(b, P, S); + _key(salt, P, S); + if (Date.now() - start > MAX_EXECUTION_TIME) break; + } + } else { + for (i = 0; i < 64; i++) + for (j = 0; j < clen >> 1; j++) _encipher(cdata, j << 1, P, S); + var ret = []; + for (i = 0; i < clen; i++) + ret.push(((cdata[i] >> 24) & 0xff) >>> 0), + ret.push(((cdata[i] >> 16) & 0xff) >>> 0), + ret.push(((cdata[i] >> 8) & 0xff) >>> 0), + ret.push((cdata[i] & 0xff) >>> 0); + if (callback) { + callback(null, ret); + return; + } else return ret; + } + if (callback) nextTick(next); + } + + // Async + if (typeof callback !== "undefined") { + next(); + + // Sync + } else { + var res; + while (true) if (typeof (res = next()) !== "undefined") return res || []; + } +} + +/** + * Internally hashes a password. + * @param {string} password Password to hash + * @param {?string} salt Salt to use, actually never null + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash. If omitted, + * hashing is performed synchronously. + * @param {function(number)=} progressCallback Callback called with the current progress + * @returns {string|undefined} Resulting hash if callback has been omitted, otherwise `undefined` + * @inner + */ +function _hash(password, salt, callback, progressCallback) { + var err; + if (typeof password !== "string" || typeof salt !== "string") { + err = Error("Invalid string / salt: Not a string"); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + + // Validate the salt + var minor, offset; + if (salt.charAt(0) !== "$" || salt.charAt(1) !== "2") { + err = Error("Invalid salt version: " + salt.substring(0, 2)); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + if (salt.charAt(2) === "$") (minor = String.fromCharCode(0)), (offset = 3); + else { + minor = salt.charAt(2); + if ( + (minor !== "a" && minor !== "b" && minor !== "y") || + salt.charAt(3) !== "$" + ) { + err = Error("Invalid salt revision: " + salt.substring(2, 4)); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + offset = 4; + } + + // Extract number of rounds + if (salt.charAt(offset + 2) > "$") { + err = Error("Missing salt rounds"); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + var r1 = parseInt(salt.substring(offset, offset + 1), 10) * 10, + r2 = parseInt(salt.substring(offset + 1, offset + 2), 10), + rounds = r1 + r2, + real_salt = salt.substring(offset + 3, offset + 25); + password += minor >= "a" ? "\x00" : ""; + + var passwordb = utf8Array(password), + saltb = base64_decode(real_salt, BCRYPT_SALT_LEN); + + /** + * Finishes hashing. + * @param {Array.<number>} bytes Byte array + * @returns {string} + * @inner + */ + function finish(bytes) { + var res = []; + res.push("$2"); + if (minor >= "a") res.push(minor); + res.push("$"); + if (rounds < 10) res.push("0"); + res.push(rounds.toString()); + res.push("$"); + res.push(base64_encode(saltb, saltb.length)); + res.push(base64_encode(bytes, C_ORIG.length * 4 - 1)); + return res.join(""); + } + + // Sync + if (typeof callback == "undefined") + return finish(_crypt(passwordb, saltb, rounds)); + // Async + else { + _crypt( + passwordb, + saltb, + rounds, + function (err, bytes) { + if (err) callback(err, null); + else callback(null, finish(bytes)); + }, + progressCallback, + ); + } +} + +/** + * Encodes a byte array to base64 with up to len bytes of input, using the custom bcrypt alphabet. + * @function + * @param {!Array.<number>} bytes Byte array + * @param {number} length Maximum input length + * @returns {string} + */ +export function encodeBase64(bytes, length) { + return base64_encode(bytes, length); +} + +/** + * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet. + * @function + * @param {string} string String to decode + * @param {number} length Maximum output length + * @returns {!Array.<number>} + */ +export function decodeBase64(string, length) { + return base64_decode(string, length); +} + +export default { + setRandomFallback, + genSaltSync, + genSalt, + hashSync, + hash, + compareSync, + compare, + getRounds, + getSalt, + truncates, + encodeBase64, + decodeBase64, +}; diff --git a/node_modules/bcryptjs/package.json b/node_modules/bcryptjs/package.json new file mode 100644 index 0000000..86e9543 --- /dev/null +++ b/node_modules/bcryptjs/package.json @@ -0,0 +1,76 @@ +{ + "name": "bcryptjs", + "description": "Optimized bcrypt in plain JavaScript with zero dependencies, with TypeScript support. Compatible to 'bcrypt'.", + "version": "3.0.2", + "author": "Daniel Wirtz <dcode@dcode.io>", + "contributors": [ + "Shane Girish <shaneGirish@gmail.com> (https://github.com/shaneGirish)", + "Alex Murray <> (https://github.com/alexmurray)", + "Nicolas Pelletier <> (https://github.com/NicolasPelletier)", + "Josh Rogers <> (https://github.com/geekymole)", + "Noah Isaacson <noah@nisaacson.com> (https://github.com/nisaacson)" + ], + "repository": { + "type": "url", + "url": "https://github.com/dcodeIO/bcrypt.js.git" + }, + "bugs": { + "url": "https://github.com/dcodeIO/bcrypt.js/issues" + }, + "keywords": [ + "bcrypt", + "password", + "auth", + "authentication", + "encryption", + "crypt", + "crypto" + ], + "type": "module", + "main": "umd/index.js", + "types": "umd/index.d.ts", + "exports": { + ".": { + "import": { + "types": "./index.d.ts", + "default": "./index.js" + }, + "require": { + "types": "./umd/index.d.ts", + "default": "./umd/index.js" + } + } + }, + "bin": { + "bcrypt": "bin/bcrypt" + }, + "license": "BSD-3-Clause", + "scripts": { + "build": "node scripts/build.js", + "lint": "prettier --check .", + "format": "prettier --write .", + "test": "npm run test:unit && npm run test:typescript", + "test:unit": "node tests", + "test:typescript": "tsc --project tests/typescript/tsconfig.esnext.json && tsc --project tests/typescript/tsconfig.nodenext.json && tsc --project tests/typescript/tsconfig.commonjs.json && tsc --project tests/typescript/tsconfig.global.json" + }, + "files": [ + "index.js", + "index.d.ts", + "types.d.ts", + "umd/index.js", + "umd/index.d.ts", + "umd/types.d.ts", + "umd/package.json", + "LICENSE", + "README.md" + ], + "browser": { + "crypto": false + }, + "devDependencies": { + "bcrypt": "^5.1.1", + "esm2umd": "^0.3.1", + "prettier": "^3.5.0", + "typescript": "^5.7.3" + } +} diff --git a/node_modules/bcryptjs/types.d.ts b/node_modules/bcryptjs/types.d.ts new file mode 100644 index 0000000..3cbe5b1 --- /dev/null +++ b/node_modules/bcryptjs/types.d.ts @@ -0,0 +1,157 @@ +// Originally imported from https://github.com/DefinitelyTyped/DefinitelyTyped/blob/8b36dbdf95b624b8a7cd7f8416f06c15d274f9e6/types/bcryptjs/index.d.ts +// MIT license. + +/** Called with an error on failure or a value of type `T` upon success. */ +type Callback<T> = (err: Error | null, result?: T) => void; +/** Called with the percentage of rounds completed (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. */ +type ProgressCallback = (percentage: number) => void; +/** Called to obtain random bytes when both Web Crypto API and Node.js crypto are not available. */ +type RandomFallback = (length: number) => number[]; + +/** + * Sets the pseudo random number generator to use as a fallback if neither node's crypto module nor the Web Crypto API is available. + * Please note: It is highly important that the PRNG used is cryptographically secure and that it is seeded properly! + * @param random Function taking the number of bytes to generate as its sole argument, returning the corresponding array of cryptographically secure random byte values. + */ +export declare function setRandomFallback(random: RandomFallback): void; + +/** + * Synchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @return Resulting salt + * @throws If a random fallback is required but not set + */ +export declare function genSaltSync(rounds?: number): string; + +/** + * Asynchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @return Promise with resulting salt, if callback has been omitted + */ +export declare function genSalt(rounds?: number): Promise<string>; + +/** + * Asynchronously generates a salt. + * @param callback Callback receiving the error, if any, and the resulting salt + */ +export declare function genSalt(callback: Callback<string>): void; + +/** + * Asynchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @param callback Callback receiving the error, if any, and the resulting salt + */ +export declare function genSalt( + rounds: number, + callback: Callback<string>, +): void; + +/** + * Synchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use, default to 10 + * @return Resulting hash + */ +export declare function hashSync( + password: string, + salt?: number | string, +): string; + +/** + * Asynchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use + * @return Promise with resulting hash, if callback has been omitted + */ +export declare function hash( + password: string, + salt: number | string, +): Promise<string>; + +/** + * Asynchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use + * @param callback Callback receiving the error, if any, and the resulting hash + * @param progressCallback Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per MAX_EXECUTION_TIME = 100 ms. + */ +export declare function hash( + password: string, + salt: number | string, + callback?: Callback<string>, + progressCallback?: ProgressCallback, +): void; + +/** + * Synchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @return true if matching, otherwise false + */ +export declare function compareSync(password: string, hash: string): boolean; + +/** + * Asynchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @return Promise, if callback has been omitted + */ +export declare function compare( + password: string, + hash: string, +): Promise<boolean>; + +/** + * Asynchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @param callback Callback receiving the error, if any, otherwise the result + * @param progressCallback Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per MAX_EXECUTION_TIME = 100 ms. + */ +export declare function compare( + password: string, + hash: string, + callback?: Callback<boolean>, + progressCallback?: ProgressCallback, +): void; + +/** + * Gets the number of rounds used to encrypt the specified hash. + * @param hash Hash to extract the used number of rounds from + * @return Number of rounds used + */ +export declare function getRounds(hash: string): number; + +/** + * Gets the salt portion from a hash. Does not validate the hash. + * @param hash Hash to extract the salt from + * @return Extracted salt part + */ +export declare function getSalt(hash: string): string; + +/** + * Tests if a password will be truncated when hashed, that is its length is + * greater than 72 bytes when converted to UTF-8. + * @param password The password to test + * @returns `true` if truncated, otherwise `false` + */ +export declare function truncates(password: string): boolean; + +/** + * Encodes a byte array to base64 with up to len bytes of input, using the custom bcrypt alphabet. + * @function + * @param b Byte array + * @param len Maximum input length + */ +export declare function encodeBase64( + b: Readonly<ArrayLike<number>>, + len: number, +): string; + +/** + * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet. + * @function + * @param s String to decode + * @param len Maximum output length + */ +export declare function decodeBase64(s: string, len: number): number[]; diff --git a/node_modules/bcryptjs/umd/index.d.ts b/node_modules/bcryptjs/umd/index.d.ts new file mode 100644 index 0000000..8c2eb07 --- /dev/null +++ b/node_modules/bcryptjs/umd/index.d.ts @@ -0,0 +1,3 @@ +import * as bcrypt from "./types.js"; +export = bcrypt; +export as namespace bcrypt; diff --git a/node_modules/bcryptjs/umd/index.js b/node_modules/bcryptjs/umd/index.js new file mode 100644 index 0000000..50f716a --- /dev/null +++ b/node_modules/bcryptjs/umd/index.js @@ -0,0 +1,1221 @@ +// GENERATED FILE. DO NOT EDIT. +(function (global, factory) { + function preferDefault(exports) { + return exports.default || exports; + } + if (typeof define === "function" && define.amd) { + define(["crypto"], function (_crypto) { + var exports = {}; + factory(exports, _crypto); + return preferDefault(exports); + }); + } else if (typeof exports === "object") { + factory(exports, require("crypto")); + if (typeof module === "object") module.exports = preferDefault(exports); + } else { + (function () { + var exports = {}; + factory(exports, global.crypto); + global.bcrypt = preferDefault(exports); + })(); + } +})( + typeof globalThis !== "undefined" + ? globalThis + : typeof self !== "undefined" + ? self + : this, + function (_exports, _crypto) { + "use strict"; + + Object.defineProperty(_exports, "__esModule", { + value: true, + }); + _exports.compare = compare; + _exports.compareSync = compareSync; + _exports.decodeBase64 = decodeBase64; + _exports.default = void 0; + _exports.encodeBase64 = encodeBase64; + _exports.genSalt = genSalt; + _exports.genSaltSync = genSaltSync; + _exports.getRounds = getRounds; + _exports.getSalt = getSalt; + _exports.hash = hash; + _exports.hashSync = hashSync; + _exports.setRandomFallback = setRandomFallback; + _exports.truncates = truncates; + _crypto = _interopRequireDefault(_crypto); + function _interopRequireDefault(e) { + return e && e.__esModule ? e : { default: e }; + } + /* + Copyright (c) 2012 Nevins Bartolomeo <nevins.bartolomeo@gmail.com> + Copyright (c) 2012 Shane Girish <shaneGirish@gmail.com> + Copyright (c) 2025 Daniel Wirtz <dcode@dcode.io> + + Redistribution and use in source and binary forms, with or without + modification, are permitted provided that the following conditions + are met: + 1. Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + 2. Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + 3. The name of the author may not be used to endorse or promote products + derived from this software without specific prior written permission. + + THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR + IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES + OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. + IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT, + INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT + NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF + THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + + // The Node.js crypto module is used as a fallback for the Web Crypto API. When + // building for the browser, inclusion of the crypto module should be disabled, + // which the package hints at in its package.json for bundlers that support it. + + /** + * The random implementation to use as a fallback. + * @type {?function(number):!Array.<number>} + * @inner + */ + var randomFallback = null; + + /** + * Generates cryptographically secure random bytes. + * @function + * @param {number} len Bytes length + * @returns {!Array.<number>} Random bytes + * @throws {Error} If no random implementation is available + * @inner + */ + function randomBytes(len) { + // Web Crypto API. Globally available in the browser and in Node.js >=23. + try { + return crypto.getRandomValues(new Uint8Array(len)); + } catch {} + // Node.js crypto module for non-browser environments. + try { + return _crypto.default.randomBytes(len); + } catch {} + // Custom fallback specified with `setRandomFallback`. + if (!randomFallback) { + throw Error( + "Neither WebCryptoAPI nor a crypto module is available. Use bcrypt.setRandomFallback to set an alternative", + ); + } + return randomFallback(len); + } + + /** + * Sets the pseudo random number generator to use as a fallback if neither node's `crypto` module nor the Web Crypto + * API is available. Please note: It is highly important that the PRNG used is cryptographically secure and that it + * is seeded properly! + * @param {?function(number):!Array.<number>} random Function taking the number of bytes to generate as its + * sole argument, returning the corresponding array of cryptographically secure random byte values. + * @see http://nodejs.org/api/crypto.html + * @see http://www.w3.org/TR/WebCryptoAPI/ + */ + function setRandomFallback(random) { + randomFallback = random; + } + + /** + * Synchronously generates a salt. + * @param {number=} rounds Number of rounds to use, defaults to 10 if omitted + * @param {number=} seed_length Not supported. + * @returns {string} Resulting salt + * @throws {Error} If a random fallback is required but not set + */ + function genSaltSync(rounds, seed_length) { + rounds = rounds || GENSALT_DEFAULT_LOG2_ROUNDS; + if (typeof rounds !== "number") + throw Error( + "Illegal arguments: " + typeof rounds + ", " + typeof seed_length, + ); + if (rounds < 4) rounds = 4; + else if (rounds > 31) rounds = 31; + var salt = []; + salt.push("$2b$"); + if (rounds < 10) salt.push("0"); + salt.push(rounds.toString()); + salt.push("$"); + salt.push(base64_encode(randomBytes(BCRYPT_SALT_LEN), BCRYPT_SALT_LEN)); // May throw + return salt.join(""); + } + + /** + * Asynchronously generates a salt. + * @param {(number|function(Error, string=))=} rounds Number of rounds to use, defaults to 10 if omitted + * @param {(number|function(Error, string=))=} seed_length Not supported. + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting salt + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ + function genSalt(rounds, seed_length, callback) { + if (typeof seed_length === "function") + (callback = seed_length), (seed_length = undefined); // Not supported. + if (typeof rounds === "function") + (callback = rounds), (rounds = undefined); + if (typeof rounds === "undefined") rounds = GENSALT_DEFAULT_LOG2_ROUNDS; + else if (typeof rounds !== "number") + throw Error("illegal arguments: " + typeof rounds); + function _async(callback) { + nextTick(function () { + // Pretty thin, but salting is fast enough + try { + callback(null, genSaltSync(rounds)); + } catch (err) { + callback(err); + } + }); + } + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); + } + + /** + * Synchronously generates a hash for the given password. + * @param {string} password Password to hash + * @param {(number|string)=} salt Salt length to generate or salt to use, default to 10 + * @returns {string} Resulting hash + */ + function hashSync(password, salt) { + if (typeof salt === "undefined") salt = GENSALT_DEFAULT_LOG2_ROUNDS; + if (typeof salt === "number") salt = genSaltSync(salt); + if (typeof password !== "string" || typeof salt !== "string") + throw Error( + "Illegal arguments: " + typeof password + ", " + typeof salt, + ); + return _hash(password, salt); + } + + /** + * Asynchronously generates a hash for the given password. + * @param {string} password Password to hash + * @param {number|string} salt Salt length to generate or salt to use + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash + * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed + * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ + function hash(password, salt, callback, progressCallback) { + function _async(callback) { + if (typeof password === "string" && typeof salt === "number") + genSalt(salt, function (err, salt) { + _hash(password, salt, callback, progressCallback); + }); + else if (typeof password === "string" && typeof salt === "string") + _hash(password, salt, callback, progressCallback); + else + nextTick( + callback.bind( + this, + Error( + "Illegal arguments: " + typeof password + ", " + typeof salt, + ), + ), + ); + } + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); + } + + /** + * Compares two strings of the same length in constant time. + * @param {string} known Must be of the correct length + * @param {string} unknown Must be the same length as `known` + * @returns {boolean} + * @inner + */ + function safeStringCompare(known, unknown) { + var diff = known.length ^ unknown.length; + for (var i = 0; i < known.length; ++i) { + diff |= known.charCodeAt(i) ^ unknown.charCodeAt(i); + } + return diff === 0; + } + + /** + * Synchronously tests a password against a hash. + * @param {string} password Password to compare + * @param {string} hash Hash to test against + * @returns {boolean} true if matching, otherwise false + * @throws {Error} If an argument is illegal + */ + function compareSync(password, hash) { + if (typeof password !== "string" || typeof hash !== "string") + throw Error( + "Illegal arguments: " + typeof password + ", " + typeof hash, + ); + if (hash.length !== 60) return false; + return safeStringCompare( + hashSync(password, hash.substring(0, hash.length - 31)), + hash, + ); + } + + /** + * Asynchronously tests a password against a hash. + * @param {string} password Password to compare + * @param {string} hashValue Hash to test against + * @param {function(Error, boolean)=} callback Callback receiving the error, if any, otherwise the result + * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed + * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. + * @returns {!Promise} If `callback` has been omitted + * @throws {Error} If `callback` is present but not a function + */ + function compare(password, hashValue, callback, progressCallback) { + function _async(callback) { + if (typeof password !== "string" || typeof hashValue !== "string") { + nextTick( + callback.bind( + this, + Error( + "Illegal arguments: " + + typeof password + + ", " + + typeof hashValue, + ), + ), + ); + return; + } + if (hashValue.length !== 60) { + nextTick(callback.bind(this, null, false)); + return; + } + hash( + password, + hashValue.substring(0, 29), + function (err, comp) { + if (err) callback(err); + else callback(null, safeStringCompare(comp, hashValue)); + }, + progressCallback, + ); + } + if (callback) { + if (typeof callback !== "function") + throw Error("Illegal callback: " + typeof callback); + _async(callback); + } else + return new Promise(function (resolve, reject) { + _async(function (err, res) { + if (err) { + reject(err); + return; + } + resolve(res); + }); + }); + } + + /** + * Gets the number of rounds used to encrypt the specified hash. + * @param {string} hash Hash to extract the used number of rounds from + * @returns {number} Number of rounds used + * @throws {Error} If `hash` is not a string + */ + function getRounds(hash) { + if (typeof hash !== "string") + throw Error("Illegal arguments: " + typeof hash); + return parseInt(hash.split("$")[2], 10); + } + + /** + * Gets the salt portion from a hash. Does not validate the hash. + * @param {string} hash Hash to extract the salt from + * @returns {string} Extracted salt part + * @throws {Error} If `hash` is not a string or otherwise invalid + */ + function getSalt(hash) { + if (typeof hash !== "string") + throw Error("Illegal arguments: " + typeof hash); + if (hash.length !== 60) + throw Error("Illegal hash length: " + hash.length + " != 60"); + return hash.substring(0, 29); + } + + /** + * Tests if a password will be truncated when hashed, that is its length is + * greater than 72 bytes when converted to UTF-8. + * @param {string} password The password to test + * @returns {boolean} `true` if truncated, otherwise `false` + */ + function truncates(password) { + if (typeof password !== "string") + throw Error("Illegal arguments: " + typeof password); + return utf8Length(password) > 72; + } + + /** + * Continues with the callback on the next tick. + * @function + * @param {function(...[*])} callback Callback to execute + * @inner + */ + var nextTick = + typeof process !== "undefined" && + process && + typeof process.nextTick === "function" + ? typeof setImmediate === "function" + ? setImmediate + : process.nextTick + : setTimeout; + + /** Calculates the byte length of a string encoded as UTF8. */ + function utf8Length(string) { + var len = 0, + c = 0; + for (var i = 0; i < string.length; ++i) { + c = string.charCodeAt(i); + if (c < 128) len += 1; + else if (c < 2048) len += 2; + else if ( + (c & 0xfc00) === 0xd800 && + (string.charCodeAt(i + 1) & 0xfc00) === 0xdc00 + ) { + ++i; + len += 4; + } else len += 3; + } + return len; + } + + /** Converts a string to an array of UTF8 bytes. */ + function utf8Array(string) { + var offset = 0, + c1, + c2; + var buffer = new Array(utf8Length(string)); + for (var i = 0, k = string.length; i < k; ++i) { + c1 = string.charCodeAt(i); + if (c1 < 128) { + buffer[offset++] = c1; + } else if (c1 < 2048) { + buffer[offset++] = (c1 >> 6) | 192; + buffer[offset++] = (c1 & 63) | 128; + } else if ( + (c1 & 0xfc00) === 0xd800 && + ((c2 = string.charCodeAt(i + 1)) & 0xfc00) === 0xdc00 + ) { + c1 = 0x10000 + ((c1 & 0x03ff) << 10) + (c2 & 0x03ff); + ++i; + buffer[offset++] = (c1 >> 18) | 240; + buffer[offset++] = ((c1 >> 12) & 63) | 128; + buffer[offset++] = ((c1 >> 6) & 63) | 128; + buffer[offset++] = (c1 & 63) | 128; + } else { + buffer[offset++] = (c1 >> 12) | 224; + buffer[offset++] = ((c1 >> 6) & 63) | 128; + buffer[offset++] = (c1 & 63) | 128; + } + } + return buffer; + } + + // A base64 implementation for the bcrypt algorithm. This is partly non-standard. + + /** + * bcrypt's own non-standard base64 dictionary. + * @type {!Array.<string>} + * @const + * @inner + **/ + var BASE64_CODE = + "./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789".split( + "", + ); + + /** + * @type {!Array.<number>} + * @const + * @inner + **/ + var BASE64_INDEX = [ + -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, + -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, + -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 0, 1, 54, 55, 56, 57, 58, 59, 60, + 61, 62, 63, -1, -1, -1, -1, -1, -1, -1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, + 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, -1, -1, + -1, -1, -1, -1, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, + 42, 43, 44, 45, 46, 47, 48, 49, 50, 51, 52, 53, -1, -1, -1, -1, -1, + ]; + + /** + * Encodes a byte array to base64 with up to len bytes of input. + * @param {!Array.<number>} b Byte array + * @param {number} len Maximum input length + * @returns {string} + * @inner + */ + function base64_encode(b, len) { + var off = 0, + rs = [], + c1, + c2; + if (len <= 0 || len > b.length) throw Error("Illegal len: " + len); + while (off < len) { + c1 = b[off++] & 0xff; + rs.push(BASE64_CODE[(c1 >> 2) & 0x3f]); + c1 = (c1 & 0x03) << 4; + if (off >= len) { + rs.push(BASE64_CODE[c1 & 0x3f]); + break; + } + c2 = b[off++] & 0xff; + c1 |= (c2 >> 4) & 0x0f; + rs.push(BASE64_CODE[c1 & 0x3f]); + c1 = (c2 & 0x0f) << 2; + if (off >= len) { + rs.push(BASE64_CODE[c1 & 0x3f]); + break; + } + c2 = b[off++] & 0xff; + c1 |= (c2 >> 6) & 0x03; + rs.push(BASE64_CODE[c1 & 0x3f]); + rs.push(BASE64_CODE[c2 & 0x3f]); + } + return rs.join(""); + } + + /** + * Decodes a base64 encoded string to up to len bytes of output. + * @param {string} s String to decode + * @param {number} len Maximum output length + * @returns {!Array.<number>} + * @inner + */ + function base64_decode(s, len) { + var off = 0, + slen = s.length, + olen = 0, + rs = [], + c1, + c2, + c3, + c4, + o, + code; + if (len <= 0) throw Error("Illegal len: " + len); + while (off < slen - 1 && olen < len) { + code = s.charCodeAt(off++); + c1 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + code = s.charCodeAt(off++); + c2 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + if (c1 == -1 || c2 == -1) break; + o = (c1 << 2) >>> 0; + o |= (c2 & 0x30) >> 4; + rs.push(String.fromCharCode(o)); + if (++olen >= len || off >= slen) break; + code = s.charCodeAt(off++); + c3 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + if (c3 == -1) break; + o = ((c2 & 0x0f) << 4) >>> 0; + o |= (c3 & 0x3c) >> 2; + rs.push(String.fromCharCode(o)); + if (++olen >= len || off >= slen) break; + code = s.charCodeAt(off++); + c4 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1; + o = ((c3 & 0x03) << 6) >>> 0; + o |= c4; + rs.push(String.fromCharCode(o)); + ++olen; + } + var res = []; + for (off = 0; off < olen; off++) res.push(rs[off].charCodeAt(0)); + return res; + } + + /** + * @type {number} + * @const + * @inner + */ + var BCRYPT_SALT_LEN = 16; + + /** + * @type {number} + * @const + * @inner + */ + var GENSALT_DEFAULT_LOG2_ROUNDS = 10; + + /** + * @type {number} + * @const + * @inner + */ + var BLOWFISH_NUM_ROUNDS = 16; + + /** + * @type {number} + * @const + * @inner + */ + var MAX_EXECUTION_TIME = 100; + + /** + * @type {Array.<number>} + * @const + * @inner + */ + var P_ORIG = [ + 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, 0xa4093822, 0x299f31d0, + 0x082efa98, 0xec4e6c89, 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c, + 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917, 0x9216d5d9, 0x8979fb1b, + ]; + + /** + * @type {Array.<number>} + * @const + * @inner + */ + var S_ORIG = [ + 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, 0xb8e1afed, 0x6a267e96, + 0xba7c9045, 0xf12c7f99, 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16, + 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e, 0x0d95748f, 0x728eb658, + 0x718bcd58, 0x82154aee, 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, + 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef, 0x8e79dcb0, 0x603a180e, + 0x6c9e0e8b, 0xb01e8a3e, 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60, + 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440, 0x55ca396a, 0x2aab10b6, + 0xb4cc5c34, 0x1141e8ce, 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a, + 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e, 0xafd6ba33, 0x6c24cf5c, + 0x7a325381, 0x28958677, 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193, + 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, 0xef845d5d, 0xe98575b1, + 0xdc262302, 0xeb651b88, 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239, + 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e, 0x21c66842, 0xf6e96c9a, + 0x670c9c61, 0xabd388f0, 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, + 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98, 0xa1f1651d, 0x39af0176, + 0x66ca593e, 0x82430e88, 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe, + 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6, 0x4ed3aa62, 0x363f7706, + 0x1bfedf72, 0x429b023d, 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b, + 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7, 0xe3fe501a, 0xb6794c3b, + 0x976ce0bd, 0x04c006ba, 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463, + 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, 0x6dfc511f, 0x9b30952c, + 0xcc814544, 0xaf5ebd09, 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3, + 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb, 0x5579c0bd, 0x1a60320a, + 0xd6a100c6, 0x402c7279, 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, + 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab, 0x323db5fa, 0xfd238760, + 0x53317b48, 0x3e00df82, 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db, + 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573, 0x695b27b0, 0xbbca58c8, + 0xe1ffa35d, 0xb8f011a0, 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, + 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790, 0xe1ddf2da, 0xa4cb7e33, + 0x62fb1341, 0xcee4c6e8, 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4, + 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, 0xd08ed1d0, 0xafc725e0, + 0x8e3c5b2f, 0x8e7594b7, 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c, + 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad, 0x2f2f2218, 0xbe0e1777, + 0xea752dfe, 0x8b021fa1, 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, + 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, 0x165fa266, 0x80957705, + 0x93cc7314, 0x211a1477, 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf, + 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49, 0x00250e2d, 0x2071b35e, + 0x226800bb, 0x57b8e0af, 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa, + 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5, 0x83260376, 0x6295cfa9, + 0x11c81968, 0x4e734a41, 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915, + 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, 0x08ba6fb5, 0x571be91f, + 0xf296ec6b, 0x2a0dd915, 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664, + 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a, 0x4b7a70e9, 0xb5b32944, + 0xdb75092e, 0xc4192623, 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, + 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1, 0x193602a5, 0x75094c29, + 0xa0591340, 0xe4183a3e, 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6, + 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1, 0x4cdd2086, 0x8470eb26, + 0x6382e9c6, 0x021ecc5e, 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, + 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737, 0x3e07841c, 0x7fdeae5c, + 0x8e7d44ec, 0x5716f2b8, 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff, + 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, 0xd19113f9, 0x7ca92ff6, + 0x94324773, 0x22f54701, 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7, + 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41, 0xe238cd99, 0x3bea0e2f, + 0x3280bba1, 0x183eb331, 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, + 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af, 0xde9a771f, 0xd9930810, + 0xb38bae12, 0xdccf3f2e, 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87, + 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c, 0xec7aec3a, 0xdb851dfa, + 0x63094366, 0xc464c3d2, 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16, + 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd, 0x71dff89e, 0x10314e55, + 0x81ac77d6, 0x5f11199b, 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509, + 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, 0x86e34570, 0xeae96fb1, + 0x860e5e0a, 0x5a3e2ab3, 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f, + 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a, 0xc6150eba, 0x94e2ea78, + 0xa5fc3c53, 0x1e0a2df4, 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, + 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66, 0xe3bc4595, 0xa67bc883, + 0xb17f37d1, 0x018cff28, 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802, + 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84, 0x1521b628, 0x29076170, + 0xecdd4775, 0x619f1510, 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, + 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14, 0xeecc86bc, 0x60622ca7, + 0x9cab5cab, 0xb2f3846e, 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50, + 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, 0x9b540b19, 0x875fa099, + 0x95f7997e, 0x623d7da8, 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281, + 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99, 0x57f584a5, 0x1b227263, + 0x9b83c3ff, 0x1ac24696, 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, + 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, 0x5d4a14d9, 0xe864b7e3, + 0x42105d14, 0x203e13e0, 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0, + 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105, 0xd81e799e, 0x86854dc7, + 0xe44b476a, 0x3d816250, 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, + 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285, 0x095bbf00, 0xad19489d, + 0x1462b174, 0x23820e00, 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061, + 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, 0x7cde3759, 0xcbee7460, + 0x4085f2a7, 0xce77326e, 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735, + 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc, 0x9e447a2e, 0xc3453484, + 0xfdd56705, 0x0e1e9ec9, 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, + 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20, 0x153e21e7, 0x8fb03d4a, + 0xe6e39f2b, 0xdb83adf7, 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934, + 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068, 0xd4082471, 0x3320f46a, + 0x43b7d4b7, 0x500061af, 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840, + 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45, 0xbfbc09ec, 0x03bd9785, + 0x7fac6dd0, 0x31cb8504, 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a, + 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, 0x68dc1462, 0xd7486900, + 0x680ec0a4, 0x27a18dee, 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6, + 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42, 0x20fe9e35, 0xd9f385b9, + 0xee39d7ab, 0x3b124e8b, 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, + 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb, 0xfb0af54e, 0xd8feb397, + 0x454056ac, 0xba489527, 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b, + 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33, 0xa62a4a56, 0x3f3125f9, + 0x5ef47e1c, 0x9029317c, 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3, + 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc, 0x07f9c9ee, 0x41041f0f, + 0x404779a4, 0x5d886e17, 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564, + 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, 0x0e12b4c2, 0x02e1329e, + 0xaf664fd1, 0xcad18115, 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922, + 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728, 0xd0127845, 0x95b794fd, + 0x647d0862, 0xe7ccf5f0, 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, + 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, 0xa812dc60, 0xa1ebddf8, + 0x991be14c, 0xdb6e6b0d, 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804, + 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b, 0x667b9ffb, 0xcedb7d9c, + 0xa091cf0b, 0xd9155ea3, 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb, + 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d, 0x6842ada7, 0xc66a2b3b, + 0x12754ccc, 0x782ef11c, 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350, + 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, 0x44421659, 0x0a121386, + 0xd90cec6e, 0xd5abea2a, 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe, + 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d, 0xd1fd8346, 0xf6381fb0, + 0x7745ae04, 0xd736fccc, 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, + 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61, 0x4e58f48f, 0xf2ddfda2, + 0xf474ef38, 0x8789bdc2, 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9, + 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2, 0x466e598e, 0x20b45770, + 0x8cd55591, 0xc902de4c, 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e, + 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633, 0xe85a1f02, 0x09f0be8c, + 0x4a99a025, 0x1d6efe10, 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169, + 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, 0x50115e01, 0xa70683fa, + 0xa002b5c4, 0x0de6d027, 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5, + 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62, 0x11e69ed7, 0x2338ea63, + 0x53c2dd94, 0xc2c21634, 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, + 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24, 0x86e3725f, 0x724d9db9, + 0x1ac15bb4, 0xd39eb8fc, 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4, + 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c, 0x6fd5c7e7, 0x56e14ec4, + 0x362abfce, 0xddc6c837, 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0, + 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b, 0x5cb0679e, 0x4fa33742, + 0xd3822740, 0x99bc9bbe, 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b, + 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, 0x5748ab2f, 0xbc946e79, + 0xc6a376d2, 0x6549c2c8, 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6, + 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304, 0xa1fad5f0, 0x6a2d519a, + 0x63ef8ce2, 0x9a86ee22, 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, + 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6, 0x2826a2f9, 0xa73a3ae1, + 0x4ba99586, 0xef5562e9, 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59, + 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593, 0xe990fd5a, 0x9e34d797, + 0x2cf0b7d9, 0x022b8b51, 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, + 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c, 0xe029ac71, 0xe019a5e6, + 0x47b0acfd, 0xed93fa9b, 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28, + 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, 0x15056dd4, 0x88f46dba, + 0x03a16125, 0x0564f0bd, 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a, + 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319, 0x7533d928, 0xb155fdf5, + 0x03563482, 0x8aba3cbb, 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, + 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991, 0xea7a90c2, 0xfb3e7bce, + 0x5121ce64, 0x774fbe32, 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680, + 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166, 0xb39a460a, 0x6445c0dd, + 0x586cdecf, 0x1c20c8ae, 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, + 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5, 0x72eacea8, 0xfa6484bb, + 0x8d6612ae, 0xbf3c6f47, 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370, + 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, 0x4040cb08, 0x4eb4e2cc, + 0x34d2466a, 0x0115af84, 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048, + 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8, 0x611560b1, 0xe7933fdc, + 0xbb3a792b, 0x344525bd, 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, + 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, 0x1a908749, 0xd44fbd9a, + 0xd0dadecb, 0xd50ada38, 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f, + 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c, 0xbf97222c, 0x15e6fc2a, + 0x0f91fc71, 0x9b941525, 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1, + 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442, 0xe0ec6e0e, 0x1698db3b, + 0x4c98a0be, 0x3278e964, 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e, + 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, 0xdf359f8d, 0x9b992f2e, + 0xe60b6f47, 0x0fe3f11d, 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f, + 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299, 0xf523f357, 0xa6327623, + 0x93a83531, 0x56cccd02, 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, + 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614, 0xe6c6c7bd, 0x327a140a, + 0x45e1d006, 0xc3f27b9a, 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6, + 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b, 0x53113ec0, 0x1640e3d3, + 0x38abbd60, 0x2547adf0, 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060, + 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e, 0x1948c25c, 0x02fb8a8c, + 0x01c36ae4, 0xd6ebe1f9, 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f, + 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6, + ]; + + /** + * @type {Array.<number>} + * @const + * @inner + */ + var C_ORIG = [ + 0x4f727068, 0x65616e42, 0x65686f6c, 0x64657253, 0x63727944, 0x6f756274, + ]; + + /** + * @param {Array.<number>} lr + * @param {number} off + * @param {Array.<number>} P + * @param {Array.<number>} S + * @returns {Array.<number>} + * @inner + */ + function _encipher(lr, off, P, S) { + // This is our bottleneck: 1714/1905 ticks / 90% - see profile.txt + var n, + l = lr[off], + r = lr[off + 1]; + l ^= P[0]; + + /* + for (var i=0, k=BLOWFISH_NUM_ROUNDS-2; i<=k;) + // Feistel substitution on left word + n = S[l >>> 24], + n += S[0x100 | ((l >> 16) & 0xff)], + n ^= S[0x200 | ((l >> 8) & 0xff)], + n += S[0x300 | (l & 0xff)], + r ^= n ^ P[++i], + // Feistel substitution on right word + n = S[r >>> 24], + n += S[0x100 | ((r >> 16) & 0xff)], + n ^= S[0x200 | ((r >> 8) & 0xff)], + n += S[0x300 | (r & 0xff)], + l ^= n ^ P[++i]; + */ + + //The following is an unrolled version of the above loop. + //Iteration 0 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[1]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[2]; + //Iteration 1 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[3]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[4]; + //Iteration 2 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[5]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[6]; + //Iteration 3 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[7]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[8]; + //Iteration 4 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[9]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[10]; + //Iteration 5 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[11]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[12]; + //Iteration 6 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[13]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[14]; + //Iteration 7 + n = S[l >>> 24]; + n += S[0x100 | ((l >> 16) & 0xff)]; + n ^= S[0x200 | ((l >> 8) & 0xff)]; + n += S[0x300 | (l & 0xff)]; + r ^= n ^ P[15]; + n = S[r >>> 24]; + n += S[0x100 | ((r >> 16) & 0xff)]; + n ^= S[0x200 | ((r >> 8) & 0xff)]; + n += S[0x300 | (r & 0xff)]; + l ^= n ^ P[16]; + lr[off] = r ^ P[BLOWFISH_NUM_ROUNDS + 1]; + lr[off + 1] = l; + return lr; + } + + /** + * @param {Array.<number>} data + * @param {number} offp + * @returns {{key: number, offp: number}} + * @inner + */ + function _streamtoword(data, offp) { + for (var i = 0, word = 0; i < 4; ++i) + (word = (word << 8) | (data[offp] & 0xff)), + (offp = (offp + 1) % data.length); + return { + key: word, + offp: offp, + }; + } + + /** + * @param {Array.<number>} key + * @param {Array.<number>} P + * @param {Array.<number>} S + * @inner + */ + function _key(key, P, S) { + var offset = 0, + lr = [0, 0], + plen = P.length, + slen = S.length, + sw; + for (var i = 0; i < plen; i++) + (sw = _streamtoword(key, offset)), + (offset = sw.offp), + (P[i] = P[i] ^ sw.key); + for (i = 0; i < plen; i += 2) + (lr = _encipher(lr, 0, P, S)), (P[i] = lr[0]), (P[i + 1] = lr[1]); + for (i = 0; i < slen; i += 2) + (lr = _encipher(lr, 0, P, S)), (S[i] = lr[0]), (S[i + 1] = lr[1]); + } + + /** + * Expensive key schedule Blowfish. + * @param {Array.<number>} data + * @param {Array.<number>} key + * @param {Array.<number>} P + * @param {Array.<number>} S + * @inner + */ + function _ekskey(data, key, P, S) { + var offp = 0, + lr = [0, 0], + plen = P.length, + slen = S.length, + sw; + for (var i = 0; i < plen; i++) + (sw = _streamtoword(key, offp)), + (offp = sw.offp), + (P[i] = P[i] ^ sw.key); + offp = 0; + for (i = 0; i < plen; i += 2) + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[0] ^= sw.key), + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[1] ^= sw.key), + (lr = _encipher(lr, 0, P, S)), + (P[i] = lr[0]), + (P[i + 1] = lr[1]); + for (i = 0; i < slen; i += 2) + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[0] ^= sw.key), + (sw = _streamtoword(data, offp)), + (offp = sw.offp), + (lr[1] ^= sw.key), + (lr = _encipher(lr, 0, P, S)), + (S[i] = lr[0]), + (S[i + 1] = lr[1]); + } + + /** + * Internaly crypts a string. + * @param {Array.<number>} b Bytes to crypt + * @param {Array.<number>} salt Salt bytes to use + * @param {number} rounds Number of rounds + * @param {function(Error, Array.<number>=)=} callback Callback receiving the error, if any, and the resulting bytes. If + * omitted, the operation will be performed synchronously. + * @param {function(number)=} progressCallback Callback called with the current progress + * @returns {!Array.<number>|undefined} Resulting bytes if callback has been omitted, otherwise `undefined` + * @inner + */ + function _crypt(b, salt, rounds, callback, progressCallback) { + var cdata = C_ORIG.slice(), + clen = cdata.length, + err; + + // Validate + if (rounds < 4 || rounds > 31) { + err = Error("Illegal number of rounds (4-31): " + rounds); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + if (salt.length !== BCRYPT_SALT_LEN) { + err = Error( + "Illegal salt length: " + salt.length + " != " + BCRYPT_SALT_LEN, + ); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + rounds = (1 << rounds) >>> 0; + var P, + S, + i = 0, + j; + + //Use typed arrays when available - huge speedup! + if (typeof Int32Array === "function") { + P = new Int32Array(P_ORIG); + S = new Int32Array(S_ORIG); + } else { + P = P_ORIG.slice(); + S = S_ORIG.slice(); + } + _ekskey(salt, b, P, S); + + /** + * Calcualtes the next round. + * @returns {Array.<number>|undefined} Resulting array if callback has been omitted, otherwise `undefined` + * @inner + */ + function next() { + if (progressCallback) progressCallback(i / rounds); + if (i < rounds) { + var start = Date.now(); + for (; i < rounds; ) { + i = i + 1; + _key(b, P, S); + _key(salt, P, S); + if (Date.now() - start > MAX_EXECUTION_TIME) break; + } + } else { + for (i = 0; i < 64; i++) + for (j = 0; j < clen >> 1; j++) _encipher(cdata, j << 1, P, S); + var ret = []; + for (i = 0; i < clen; i++) + ret.push(((cdata[i] >> 24) & 0xff) >>> 0), + ret.push(((cdata[i] >> 16) & 0xff) >>> 0), + ret.push(((cdata[i] >> 8) & 0xff) >>> 0), + ret.push((cdata[i] & 0xff) >>> 0); + if (callback) { + callback(null, ret); + return; + } else return ret; + } + if (callback) nextTick(next); + } + + // Async + if (typeof callback !== "undefined") { + next(); + + // Sync + } else { + var res; + while (true) + if (typeof (res = next()) !== "undefined") return res || []; + } + } + + /** + * Internally hashes a password. + * @param {string} password Password to hash + * @param {?string} salt Salt to use, actually never null + * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash. If omitted, + * hashing is performed synchronously. + * @param {function(number)=} progressCallback Callback called with the current progress + * @returns {string|undefined} Resulting hash if callback has been omitted, otherwise `undefined` + * @inner + */ + function _hash(password, salt, callback, progressCallback) { + var err; + if (typeof password !== "string" || typeof salt !== "string") { + err = Error("Invalid string / salt: Not a string"); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + + // Validate the salt + var minor, offset; + if (salt.charAt(0) !== "$" || salt.charAt(1) !== "2") { + err = Error("Invalid salt version: " + salt.substring(0, 2)); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + if (salt.charAt(2) === "$") + (minor = String.fromCharCode(0)), (offset = 3); + else { + minor = salt.charAt(2); + if ( + (minor !== "a" && minor !== "b" && minor !== "y") || + salt.charAt(3) !== "$" + ) { + err = Error("Invalid salt revision: " + salt.substring(2, 4)); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + offset = 4; + } + + // Extract number of rounds + if (salt.charAt(offset + 2) > "$") { + err = Error("Missing salt rounds"); + if (callback) { + nextTick(callback.bind(this, err)); + return; + } else throw err; + } + var r1 = parseInt(salt.substring(offset, offset + 1), 10) * 10, + r2 = parseInt(salt.substring(offset + 1, offset + 2), 10), + rounds = r1 + r2, + real_salt = salt.substring(offset + 3, offset + 25); + password += minor >= "a" ? "\x00" : ""; + var passwordb = utf8Array(password), + saltb = base64_decode(real_salt, BCRYPT_SALT_LEN); + + /** + * Finishes hashing. + * @param {Array.<number>} bytes Byte array + * @returns {string} + * @inner + */ + function finish(bytes) { + var res = []; + res.push("$2"); + if (minor >= "a") res.push(minor); + res.push("$"); + if (rounds < 10) res.push("0"); + res.push(rounds.toString()); + res.push("$"); + res.push(base64_encode(saltb, saltb.length)); + res.push(base64_encode(bytes, C_ORIG.length * 4 - 1)); + return res.join(""); + } + + // Sync + if (typeof callback == "undefined") + return finish(_crypt(passwordb, saltb, rounds)); + // Async + else { + _crypt( + passwordb, + saltb, + rounds, + function (err, bytes) { + if (err) callback(err, null); + else callback(null, finish(bytes)); + }, + progressCallback, + ); + } + } + + /** + * Encodes a byte array to base64 with up to len bytes of input, using the custom bcrypt alphabet. + * @function + * @param {!Array.<number>} bytes Byte array + * @param {number} length Maximum input length + * @returns {string} + */ + function encodeBase64(bytes, length) { + return base64_encode(bytes, length); + } + + /** + * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet. + * @function + * @param {string} string String to decode + * @param {number} length Maximum output length + * @returns {!Array.<number>} + */ + function decodeBase64(string, length) { + return base64_decode(string, length); + } + var _default = (_exports.default = { + setRandomFallback, + genSaltSync, + genSalt, + hashSync, + hash, + compareSync, + compare, + getRounds, + getSalt, + truncates, + encodeBase64, + decodeBase64, + }); + }, +); diff --git a/node_modules/bcryptjs/umd/package.json b/node_modules/bcryptjs/umd/package.json new file mode 100644 index 0000000..5bbefff --- /dev/null +++ b/node_modules/bcryptjs/umd/package.json @@ -0,0 +1,3 @@ +{ + "type": "commonjs" +} diff --git a/node_modules/bcryptjs/umd/types.d.ts b/node_modules/bcryptjs/umd/types.d.ts new file mode 100644 index 0000000..3cbe5b1 --- /dev/null +++ b/node_modules/bcryptjs/umd/types.d.ts @@ -0,0 +1,157 @@ +// Originally imported from https://github.com/DefinitelyTyped/DefinitelyTyped/blob/8b36dbdf95b624b8a7cd7f8416f06c15d274f9e6/types/bcryptjs/index.d.ts +// MIT license. + +/** Called with an error on failure or a value of type `T` upon success. */ +type Callback<T> = (err: Error | null, result?: T) => void; +/** Called with the percentage of rounds completed (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms. */ +type ProgressCallback = (percentage: number) => void; +/** Called to obtain random bytes when both Web Crypto API and Node.js crypto are not available. */ +type RandomFallback = (length: number) => number[]; + +/** + * Sets the pseudo random number generator to use as a fallback if neither node's crypto module nor the Web Crypto API is available. + * Please note: It is highly important that the PRNG used is cryptographically secure and that it is seeded properly! + * @param random Function taking the number of bytes to generate as its sole argument, returning the corresponding array of cryptographically secure random byte values. + */ +export declare function setRandomFallback(random: RandomFallback): void; + +/** + * Synchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @return Resulting salt + * @throws If a random fallback is required but not set + */ +export declare function genSaltSync(rounds?: number): string; + +/** + * Asynchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @return Promise with resulting salt, if callback has been omitted + */ +export declare function genSalt(rounds?: number): Promise<string>; + +/** + * Asynchronously generates a salt. + * @param callback Callback receiving the error, if any, and the resulting salt + */ +export declare function genSalt(callback: Callback<string>): void; + +/** + * Asynchronously generates a salt. + * @param rounds Number of rounds to use, defaults to 10 if omitted + * @param callback Callback receiving the error, if any, and the resulting salt + */ +export declare function genSalt( + rounds: number, + callback: Callback<string>, +): void; + +/** + * Synchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use, default to 10 + * @return Resulting hash + */ +export declare function hashSync( + password: string, + salt?: number | string, +): string; + +/** + * Asynchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use + * @return Promise with resulting hash, if callback has been omitted + */ +export declare function hash( + password: string, + salt: number | string, +): Promise<string>; + +/** + * Asynchronously generates a hash for the given password. + * @param password Password to hash + * @param salt Salt length to generate or salt to use + * @param callback Callback receiving the error, if any, and the resulting hash + * @param progressCallback Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per MAX_EXECUTION_TIME = 100 ms. + */ +export declare function hash( + password: string, + salt: number | string, + callback?: Callback<string>, + progressCallback?: ProgressCallback, +): void; + +/** + * Synchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @return true if matching, otherwise false + */ +export declare function compareSync(password: string, hash: string): boolean; + +/** + * Asynchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @return Promise, if callback has been omitted + */ +export declare function compare( + password: string, + hash: string, +): Promise<boolean>; + +/** + * Asynchronously tests a password against a hash. + * @param password Password to test + * @param hash Hash to test against + * @param callback Callback receiving the error, if any, otherwise the result + * @param progressCallback Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per MAX_EXECUTION_TIME = 100 ms. + */ +export declare function compare( + password: string, + hash: string, + callback?: Callback<boolean>, + progressCallback?: ProgressCallback, +): void; + +/** + * Gets the number of rounds used to encrypt the specified hash. + * @param hash Hash to extract the used number of rounds from + * @return Number of rounds used + */ +export declare function getRounds(hash: string): number; + +/** + * Gets the salt portion from a hash. Does not validate the hash. + * @param hash Hash to extract the salt from + * @return Extracted salt part + */ +export declare function getSalt(hash: string): string; + +/** + * Tests if a password will be truncated when hashed, that is its length is + * greater than 72 bytes when converted to UTF-8. + * @param password The password to test + * @returns `true` if truncated, otherwise `false` + */ +export declare function truncates(password: string): boolean; + +/** + * Encodes a byte array to base64 with up to len bytes of input, using the custom bcrypt alphabet. + * @function + * @param b Byte array + * @param len Maximum input length + */ +export declare function encodeBase64( + b: Readonly<ArrayLike<number>>, + len: number, +): string; + +/** + * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet. + * @function + * @param s String to decode + * @param len Maximum output length + */ +export declare function decodeBase64(s: string, len: number): number[]; diff --git a/node_modules/bn.js/LICENSE b/node_modules/bn.js/LICENSE new file mode 100644 index 0000000..c328f04 --- /dev/null +++ b/node_modules/bn.js/LICENSE @@ -0,0 +1,19 @@ +Copyright Fedor Indutny, 2015. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/bn.js/README.md b/node_modules/bn.js/README.md new file mode 100644 index 0000000..aecc3ba --- /dev/null +++ b/node_modules/bn.js/README.md @@ -0,0 +1,200 @@ +# <img src="./logo.png" alt="bn.js" width="160" height="160" /> + +> BigNum in pure javascript + +[](http://travis-ci.org/indutny/bn.js) + +## Install +`npm install --save bn.js` + +## Usage + +```js +const BN = require('bn.js'); + +var a = new BN('dead', 16); +var b = new BN('101010', 2); + +var res = a.add(b); +console.log(res.toString(10)); // 57047 +``` + +**Note**: decimals are not supported in this library. + +## Notation + +### Prefixes + +There are several prefixes to instructions that affect the way the work. Here +is the list of them in the order of appearance in the function name: + +* `i` - perform operation in-place, storing the result in the host object (on + which the method was invoked). Might be used to avoid number allocation costs +* `u` - unsigned, ignore the sign of operands when performing operation, or + always return positive value. Second case applies to reduction operations + like `mod()`. In such cases if the result will be negative - modulo will be + added to the result to make it positive + +### Postfixes + +The only available postfix at the moment is: + +* `n` - which means that the argument of the function must be a plain JavaScript + Number. Decimals are not supported. + +### Examples + +* `a.iadd(b)` - perform addition on `a` and `b`, storing the result in `a` +* `a.umod(b)` - reduce `a` modulo `b`, returning positive value +* `a.iushln(13)` - shift bits of `a` left by 13 + +## Instructions + +Prefixes/postfixes are put in parens at the of the line. `endian` - could be +either `le` (little-endian) or `be` (big-endian). + +### Utilities + +* `a.clone()` - clone number +* `a.toString(base, length)` - convert to base-string and pad with zeroes +* `a.toNumber()` - convert to Javascript Number (limited to 53 bits) +* `a.toJSON()` - convert to JSON compatible hex string (alias of `toString(16)`) +* `a.toArray(endian, length)` - convert to byte `Array`, and optionally zero + pad to length, throwing if already exceeding +* `a.toArrayLike(type, endian, length)` - convert to an instance of `type`, + which must behave like an `Array` +* `a.toBuffer(endian, length)` - convert to Node.js Buffer (if available). For + compatibility with browserify and similar tools, use this instead: + `a.toArrayLike(Buffer, endian, length)` +* `a.bitLength()` - get number of bits occupied +* `a.zeroBits()` - return number of less-significant consequent zero bits + (example: `1010000` has 4 zero bits) +* `a.byteLength()` - return number of bytes occupied +* `a.isNeg()` - true if the number is negative +* `a.isEven()` - no comments +* `a.isOdd()` - no comments +* `a.isZero()` - no comments +* `a.cmp(b)` - compare numbers and return `-1` (a `<` b), `0` (a `==` b), or `1` (a `>` b) + depending on the comparison result (`ucmp`, `cmpn`) +* `a.lt(b)` - `a` less than `b` (`n`) +* `a.lte(b)` - `a` less than or equals `b` (`n`) +* `a.gt(b)` - `a` greater than `b` (`n`) +* `a.gte(b)` - `a` greater than or equals `b` (`n`) +* `a.eq(b)` - `a` equals `b` (`n`) +* `a.toTwos(width)` - convert to two's complement representation, where `width` is bit width +* `a.fromTwos(width)` - convert from two's complement representation, where `width` is the bit width +* `BN.isBN(object)` - returns true if the supplied `object` is a BN.js instance + +### Arithmetics + +* `a.neg()` - negate sign (`i`) +* `a.abs()` - absolute value (`i`) +* `a.add(b)` - addition (`i`, `n`, `in`) +* `a.sub(b)` - subtraction (`i`, `n`, `in`) +* `a.mul(b)` - multiply (`i`, `n`, `in`) +* `a.sqr()` - square (`i`) +* `a.pow(b)` - raise `a` to the power of `b` +* `a.div(b)` - divide (`divn`, `idivn`) +* `a.mod(b)` - reduct (`u`, `n`) (but no `umodn`) +* `a.divRound(b)` - rounded division + +### Bit operations + +* `a.or(b)` - or (`i`, `u`, `iu`) +* `a.and(b)` - and (`i`, `u`, `iu`, `andln`) (NOTE: `andln` is going to be replaced + with `andn` in future) +* `a.xor(b)` - xor (`i`, `u`, `iu`) +* `a.setn(b)` - set specified bit to `1` +* `a.shln(b)` - shift left (`i`, `u`, `iu`) +* `a.shrn(b)` - shift right (`i`, `u`, `iu`) +* `a.testn(b)` - test if specified bit is set +* `a.maskn(b)` - clear bits with indexes higher or equal to `b` (`i`) +* `a.bincn(b)` - add `1 << b` to the number +* `a.notn(w)` - not (for the width specified by `w`) (`i`) + +### Reduction + +* `a.gcd(b)` - GCD +* `a.egcd(b)` - Extended GCD results (`{ a: ..., b: ..., gcd: ... }`) +* `a.invm(b)` - inverse `a` modulo `b` + +## Fast reduction + +When doing lots of reductions using the same modulo, it might be beneficial to +use some tricks: like [Montgomery multiplication][0], or using special algorithm +for [Mersenne Prime][1]. + +### Reduction context + +To enable this tricks one should create a reduction context: + +```js +var red = BN.red(num); +``` +where `num` is just a BN instance. + +Or: + +```js +var red = BN.red(primeName); +``` + +Where `primeName` is either of these [Mersenne Primes][1]: + +* `'k256'` +* `'p224'` +* `'p192'` +* `'p25519'` + +Or: + +```js +var red = BN.mont(num); +``` + +To reduce numbers with [Montgomery trick][0]. `.mont()` is generally faster than +`.red(num)`, but slower than `BN.red(primeName)`. + +### Converting numbers + +Before performing anything in reduction context - numbers should be converted +to it. Usually, this means that one should: + +* Convert inputs to reducted ones +* Operate on them in reduction context +* Convert outputs back from the reduction context + +Here is how one may convert numbers to `red`: + +```js +var redA = a.toRed(red); +``` +Where `red` is a reduction context created using instructions above + +Here is how to convert them back: + +```js +var a = redA.fromRed(); +``` + +### Red instructions + +Most of the instructions from the very start of this readme have their +counterparts in red context: + +* `a.redAdd(b)`, `a.redIAdd(b)` +* `a.redSub(b)`, `a.redISub(b)` +* `a.redShl(num)` +* `a.redMul(b)`, `a.redIMul(b)` +* `a.redSqr()`, `a.redISqr()` +* `a.redSqrt()` - square root modulo reduction context's prime +* `a.redInvm()` - modular inverse of the number +* `a.redNeg()` +* `a.redPow(b)` - modular exponentiation + +## LICENSE + +This software is licensed under the MIT License. + +[0]: https://en.wikipedia.org/wiki/Montgomery_modular_multiplication +[1]: https://en.wikipedia.org/wiki/Mersenne_prime diff --git a/node_modules/bn.js/lib/bn.js b/node_modules/bn.js/lib/bn.js new file mode 100644 index 0000000..ee78646 --- /dev/null +++ b/node_modules/bn.js/lib/bn.js @@ -0,0 +1,3446 @@ +(function (module, exports) { + 'use strict'; + + // Utils + function assert (val, msg) { + if (!val) throw new Error(msg || 'Assertion failed'); + } + + // Could use `inherits` module, but don't want to move from single file + // architecture yet. + function inherits (ctor, superCtor) { + ctor.super_ = superCtor; + var TempCtor = function () {}; + TempCtor.prototype = superCtor.prototype; + ctor.prototype = new TempCtor(); + ctor.prototype.constructor = ctor; + } + + // BN + + function BN (number, base, endian) { + if (BN.isBN(number)) { + return number; + } + + this.negative = 0; + this.words = null; + this.length = 0; + + // Reduction context + this.red = null; + + if (number !== null) { + if (base === 'le' || base === 'be') { + endian = base; + base = 10; + } + + this._init(number || 0, base || 10, endian || 'be'); + } + } + if (typeof module === 'object') { + module.exports = BN; + } else { + exports.BN = BN; + } + + BN.BN = BN; + BN.wordSize = 26; + + var Buffer; + try { + if (typeof window !== 'undefined' && typeof window.Buffer !== 'undefined') { + Buffer = window.Buffer; + } else { + Buffer = require('buffer').Buffer; + } + } catch (e) { + } + + BN.isBN = function isBN (num) { + if (num instanceof BN) { + return true; + } + + return num !== null && typeof num === 'object' && + num.constructor.wordSize === BN.wordSize && Array.isArray(num.words); + }; + + BN.max = function max (left, right) { + if (left.cmp(right) > 0) return left; + return right; + }; + + BN.min = function min (left, right) { + if (left.cmp(right) < 0) return left; + return right; + }; + + BN.prototype._init = function init (number, base, endian) { + if (typeof number === 'number') { + return this._initNumber(number, base, endian); + } + + if (typeof number === 'object') { + return this._initArray(number, base, endian); + } + + if (base === 'hex') { + base = 16; + } + assert(base === (base | 0) && base >= 2 && base <= 36); + + number = number.toString().replace(/\s+/g, ''); + var start = 0; + if (number[0] === '-') { + start++; + this.negative = 1; + } + + if (start < number.length) { + if (base === 16) { + this._parseHex(number, start, endian); + } else { + this._parseBase(number, base, start); + if (endian === 'le') { + this._initArray(this.toArray(), base, endian); + } + } + } + }; + + BN.prototype._initNumber = function _initNumber (number, base, endian) { + if (number < 0) { + this.negative = 1; + number = -number; + } + if (number < 0x4000000) { + this.words = [ number & 0x3ffffff ]; + this.length = 1; + } else if (number < 0x10000000000000) { + this.words = [ + number & 0x3ffffff, + (number / 0x4000000) & 0x3ffffff + ]; + this.length = 2; + } else { + assert(number < 0x20000000000000); // 2 ^ 53 (unsafe) + this.words = [ + number & 0x3ffffff, + (number / 0x4000000) & 0x3ffffff, + 1 + ]; + this.length = 3; + } + + if (endian !== 'le') return; + + // Reverse the bytes + this._initArray(this.toArray(), base, endian); + }; + + BN.prototype._initArray = function _initArray (number, base, endian) { + // Perhaps a Uint8Array + assert(typeof number.length === 'number'); + if (number.length <= 0) { + this.words = [ 0 ]; + this.length = 1; + return this; + } + + this.length = Math.ceil(number.length / 3); + this.words = new Array(this.length); + for (var i = 0; i < this.length; i++) { + this.words[i] = 0; + } + + var j, w; + var off = 0; + if (endian === 'be') { + for (i = number.length - 1, j = 0; i >= 0; i -= 3) { + w = number[i] | (number[i - 1] << 8) | (number[i - 2] << 16); + this.words[j] |= (w << off) & 0x3ffffff; + this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff; + off += 24; + if (off >= 26) { + off -= 26; + j++; + } + } + } else if (endian === 'le') { + for (i = 0, j = 0; i < number.length; i += 3) { + w = number[i] | (number[i + 1] << 8) | (number[i + 2] << 16); + this.words[j] |= (w << off) & 0x3ffffff; + this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff; + off += 24; + if (off >= 26) { + off -= 26; + j++; + } + } + } + return this.strip(); + }; + + function parseHex4Bits (string, index) { + var c = string.charCodeAt(index); + // 'A' - 'F' + if (c >= 65 && c <= 70) { + return c - 55; + // 'a' - 'f' + } else if (c >= 97 && c <= 102) { + return c - 87; + // '0' - '9' + } else { + return (c - 48) & 0xf; + } + } + + function parseHexByte (string, lowerBound, index) { + var r = parseHex4Bits(string, index); + if (index - 1 >= lowerBound) { + r |= parseHex4Bits(string, index - 1) << 4; + } + return r; + } + + BN.prototype._parseHex = function _parseHex (number, start, endian) { + // Create possibly bigger array to ensure that it fits the number + this.length = Math.ceil((number.length - start) / 6); + this.words = new Array(this.length); + for (var i = 0; i < this.length; i++) { + this.words[i] = 0; + } + + // 24-bits chunks + var off = 0; + var j = 0; + + var w; + if (endian === 'be') { + for (i = number.length - 1; i >= start; i -= 2) { + w = parseHexByte(number, start, i) << off; + this.words[j] |= w & 0x3ffffff; + if (off >= 18) { + off -= 18; + j += 1; + this.words[j] |= w >>> 26; + } else { + off += 8; + } + } + } else { + var parseLength = number.length - start; + for (i = parseLength % 2 === 0 ? start + 1 : start; i < number.length; i += 2) { + w = parseHexByte(number, start, i) << off; + this.words[j] |= w & 0x3ffffff; + if (off >= 18) { + off -= 18; + j += 1; + this.words[j] |= w >>> 26; + } else { + off += 8; + } + } + } + + this.strip(); + }; + + function parseBase (str, start, end, mul) { + var r = 0; + var len = Math.min(str.length, end); + for (var i = start; i < len; i++) { + var c = str.charCodeAt(i) - 48; + + r *= mul; + + // 'a' + if (c >= 49) { + r += c - 49 + 0xa; + + // 'A' + } else if (c >= 17) { + r += c - 17 + 0xa; + + // '0' - '9' + } else { + r += c; + } + } + return r; + } + + BN.prototype._parseBase = function _parseBase (number, base, start) { + // Initialize as zero + this.words = [ 0 ]; + this.length = 1; + + // Find length of limb in base + for (var limbLen = 0, limbPow = 1; limbPow <= 0x3ffffff; limbPow *= base) { + limbLen++; + } + limbLen--; + limbPow = (limbPow / base) | 0; + + var total = number.length - start; + var mod = total % limbLen; + var end = Math.min(total, total - mod) + start; + + var word = 0; + for (var i = start; i < end; i += limbLen) { + word = parseBase(number, i, i + limbLen, base); + + this.imuln(limbPow); + if (this.words[0] + word < 0x4000000) { + this.words[0] += word; + } else { + this._iaddn(word); + } + } + + if (mod !== 0) { + var pow = 1; + word = parseBase(number, i, number.length, base); + + for (i = 0; i < mod; i++) { + pow *= base; + } + + this.imuln(pow); + if (this.words[0] + word < 0x4000000) { + this.words[0] += word; + } else { + this._iaddn(word); + } + } + + this.strip(); + }; + + BN.prototype.copy = function copy (dest) { + dest.words = new Array(this.length); + for (var i = 0; i < this.length; i++) { + dest.words[i] = this.words[i]; + } + dest.length = this.length; + dest.negative = this.negative; + dest.red = this.red; + }; + + BN.prototype.clone = function clone () { + var r = new BN(null); + this.copy(r); + return r; + }; + + BN.prototype._expand = function _expand (size) { + while (this.length < size) { + this.words[this.length++] = 0; + } + return this; + }; + + // Remove leading `0` from `this` + BN.prototype.strip = function strip () { + while (this.length > 1 && this.words[this.length - 1] === 0) { + this.length--; + } + return this._normSign(); + }; + + BN.prototype._normSign = function _normSign () { + // -0 = 0 + if (this.length === 1 && this.words[0] === 0) { + this.negative = 0; + } + return this; + }; + + BN.prototype.inspect = function inspect () { + return (this.red ? '<BN-R: ' : '<BN: ') + this.toString(16) + '>'; + }; + + /* + + var zeros = []; + var groupSizes = []; + var groupBases = []; + + var s = ''; + var i = -1; + while (++i < BN.wordSize) { + zeros[i] = s; + s += '0'; + } + groupSizes[0] = 0; + groupSizes[1] = 0; + groupBases[0] = 0; + groupBases[1] = 0; + var base = 2 - 1; + while (++base < 36 + 1) { + var groupSize = 0; + var groupBase = 1; + while (groupBase < (1 << BN.wordSize) / base) { + groupBase *= base; + groupSize += 1; + } + groupSizes[base] = groupSize; + groupBases[base] = groupBase; + } + + */ + + var zeros = [ + '', + '0', + '00', + '000', + '0000', + '00000', + '000000', + '0000000', + '00000000', + '000000000', + '0000000000', + '00000000000', + '000000000000', + '0000000000000', + '00000000000000', + '000000000000000', + '0000000000000000', + '00000000000000000', + '000000000000000000', + '0000000000000000000', + '00000000000000000000', + '000000000000000000000', + '0000000000000000000000', + '00000000000000000000000', + '000000000000000000000000', + '0000000000000000000000000' + ]; + + var groupSizes = [ + 0, 0, + 25, 16, 12, 11, 10, 9, 8, + 8, 7, 7, 7, 7, 6, 6, + 6, 6, 6, 6, 6, 5, 5, + 5, 5, 5, 5, 5, 5, 5, + 5, 5, 5, 5, 5, 5, 5 + ]; + + var groupBases = [ + 0, 0, + 33554432, 43046721, 16777216, 48828125, 60466176, 40353607, 16777216, + 43046721, 10000000, 19487171, 35831808, 62748517, 7529536, 11390625, + 16777216, 24137569, 34012224, 47045881, 64000000, 4084101, 5153632, + 6436343, 7962624, 9765625, 11881376, 14348907, 17210368, 20511149, + 24300000, 28629151, 33554432, 39135393, 45435424, 52521875, 60466176 + ]; + + BN.prototype.toString = function toString (base, padding) { + base = base || 10; + padding = padding | 0 || 1; + + var out; + if (base === 16 || base === 'hex') { + out = ''; + var off = 0; + var carry = 0; + for (var i = 0; i < this.length; i++) { + var w = this.words[i]; + var word = (((w << off) | carry) & 0xffffff).toString(16); + carry = (w >>> (24 - off)) & 0xffffff; + off += 2; + if (off >= 26) { + off -= 26; + i--; + } + if (carry !== 0 || i !== this.length - 1) { + out = zeros[6 - word.length] + word + out; + } else { + out = word + out; + } + } + if (carry !== 0) { + out = carry.toString(16) + out; + } + while (out.length % padding !== 0) { + out = '0' + out; + } + if (this.negative !== 0) { + out = '-' + out; + } + return out; + } + + if (base === (base | 0) && base >= 2 && base <= 36) { + // var groupSize = Math.floor(BN.wordSize * Math.LN2 / Math.log(base)); + var groupSize = groupSizes[base]; + // var groupBase = Math.pow(base, groupSize); + var groupBase = groupBases[base]; + out = ''; + var c = this.clone(); + c.negative = 0; + while (!c.isZero()) { + var r = c.modn(groupBase).toString(base); + c = c.idivn(groupBase); + + if (!c.isZero()) { + out = zeros[groupSize - r.length] + r + out; + } else { + out = r + out; + } + } + if (this.isZero()) { + out = '0' + out; + } + while (out.length % padding !== 0) { + out = '0' + out; + } + if (this.negative !== 0) { + out = '-' + out; + } + return out; + } + + assert(false, 'Base should be between 2 and 36'); + }; + + BN.prototype.toNumber = function toNumber () { + var ret = this.words[0]; + if (this.length === 2) { + ret += this.words[1] * 0x4000000; + } else if (this.length === 3 && this.words[2] === 0x01) { + // NOTE: at this stage it is known that the top bit is set + ret += 0x10000000000000 + (this.words[1] * 0x4000000); + } else if (this.length > 2) { + assert(false, 'Number can only safely store up to 53 bits'); + } + return (this.negative !== 0) ? -ret : ret; + }; + + BN.prototype.toJSON = function toJSON () { + return this.toString(16); + }; + + BN.prototype.toBuffer = function toBuffer (endian, length) { + assert(typeof Buffer !== 'undefined'); + return this.toArrayLike(Buffer, endian, length); + }; + + BN.prototype.toArray = function toArray (endian, length) { + return this.toArrayLike(Array, endian, length); + }; + + BN.prototype.toArrayLike = function toArrayLike (ArrayType, endian, length) { + var byteLength = this.byteLength(); + var reqLength = length || Math.max(1, byteLength); + assert(byteLength <= reqLength, 'byte array longer than desired length'); + assert(reqLength > 0, 'Requested array length <= 0'); + + this.strip(); + var littleEndian = endian === 'le'; + var res = new ArrayType(reqLength); + + var b, i; + var q = this.clone(); + if (!littleEndian) { + // Assume big-endian + for (i = 0; i < reqLength - byteLength; i++) { + res[i] = 0; + } + + for (i = 0; !q.isZero(); i++) { + b = q.andln(0xff); + q.iushrn(8); + + res[reqLength - i - 1] = b; + } + } else { + for (i = 0; !q.isZero(); i++) { + b = q.andln(0xff); + q.iushrn(8); + + res[i] = b; + } + + for (; i < reqLength; i++) { + res[i] = 0; + } + } + + return res; + }; + + if (Math.clz32) { + BN.prototype._countBits = function _countBits (w) { + return 32 - Math.clz32(w); + }; + } else { + BN.prototype._countBits = function _countBits (w) { + var t = w; + var r = 0; + if (t >= 0x1000) { + r += 13; + t >>>= 13; + } + if (t >= 0x40) { + r += 7; + t >>>= 7; + } + if (t >= 0x8) { + r += 4; + t >>>= 4; + } + if (t >= 0x02) { + r += 2; + t >>>= 2; + } + return r + t; + }; + } + + BN.prototype._zeroBits = function _zeroBits (w) { + // Short-cut + if (w === 0) return 26; + + var t = w; + var r = 0; + if ((t & 0x1fff) === 0) { + r += 13; + t >>>= 13; + } + if ((t & 0x7f) === 0) { + r += 7; + t >>>= 7; + } + if ((t & 0xf) === 0) { + r += 4; + t >>>= 4; + } + if ((t & 0x3) === 0) { + r += 2; + t >>>= 2; + } + if ((t & 0x1) === 0) { + r++; + } + return r; + }; + + // Return number of used bits in a BN + BN.prototype.bitLength = function bitLength () { + var w = this.words[this.length - 1]; + var hi = this._countBits(w); + return (this.length - 1) * 26 + hi; + }; + + function toBitArray (num) { + var w = new Array(num.bitLength()); + + for (var bit = 0; bit < w.length; bit++) { + var off = (bit / 26) | 0; + var wbit = bit % 26; + + w[bit] = (num.words[off] & (1 << wbit)) >>> wbit; + } + + return w; + } + + // Number of trailing zero bits + BN.prototype.zeroBits = function zeroBits () { + if (this.isZero()) return 0; + + var r = 0; + for (var i = 0; i < this.length; i++) { + var b = this._zeroBits(this.words[i]); + r += b; + if (b !== 26) break; + } + return r; + }; + + BN.prototype.byteLength = function byteLength () { + return Math.ceil(this.bitLength() / 8); + }; + + BN.prototype.toTwos = function toTwos (width) { + if (this.negative !== 0) { + return this.abs().inotn(width).iaddn(1); + } + return this.clone(); + }; + + BN.prototype.fromTwos = function fromTwos (width) { + if (this.testn(width - 1)) { + return this.notn(width).iaddn(1).ineg(); + } + return this.clone(); + }; + + BN.prototype.isNeg = function isNeg () { + return this.negative !== 0; + }; + + // Return negative clone of `this` + BN.prototype.neg = function neg () { + return this.clone().ineg(); + }; + + BN.prototype.ineg = function ineg () { + if (!this.isZero()) { + this.negative ^= 1; + } + + return this; + }; + + // Or `num` with `this` in-place + BN.prototype.iuor = function iuor (num) { + while (this.length < num.length) { + this.words[this.length++] = 0; + } + + for (var i = 0; i < num.length; i++) { + this.words[i] = this.words[i] | num.words[i]; + } + + return this.strip(); + }; + + BN.prototype.ior = function ior (num) { + assert((this.negative | num.negative) === 0); + return this.iuor(num); + }; + + // Or `num` with `this` + BN.prototype.or = function or (num) { + if (this.length > num.length) return this.clone().ior(num); + return num.clone().ior(this); + }; + + BN.prototype.uor = function uor (num) { + if (this.length > num.length) return this.clone().iuor(num); + return num.clone().iuor(this); + }; + + // And `num` with `this` in-place + BN.prototype.iuand = function iuand (num) { + // b = min-length(num, this) + var b; + if (this.length > num.length) { + b = num; + } else { + b = this; + } + + for (var i = 0; i < b.length; i++) { + this.words[i] = this.words[i] & num.words[i]; + } + + this.length = b.length; + + return this.strip(); + }; + + BN.prototype.iand = function iand (num) { + assert((this.negative | num.negative) === 0); + return this.iuand(num); + }; + + // And `num` with `this` + BN.prototype.and = function and (num) { + if (this.length > num.length) return this.clone().iand(num); + return num.clone().iand(this); + }; + + BN.prototype.uand = function uand (num) { + if (this.length > num.length) return this.clone().iuand(num); + return num.clone().iuand(this); + }; + + // Xor `num` with `this` in-place + BN.prototype.iuxor = function iuxor (num) { + // a.length > b.length + var a; + var b; + if (this.length > num.length) { + a = this; + b = num; + } else { + a = num; + b = this; + } + + for (var i = 0; i < b.length; i++) { + this.words[i] = a.words[i] ^ b.words[i]; + } + + if (this !== a) { + for (; i < a.length; i++) { + this.words[i] = a.words[i]; + } + } + + this.length = a.length; + + return this.strip(); + }; + + BN.prototype.ixor = function ixor (num) { + assert((this.negative | num.negative) === 0); + return this.iuxor(num); + }; + + // Xor `num` with `this` + BN.prototype.xor = function xor (num) { + if (this.length > num.length) return this.clone().ixor(num); + return num.clone().ixor(this); + }; + + BN.prototype.uxor = function uxor (num) { + if (this.length > num.length) return this.clone().iuxor(num); + return num.clone().iuxor(this); + }; + + // Not ``this`` with ``width`` bitwidth + BN.prototype.inotn = function inotn (width) { + assert(typeof width === 'number' && width >= 0); + + var bytesNeeded = Math.ceil(width / 26) | 0; + var bitsLeft = width % 26; + + // Extend the buffer with leading zeroes + this._expand(bytesNeeded); + + if (bitsLeft > 0) { + bytesNeeded--; + } + + // Handle complete words + for (var i = 0; i < bytesNeeded; i++) { + this.words[i] = ~this.words[i] & 0x3ffffff; + } + + // Handle the residue + if (bitsLeft > 0) { + this.words[i] = ~this.words[i] & (0x3ffffff >> (26 - bitsLeft)); + } + + // And remove leading zeroes + return this.strip(); + }; + + BN.prototype.notn = function notn (width) { + return this.clone().inotn(width); + }; + + // Set `bit` of `this` + BN.prototype.setn = function setn (bit, val) { + assert(typeof bit === 'number' && bit >= 0); + + var off = (bit / 26) | 0; + var wbit = bit % 26; + + this._expand(off + 1); + + if (val) { + this.words[off] = this.words[off] | (1 << wbit); + } else { + this.words[off] = this.words[off] & ~(1 << wbit); + } + + return this.strip(); + }; + + // Add `num` to `this` in-place + BN.prototype.iadd = function iadd (num) { + var r; + + // negative + positive + if (this.negative !== 0 && num.negative === 0) { + this.negative = 0; + r = this.isub(num); + this.negative ^= 1; + return this._normSign(); + + // positive + negative + } else if (this.negative === 0 && num.negative !== 0) { + num.negative = 0; + r = this.isub(num); + num.negative = 1; + return r._normSign(); + } + + // a.length > b.length + var a, b; + if (this.length > num.length) { + a = this; + b = num; + } else { + a = num; + b = this; + } + + var carry = 0; + for (var i = 0; i < b.length; i++) { + r = (a.words[i] | 0) + (b.words[i] | 0) + carry; + this.words[i] = r & 0x3ffffff; + carry = r >>> 26; + } + for (; carry !== 0 && i < a.length; i++) { + r = (a.words[i] | 0) + carry; + this.words[i] = r & 0x3ffffff; + carry = r >>> 26; + } + + this.length = a.length; + if (carry !== 0) { + this.words[this.length] = carry; + this.length++; + // Copy the rest of the words + } else if (a !== this) { + for (; i < a.length; i++) { + this.words[i] = a.words[i]; + } + } + + return this; + }; + + // Add `num` to `this` + BN.prototype.add = function add (num) { + var res; + if (num.negative !== 0 && this.negative === 0) { + num.negative = 0; + res = this.sub(num); + num.negative ^= 1; + return res; + } else if (num.negative === 0 && this.negative !== 0) { + this.negative = 0; + res = num.sub(this); + this.negative = 1; + return res; + } + + if (this.length > num.length) return this.clone().iadd(num); + + return num.clone().iadd(this); + }; + + // Subtract `num` from `this` in-place + BN.prototype.isub = function isub (num) { + // this - (-num) = this + num + if (num.negative !== 0) { + num.negative = 0; + var r = this.iadd(num); + num.negative = 1; + return r._normSign(); + + // -this - num = -(this + num) + } else if (this.negative !== 0) { + this.negative = 0; + this.iadd(num); + this.negative = 1; + return this._normSign(); + } + + // At this point both numbers are positive + var cmp = this.cmp(num); + + // Optimization - zeroify + if (cmp === 0) { + this.negative = 0; + this.length = 1; + this.words[0] = 0; + return this; + } + + // a > b + var a, b; + if (cmp > 0) { + a = this; + b = num; + } else { + a = num; + b = this; + } + + var carry = 0; + for (var i = 0; i < b.length; i++) { + r = (a.words[i] | 0) - (b.words[i] | 0) + carry; + carry = r >> 26; + this.words[i] = r & 0x3ffffff; + } + for (; carry !== 0 && i < a.length; i++) { + r = (a.words[i] | 0) + carry; + carry = r >> 26; + this.words[i] = r & 0x3ffffff; + } + + // Copy rest of the words + if (carry === 0 && i < a.length && a !== this) { + for (; i < a.length; i++) { + this.words[i] = a.words[i]; + } + } + + this.length = Math.max(this.length, i); + + if (a !== this) { + this.negative = 1; + } + + return this.strip(); + }; + + // Subtract `num` from `this` + BN.prototype.sub = function sub (num) { + return this.clone().isub(num); + }; + + function smallMulTo (self, num, out) { + out.negative = num.negative ^ self.negative; + var len = (self.length + num.length) | 0; + out.length = len; + len = (len - 1) | 0; + + // Peel one iteration (compiler can't do it, because of code complexity) + var a = self.words[0] | 0; + var b = num.words[0] | 0; + var r = a * b; + + var lo = r & 0x3ffffff; + var carry = (r / 0x4000000) | 0; + out.words[0] = lo; + + for (var k = 1; k < len; k++) { + // Sum all words with the same `i + j = k` and accumulate `ncarry`, + // note that ncarry could be >= 0x3ffffff + var ncarry = carry >>> 26; + var rword = carry & 0x3ffffff; + var maxJ = Math.min(k, num.length - 1); + for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) { + var i = (k - j) | 0; + a = self.words[i] | 0; + b = num.words[j] | 0; + r = a * b + rword; + ncarry += (r / 0x4000000) | 0; + rword = r & 0x3ffffff; + } + out.words[k] = rword | 0; + carry = ncarry | 0; + } + if (carry !== 0) { + out.words[k] = carry | 0; + } else { + out.length--; + } + + return out.strip(); + } + + // TODO(indutny): it may be reasonable to omit it for users who don't need + // to work with 256-bit numbers, otherwise it gives 20% improvement for 256-bit + // multiplication (like elliptic secp256k1). + var comb10MulTo = function comb10MulTo (self, num, out) { + var a = self.words; + var b = num.words; + var o = out.words; + var c = 0; + var lo; + var mid; + var hi; + var a0 = a[0] | 0; + var al0 = a0 & 0x1fff; + var ah0 = a0 >>> 13; + var a1 = a[1] | 0; + var al1 = a1 & 0x1fff; + var ah1 = a1 >>> 13; + var a2 = a[2] | 0; + var al2 = a2 & 0x1fff; + var ah2 = a2 >>> 13; + var a3 = a[3] | 0; + var al3 = a3 & 0x1fff; + var ah3 = a3 >>> 13; + var a4 = a[4] | 0; + var al4 = a4 & 0x1fff; + var ah4 = a4 >>> 13; + var a5 = a[5] | 0; + var al5 = a5 & 0x1fff; + var ah5 = a5 >>> 13; + var a6 = a[6] | 0; + var al6 = a6 & 0x1fff; + var ah6 = a6 >>> 13; + var a7 = a[7] | 0; + var al7 = a7 & 0x1fff; + var ah7 = a7 >>> 13; + var a8 = a[8] | 0; + var al8 = a8 & 0x1fff; + var ah8 = a8 >>> 13; + var a9 = a[9] | 0; + var al9 = a9 & 0x1fff; + var ah9 = a9 >>> 13; + var b0 = b[0] | 0; + var bl0 = b0 & 0x1fff; + var bh0 = b0 >>> 13; + var b1 = b[1] | 0; + var bl1 = b1 & 0x1fff; + var bh1 = b1 >>> 13; + var b2 = b[2] | 0; + var bl2 = b2 & 0x1fff; + var bh2 = b2 >>> 13; + var b3 = b[3] | 0; + var bl3 = b3 & 0x1fff; + var bh3 = b3 >>> 13; + var b4 = b[4] | 0; + var bl4 = b4 & 0x1fff; + var bh4 = b4 >>> 13; + var b5 = b[5] | 0; + var bl5 = b5 & 0x1fff; + var bh5 = b5 >>> 13; + var b6 = b[6] | 0; + var bl6 = b6 & 0x1fff; + var bh6 = b6 >>> 13; + var b7 = b[7] | 0; + var bl7 = b7 & 0x1fff; + var bh7 = b7 >>> 13; + var b8 = b[8] | 0; + var bl8 = b8 & 0x1fff; + var bh8 = b8 >>> 13; + var b9 = b[9] | 0; + var bl9 = b9 & 0x1fff; + var bh9 = b9 >>> 13; + + out.negative = self.negative ^ num.negative; + out.length = 19; + /* k = 0 */ + lo = Math.imul(al0, bl0); + mid = Math.imul(al0, bh0); + mid = (mid + Math.imul(ah0, bl0)) | 0; + hi = Math.imul(ah0, bh0); + var w0 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w0 >>> 26)) | 0; + w0 &= 0x3ffffff; + /* k = 1 */ + lo = Math.imul(al1, bl0); + mid = Math.imul(al1, bh0); + mid = (mid + Math.imul(ah1, bl0)) | 0; + hi = Math.imul(ah1, bh0); + lo = (lo + Math.imul(al0, bl1)) | 0; + mid = (mid + Math.imul(al0, bh1)) | 0; + mid = (mid + Math.imul(ah0, bl1)) | 0; + hi = (hi + Math.imul(ah0, bh1)) | 0; + var w1 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w1 >>> 26)) | 0; + w1 &= 0x3ffffff; + /* k = 2 */ + lo = Math.imul(al2, bl0); + mid = Math.imul(al2, bh0); + mid = (mid + Math.imul(ah2, bl0)) | 0; + hi = Math.imul(ah2, bh0); + lo = (lo + Math.imul(al1, bl1)) | 0; + mid = (mid + Math.imul(al1, bh1)) | 0; + mid = (mid + Math.imul(ah1, bl1)) | 0; + hi = (hi + Math.imul(ah1, bh1)) | 0; + lo = (lo + Math.imul(al0, bl2)) | 0; + mid = (mid + Math.imul(al0, bh2)) | 0; + mid = (mid + Math.imul(ah0, bl2)) | 0; + hi = (hi + Math.imul(ah0, bh2)) | 0; + var w2 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w2 >>> 26)) | 0; + w2 &= 0x3ffffff; + /* k = 3 */ + lo = Math.imul(al3, bl0); + mid = Math.imul(al3, bh0); + mid = (mid + Math.imul(ah3, bl0)) | 0; + hi = Math.imul(ah3, bh0); + lo = (lo + Math.imul(al2, bl1)) | 0; + mid = (mid + Math.imul(al2, bh1)) | 0; + mid = (mid + Math.imul(ah2, bl1)) | 0; + hi = (hi + Math.imul(ah2, bh1)) | 0; + lo = (lo + Math.imul(al1, bl2)) | 0; + mid = (mid + Math.imul(al1, bh2)) | 0; + mid = (mid + Math.imul(ah1, bl2)) | 0; + hi = (hi + Math.imul(ah1, bh2)) | 0; + lo = (lo + Math.imul(al0, bl3)) | 0; + mid = (mid + Math.imul(al0, bh3)) | 0; + mid = (mid + Math.imul(ah0, bl3)) | 0; + hi = (hi + Math.imul(ah0, bh3)) | 0; + var w3 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w3 >>> 26)) | 0; + w3 &= 0x3ffffff; + /* k = 4 */ + lo = Math.imul(al4, bl0); + mid = Math.imul(al4, bh0); + mid = (mid + Math.imul(ah4, bl0)) | 0; + hi = Math.imul(ah4, bh0); + lo = (lo + Math.imul(al3, bl1)) | 0; + mid = (mid + Math.imul(al3, bh1)) | 0; + mid = (mid + Math.imul(ah3, bl1)) | 0; + hi = (hi + Math.imul(ah3, bh1)) | 0; + lo = (lo + Math.imul(al2, bl2)) | 0; + mid = (mid + Math.imul(al2, bh2)) | 0; + mid = (mid + Math.imul(ah2, bl2)) | 0; + hi = (hi + Math.imul(ah2, bh2)) | 0; + lo = (lo + Math.imul(al1, bl3)) | 0; + mid = (mid + Math.imul(al1, bh3)) | 0; + mid = (mid + Math.imul(ah1, bl3)) | 0; + hi = (hi + Math.imul(ah1, bh3)) | 0; + lo = (lo + Math.imul(al0, bl4)) | 0; + mid = (mid + Math.imul(al0, bh4)) | 0; + mid = (mid + Math.imul(ah0, bl4)) | 0; + hi = (hi + Math.imul(ah0, bh4)) | 0; + var w4 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w4 >>> 26)) | 0; + w4 &= 0x3ffffff; + /* k = 5 */ + lo = Math.imul(al5, bl0); + mid = Math.imul(al5, bh0); + mid = (mid + Math.imul(ah5, bl0)) | 0; + hi = Math.imul(ah5, bh0); + lo = (lo + Math.imul(al4, bl1)) | 0; + mid = (mid + Math.imul(al4, bh1)) | 0; + mid = (mid + Math.imul(ah4, bl1)) | 0; + hi = (hi + Math.imul(ah4, bh1)) | 0; + lo = (lo + Math.imul(al3, bl2)) | 0; + mid = (mid + Math.imul(al3, bh2)) | 0; + mid = (mid + Math.imul(ah3, bl2)) | 0; + hi = (hi + Math.imul(ah3, bh2)) | 0; + lo = (lo + Math.imul(al2, bl3)) | 0; + mid = (mid + Math.imul(al2, bh3)) | 0; + mid = (mid + Math.imul(ah2, bl3)) | 0; + hi = (hi + Math.imul(ah2, bh3)) | 0; + lo = (lo + Math.imul(al1, bl4)) | 0; + mid = (mid + Math.imul(al1, bh4)) | 0; + mid = (mid + Math.imul(ah1, bl4)) | 0; + hi = (hi + Math.imul(ah1, bh4)) | 0; + lo = (lo + Math.imul(al0, bl5)) | 0; + mid = (mid + Math.imul(al0, bh5)) | 0; + mid = (mid + Math.imul(ah0, bl5)) | 0; + hi = (hi + Math.imul(ah0, bh5)) | 0; + var w5 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w5 >>> 26)) | 0; + w5 &= 0x3ffffff; + /* k = 6 */ + lo = Math.imul(al6, bl0); + mid = Math.imul(al6, bh0); + mid = (mid + Math.imul(ah6, bl0)) | 0; + hi = Math.imul(ah6, bh0); + lo = (lo + Math.imul(al5, bl1)) | 0; + mid = (mid + Math.imul(al5, bh1)) | 0; + mid = (mid + Math.imul(ah5, bl1)) | 0; + hi = (hi + Math.imul(ah5, bh1)) | 0; + lo = (lo + Math.imul(al4, bl2)) | 0; + mid = (mid + Math.imul(al4, bh2)) | 0; + mid = (mid + Math.imul(ah4, bl2)) | 0; + hi = (hi + Math.imul(ah4, bh2)) | 0; + lo = (lo + Math.imul(al3, bl3)) | 0; + mid = (mid + Math.imul(al3, bh3)) | 0; + mid = (mid + Math.imul(ah3, bl3)) | 0; + hi = (hi + Math.imul(ah3, bh3)) | 0; + lo = (lo + Math.imul(al2, bl4)) | 0; + mid = (mid + Math.imul(al2, bh4)) | 0; + mid = (mid + Math.imul(ah2, bl4)) | 0; + hi = (hi + Math.imul(ah2, bh4)) | 0; + lo = (lo + Math.imul(al1, bl5)) | 0; + mid = (mid + Math.imul(al1, bh5)) | 0; + mid = (mid + Math.imul(ah1, bl5)) | 0; + hi = (hi + Math.imul(ah1, bh5)) | 0; + lo = (lo + Math.imul(al0, bl6)) | 0; + mid = (mid + Math.imul(al0, bh6)) | 0; + mid = (mid + Math.imul(ah0, bl6)) | 0; + hi = (hi + Math.imul(ah0, bh6)) | 0; + var w6 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w6 >>> 26)) | 0; + w6 &= 0x3ffffff; + /* k = 7 */ + lo = Math.imul(al7, bl0); + mid = Math.imul(al7, bh0); + mid = (mid + Math.imul(ah7, bl0)) | 0; + hi = Math.imul(ah7, bh0); + lo = (lo + Math.imul(al6, bl1)) | 0; + mid = (mid + Math.imul(al6, bh1)) | 0; + mid = (mid + Math.imul(ah6, bl1)) | 0; + hi = (hi + Math.imul(ah6, bh1)) | 0; + lo = (lo + Math.imul(al5, bl2)) | 0; + mid = (mid + Math.imul(al5, bh2)) | 0; + mid = (mid + Math.imul(ah5, bl2)) | 0; + hi = (hi + Math.imul(ah5, bh2)) | 0; + lo = (lo + Math.imul(al4, bl3)) | 0; + mid = (mid + Math.imul(al4, bh3)) | 0; + mid = (mid + Math.imul(ah4, bl3)) | 0; + hi = (hi + Math.imul(ah4, bh3)) | 0; + lo = (lo + Math.imul(al3, bl4)) | 0; + mid = (mid + Math.imul(al3, bh4)) | 0; + mid = (mid + Math.imul(ah3, bl4)) | 0; + hi = (hi + Math.imul(ah3, bh4)) | 0; + lo = (lo + Math.imul(al2, bl5)) | 0; + mid = (mid + Math.imul(al2, bh5)) | 0; + mid = (mid + Math.imul(ah2, bl5)) | 0; + hi = (hi + Math.imul(ah2, bh5)) | 0; + lo = (lo + Math.imul(al1, bl6)) | 0; + mid = (mid + Math.imul(al1, bh6)) | 0; + mid = (mid + Math.imul(ah1, bl6)) | 0; + hi = (hi + Math.imul(ah1, bh6)) | 0; + lo = (lo + Math.imul(al0, bl7)) | 0; + mid = (mid + Math.imul(al0, bh7)) | 0; + mid = (mid + Math.imul(ah0, bl7)) | 0; + hi = (hi + Math.imul(ah0, bh7)) | 0; + var w7 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w7 >>> 26)) | 0; + w7 &= 0x3ffffff; + /* k = 8 */ + lo = Math.imul(al8, bl0); + mid = Math.imul(al8, bh0); + mid = (mid + Math.imul(ah8, bl0)) | 0; + hi = Math.imul(ah8, bh0); + lo = (lo + Math.imul(al7, bl1)) | 0; + mid = (mid + Math.imul(al7, bh1)) | 0; + mid = (mid + Math.imul(ah7, bl1)) | 0; + hi = (hi + Math.imul(ah7, bh1)) | 0; + lo = (lo + Math.imul(al6, bl2)) | 0; + mid = (mid + Math.imul(al6, bh2)) | 0; + mid = (mid + Math.imul(ah6, bl2)) | 0; + hi = (hi + Math.imul(ah6, bh2)) | 0; + lo = (lo + Math.imul(al5, bl3)) | 0; + mid = (mid + Math.imul(al5, bh3)) | 0; + mid = (mid + Math.imul(ah5, bl3)) | 0; + hi = (hi + Math.imul(ah5, bh3)) | 0; + lo = (lo + Math.imul(al4, bl4)) | 0; + mid = (mid + Math.imul(al4, bh4)) | 0; + mid = (mid + Math.imul(ah4, bl4)) | 0; + hi = (hi + Math.imul(ah4, bh4)) | 0; + lo = (lo + Math.imul(al3, bl5)) | 0; + mid = (mid + Math.imul(al3, bh5)) | 0; + mid = (mid + Math.imul(ah3, bl5)) | 0; + hi = (hi + Math.imul(ah3, bh5)) | 0; + lo = (lo + Math.imul(al2, bl6)) | 0; + mid = (mid + Math.imul(al2, bh6)) | 0; + mid = (mid + Math.imul(ah2, bl6)) | 0; + hi = (hi + Math.imul(ah2, bh6)) | 0; + lo = (lo + Math.imul(al1, bl7)) | 0; + mid = (mid + Math.imul(al1, bh7)) | 0; + mid = (mid + Math.imul(ah1, bl7)) | 0; + hi = (hi + Math.imul(ah1, bh7)) | 0; + lo = (lo + Math.imul(al0, bl8)) | 0; + mid = (mid + Math.imul(al0, bh8)) | 0; + mid = (mid + Math.imul(ah0, bl8)) | 0; + hi = (hi + Math.imul(ah0, bh8)) | 0; + var w8 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w8 >>> 26)) | 0; + w8 &= 0x3ffffff; + /* k = 9 */ + lo = Math.imul(al9, bl0); + mid = Math.imul(al9, bh0); + mid = (mid + Math.imul(ah9, bl0)) | 0; + hi = Math.imul(ah9, bh0); + lo = (lo + Math.imul(al8, bl1)) | 0; + mid = (mid + Math.imul(al8, bh1)) | 0; + mid = (mid + Math.imul(ah8, bl1)) | 0; + hi = (hi + Math.imul(ah8, bh1)) | 0; + lo = (lo + Math.imul(al7, bl2)) | 0; + mid = (mid + Math.imul(al7, bh2)) | 0; + mid = (mid + Math.imul(ah7, bl2)) | 0; + hi = (hi + Math.imul(ah7, bh2)) | 0; + lo = (lo + Math.imul(al6, bl3)) | 0; + mid = (mid + Math.imul(al6, bh3)) | 0; + mid = (mid + Math.imul(ah6, bl3)) | 0; + hi = (hi + Math.imul(ah6, bh3)) | 0; + lo = (lo + Math.imul(al5, bl4)) | 0; + mid = (mid + Math.imul(al5, bh4)) | 0; + mid = (mid + Math.imul(ah5, bl4)) | 0; + hi = (hi + Math.imul(ah5, bh4)) | 0; + lo = (lo + Math.imul(al4, bl5)) | 0; + mid = (mid + Math.imul(al4, bh5)) | 0; + mid = (mid + Math.imul(ah4, bl5)) | 0; + hi = (hi + Math.imul(ah4, bh5)) | 0; + lo = (lo + Math.imul(al3, bl6)) | 0; + mid = (mid + Math.imul(al3, bh6)) | 0; + mid = (mid + Math.imul(ah3, bl6)) | 0; + hi = (hi + Math.imul(ah3, bh6)) | 0; + lo = (lo + Math.imul(al2, bl7)) | 0; + mid = (mid + Math.imul(al2, bh7)) | 0; + mid = (mid + Math.imul(ah2, bl7)) | 0; + hi = (hi + Math.imul(ah2, bh7)) | 0; + lo = (lo + Math.imul(al1, bl8)) | 0; + mid = (mid + Math.imul(al1, bh8)) | 0; + mid = (mid + Math.imul(ah1, bl8)) | 0; + hi = (hi + Math.imul(ah1, bh8)) | 0; + lo = (lo + Math.imul(al0, bl9)) | 0; + mid = (mid + Math.imul(al0, bh9)) | 0; + mid = (mid + Math.imul(ah0, bl9)) | 0; + hi = (hi + Math.imul(ah0, bh9)) | 0; + var w9 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w9 >>> 26)) | 0; + w9 &= 0x3ffffff; + /* k = 10 */ + lo = Math.imul(al9, bl1); + mid = Math.imul(al9, bh1); + mid = (mid + Math.imul(ah9, bl1)) | 0; + hi = Math.imul(ah9, bh1); + lo = (lo + Math.imul(al8, bl2)) | 0; + mid = (mid + Math.imul(al8, bh2)) | 0; + mid = (mid + Math.imul(ah8, bl2)) | 0; + hi = (hi + Math.imul(ah8, bh2)) | 0; + lo = (lo + Math.imul(al7, bl3)) | 0; + mid = (mid + Math.imul(al7, bh3)) | 0; + mid = (mid + Math.imul(ah7, bl3)) | 0; + hi = (hi + Math.imul(ah7, bh3)) | 0; + lo = (lo + Math.imul(al6, bl4)) | 0; + mid = (mid + Math.imul(al6, bh4)) | 0; + mid = (mid + Math.imul(ah6, bl4)) | 0; + hi = (hi + Math.imul(ah6, bh4)) | 0; + lo = (lo + Math.imul(al5, bl5)) | 0; + mid = (mid + Math.imul(al5, bh5)) | 0; + mid = (mid + Math.imul(ah5, bl5)) | 0; + hi = (hi + Math.imul(ah5, bh5)) | 0; + lo = (lo + Math.imul(al4, bl6)) | 0; + mid = (mid + Math.imul(al4, bh6)) | 0; + mid = (mid + Math.imul(ah4, bl6)) | 0; + hi = (hi + Math.imul(ah4, bh6)) | 0; + lo = (lo + Math.imul(al3, bl7)) | 0; + mid = (mid + Math.imul(al3, bh7)) | 0; + mid = (mid + Math.imul(ah3, bl7)) | 0; + hi = (hi + Math.imul(ah3, bh7)) | 0; + lo = (lo + Math.imul(al2, bl8)) | 0; + mid = (mid + Math.imul(al2, bh8)) | 0; + mid = (mid + Math.imul(ah2, bl8)) | 0; + hi = (hi + Math.imul(ah2, bh8)) | 0; + lo = (lo + Math.imul(al1, bl9)) | 0; + mid = (mid + Math.imul(al1, bh9)) | 0; + mid = (mid + Math.imul(ah1, bl9)) | 0; + hi = (hi + Math.imul(ah1, bh9)) | 0; + var w10 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w10 >>> 26)) | 0; + w10 &= 0x3ffffff; + /* k = 11 */ + lo = Math.imul(al9, bl2); + mid = Math.imul(al9, bh2); + mid = (mid + Math.imul(ah9, bl2)) | 0; + hi = Math.imul(ah9, bh2); + lo = (lo + Math.imul(al8, bl3)) | 0; + mid = (mid + Math.imul(al8, bh3)) | 0; + mid = (mid + Math.imul(ah8, bl3)) | 0; + hi = (hi + Math.imul(ah8, bh3)) | 0; + lo = (lo + Math.imul(al7, bl4)) | 0; + mid = (mid + Math.imul(al7, bh4)) | 0; + mid = (mid + Math.imul(ah7, bl4)) | 0; + hi = (hi + Math.imul(ah7, bh4)) | 0; + lo = (lo + Math.imul(al6, bl5)) | 0; + mid = (mid + Math.imul(al6, bh5)) | 0; + mid = (mid + Math.imul(ah6, bl5)) | 0; + hi = (hi + Math.imul(ah6, bh5)) | 0; + lo = (lo + Math.imul(al5, bl6)) | 0; + mid = (mid + Math.imul(al5, bh6)) | 0; + mid = (mid + Math.imul(ah5, bl6)) | 0; + hi = (hi + Math.imul(ah5, bh6)) | 0; + lo = (lo + Math.imul(al4, bl7)) | 0; + mid = (mid + Math.imul(al4, bh7)) | 0; + mid = (mid + Math.imul(ah4, bl7)) | 0; + hi = (hi + Math.imul(ah4, bh7)) | 0; + lo = (lo + Math.imul(al3, bl8)) | 0; + mid = (mid + Math.imul(al3, bh8)) | 0; + mid = (mid + Math.imul(ah3, bl8)) | 0; + hi = (hi + Math.imul(ah3, bh8)) | 0; + lo = (lo + Math.imul(al2, bl9)) | 0; + mid = (mid + Math.imul(al2, bh9)) | 0; + mid = (mid + Math.imul(ah2, bl9)) | 0; + hi = (hi + Math.imul(ah2, bh9)) | 0; + var w11 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w11 >>> 26)) | 0; + w11 &= 0x3ffffff; + /* k = 12 */ + lo = Math.imul(al9, bl3); + mid = Math.imul(al9, bh3); + mid = (mid + Math.imul(ah9, bl3)) | 0; + hi = Math.imul(ah9, bh3); + lo = (lo + Math.imul(al8, bl4)) | 0; + mid = (mid + Math.imul(al8, bh4)) | 0; + mid = (mid + Math.imul(ah8, bl4)) | 0; + hi = (hi + Math.imul(ah8, bh4)) | 0; + lo = (lo + Math.imul(al7, bl5)) | 0; + mid = (mid + Math.imul(al7, bh5)) | 0; + mid = (mid + Math.imul(ah7, bl5)) | 0; + hi = (hi + Math.imul(ah7, bh5)) | 0; + lo = (lo + Math.imul(al6, bl6)) | 0; + mid = (mid + Math.imul(al6, bh6)) | 0; + mid = (mid + Math.imul(ah6, bl6)) | 0; + hi = (hi + Math.imul(ah6, bh6)) | 0; + lo = (lo + Math.imul(al5, bl7)) | 0; + mid = (mid + Math.imul(al5, bh7)) | 0; + mid = (mid + Math.imul(ah5, bl7)) | 0; + hi = (hi + Math.imul(ah5, bh7)) | 0; + lo = (lo + Math.imul(al4, bl8)) | 0; + mid = (mid + Math.imul(al4, bh8)) | 0; + mid = (mid + Math.imul(ah4, bl8)) | 0; + hi = (hi + Math.imul(ah4, bh8)) | 0; + lo = (lo + Math.imul(al3, bl9)) | 0; + mid = (mid + Math.imul(al3, bh9)) | 0; + mid = (mid + Math.imul(ah3, bl9)) | 0; + hi = (hi + Math.imul(ah3, bh9)) | 0; + var w12 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w12 >>> 26)) | 0; + w12 &= 0x3ffffff; + /* k = 13 */ + lo = Math.imul(al9, bl4); + mid = Math.imul(al9, bh4); + mid = (mid + Math.imul(ah9, bl4)) | 0; + hi = Math.imul(ah9, bh4); + lo = (lo + Math.imul(al8, bl5)) | 0; + mid = (mid + Math.imul(al8, bh5)) | 0; + mid = (mid + Math.imul(ah8, bl5)) | 0; + hi = (hi + Math.imul(ah8, bh5)) | 0; + lo = (lo + Math.imul(al7, bl6)) | 0; + mid = (mid + Math.imul(al7, bh6)) | 0; + mid = (mid + Math.imul(ah7, bl6)) | 0; + hi = (hi + Math.imul(ah7, bh6)) | 0; + lo = (lo + Math.imul(al6, bl7)) | 0; + mid = (mid + Math.imul(al6, bh7)) | 0; + mid = (mid + Math.imul(ah6, bl7)) | 0; + hi = (hi + Math.imul(ah6, bh7)) | 0; + lo = (lo + Math.imul(al5, bl8)) | 0; + mid = (mid + Math.imul(al5, bh8)) | 0; + mid = (mid + Math.imul(ah5, bl8)) | 0; + hi = (hi + Math.imul(ah5, bh8)) | 0; + lo = (lo + Math.imul(al4, bl9)) | 0; + mid = (mid + Math.imul(al4, bh9)) | 0; + mid = (mid + Math.imul(ah4, bl9)) | 0; + hi = (hi + Math.imul(ah4, bh9)) | 0; + var w13 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w13 >>> 26)) | 0; + w13 &= 0x3ffffff; + /* k = 14 */ + lo = Math.imul(al9, bl5); + mid = Math.imul(al9, bh5); + mid = (mid + Math.imul(ah9, bl5)) | 0; + hi = Math.imul(ah9, bh5); + lo = (lo + Math.imul(al8, bl6)) | 0; + mid = (mid + Math.imul(al8, bh6)) | 0; + mid = (mid + Math.imul(ah8, bl6)) | 0; + hi = (hi + Math.imul(ah8, bh6)) | 0; + lo = (lo + Math.imul(al7, bl7)) | 0; + mid = (mid + Math.imul(al7, bh7)) | 0; + mid = (mid + Math.imul(ah7, bl7)) | 0; + hi = (hi + Math.imul(ah7, bh7)) | 0; + lo = (lo + Math.imul(al6, bl8)) | 0; + mid = (mid + Math.imul(al6, bh8)) | 0; + mid = (mid + Math.imul(ah6, bl8)) | 0; + hi = (hi + Math.imul(ah6, bh8)) | 0; + lo = (lo + Math.imul(al5, bl9)) | 0; + mid = (mid + Math.imul(al5, bh9)) | 0; + mid = (mid + Math.imul(ah5, bl9)) | 0; + hi = (hi + Math.imul(ah5, bh9)) | 0; + var w14 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w14 >>> 26)) | 0; + w14 &= 0x3ffffff; + /* k = 15 */ + lo = Math.imul(al9, bl6); + mid = Math.imul(al9, bh6); + mid = (mid + Math.imul(ah9, bl6)) | 0; + hi = Math.imul(ah9, bh6); + lo = (lo + Math.imul(al8, bl7)) | 0; + mid = (mid + Math.imul(al8, bh7)) | 0; + mid = (mid + Math.imul(ah8, bl7)) | 0; + hi = (hi + Math.imul(ah8, bh7)) | 0; + lo = (lo + Math.imul(al7, bl8)) | 0; + mid = (mid + Math.imul(al7, bh8)) | 0; + mid = (mid + Math.imul(ah7, bl8)) | 0; + hi = (hi + Math.imul(ah7, bh8)) | 0; + lo = (lo + Math.imul(al6, bl9)) | 0; + mid = (mid + Math.imul(al6, bh9)) | 0; + mid = (mid + Math.imul(ah6, bl9)) | 0; + hi = (hi + Math.imul(ah6, bh9)) | 0; + var w15 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w15 >>> 26)) | 0; + w15 &= 0x3ffffff; + /* k = 16 */ + lo = Math.imul(al9, bl7); + mid = Math.imul(al9, bh7); + mid = (mid + Math.imul(ah9, bl7)) | 0; + hi = Math.imul(ah9, bh7); + lo = (lo + Math.imul(al8, bl8)) | 0; + mid = (mid + Math.imul(al8, bh8)) | 0; + mid = (mid + Math.imul(ah8, bl8)) | 0; + hi = (hi + Math.imul(ah8, bh8)) | 0; + lo = (lo + Math.imul(al7, bl9)) | 0; + mid = (mid + Math.imul(al7, bh9)) | 0; + mid = (mid + Math.imul(ah7, bl9)) | 0; + hi = (hi + Math.imul(ah7, bh9)) | 0; + var w16 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w16 >>> 26)) | 0; + w16 &= 0x3ffffff; + /* k = 17 */ + lo = Math.imul(al9, bl8); + mid = Math.imul(al9, bh8); + mid = (mid + Math.imul(ah9, bl8)) | 0; + hi = Math.imul(ah9, bh8); + lo = (lo + Math.imul(al8, bl9)) | 0; + mid = (mid + Math.imul(al8, bh9)) | 0; + mid = (mid + Math.imul(ah8, bl9)) | 0; + hi = (hi + Math.imul(ah8, bh9)) | 0; + var w17 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w17 >>> 26)) | 0; + w17 &= 0x3ffffff; + /* k = 18 */ + lo = Math.imul(al9, bl9); + mid = Math.imul(al9, bh9); + mid = (mid + Math.imul(ah9, bl9)) | 0; + hi = Math.imul(ah9, bh9); + var w18 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0; + c = (((hi + (mid >>> 13)) | 0) + (w18 >>> 26)) | 0; + w18 &= 0x3ffffff; + o[0] = w0; + o[1] = w1; + o[2] = w2; + o[3] = w3; + o[4] = w4; + o[5] = w5; + o[6] = w6; + o[7] = w7; + o[8] = w8; + o[9] = w9; + o[10] = w10; + o[11] = w11; + o[12] = w12; + o[13] = w13; + o[14] = w14; + o[15] = w15; + o[16] = w16; + o[17] = w17; + o[18] = w18; + if (c !== 0) { + o[19] = c; + out.length++; + } + return out; + }; + + // Polyfill comb + if (!Math.imul) { + comb10MulTo = smallMulTo; + } + + function bigMulTo (self, num, out) { + out.negative = num.negative ^ self.negative; + out.length = self.length + num.length; + + var carry = 0; + var hncarry = 0; + for (var k = 0; k < out.length - 1; k++) { + // Sum all words with the same `i + j = k` and accumulate `ncarry`, + // note that ncarry could be >= 0x3ffffff + var ncarry = hncarry; + hncarry = 0; + var rword = carry & 0x3ffffff; + var maxJ = Math.min(k, num.length - 1); + for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) { + var i = k - j; + var a = self.words[i] | 0; + var b = num.words[j] | 0; + var r = a * b; + + var lo = r & 0x3ffffff; + ncarry = (ncarry + ((r / 0x4000000) | 0)) | 0; + lo = (lo + rword) | 0; + rword = lo & 0x3ffffff; + ncarry = (ncarry + (lo >>> 26)) | 0; + + hncarry += ncarry >>> 26; + ncarry &= 0x3ffffff; + } + out.words[k] = rword; + carry = ncarry; + ncarry = hncarry; + } + if (carry !== 0) { + out.words[k] = carry; + } else { + out.length--; + } + + return out.strip(); + } + + function jumboMulTo (self, num, out) { + var fftm = new FFTM(); + return fftm.mulp(self, num, out); + } + + BN.prototype.mulTo = function mulTo (num, out) { + var res; + var len = this.length + num.length; + if (this.length === 10 && num.length === 10) { + res = comb10MulTo(this, num, out); + } else if (len < 63) { + res = smallMulTo(this, num, out); + } else if (len < 1024) { + res = bigMulTo(this, num, out); + } else { + res = jumboMulTo(this, num, out); + } + + return res; + }; + + // Cooley-Tukey algorithm for FFT + // slightly revisited to rely on looping instead of recursion + + function FFTM (x, y) { + this.x = x; + this.y = y; + } + + FFTM.prototype.makeRBT = function makeRBT (N) { + var t = new Array(N); + var l = BN.prototype._countBits(N) - 1; + for (var i = 0; i < N; i++) { + t[i] = this.revBin(i, l, N); + } + + return t; + }; + + // Returns binary-reversed representation of `x` + FFTM.prototype.revBin = function revBin (x, l, N) { + if (x === 0 || x === N - 1) return x; + + var rb = 0; + for (var i = 0; i < l; i++) { + rb |= (x & 1) << (l - i - 1); + x >>= 1; + } + + return rb; + }; + + // Performs "tweedling" phase, therefore 'emulating' + // behaviour of the recursive algorithm + FFTM.prototype.permute = function permute (rbt, rws, iws, rtws, itws, N) { + for (var i = 0; i < N; i++) { + rtws[i] = rws[rbt[i]]; + itws[i] = iws[rbt[i]]; + } + }; + + FFTM.prototype.transform = function transform (rws, iws, rtws, itws, N, rbt) { + this.permute(rbt, rws, iws, rtws, itws, N); + + for (var s = 1; s < N; s <<= 1) { + var l = s << 1; + + var rtwdf = Math.cos(2 * Math.PI / l); + var itwdf = Math.sin(2 * Math.PI / l); + + for (var p = 0; p < N; p += l) { + var rtwdf_ = rtwdf; + var itwdf_ = itwdf; + + for (var j = 0; j < s; j++) { + var re = rtws[p + j]; + var ie = itws[p + j]; + + var ro = rtws[p + j + s]; + var io = itws[p + j + s]; + + var rx = rtwdf_ * ro - itwdf_ * io; + + io = rtwdf_ * io + itwdf_ * ro; + ro = rx; + + rtws[p + j] = re + ro; + itws[p + j] = ie + io; + + rtws[p + j + s] = re - ro; + itws[p + j + s] = ie - io; + + /* jshint maxdepth : false */ + if (j !== l) { + rx = rtwdf * rtwdf_ - itwdf * itwdf_; + + itwdf_ = rtwdf * itwdf_ + itwdf * rtwdf_; + rtwdf_ = rx; + } + } + } + } + }; + + FFTM.prototype.guessLen13b = function guessLen13b (n, m) { + var N = Math.max(m, n) | 1; + var odd = N & 1; + var i = 0; + for (N = N / 2 | 0; N; N = N >>> 1) { + i++; + } + + return 1 << i + 1 + odd; + }; + + FFTM.prototype.conjugate = function conjugate (rws, iws, N) { + if (N <= 1) return; + + for (var i = 0; i < N / 2; i++) { + var t = rws[i]; + + rws[i] = rws[N - i - 1]; + rws[N - i - 1] = t; + + t = iws[i]; + + iws[i] = -iws[N - i - 1]; + iws[N - i - 1] = -t; + } + }; + + FFTM.prototype.normalize13b = function normalize13b (ws, N) { + var carry = 0; + for (var i = 0; i < N / 2; i++) { + var w = Math.round(ws[2 * i + 1] / N) * 0x2000 + + Math.round(ws[2 * i] / N) + + carry; + + ws[i] = w & 0x3ffffff; + + if (w < 0x4000000) { + carry = 0; + } else { + carry = w / 0x4000000 | 0; + } + } + + return ws; + }; + + FFTM.prototype.convert13b = function convert13b (ws, len, rws, N) { + var carry = 0; + for (var i = 0; i < len; i++) { + carry = carry + (ws[i] | 0); + + rws[2 * i] = carry & 0x1fff; carry = carry >>> 13; + rws[2 * i + 1] = carry & 0x1fff; carry = carry >>> 13; + } + + // Pad with zeroes + for (i = 2 * len; i < N; ++i) { + rws[i] = 0; + } + + assert(carry === 0); + assert((carry & ~0x1fff) === 0); + }; + + FFTM.prototype.stub = function stub (N) { + var ph = new Array(N); + for (var i = 0; i < N; i++) { + ph[i] = 0; + } + + return ph; + }; + + FFTM.prototype.mulp = function mulp (x, y, out) { + var N = 2 * this.guessLen13b(x.length, y.length); + + var rbt = this.makeRBT(N); + + var _ = this.stub(N); + + var rws = new Array(N); + var rwst = new Array(N); + var iwst = new Array(N); + + var nrws = new Array(N); + var nrwst = new Array(N); + var niwst = new Array(N); + + var rmws = out.words; + rmws.length = N; + + this.convert13b(x.words, x.length, rws, N); + this.convert13b(y.words, y.length, nrws, N); + + this.transform(rws, _, rwst, iwst, N, rbt); + this.transform(nrws, _, nrwst, niwst, N, rbt); + + for (var i = 0; i < N; i++) { + var rx = rwst[i] * nrwst[i] - iwst[i] * niwst[i]; + iwst[i] = rwst[i] * niwst[i] + iwst[i] * nrwst[i]; + rwst[i] = rx; + } + + this.conjugate(rwst, iwst, N); + this.transform(rwst, iwst, rmws, _, N, rbt); + this.conjugate(rmws, _, N); + this.normalize13b(rmws, N); + + out.negative = x.negative ^ y.negative; + out.length = x.length + y.length; + return out.strip(); + }; + + // Multiply `this` by `num` + BN.prototype.mul = function mul (num) { + var out = new BN(null); + out.words = new Array(this.length + num.length); + return this.mulTo(num, out); + }; + + // Multiply employing FFT + BN.prototype.mulf = function mulf (num) { + var out = new BN(null); + out.words = new Array(this.length + num.length); + return jumboMulTo(this, num, out); + }; + + // In-place Multiplication + BN.prototype.imul = function imul (num) { + return this.clone().mulTo(num, this); + }; + + BN.prototype.imuln = function imuln (num) { + assert(typeof num === 'number'); + assert(num < 0x4000000); + + // Carry + var carry = 0; + for (var i = 0; i < this.length; i++) { + var w = (this.words[i] | 0) * num; + var lo = (w & 0x3ffffff) + (carry & 0x3ffffff); + carry >>= 26; + carry += (w / 0x4000000) | 0; + // NOTE: lo is 27bit maximum + carry += lo >>> 26; + this.words[i] = lo & 0x3ffffff; + } + + if (carry !== 0) { + this.words[i] = carry; + this.length++; + } + + return this; + }; + + BN.prototype.muln = function muln (num) { + return this.clone().imuln(num); + }; + + // `this` * `this` + BN.prototype.sqr = function sqr () { + return this.mul(this); + }; + + // `this` * `this` in-place + BN.prototype.isqr = function isqr () { + return this.imul(this.clone()); + }; + + // Math.pow(`this`, `num`) + BN.prototype.pow = function pow (num) { + var w = toBitArray(num); + if (w.length === 0) return new BN(1); + + // Skip leading zeroes + var res = this; + for (var i = 0; i < w.length; i++, res = res.sqr()) { + if (w[i] !== 0) break; + } + + if (++i < w.length) { + for (var q = res.sqr(); i < w.length; i++, q = q.sqr()) { + if (w[i] === 0) continue; + + res = res.mul(q); + } + } + + return res; + }; + + // Shift-left in-place + BN.prototype.iushln = function iushln (bits) { + assert(typeof bits === 'number' && bits >= 0); + var r = bits % 26; + var s = (bits - r) / 26; + var carryMask = (0x3ffffff >>> (26 - r)) << (26 - r); + var i; + + if (r !== 0) { + var carry = 0; + + for (i = 0; i < this.length; i++) { + var newCarry = this.words[i] & carryMask; + var c = ((this.words[i] | 0) - newCarry) << r; + this.words[i] = c | carry; + carry = newCarry >>> (26 - r); + } + + if (carry) { + this.words[i] = carry; + this.length++; + } + } + + if (s !== 0) { + for (i = this.length - 1; i >= 0; i--) { + this.words[i + s] = this.words[i]; + } + + for (i = 0; i < s; i++) { + this.words[i] = 0; + } + + this.length += s; + } + + return this.strip(); + }; + + BN.prototype.ishln = function ishln (bits) { + // TODO(indutny): implement me + assert(this.negative === 0); + return this.iushln(bits); + }; + + // Shift-right in-place + // NOTE: `hint` is a lowest bit before trailing zeroes + // NOTE: if `extended` is present - it will be filled with destroyed bits + BN.prototype.iushrn = function iushrn (bits, hint, extended) { + assert(typeof bits === 'number' && bits >= 0); + var h; + if (hint) { + h = (hint - (hint % 26)) / 26; + } else { + h = 0; + } + + var r = bits % 26; + var s = Math.min((bits - r) / 26, this.length); + var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r); + var maskedWords = extended; + + h -= s; + h = Math.max(0, h); + + // Extended mode, copy masked part + if (maskedWords) { + for (var i = 0; i < s; i++) { + maskedWords.words[i] = this.words[i]; + } + maskedWords.length = s; + } + + if (s === 0) { + // No-op, we should not move anything at all + } else if (this.length > s) { + this.length -= s; + for (i = 0; i < this.length; i++) { + this.words[i] = this.words[i + s]; + } + } else { + this.words[0] = 0; + this.length = 1; + } + + var carry = 0; + for (i = this.length - 1; i >= 0 && (carry !== 0 || i >= h); i--) { + var word = this.words[i] | 0; + this.words[i] = (carry << (26 - r)) | (word >>> r); + carry = word & mask; + } + + // Push carried bits as a mask + if (maskedWords && carry !== 0) { + maskedWords.words[maskedWords.length++] = carry; + } + + if (this.length === 0) { + this.words[0] = 0; + this.length = 1; + } + + return this.strip(); + }; + + BN.prototype.ishrn = function ishrn (bits, hint, extended) { + // TODO(indutny): implement me + assert(this.negative === 0); + return this.iushrn(bits, hint, extended); + }; + + // Shift-left + BN.prototype.shln = function shln (bits) { + return this.clone().ishln(bits); + }; + + BN.prototype.ushln = function ushln (bits) { + return this.clone().iushln(bits); + }; + + // Shift-right + BN.prototype.shrn = function shrn (bits) { + return this.clone().ishrn(bits); + }; + + BN.prototype.ushrn = function ushrn (bits) { + return this.clone().iushrn(bits); + }; + + // Test if n bit is set + BN.prototype.testn = function testn (bit) { + assert(typeof bit === 'number' && bit >= 0); + var r = bit % 26; + var s = (bit - r) / 26; + var q = 1 << r; + + // Fast case: bit is much higher than all existing words + if (this.length <= s) return false; + + // Check bit and return + var w = this.words[s]; + + return !!(w & q); + }; + + // Return only lowers bits of number (in-place) + BN.prototype.imaskn = function imaskn (bits) { + assert(typeof bits === 'number' && bits >= 0); + var r = bits % 26; + var s = (bits - r) / 26; + + assert(this.negative === 0, 'imaskn works only with positive numbers'); + + if (this.length <= s) { + return this; + } + + if (r !== 0) { + s++; + } + this.length = Math.min(s, this.length); + + if (r !== 0) { + var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r); + this.words[this.length - 1] &= mask; + } + + return this.strip(); + }; + + // Return only lowers bits of number + BN.prototype.maskn = function maskn (bits) { + return this.clone().imaskn(bits); + }; + + // Add plain number `num` to `this` + BN.prototype.iaddn = function iaddn (num) { + assert(typeof num === 'number'); + assert(num < 0x4000000); + if (num < 0) return this.isubn(-num); + + // Possible sign change + if (this.negative !== 0) { + if (this.length === 1 && (this.words[0] | 0) < num) { + this.words[0] = num - (this.words[0] | 0); + this.negative = 0; + return this; + } + + this.negative = 0; + this.isubn(num); + this.negative = 1; + return this; + } + + // Add without checks + return this._iaddn(num); + }; + + BN.prototype._iaddn = function _iaddn (num) { + this.words[0] += num; + + // Carry + for (var i = 0; i < this.length && this.words[i] >= 0x4000000; i++) { + this.words[i] -= 0x4000000; + if (i === this.length - 1) { + this.words[i + 1] = 1; + } else { + this.words[i + 1]++; + } + } + this.length = Math.max(this.length, i + 1); + + return this; + }; + + // Subtract plain number `num` from `this` + BN.prototype.isubn = function isubn (num) { + assert(typeof num === 'number'); + assert(num < 0x4000000); + if (num < 0) return this.iaddn(-num); + + if (this.negative !== 0) { + this.negative = 0; + this.iaddn(num); + this.negative = 1; + return this; + } + + this.words[0] -= num; + + if (this.length === 1 && this.words[0] < 0) { + this.words[0] = -this.words[0]; + this.negative = 1; + } else { + // Carry + for (var i = 0; i < this.length && this.words[i] < 0; i++) { + this.words[i] += 0x4000000; + this.words[i + 1] -= 1; + } + } + + return this.strip(); + }; + + BN.prototype.addn = function addn (num) { + return this.clone().iaddn(num); + }; + + BN.prototype.subn = function subn (num) { + return this.clone().isubn(num); + }; + + BN.prototype.iabs = function iabs () { + this.negative = 0; + + return this; + }; + + BN.prototype.abs = function abs () { + return this.clone().iabs(); + }; + + BN.prototype._ishlnsubmul = function _ishlnsubmul (num, mul, shift) { + var len = num.length + shift; + var i; + + this._expand(len); + + var w; + var carry = 0; + for (i = 0; i < num.length; i++) { + w = (this.words[i + shift] | 0) + carry; + var right = (num.words[i] | 0) * mul; + w -= right & 0x3ffffff; + carry = (w >> 26) - ((right / 0x4000000) | 0); + this.words[i + shift] = w & 0x3ffffff; + } + for (; i < this.length - shift; i++) { + w = (this.words[i + shift] | 0) + carry; + carry = w >> 26; + this.words[i + shift] = w & 0x3ffffff; + } + + if (carry === 0) return this.strip(); + + // Subtraction overflow + assert(carry === -1); + carry = 0; + for (i = 0; i < this.length; i++) { + w = -(this.words[i] | 0) + carry; + carry = w >> 26; + this.words[i] = w & 0x3ffffff; + } + this.negative = 1; + + return this.strip(); + }; + + BN.prototype._wordDiv = function _wordDiv (num, mode) { + var shift = this.length - num.length; + + var a = this.clone(); + var b = num; + + // Normalize + var bhi = b.words[b.length - 1] | 0; + var bhiBits = this._countBits(bhi); + shift = 26 - bhiBits; + if (shift !== 0) { + b = b.ushln(shift); + a.iushln(shift); + bhi = b.words[b.length - 1] | 0; + } + + // Initialize quotient + var m = a.length - b.length; + var q; + + if (mode !== 'mod') { + q = new BN(null); + q.length = m + 1; + q.words = new Array(q.length); + for (var i = 0; i < q.length; i++) { + q.words[i] = 0; + } + } + + var diff = a.clone()._ishlnsubmul(b, 1, m); + if (diff.negative === 0) { + a = diff; + if (q) { + q.words[m] = 1; + } + } + + for (var j = m - 1; j >= 0; j--) { + var qj = (a.words[b.length + j] | 0) * 0x4000000 + + (a.words[b.length + j - 1] | 0); + + // NOTE: (qj / bhi) is (0x3ffffff * 0x4000000 + 0x3ffffff) / 0x2000000 max + // (0x7ffffff) + qj = Math.min((qj / bhi) | 0, 0x3ffffff); + + a._ishlnsubmul(b, qj, j); + while (a.negative !== 0) { + qj--; + a.negative = 0; + a._ishlnsubmul(b, 1, j); + if (!a.isZero()) { + a.negative ^= 1; + } + } + if (q) { + q.words[j] = qj; + } + } + if (q) { + q.strip(); + } + a.strip(); + + // Denormalize + if (mode !== 'div' && shift !== 0) { + a.iushrn(shift); + } + + return { + div: q || null, + mod: a + }; + }; + + // NOTE: 1) `mode` can be set to `mod` to request mod only, + // to `div` to request div only, or be absent to + // request both div & mod + // 2) `positive` is true if unsigned mod is requested + BN.prototype.divmod = function divmod (num, mode, positive) { + assert(!num.isZero()); + + if (this.isZero()) { + return { + div: new BN(0), + mod: new BN(0) + }; + } + + var div, mod, res; + if (this.negative !== 0 && num.negative === 0) { + res = this.neg().divmod(num, mode); + + if (mode !== 'mod') { + div = res.div.neg(); + } + + if (mode !== 'div') { + mod = res.mod.neg(); + if (positive && mod.negative !== 0) { + mod.iadd(num); + } + } + + return { + div: div, + mod: mod + }; + } + + if (this.negative === 0 && num.negative !== 0) { + res = this.divmod(num.neg(), mode); + + if (mode !== 'mod') { + div = res.div.neg(); + } + + return { + div: div, + mod: res.mod + }; + } + + if ((this.negative & num.negative) !== 0) { + res = this.neg().divmod(num.neg(), mode); + + if (mode !== 'div') { + mod = res.mod.neg(); + if (positive && mod.negative !== 0) { + mod.isub(num); + } + } + + return { + div: res.div, + mod: mod + }; + } + + // Both numbers are positive at this point + + // Strip both numbers to approximate shift value + if (num.length > this.length || this.cmp(num) < 0) { + return { + div: new BN(0), + mod: this + }; + } + + // Very short reduction + if (num.length === 1) { + if (mode === 'div') { + return { + div: this.divn(num.words[0]), + mod: null + }; + } + + if (mode === 'mod') { + return { + div: null, + mod: new BN(this.modn(num.words[0])) + }; + } + + return { + div: this.divn(num.words[0]), + mod: new BN(this.modn(num.words[0])) + }; + } + + return this._wordDiv(num, mode); + }; + + // Find `this` / `num` + BN.prototype.div = function div (num) { + return this.divmod(num, 'div', false).div; + }; + + // Find `this` % `num` + BN.prototype.mod = function mod (num) { + return this.divmod(num, 'mod', false).mod; + }; + + BN.prototype.umod = function umod (num) { + return this.divmod(num, 'mod', true).mod; + }; + + // Find Round(`this` / `num`) + BN.prototype.divRound = function divRound (num) { + var dm = this.divmod(num); + + // Fast case - exact division + if (dm.mod.isZero()) return dm.div; + + var mod = dm.div.negative !== 0 ? dm.mod.isub(num) : dm.mod; + + var half = num.ushrn(1); + var r2 = num.andln(1); + var cmp = mod.cmp(half); + + // Round down + if (cmp < 0 || r2 === 1 && cmp === 0) return dm.div; + + // Round up + return dm.div.negative !== 0 ? dm.div.isubn(1) : dm.div.iaddn(1); + }; + + BN.prototype.modn = function modn (num) { + assert(num <= 0x3ffffff); + var p = (1 << 26) % num; + + var acc = 0; + for (var i = this.length - 1; i >= 0; i--) { + acc = (p * acc + (this.words[i] | 0)) % num; + } + + return acc; + }; + + // In-place division by number + BN.prototype.idivn = function idivn (num) { + assert(num <= 0x3ffffff); + + var carry = 0; + for (var i = this.length - 1; i >= 0; i--) { + var w = (this.words[i] | 0) + carry * 0x4000000; + this.words[i] = (w / num) | 0; + carry = w % num; + } + + return this.strip(); + }; + + BN.prototype.divn = function divn (num) { + return this.clone().idivn(num); + }; + + BN.prototype.egcd = function egcd (p) { + assert(p.negative === 0); + assert(!p.isZero()); + + var x = this; + var y = p.clone(); + + if (x.negative !== 0) { + x = x.umod(p); + } else { + x = x.clone(); + } + + // A * x + B * y = x + var A = new BN(1); + var B = new BN(0); + + // C * x + D * y = y + var C = new BN(0); + var D = new BN(1); + + var g = 0; + + while (x.isEven() && y.isEven()) { + x.iushrn(1); + y.iushrn(1); + ++g; + } + + var yp = y.clone(); + var xp = x.clone(); + + while (!x.isZero()) { + for (var i = 0, im = 1; (x.words[0] & im) === 0 && i < 26; ++i, im <<= 1); + if (i > 0) { + x.iushrn(i); + while (i-- > 0) { + if (A.isOdd() || B.isOdd()) { + A.iadd(yp); + B.isub(xp); + } + + A.iushrn(1); + B.iushrn(1); + } + } + + for (var j = 0, jm = 1; (y.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1); + if (j > 0) { + y.iushrn(j); + while (j-- > 0) { + if (C.isOdd() || D.isOdd()) { + C.iadd(yp); + D.isub(xp); + } + + C.iushrn(1); + D.iushrn(1); + } + } + + if (x.cmp(y) >= 0) { + x.isub(y); + A.isub(C); + B.isub(D); + } else { + y.isub(x); + C.isub(A); + D.isub(B); + } + } + + return { + a: C, + b: D, + gcd: y.iushln(g) + }; + }; + + // This is reduced incarnation of the binary EEA + // above, designated to invert members of the + // _prime_ fields F(p) at a maximal speed + BN.prototype._invmp = function _invmp (p) { + assert(p.negative === 0); + assert(!p.isZero()); + + var a = this; + var b = p.clone(); + + if (a.negative !== 0) { + a = a.umod(p); + } else { + a = a.clone(); + } + + var x1 = new BN(1); + var x2 = new BN(0); + + var delta = b.clone(); + + while (a.cmpn(1) > 0 && b.cmpn(1) > 0) { + for (var i = 0, im = 1; (a.words[0] & im) === 0 && i < 26; ++i, im <<= 1); + if (i > 0) { + a.iushrn(i); + while (i-- > 0) { + if (x1.isOdd()) { + x1.iadd(delta); + } + + x1.iushrn(1); + } + } + + for (var j = 0, jm = 1; (b.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1); + if (j > 0) { + b.iushrn(j); + while (j-- > 0) { + if (x2.isOdd()) { + x2.iadd(delta); + } + + x2.iushrn(1); + } + } + + if (a.cmp(b) >= 0) { + a.isub(b); + x1.isub(x2); + } else { + b.isub(a); + x2.isub(x1); + } + } + + var res; + if (a.cmpn(1) === 0) { + res = x1; + } else { + res = x2; + } + + if (res.cmpn(0) < 0) { + res.iadd(p); + } + + return res; + }; + + BN.prototype.gcd = function gcd (num) { + if (this.isZero()) return num.abs(); + if (num.isZero()) return this.abs(); + + var a = this.clone(); + var b = num.clone(); + a.negative = 0; + b.negative = 0; + + // Remove common factor of two + for (var shift = 0; a.isEven() && b.isEven(); shift++) { + a.iushrn(1); + b.iushrn(1); + } + + do { + while (a.isEven()) { + a.iushrn(1); + } + while (b.isEven()) { + b.iushrn(1); + } + + var r = a.cmp(b); + if (r < 0) { + // Swap `a` and `b` to make `a` always bigger than `b` + var t = a; + a = b; + b = t; + } else if (r === 0 || b.cmpn(1) === 0) { + break; + } + + a.isub(b); + } while (true); + + return b.iushln(shift); + }; + + // Invert number in the field F(num) + BN.prototype.invm = function invm (num) { + return this.egcd(num).a.umod(num); + }; + + BN.prototype.isEven = function isEven () { + return (this.words[0] & 1) === 0; + }; + + BN.prototype.isOdd = function isOdd () { + return (this.words[0] & 1) === 1; + }; + + // And first word and num + BN.prototype.andln = function andln (num) { + return this.words[0] & num; + }; + + // Increment at the bit position in-line + BN.prototype.bincn = function bincn (bit) { + assert(typeof bit === 'number'); + var r = bit % 26; + var s = (bit - r) / 26; + var q = 1 << r; + + // Fast case: bit is much higher than all existing words + if (this.length <= s) { + this._expand(s + 1); + this.words[s] |= q; + return this; + } + + // Add bit and propagate, if needed + var carry = q; + for (var i = s; carry !== 0 && i < this.length; i++) { + var w = this.words[i] | 0; + w += carry; + carry = w >>> 26; + w &= 0x3ffffff; + this.words[i] = w; + } + if (carry !== 0) { + this.words[i] = carry; + this.length++; + } + return this; + }; + + BN.prototype.isZero = function isZero () { + return this.length === 1 && this.words[0] === 0; + }; + + BN.prototype.cmpn = function cmpn (num) { + var negative = num < 0; + + if (this.negative !== 0 && !negative) return -1; + if (this.negative === 0 && negative) return 1; + + this.strip(); + + var res; + if (this.length > 1) { + res = 1; + } else { + if (negative) { + num = -num; + } + + assert(num <= 0x3ffffff, 'Number is too big'); + + var w = this.words[0] | 0; + res = w === num ? 0 : w < num ? -1 : 1; + } + if (this.negative !== 0) return -res | 0; + return res; + }; + + // Compare two numbers and return: + // 1 - if `this` > `num` + // 0 - if `this` == `num` + // -1 - if `this` < `num` + BN.prototype.cmp = function cmp (num) { + if (this.negative !== 0 && num.negative === 0) return -1; + if (this.negative === 0 && num.negative !== 0) return 1; + + var res = this.ucmp(num); + if (this.negative !== 0) return -res | 0; + return res; + }; + + // Unsigned comparison + BN.prototype.ucmp = function ucmp (num) { + // At this point both numbers have the same sign + if (this.length > num.length) return 1; + if (this.length < num.length) return -1; + + var res = 0; + for (var i = this.length - 1; i >= 0; i--) { + var a = this.words[i] | 0; + var b = num.words[i] | 0; + + if (a === b) continue; + if (a < b) { + res = -1; + } else if (a > b) { + res = 1; + } + break; + } + return res; + }; + + BN.prototype.gtn = function gtn (num) { + return this.cmpn(num) === 1; + }; + + BN.prototype.gt = function gt (num) { + return this.cmp(num) === 1; + }; + + BN.prototype.gten = function gten (num) { + return this.cmpn(num) >= 0; + }; + + BN.prototype.gte = function gte (num) { + return this.cmp(num) >= 0; + }; + + BN.prototype.ltn = function ltn (num) { + return this.cmpn(num) === -1; + }; + + BN.prototype.lt = function lt (num) { + return this.cmp(num) === -1; + }; + + BN.prototype.lten = function lten (num) { + return this.cmpn(num) <= 0; + }; + + BN.prototype.lte = function lte (num) { + return this.cmp(num) <= 0; + }; + + BN.prototype.eqn = function eqn (num) { + return this.cmpn(num) === 0; + }; + + BN.prototype.eq = function eq (num) { + return this.cmp(num) === 0; + }; + + // + // A reduce context, could be using montgomery or something better, depending + // on the `m` itself. + // + BN.red = function red (num) { + return new Red(num); + }; + + BN.prototype.toRed = function toRed (ctx) { + assert(!this.red, 'Already a number in reduction context'); + assert(this.negative === 0, 'red works only with positives'); + return ctx.convertTo(this)._forceRed(ctx); + }; + + BN.prototype.fromRed = function fromRed () { + assert(this.red, 'fromRed works only with numbers in reduction context'); + return this.red.convertFrom(this); + }; + + BN.prototype._forceRed = function _forceRed (ctx) { + this.red = ctx; + return this; + }; + + BN.prototype.forceRed = function forceRed (ctx) { + assert(!this.red, 'Already a number in reduction context'); + return this._forceRed(ctx); + }; + + BN.prototype.redAdd = function redAdd (num) { + assert(this.red, 'redAdd works only with red numbers'); + return this.red.add(this, num); + }; + + BN.prototype.redIAdd = function redIAdd (num) { + assert(this.red, 'redIAdd works only with red numbers'); + return this.red.iadd(this, num); + }; + + BN.prototype.redSub = function redSub (num) { + assert(this.red, 'redSub works only with red numbers'); + return this.red.sub(this, num); + }; + + BN.prototype.redISub = function redISub (num) { + assert(this.red, 'redISub works only with red numbers'); + return this.red.isub(this, num); + }; + + BN.prototype.redShl = function redShl (num) { + assert(this.red, 'redShl works only with red numbers'); + return this.red.shl(this, num); + }; + + BN.prototype.redMul = function redMul (num) { + assert(this.red, 'redMul works only with red numbers'); + this.red._verify2(this, num); + return this.red.mul(this, num); + }; + + BN.prototype.redIMul = function redIMul (num) { + assert(this.red, 'redMul works only with red numbers'); + this.red._verify2(this, num); + return this.red.imul(this, num); + }; + + BN.prototype.redSqr = function redSqr () { + assert(this.red, 'redSqr works only with red numbers'); + this.red._verify1(this); + return this.red.sqr(this); + }; + + BN.prototype.redISqr = function redISqr () { + assert(this.red, 'redISqr works only with red numbers'); + this.red._verify1(this); + return this.red.isqr(this); + }; + + // Square root over p + BN.prototype.redSqrt = function redSqrt () { + assert(this.red, 'redSqrt works only with red numbers'); + this.red._verify1(this); + return this.red.sqrt(this); + }; + + BN.prototype.redInvm = function redInvm () { + assert(this.red, 'redInvm works only with red numbers'); + this.red._verify1(this); + return this.red.invm(this); + }; + + // Return negative clone of `this` % `red modulo` + BN.prototype.redNeg = function redNeg () { + assert(this.red, 'redNeg works only with red numbers'); + this.red._verify1(this); + return this.red.neg(this); + }; + + BN.prototype.redPow = function redPow (num) { + assert(this.red && !num.red, 'redPow(normalNum)'); + this.red._verify1(this); + return this.red.pow(this, num); + }; + + // Prime numbers with efficient reduction + var primes = { + k256: null, + p224: null, + p192: null, + p25519: null + }; + + // Pseudo-Mersenne prime + function MPrime (name, p) { + // P = 2 ^ N - K + this.name = name; + this.p = new BN(p, 16); + this.n = this.p.bitLength(); + this.k = new BN(1).iushln(this.n).isub(this.p); + + this.tmp = this._tmp(); + } + + MPrime.prototype._tmp = function _tmp () { + var tmp = new BN(null); + tmp.words = new Array(Math.ceil(this.n / 13)); + return tmp; + }; + + MPrime.prototype.ireduce = function ireduce (num) { + // Assumes that `num` is less than `P^2` + // num = HI * (2 ^ N - K) + HI * K + LO = HI * K + LO (mod P) + var r = num; + var rlen; + + do { + this.split(r, this.tmp); + r = this.imulK(r); + r = r.iadd(this.tmp); + rlen = r.bitLength(); + } while (rlen > this.n); + + var cmp = rlen < this.n ? -1 : r.ucmp(this.p); + if (cmp === 0) { + r.words[0] = 0; + r.length = 1; + } else if (cmp > 0) { + r.isub(this.p); + } else { + if (r.strip !== undefined) { + // r is BN v4 instance + r.strip(); + } else { + // r is BN v5 instance + r._strip(); + } + } + + return r; + }; + + MPrime.prototype.split = function split (input, out) { + input.iushrn(this.n, 0, out); + }; + + MPrime.prototype.imulK = function imulK (num) { + return num.imul(this.k); + }; + + function K256 () { + MPrime.call( + this, + 'k256', + 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f'); + } + inherits(K256, MPrime); + + K256.prototype.split = function split (input, output) { + // 256 = 9 * 26 + 22 + var mask = 0x3fffff; + + var outLen = Math.min(input.length, 9); + for (var i = 0; i < outLen; i++) { + output.words[i] = input.words[i]; + } + output.length = outLen; + + if (input.length <= 9) { + input.words[0] = 0; + input.length = 1; + return; + } + + // Shift by 9 limbs + var prev = input.words[9]; + output.words[output.length++] = prev & mask; + + for (i = 10; i < input.length; i++) { + var next = input.words[i] | 0; + input.words[i - 10] = ((next & mask) << 4) | (prev >>> 22); + prev = next; + } + prev >>>= 22; + input.words[i - 10] = prev; + if (prev === 0 && input.length > 10) { + input.length -= 10; + } else { + input.length -= 9; + } + }; + + K256.prototype.imulK = function imulK (num) { + // K = 0x1000003d1 = [ 0x40, 0x3d1 ] + num.words[num.length] = 0; + num.words[num.length + 1] = 0; + num.length += 2; + + // bounded at: 0x40 * 0x3ffffff + 0x3d0 = 0x100000390 + var lo = 0; + for (var i = 0; i < num.length; i++) { + var w = num.words[i] | 0; + lo += w * 0x3d1; + num.words[i] = lo & 0x3ffffff; + lo = w * 0x40 + ((lo / 0x4000000) | 0); + } + + // Fast length reduction + if (num.words[num.length - 1] === 0) { + num.length--; + if (num.words[num.length - 1] === 0) { + num.length--; + } + } + return num; + }; + + function P224 () { + MPrime.call( + this, + 'p224', + 'ffffffff ffffffff ffffffff ffffffff 00000000 00000000 00000001'); + } + inherits(P224, MPrime); + + function P192 () { + MPrime.call( + this, + 'p192', + 'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff'); + } + inherits(P192, MPrime); + + function P25519 () { + // 2 ^ 255 - 19 + MPrime.call( + this, + '25519', + '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed'); + } + inherits(P25519, MPrime); + + P25519.prototype.imulK = function imulK (num) { + // K = 0x13 + var carry = 0; + for (var i = 0; i < num.length; i++) { + var hi = (num.words[i] | 0) * 0x13 + carry; + var lo = hi & 0x3ffffff; + hi >>>= 26; + + num.words[i] = lo; + carry = hi; + } + if (carry !== 0) { + num.words[num.length++] = carry; + } + return num; + }; + + // Exported mostly for testing purposes, use plain name instead + BN._prime = function prime (name) { + // Cached version of prime + if (primes[name]) return primes[name]; + + var prime; + if (name === 'k256') { + prime = new K256(); + } else if (name === 'p224') { + prime = new P224(); + } else if (name === 'p192') { + prime = new P192(); + } else if (name === 'p25519') { + prime = new P25519(); + } else { + throw new Error('Unknown prime ' + name); + } + primes[name] = prime; + + return prime; + }; + + // + // Base reduction engine + // + function Red (m) { + if (typeof m === 'string') { + var prime = BN._prime(m); + this.m = prime.p; + this.prime = prime; + } else { + assert(m.gtn(1), 'modulus must be greater than 1'); + this.m = m; + this.prime = null; + } + } + + Red.prototype._verify1 = function _verify1 (a) { + assert(a.negative === 0, 'red works only with positives'); + assert(a.red, 'red works only with red numbers'); + }; + + Red.prototype._verify2 = function _verify2 (a, b) { + assert((a.negative | b.negative) === 0, 'red works only with positives'); + assert(a.red && a.red === b.red, + 'red works only with red numbers'); + }; + + Red.prototype.imod = function imod (a) { + if (this.prime) return this.prime.ireduce(a)._forceRed(this); + return a.umod(this.m)._forceRed(this); + }; + + Red.prototype.neg = function neg (a) { + if (a.isZero()) { + return a.clone(); + } + + return this.m.sub(a)._forceRed(this); + }; + + Red.prototype.add = function add (a, b) { + this._verify2(a, b); + + var res = a.add(b); + if (res.cmp(this.m) >= 0) { + res.isub(this.m); + } + return res._forceRed(this); + }; + + Red.prototype.iadd = function iadd (a, b) { + this._verify2(a, b); + + var res = a.iadd(b); + if (res.cmp(this.m) >= 0) { + res.isub(this.m); + } + return res; + }; + + Red.prototype.sub = function sub (a, b) { + this._verify2(a, b); + + var res = a.sub(b); + if (res.cmpn(0) < 0) { + res.iadd(this.m); + } + return res._forceRed(this); + }; + + Red.prototype.isub = function isub (a, b) { + this._verify2(a, b); + + var res = a.isub(b); + if (res.cmpn(0) < 0) { + res.iadd(this.m); + } + return res; + }; + + Red.prototype.shl = function shl (a, num) { + this._verify1(a); + return this.imod(a.ushln(num)); + }; + + Red.prototype.imul = function imul (a, b) { + this._verify2(a, b); + return this.imod(a.imul(b)); + }; + + Red.prototype.mul = function mul (a, b) { + this._verify2(a, b); + return this.imod(a.mul(b)); + }; + + Red.prototype.isqr = function isqr (a) { + return this.imul(a, a.clone()); + }; + + Red.prototype.sqr = function sqr (a) { + return this.mul(a, a); + }; + + Red.prototype.sqrt = function sqrt (a) { + if (a.isZero()) return a.clone(); + + var mod3 = this.m.andln(3); + assert(mod3 % 2 === 1); + + // Fast case + if (mod3 === 3) { + var pow = this.m.add(new BN(1)).iushrn(2); + return this.pow(a, pow); + } + + // Tonelli-Shanks algorithm (Totally unoptimized and slow) + // + // Find Q and S, that Q * 2 ^ S = (P - 1) + var q = this.m.subn(1); + var s = 0; + while (!q.isZero() && q.andln(1) === 0) { + s++; + q.iushrn(1); + } + assert(!q.isZero()); + + var one = new BN(1).toRed(this); + var nOne = one.redNeg(); + + // Find quadratic non-residue + // NOTE: Max is such because of generalized Riemann hypothesis. + var lpow = this.m.subn(1).iushrn(1); + var z = this.m.bitLength(); + z = new BN(2 * z * z).toRed(this); + + while (this.pow(z, lpow).cmp(nOne) !== 0) { + z.redIAdd(nOne); + } + + var c = this.pow(z, q); + var r = this.pow(a, q.addn(1).iushrn(1)); + var t = this.pow(a, q); + var m = s; + while (t.cmp(one) !== 0) { + var tmp = t; + for (var i = 0; tmp.cmp(one) !== 0; i++) { + tmp = tmp.redSqr(); + } + assert(i < m); + var b = this.pow(c, new BN(1).iushln(m - i - 1)); + + r = r.redMul(b); + c = b.redSqr(); + t = t.redMul(c); + m = i; + } + + return r; + }; + + Red.prototype.invm = function invm (a) { + var inv = a._invmp(this.m); + if (inv.negative !== 0) { + inv.negative = 0; + return this.imod(inv).redNeg(); + } else { + return this.imod(inv); + } + }; + + Red.prototype.pow = function pow (a, num) { + if (num.isZero()) return new BN(1).toRed(this); + if (num.cmpn(1) === 0) return a.clone(); + + var windowSize = 4; + var wnd = new Array(1 << windowSize); + wnd[0] = new BN(1).toRed(this); + wnd[1] = a; + for (var i = 2; i < wnd.length; i++) { + wnd[i] = this.mul(wnd[i - 1], a); + } + + var res = wnd[0]; + var current = 0; + var currentLen = 0; + var start = num.bitLength() % 26; + if (start === 0) { + start = 26; + } + + for (i = num.length - 1; i >= 0; i--) { + var word = num.words[i]; + for (var j = start - 1; j >= 0; j--) { + var bit = (word >> j) & 1; + if (res !== wnd[0]) { + res = this.sqr(res); + } + + if (bit === 0 && current === 0) { + currentLen = 0; + continue; + } + + current <<= 1; + current |= bit; + currentLen++; + if (currentLen !== windowSize && (i !== 0 || j !== 0)) continue; + + res = this.mul(res, wnd[current]); + currentLen = 0; + current = 0; + } + start = 26; + } + + return res; + }; + + Red.prototype.convertTo = function convertTo (num) { + var r = num.umod(this.m); + + return r === num ? r.clone() : r; + }; + + Red.prototype.convertFrom = function convertFrom (num) { + var res = num.clone(); + res.red = null; + return res; + }; + + // + // Montgomery method engine + // + + BN.mont = function mont (num) { + return new Mont(num); + }; + + function Mont (m) { + Red.call(this, m); + + this.shift = this.m.bitLength(); + if (this.shift % 26 !== 0) { + this.shift += 26 - (this.shift % 26); + } + + this.r = new BN(1).iushln(this.shift); + this.r2 = this.imod(this.r.sqr()); + this.rinv = this.r._invmp(this.m); + + this.minv = this.rinv.mul(this.r).isubn(1).div(this.m); + this.minv = this.minv.umod(this.r); + this.minv = this.r.sub(this.minv); + } + inherits(Mont, Red); + + Mont.prototype.convertTo = function convertTo (num) { + return this.imod(num.ushln(this.shift)); + }; + + Mont.prototype.convertFrom = function convertFrom (num) { + var r = this.imod(num.mul(this.rinv)); + r.red = null; + return r; + }; + + Mont.prototype.imul = function imul (a, b) { + if (a.isZero() || b.isZero()) { + a.words[0] = 0; + a.length = 1; + return a; + } + + var t = a.imul(b); + var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m); + var u = t.isub(c).iushrn(this.shift); + var res = u; + + if (u.cmp(this.m) >= 0) { + res = u.isub(this.m); + } else if (u.cmpn(0) < 0) { + res = u.iadd(this.m); + } + + return res._forceRed(this); + }; + + Mont.prototype.mul = function mul (a, b) { + if (a.isZero() || b.isZero()) return new BN(0)._forceRed(this); + + var t = a.mul(b); + var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m); + var u = t.isub(c).iushrn(this.shift); + var res = u; + if (u.cmp(this.m) >= 0) { + res = u.isub(this.m); + } else if (u.cmpn(0) < 0) { + res = u.iadd(this.m); + } + + return res._forceRed(this); + }; + + Mont.prototype.invm = function invm (a) { + // (AR)^-1 * R^2 = (A^-1 * R^-1) * R^2 = A^-1 * R + var res = this.imod(a._invmp(this.m).mul(this.r2)); + return res._forceRed(this); + }; +})(typeof module === 'undefined' || module, this); diff --git a/node_modules/bn.js/package.json b/node_modules/bn.js/package.json new file mode 100644 index 0000000..a3c4ebc --- /dev/null +++ b/node_modules/bn.js/package.json @@ -0,0 +1,36 @@ +{ + "name": "bn.js", + "version": "4.12.1", + "description": "Big number implementation in pure javascript", + "main": "lib/bn.js", + "scripts": { + "lint": "semistandard", + "unit": "mocha --reporter=spec test/*-test.js", + "test": "npm run lint && npm run unit" + }, + "repository": { + "type": "git", + "url": "git@github.com:indutny/bn.js" + }, + "keywords": [ + "BN", + "BigNum", + "Big number", + "Modulo", + "Montgomery" + ], + "author": "Fedor Indutny <fedor@indutny.com>", + "license": "MIT", + "bugs": { + "url": "https://github.com/indutny/bn.js/issues" + }, + "homepage": "https://github.com/indutny/bn.js", + "browser": { + "buffer": false + }, + "devDependencies": { + "istanbul": "^0.3.5", + "mocha": "^2.1.0", + "semistandard": "^7.0.4" + } +} diff --git a/node_modules/bn.js/util/genCombMulTo.js b/node_modules/bn.js/util/genCombMulTo.js new file mode 100644 index 0000000..8b456c7 --- /dev/null +++ b/node_modules/bn.js/util/genCombMulTo.js @@ -0,0 +1,65 @@ +'use strict'; + +// NOTE: This could be potentionally used to generate loop-less multiplications +function genCombMulTo (alen, blen) { + var len = alen + blen - 1; + var src = [ + 'var a = self.words;', + 'var b = num.words;', + 'var o = out.words;', + 'var c = 0;', + 'var lo;', + 'var mid;', + 'var hi;' + ]; + for (var i = 0; i < alen; i++) { + src.push('var a' + i + ' = a[' + i + '] | 0;'); + src.push('var al' + i + ' = a' + i + ' & 0x1fff;'); + src.push('var ah' + i + ' = a' + i + ' >>> 13;'); + } + for (i = 0; i < blen; i++) { + src.push('var b' + i + ' = b[' + i + '] | 0;'); + src.push('var bl' + i + ' = b' + i + ' & 0x1fff;'); + src.push('var bh' + i + ' = b' + i + ' >>> 13;'); + } + src.push(''); + src.push('out.negative = self.negative ^ num.negative;'); + src.push('out.length = ' + len + ';'); + + for (var k = 0; k < len; k++) { + var minJ = Math.max(0, k - alen + 1); + var maxJ = Math.min(k, blen - 1); + + src.push('\/* k = ' + k + ' *\/'); + src.push('var w' + k + ' = c;'); + src.push('c = 0;'); + for (var j = minJ; j <= maxJ; j++) { + i = k - j; + + src.push('lo = Math.imul(al' + i + ', bl' + j + ');'); + src.push('mid = Math.imul(al' + i + ', bh' + j + ');'); + src.push('mid = (mid + Math.imul(ah' + i + ', bl' + j + ')) | 0;'); + src.push('hi = Math.imul(ah' + i + ', bh' + j + ');'); + + src.push('w' + k + ' = (w' + k + ' + lo) | 0;'); + src.push('w' + k + ' = (w' + k + ' + ((mid & 0x1fff) << 13)) | 0;'); + src.push('c = (c + hi) | 0;'); + src.push('c = (c + (mid >>> 13)) | 0;'); + src.push('c = (c + (w' + k + ' >>> 26)) | 0;'); + src.push('w' + k + ' &= 0x3ffffff;'); + } + } + // Store in separate step for better memory access + for (k = 0; k < len; k++) { + src.push('o[' + k + '] = w' + k + ';'); + } + src.push('if (c !== 0) {', + ' o[' + k + '] = c;', + ' out.length++;', + '}', + 'return out;'); + + return src.join('\n'); +} + +console.log(genCombMulTo(10, 10)); diff --git a/node_modules/bn.js/util/genCombMulTo10.js b/node_modules/bn.js/util/genCombMulTo10.js new file mode 100644 index 0000000..cf2e6e8 --- /dev/null +++ b/node_modules/bn.js/util/genCombMulTo10.js @@ -0,0 +1,65 @@ +'use strict'; + +function genCombMulTo (alen, blen) { + var len = alen + blen - 1; + var src = [ + 'var a = self.words;', + 'var b = num.words;', + 'var o = out.words;', + 'var c = 0;', + 'var lo;', + 'var mid;', + 'var hi;' + ]; + for (var i = 0; i < alen; i++) { + src.push('var a' + i + ' = a[' + i + '] | 0;'); + src.push('var al' + i + ' = a' + i + ' & 0x1fff;'); + src.push('var ah' + i + ' = a' + i + ' >>> 13;'); + } + for (i = 0; i < blen; i++) { + src.push('var b' + i + ' = b[' + i + '] | 0;'); + src.push('var bl' + i + ' = b' + i + ' & 0x1fff;'); + src.push('var bh' + i + ' = b' + i + ' >>> 13;'); + } + src.push(''); + src.push('out.negative = self.negative ^ num.negative;'); + src.push('out.length = ' + len + ';'); + + for (var k = 0; k < len; k++) { + var minJ = Math.max(0, k - alen + 1); + var maxJ = Math.min(k, blen - 1); + + src.push('\/* k = ' + k + ' *\/'); + src.push('lo = Math.imul(al' + (k - minJ) + ', bl' + minJ + ');'); + src.push('mid = Math.imul(al' + (k - minJ) + ', bh' + minJ + ');'); + src.push( + 'mid = (mid + Math.imul(ah' + (k - minJ) + ', bl' + minJ + ')) | 0;'); + src.push('hi = Math.imul(ah' + (k - minJ) + ', bh' + minJ + ');'); + + for (var j = minJ + 1; j <= maxJ; j++) { + i = k - j; + + src.push('lo = (lo + Math.imul(al' + i + ', bl' + j + ')) | 0;'); + src.push('mid = (mid + Math.imul(al' + i + ', bh' + j + ')) | 0;'); + src.push('mid = (mid + Math.imul(ah' + i + ', bl' + j + ')) | 0;'); + src.push('hi = (hi + Math.imul(ah' + i + ', bh' + j + ')) | 0;'); + } + + src.push('var w' + k + ' = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;'); + src.push('c = (((hi + (mid >>> 13)) | 0) + (w' + k + ' >>> 26)) | 0;'); + src.push('w' + k + ' &= 0x3ffffff;'); + } + // Store in separate step for better memory access + for (k = 0; k < len; k++) { + src.push('o[' + k + '] = w' + k + ';'); + } + src.push('if (c !== 0) {', + ' o[' + k + '] = c;', + ' out.length++;', + '}', + 'return out;'); + + return src.join('\n'); +} + +console.log(genCombMulTo(10, 10)); diff --git a/node_modules/connect-mongo/.commitlintrc.yml b/node_modules/connect-mongo/.commitlintrc.yml new file mode 100644 index 0000000..0974185 --- /dev/null +++ b/node_modules/connect-mongo/.commitlintrc.yml @@ -0,0 +1,2 @@ +extends: + - '@commitlint/config-conventional' diff --git a/node_modules/connect-mongo/.editorconfig b/node_modules/connect-mongo/.editorconfig new file mode 100644 index 0000000..63187fe --- /dev/null +++ b/node_modules/connect-mongo/.editorconfig @@ -0,0 +1,15 @@ +# http://editorconfig.org +root = true + +[*] +charset = utf-8 +end_of_line = lf +indent_size = 2 +indent_style = space +insert_final_newline = true +max_line_length = 80 +trim_trailing_whitespace = true + +[*.md] +max_line_length = 0 +trim_trailing_whitespace = false diff --git a/node_modules/connect-mongo/.eslintcache b/node_modules/connect-mongo/.eslintcache new file mode 100644 index 0000000..d5d995e --- /dev/null +++ b/node_modules/connect-mongo/.eslintcache @@ -0,0 +1 @@ +[{"/Users/jerome/jdesboeufs/connect-mongo/src/index.ts":"1","/Users/jerome/jdesboeufs/connect-mongo/src/lib/MongoStore.spec.ts":"2","/Users/jerome/jdesboeufs/connect-mongo/src/lib/MongoStore.ts":"3","/Users/jerome/jdesboeufs/connect-mongo/src/test/integration.spec.ts":"4","/Users/jerome/jdesboeufs/connect-mongo/src/test/testHelper.ts":"5","/Users/jerome/jdesboeufs/connect-mongo/src/types/kruptein.d.ts":"6"},{"size":62,"mtime":1697277963559,"results":"7","hashOfConfig":"8"},{"size":10670,"mtime":1697277963560,"results":"9","hashOfConfig":"8"},{"size":15474,"mtime":1697277963560,"results":"10","hashOfConfig":"8"},{"size":2547,"mtime":1697277963560,"results":"11","hashOfConfig":"8"},{"size":1641,"mtime":1697277963560,"results":"12","hashOfConfig":"8"},{"size":1146,"mtime":1697277963560,"results":"13","hashOfConfig":"8"},{"filePath":"14","messages":"15","errorCount":0,"fatalErrorCount":0,"warningCount":0,"fixableErrorCount":0,"fixableWarningCount":0},"2sls2i",{"filePath":"16","messages":"17","errorCount":0,"fatalErrorCount":0,"warningCount":0,"fixableErrorCount":0,"fixableWarningCount":0},{"filePath":"18","messages":"19","errorCount":0,"fatalErrorCount":0,"warningCount":27,"fixableErrorCount":0,"fixableWarningCount":0,"source":null},{"filePath":"20","messages":"21","errorCount":0,"fatalErrorCount":0,"warningCount":1,"fixableErrorCount":0,"fixableWarningCount":0,"source":null},{"filePath":"22","messages":"23","errorCount":0,"fatalErrorCount":0,"warningCount":0,"fixableErrorCount":0,"fixableWarningCount":0},{"filePath":"24","messages":"25","errorCount":0,"fatalErrorCount":0,"warningCount":1,"fixableErrorCount":0,"fixableWarningCount":0,"source":null},"/Users/jerome/jdesboeufs/connect-mongo/src/index.ts",[],"/Users/jerome/jdesboeufs/connect-mongo/src/lib/MongoStore.spec.ts",[],"/Users/jerome/jdesboeufs/connect-mongo/src/lib/MongoStore.ts",["26","27","28","29","30","31","32","33","34","35","36","37","38","39","40","41","42","43","44","45","46","47","48","49","50","51","52"],"/Users/jerome/jdesboeufs/connect-mongo/src/test/integration.spec.ts",["53"],"/Users/jerome/jdesboeufs/connect-mongo/src/test/testHelper.ts",[],"/Users/jerome/jdesboeufs/connect-mongo/src/types/kruptein.d.ts",["54"],{"ruleId":"55","severity":1,"message":"56","line":20,"column":3,"nodeType":"57","messageId":"58","endLine":20,"endColumn":11},{"ruleId":"55","severity":1,"message":"59","line":21,"column":3,"nodeType":"57","messageId":"58","endLine":21,"endColumn":10},{"ruleId":"55","severity":1,"message":"60","line":22,"column":3,"nodeType":"57","messageId":"58","endLine":22,"endColumn":10},{"ruleId":"61","severity":1,"message":"62","line":39,"column":19,"nodeType":"63","messageId":"64","endLine":39,"endColumn":22,"suggestions":"65"},{"ruleId":"61","severity":1,"message":"62","line":39,"column":27,"nodeType":"63","messageId":"64","endLine":39,"endColumn":30,"suggestions":"66"},{"ruleId":"61","severity":1,"message":"62","line":40,"column":21,"nodeType":"63","messageId":"64","endLine":40,"endColumn":24,"suggestions":"67"},{"ruleId":"61","severity":1,"message":"62","line":40,"column":29,"nodeType":"63","messageId":"64","endLine":40,"endColumn":32,"suggestions":"68"},{"ruleId":"61","severity":1,"message":"62","line":42,"column":21,"nodeType":"63","messageId":"64","endLine":42,"endColumn":24,"suggestions":"69"},{"ruleId":"61","severity":1,"message":"62","line":42,"column":29,"nodeType":"63","messageId":"64","endLine":42,"endColumn":32,"suggestions":"70"},{"ruleId":"61","severity":1,"message":"62","line":62,"column":19,"nodeType":"63","messageId":"64","endLine":62,"endColumn":22,"suggestions":"71"},{"ruleId":"61","severity":1,"message":"62","line":62,"column":27,"nodeType":"63","messageId":"64","endLine":62,"endColumn":30,"suggestions":"72"},{"ruleId":"61","severity":1,"message":"62","line":63,"column":21,"nodeType":"63","messageId":"64","endLine":63,"endColumn":24,"suggestions":"73"},{"ruleId":"61","severity":1,"message":"62","line":63,"column":29,"nodeType":"63","messageId":"64","endLine":63,"endColumn":32,"suggestions":"74"},{"ruleId":"61","severity":1,"message":"62","line":65,"column":21,"nodeType":"63","messageId":"64","endLine":65,"endColumn":24,"suggestions":"75"},{"ruleId":"61","severity":1,"message":"62","line":65,"column":29,"nodeType":"63","messageId":"64","endLine":65,"endColumn":32,"suggestions":"76"},{"ruleId":"61","severity":1,"message":"62","line":72,"column":12,"nodeType":"63","messageId":"64","endLine":72,"endColumn":15,"suggestions":"77"},{"ruleId":"61","severity":1,"message":"62","line":134,"column":20,"nodeType":"63","messageId":"64","endLine":134,"endColumn":23,"suggestions":"78"},{"ruleId":"61","severity":1,"message":"62","line":134,"column":28,"nodeType":"63","messageId":"64","endLine":134,"endColumn":31,"suggestions":"79"},{"ruleId":"61","severity":1,"message":"62","line":135,"column":22,"nodeType":"63","messageId":"64","endLine":135,"endColumn":25,"suggestions":"80"},{"ruleId":"61","severity":1,"message":"62","line":135,"column":30,"nodeType":"63","messageId":"64","endLine":135,"endColumn":33,"suggestions":"81"},{"ruleId":"61","severity":1,"message":"62","line":301,"column":21,"nodeType":"63","messageId":"64","endLine":301,"endColumn":24,"suggestions":"82"},{"ruleId":"61","severity":1,"message":"62","line":340,"column":21,"nodeType":"63","messageId":"64","endLine":340,"endColumn":24,"suggestions":"83"},{"ruleId":"61","severity":1,"message":"62","line":407,"column":21,"nodeType":"63","messageId":"64","endLine":407,"endColumn":24,"suggestions":"84"},{"ruleId":"61","severity":1,"message":"62","line":463,"column":12,"nodeType":"63","messageId":"64","endLine":463,"endColumn":15,"suggestions":"85"},{"ruleId":"61","severity":1,"message":"62","line":499,"column":40,"nodeType":"63","messageId":"64","endLine":499,"endColumn":43,"suggestions":"86"},{"ruleId":"61","severity":1,"message":"62","line":518,"column":26,"nodeType":"63","messageId":"64","endLine":518,"endColumn":29,"suggestions":"87"},{"ruleId":"61","severity":1,"message":"62","line":530,"column":25,"nodeType":"63","messageId":"64","endLine":530,"endColumn":28,"suggestions":"88"},{"ruleId":"61","severity":1,"message":"62","line":10,"column":20,"nodeType":"63","messageId":"64","endLine":10,"endColumn":23,"suggestions":"89"},{"ruleId":"61","severity":1,"message":"62","line":25,"column":27,"nodeType":"63","messageId":"64","endLine":25,"endColumn":30,"suggestions":"90"},"camelcase","Identifier 'key_size' is not in camel case.","Identifier","notCamelCase","Identifier 'iv_size' is not in camel case.","Identifier 'at_size' is not in camel case.","@typescript-eslint/no-explicit-any","Unexpected any. Specify a different type.","TSAnyKeyword","unexpectedAny",["91","92"],["93","94"],["95","96"],["97","98"],["99","100"],["101","102"],["103","104"],["105","106"],["107","108"],["109","110"],["111","112"],["113","114"],["115","116"],["117","118"],["119","120"],["121","122"],["123","124"],["125","126"],["127","128"],["129","130"],["131","132"],["133","134"],["135","136"],["137","138"],["139","140"],["141","142"],{"messageId":"143","fix":"144","desc":"145"},{"messageId":"146","fix":"147","desc":"148"},{"messageId":"143","fix":"149","desc":"145"},{"messageId":"146","fix":"150","desc":"148"},{"messageId":"143","fix":"151","desc":"145"},{"messageId":"146","fix":"152","desc":"148"},{"messageId":"143","fix":"153","desc":"145"},{"messageId":"146","fix":"154","desc":"148"},{"messageId":"143","fix":"155","desc":"145"},{"messageId":"146","fix":"156","desc":"148"},{"messageId":"143","fix":"157","desc":"145"},{"messageId":"146","fix":"158","desc":"148"},{"messageId":"143","fix":"159","desc":"145"},{"messageId":"146","fix":"160","desc":"148"},{"messageId":"143","fix":"161","desc":"145"},{"messageId":"146","fix":"162","desc":"148"},{"messageId":"143","fix":"163","desc":"145"},{"messageId":"146","fix":"164","desc":"148"},{"messageId":"143","fix":"165","desc":"145"},{"messageId":"146","fix":"166","desc":"148"},{"messageId":"143","fix":"167","desc":"145"},{"messageId":"146","fix":"168","desc":"148"},{"messageId":"143","fix":"169","desc":"145"},{"messageId":"146","fix":"170","desc":"148"},{"messageId":"143","fix":"171","desc":"145"},{"messageId":"146","fix":"172","desc":"148"},{"messageId":"143","fix":"173","desc":"145"},{"messageId":"146","fix":"174","desc":"148"},{"messageId":"143","fix":"175","desc":"145"},{"messageId":"146","fix":"176","desc":"148"},{"messageId":"143","fix":"177","desc":"145"},{"messageId":"146","fix":"178","desc":"148"},{"messageId":"143","fix":"179","desc":"145"},{"messageId":"146","fix":"180","desc":"148"},{"messageId":"143","fix":"181","desc":"145"},{"messageId":"146","fix":"182","desc":"148"},{"messageId":"143","fix":"183","desc":"145"},{"messageId":"146","fix":"184","desc":"148"},{"messageId":"143","fix":"185","desc":"145"},{"messageId":"146","fix":"186","desc":"148"},{"messageId":"143","fix":"187","desc":"145"},{"messageId":"146","fix":"188","desc":"148"},{"messageId":"143","fix":"189","desc":"145"},{"messageId":"146","fix":"190","desc":"148"},{"messageId":"143","fix":"191","desc":"145"},{"messageId":"146","fix":"192","desc":"148"},{"messageId":"143","fix":"193","desc":"145"},{"messageId":"146","fix":"194","desc":"148"},{"messageId":"143","fix":"195","desc":"145"},{"messageId":"146","fix":"196","desc":"148"},{"messageId":"143","fix":"197","desc":"145"},{"messageId":"146","fix":"198","desc":"148"},"suggestUnknown",{"range":"199","text":"200"},"Use `unknown` instead, this will force you to explicitly, and safely assert the type is correct.","suggestNever",{"range":"199","text":"201"},"Use `never` instead, this is useful when instantiating generic type parameters that you don't need to know the type of.",{"range":"202","text":"200"},{"range":"202","text":"201"},{"range":"203","text":"200"},{"range":"203","text":"201"},{"range":"204","text":"200"},{"range":"204","text":"201"},{"range":"205","text":"200"},{"range":"205","text":"201"},{"range":"206","text":"200"},{"range":"206","text":"201"},{"range":"207","text":"200"},{"range":"207","text":"201"},{"range":"208","text":"200"},{"range":"208","text":"201"},{"range":"209","text":"200"},{"range":"209","text":"201"},{"range":"210","text":"200"},{"range":"210","text":"201"},{"range":"211","text":"200"},{"range":"211","text":"201"},{"range":"212","text":"200"},{"range":"212","text":"201"},{"range":"213","text":"200"},{"range":"213","text":"201"},{"range":"214","text":"200"},{"range":"214","text":"201"},{"range":"215","text":"200"},{"range":"215","text":"201"},{"range":"216","text":"200"},{"range":"216","text":"201"},{"range":"217","text":"200"},{"range":"217","text":"201"},{"range":"218","text":"200"},{"range":"218","text":"201"},{"range":"219","text":"200"},{"range":"219","text":"201"},{"range":"220","text":"200"},{"range":"220","text":"201"},{"range":"221","text":"200"},{"range":"221","text":"201"},{"range":"222","text":"200"},{"range":"222","text":"201"},{"range":"223","text":"200"},{"range":"223","text":"201"},{"range":"224","text":"200"},{"range":"224","text":"201"},{"range":"225","text":"200"},{"range":"225","text":"201"},{"range":"226","text":"200"},{"range":"226","text":"201"},[890,893],"unknown","never",[898,901],[922,925],[930,933],[1001,1004],[1009,1012],[1503,1506],[1511,1514],[1535,1538],[1543,1546],[1614,1617],[1622,1625],[1743,1746],[3399,3402],[3407,3410],[3432,3435],[3440,3443],[8018,8021],[9222,9225],[11439,11442],[13268,13271],[14300,14303],[14788,14791],[15114,15117],[309,312],[1000,1003]] \ No newline at end of file diff --git a/node_modules/connect-mongo/.eslintignore b/node_modules/connect-mongo/.eslintignore new file mode 100644 index 0000000..b92edc5 --- /dev/null +++ b/node_modules/connect-mongo/.eslintignore @@ -0,0 +1,6 @@ +# /node_modules/* in the project root is ignored by default +node_modules/* +# build artefacts +build/* +coverage/* +example/* diff --git a/node_modules/connect-mongo/.eslintrc.yml b/node_modules/connect-mongo/.eslintrc.yml new file mode 100644 index 0000000..d0f9337 --- /dev/null +++ b/node_modules/connect-mongo/.eslintrc.yml @@ -0,0 +1,41 @@ +root: true +env: + node: true + es6: true + +parser: '@typescript-eslint/parser' + +parserOptions: + ecmaVersion: 9 + project: './tsconfig.json' + +extends: + - standard + - prettier + - prettier/standard + - plugin:eslint-comments/recommended + - plugin:@typescript-eslint/recommended + - prettier/@typescript-eslint + +plugins: + - eslint-comments + - prettier + - '@typescript-eslint' + +rules: + prettier/prettier: error + camelcase: warn + standard/no-callback-literal: off + '@typescript-eslint/no-unused-vars': + - warn + - args: none + varsIgnorePattern: '^_' + argsIgnorePattern: '^_' + prefer-const: + - error + - destructuring: any + ignoreReadBeforeAssign: false + '@typescript-eslint/explicit-function-return-type': off + '@typescript-eslint/no-var-requires': off + '@typescript-eslint/interface-name-prefix': off + '@typescript-eslint/ban-ts-comment': off diff --git a/node_modules/connect-mongo/.github/CONTRIBUTING.md b/node_modules/connect-mongo/.github/CONTRIBUTING.md new file mode 100644 index 0000000..5ac541a --- /dev/null +++ b/node_modules/connect-mongo/.github/CONTRIBUTING.md @@ -0,0 +1,3 @@ +# Example Contributing Guidelines + +This is an example of GitHub's contributing guidelines file. Check out GitHub's [CONTRIBUTING.md help center article](https://help.github.com/articles/setting-guidelines-for-repository-contributors/) for more information. diff --git a/node_modules/connect-mongo/.github/ISSUE_TEMPLATE.md b/node_modules/connect-mongo/.github/ISSUE_TEMPLATE.md new file mode 100644 index 0000000..5863654 --- /dev/null +++ b/node_modules/connect-mongo/.github/ISSUE_TEMPLATE.md @@ -0,0 +1,9 @@ +- **I'm submitting a ...** + [ ] bug report + [ ] feature request + [ ] question about the decisions made in the repository + [ ] question about how to use this project + +- **Summary** + +- **Other information** (e.g. detailed explanation, stack traces, related issues, suggestions how to fix, links for us to have context, eg. StackOverflow, personal fork, etc.) diff --git a/node_modules/connect-mongo/.github/PULL_REQUEST_TEMPLATE.md b/node_modules/connect-mongo/.github/PULL_REQUEST_TEMPLATE.md new file mode 100644 index 0000000..1ebedef --- /dev/null +++ b/node_modules/connect-mongo/.github/PULL_REQUEST_TEMPLATE.md @@ -0,0 +1,12 @@ +- **What kind of change does this PR introduce?** (Bug fix, feature, docs update, ...) + +- **What is the current behavior?** (You can also link to an open issue here) + +- **What is the new behavior (if this is a feature change)?** + +- **Other information**: + +- **Checklist:** + +- [ ] Added test cases +- [ ] Updated changelog diff --git a/node_modules/connect-mongo/.github/stale.yml b/node_modules/connect-mongo/.github/stale.yml new file mode 100644 index 0000000..dc90e5a --- /dev/null +++ b/node_modules/connect-mongo/.github/stale.yml @@ -0,0 +1,17 @@ +# Number of days of inactivity before an issue becomes stale +daysUntilStale: 60 +# Number of days of inactivity before a stale issue is closed +daysUntilClose: 7 +# Issues with these labels will never be considered stale +exemptLabels: + - pinned + - security +# Label to use when marking an issue as stale +staleLabel: wontfix +# Comment to post when marking an issue as stale. Set to `false` to disable +markComment: > + This issue has been automatically marked as stale because it has not had + recent activity. It will be closed if no further activity occurs. Thank you + for your contributions. +# Comment to post when closing a stale issue. Set to `false` to disable +closeComment: false diff --git a/node_modules/connect-mongo/.github/workflows/sanity.yml b/node_modules/connect-mongo/.github/workflows/sanity.yml new file mode 100644 index 0000000..051647a --- /dev/null +++ b/node_modules/connect-mongo/.github/workflows/sanity.yml @@ -0,0 +1,40 @@ +name: Sanity check + +on: + push: + branches: master + pull_request: + branches: master + +jobs: + build: + runs-on: ubuntu-latest + + strategy: + matrix: + node-version: [14.x, 16.x, 18.x] + + steps: + - uses: actions/checkout@v2 + - name: Use Node.js ${{ matrix.node-version }} + uses: actions/setup-node@v1 + with: + node-version: ${{ matrix.node-version }} + - run: docker-compose up -d + - name: Get yarn cache directory path + id: yarn-cache-dir-path + run: echo "::set-output name=dir::$(yarn cache dir)" + - uses: actions/cache@v2 + id: yarn-cache # use this to check for `cache-hit` (`steps.yarn-cache.outputs.cache-hit != 'true'`) + with: + path: ${{ steps.yarn-cache-dir-path.outputs.dir }} + key: ${{ runner.os }}-yarn-${{ hashFiles('**/yarn.lock') }} + restore-keys: | + ${{ runner.os }}-yarn- + - run: yarn install + - run: yarn test + - run: yarn add mongodb@6 && yarn test + if: ${{ matrix.node-version != '14.x' }} + - run: yarn cov:send + - run: yarn cov:check + - run: yarn build diff --git a/node_modules/connect-mongo/.npmignore b/node_modules/connect-mongo/.npmignore new file mode 100644 index 0000000..d04e71d --- /dev/null +++ b/node_modules/connect-mongo/.npmignore @@ -0,0 +1,20 @@ +.npmignore + +History.md +Makefile +Readme.md +.DS_Store + +examples/ +support/ +test/ +coverage/ +.vscode/ +.github/ +.eslintrc +.prettierrc.yml +.travis.yml +commitlint.config.js +.nyc_output/ +jest.config.js +src/test/ diff --git a/node_modules/connect-mongo/.nyc_output/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json b/node_modules/connect-mongo/.nyc_output/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json new file mode 100644 index 0000000..54b7fee --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json @@ -0,0 +1 @@ +{"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/integration.spec.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/integration.spec.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":62}},"2":{"start":{"line":5,"column":0},"end":{"line":5,"column":62}},"3":{"start":{"line":6,"column":14},"end":{"line":6,"column":45}},"4":{"start":{"line":7,"column":20},"end":{"line":7,"column":57}},"5":{"start":{"line":8,"column":18},"end":{"line":8,"column":53}},"6":{"start":{"line":9,"column":26},"end":{"line":9,"column":69}},"7":{"start":{"line":10,"column":12},"end":{"line":10,"column":43}},"8":{"start":{"line":12,"column":16},"end":{"line":12,"column":40}},"9":{"start":{"line":13,"column":18},"end":{"line":13,"column":52}},"10":{"start":{"line":14,"column":4},"end":{"line":17,"column":8}},"11":{"start":{"line":18,"column":4},"end":{"line":26,"column":7}},"12":{"start":{"line":19,"column":8},"end":{"line":24,"column":9}},"13":{"start":{"line":20,"column":12},"end":{"line":20,"column":32}},"14":{"start":{"line":23,"column":12},"end":{"line":23,"column":34}},"15":{"start":{"line":25,"column":8},"end":{"line":25,"column":59}},"16":{"start":{"line":27,"column":4},"end":{"line":29,"column":7}},"17":{"start":{"line":28,"column":8},"end":{"line":28,"column":59}},"18":{"start":{"line":30,"column":18},"end":{"line":30,"column":48}},"19":{"start":{"line":31,"column":4},"end":{"line":31,"column":17}},"20":{"start":{"line":34,"column":4},"end":{"line":39,"column":7}},"21":{"start":{"line":41,"column":0},"end":{"line":57,"column":3}},"22":{"start":{"line":42,"column":18},"end":{"line":42,"column":50}},"23":{"start":{"line":43,"column":4},"end":{"line":56,"column":7}},"24":{"start":{"line":46,"column":28},"end":{"line":46,"column":58}},"25":{"start":{"line":48,"column":8},"end":{"line":55,"column":11}},"26":{"start":{"line":52,"column":12},"end":{"line":52,"column":28}},"27":{"start":{"line":53,"column":12},"end":{"line":53,"column":48}},"28":{"start":{"line":54,"column":12},"end":{"line":54,"column":27}},"29":{"start":{"line":58,"column":0},"end":{"line":86,"column":3}},"30":{"start":{"line":59,"column":18},"end":{"line":59,"column":127}},"31":{"start":{"line":60,"column":4},"end":{"line":85,"column":7}},"32":{"start":{"line":64,"column":8},"end":{"line":84,"column":11}},"33":{"start":{"line":68,"column":12},"end":{"line":68,"column":28}},"34":{"start":{"line":69,"column":12},"end":{"line":69,"column":48}},"35":{"start":{"line":70,"column":12},"end":{"line":83,"column":15}},"36":{"start":{"line":71,"column":16},"end":{"line":73,"column":25}},"37":{"start":{"line":72,"column":20},"end":{"line":72,"column":30}},"38":{"start":{"line":75,"column":16},"end":{"line":82,"column":19}},"39":{"start":{"line":79,"column":20},"end":{"line":79,"column":36}},"40":{"start":{"line":80,"column":20},"end":{"line":80,"column":56}},"41":{"start":{"line":81,"column":20},"end":{"line":81,"column":35}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":56},"end":{"line":2,"column":57}},"loc":{"start":{"line":2,"column":71},"end":{"line":4,"column":1}},"line":2},"1":{"name":"createSupertetAgent","decl":{"start":{"line":11,"column":9},"end":{"line":11,"column":28}},"loc":{"start":{"line":11,"column":58},"end":{"line":32,"column":1}},"line":11},"2":{"name":"(anonymous_2)","decl":{"start":{"line":18,"column":17},"end":{"line":18,"column":18}},"loc":{"start":{"line":18,"column":37},"end":{"line":26,"column":5}},"line":18},"3":{"name":"(anonymous_3)","decl":{"start":{"line":27,"column":21},"end":{"line":27,"column":22}},"loc":{"start":{"line":27,"column":41},"end":{"line":29,"column":5}},"line":27},"4":{"name":"createSupertetAgentWithDefault","decl":{"start":{"line":33,"column":9},"end":{"line":33,"column":39}},"loc":{"start":{"line":33,"column":79},"end":{"line":40,"column":1}},"line":33},"5":{"name":"(anonymous_5)","decl":{"start":{"line":41,"column":39},"end":{"line":41,"column":40}},"loc":{"start":{"line":41,"column":46},"end":{"line":57,"column":1}},"line":41},"6":{"name":"(anonymous_6)","decl":{"start":{"line":46,"column":14},"end":{"line":46,"column":15}},"loc":{"start":{"line":46,"column":28},"end":{"line":46,"column":58}},"line":46},"7":{"name":"(anonymous_7)","decl":{"start":{"line":47,"column":14},"end":{"line":47,"column":15}},"loc":{"start":{"line":47,"column":26},"end":{"line":56,"column":5}},"line":47},"8":{"name":"(anonymous_8)","decl":{"start":{"line":51,"column":17},"end":{"line":51,"column":18}},"loc":{"start":{"line":51,"column":31},"end":{"line":55,"column":9}},"line":51},"9":{"name":"(anonymous_9)","decl":{"start":{"line":58,"column":56},"end":{"line":58,"column":57}},"loc":{"start":{"line":58,"column":63},"end":{"line":86,"column":1}},"line":58},"10":{"name":"(anonymous_10)","decl":{"start":{"line":63,"column":14},"end":{"line":63,"column":15}},"loc":{"start":{"line":63,"column":20},"end":{"line":85,"column":5}},"line":63},"11":{"name":"(anonymous_11)","decl":{"start":{"line":67,"column":17},"end":{"line":67,"column":18}},"loc":{"start":{"line":67,"column":31},"end":{"line":84,"column":9}},"line":67},"12":{"name":"(anonymous_12)","decl":{"start":{"line":70,"column":24},"end":{"line":70,"column":25}},"loc":{"start":{"line":70,"column":37},"end":{"line":74,"column":13}},"line":70},"13":{"name":"(anonymous_13)","decl":{"start":{"line":71,"column":27},"end":{"line":71,"column":28}},"loc":{"start":{"line":71,"column":33},"end":{"line":73,"column":17}},"line":71},"14":{"name":"(anonymous_14)","decl":{"start":{"line":74,"column":20},"end":{"line":74,"column":21}},"loc":{"start":{"line":74,"column":26},"end":{"line":83,"column":13}},"line":74},"15":{"name":"(anonymous_15)","decl":{"start":{"line":78,"column":25},"end":{"line":78,"column":26}},"loc":{"start":{"line":78,"column":39},"end":{"line":82,"column":17}},"line":78}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":56},"end":{"line":4,"column":1}}],"line":2},"1":{"loc":{"start":{"line":3,"column":11},"end":{"line":3,"column":61}},"type":"cond-expr","locations":[{"start":{"line":3,"column":37},"end":{"line":3,"column":40}},{"start":{"line":3,"column":43},"end":{"line":3,"column":61}}],"line":3},"2":{"loc":{"start":{"line":3,"column":12},"end":{"line":3,"column":33}},"type":"binary-expr","locations":[{"start":{"line":3,"column":12},"end":{"line":3,"column":15}},{"start":{"line":3,"column":19},"end":{"line":3,"column":33}}],"line":3},"3":{"loc":{"start":{"line":19,"column":8},"end":{"line":24,"column":9}},"type":"if","locations":[{"start":{"line":19,"column":8},"end":{"line":24,"column":9}},{"start":{"line":19,"column":8},"end":{"line":24,"column":9}}],"line":19},"4":{"loc":{"start":{"line":33,"column":40},"end":{"line":33,"column":56}},"type":"default-arg","locations":[{"start":{"line":33,"column":54},"end":{"line":33,"column":56}}],"line":33},"5":{"loc":{"start":{"line":33,"column":58},"end":{"line":33,"column":77}},"type":"default-arg","locations":[{"start":{"line":33,"column":75},"end":{"line":33,"column":77}}],"line":33}},"s":{"0":1,"1":5,"2":1,"3":1,"4":1,"5":1,"6":1,"7":1,"8":1,"9":1,"10":1,"11":1,"12":1,"13":0,"14":1,"15":1,"16":1,"17":0,"18":1,"19":1,"20":1,"21":1,"22":1,"23":1,"24":1,"25":1,"26":1,"27":1,"28":1,"29":1,"30":0,"31":0,"32":0,"33":0,"34":0,"35":0,"36":0,"37":0,"38":0,"39":0,"40":0,"41":0},"f":{"0":5,"1":1,"2":1,"3":0,"4":1,"5":1,"6":1,"7":1,"8":1,"9":0,"10":0,"11":0,"12":0,"13":0,"14":0,"15":0},"b":{"0":[1,1,1],"1":[1,4],"2":[5,5],"3":[0,1],"4":[1],"5":[1]},"inputSourceMap":{"version":3,"file":"integration.spec.js","sourceRoot":"","sources":["../../../src/test/integration.spec.ts"],"names":[],"mappings":";;;;;AAAA,8CAAsB;AACtB,0DAA+B;AAC/B,sDAA6B;AAC7B,sEAAyD;AACzD,4CAA4B;AAS5B,SAAS,mBAAmB,CAC1B,WAA2B,EAC3B,cAAmC;IAEnC,MAAM,GAAG,GAAG,IAAA,iBAAO,GAAE,CAAA;IACrB,MAAM,KAAK,GAAG,WAAU,CAAC,MAAM,CAAC,cAAc,CAAC,CAAA;IAC/C,GAAG,CAAC,GAAG,CACL,IAAA,yBAAO,EAAC;QACN,GAAG,WAAW;QACd,KAAK,EAAE,KAAK;KACb,CAAC,CACH,CAAA;IACD,GAAG,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,GAAG,EAAE,GAAG;QAC7B,IAAI,OAAO,GAAG,CAAC,OAAO,CAAC,KAAK,KAAK,QAAQ,EAAE;YACzC,GAAG,CAAC,OAAO,CAAC,KAAK,EAAE,CAAA;SACpB;aAAM;YACL,GAAG,CAAC,OAAO,CAAC,KAAK,GAAG,CAAC,CAAA;SACtB;QACD,GAAG,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,EAAE,KAAK,EAAE,GAAG,CAAC,OAAO,CAAC,KAAK,EAAE,CAAC,CAAA;IACpD,CAAC,CAAC,CAAA;IACF,GAAG,CAAC,GAAG,CAAC,OAAO,EAAE,UAAU,GAAG,EAAE,GAAG;QACjC,GAAG,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,EAAE,KAAK,EAAE,GAAG,CAAC,OAAO,CAAC,KAAK,EAAE,CAAC,CAAA;IACpD,CAAC,CAAC,CAAA;IACF,MAAM,KAAK,GAAG,mBAAO,CAAC,KAAK,CAAC,GAAG,CAAC,CAAA;IAChC,OAAO,KAAK,CAAA;AACd,CAAC;AAED,SAAS,8BAA8B,CACrC,cAA8C,EAAE,EAChD,iBAAsC,EAAE;IAExC,OAAO,mBAAmB,CACxB,EAAE,MAAM,EAAE,KAAK,EAAE,GAAG,WAAW,EAAE,EACjC;QACE,QAAQ,EAAE,wCAAwC;QAClD,MAAM,EAAE,oBAAoB;QAC5B,SAAS,EAAE,KAAK;QAChB,GAAG,cAAc;KAClB,CACF,CAAA;AACH,CAAC;AAED,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,aAAa,EAAE,CAAC,CAAC,EAAE,EAAE;IAClC,MAAM,KAAK,GAAG,8BAA8B,EAAE,CAAA;IAC9C,KAAK;SACF,GAAG,CAAC,GAAG,CAAC;SACR,MAAM,CAAC,GAAG,CAAC;SACX,IAAI,CAAC,CAAC,QAAQ,EAAE,EAAE,CAAC,QAAQ,CAAC,OAAO,CAAC,YAAY,CAAC,CAAC;SAClD,IAAI,CAAC,CAAC,MAAM,EAAE,EAAE;QACf,KAAK;aACF,GAAG,CAAC,GAAG,CAAC;aACR,MAAM,CAAC,GAAG,CAAC;aACX,GAAG,CAAC,CAAC,GAAG,EAAE,GAAG,EAAE,EAAE;YAChB,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;YACf,CAAC,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,EAAE,EAAE,KAAK,EAAE,CAAC,EAAE,CAAC,CAAA;YACnC,OAAO,CAAC,CAAC,GAAG,EAAE,CAAA;QAChB,CAAC,CAAC,CAAA;IACN,CAAC,CAAC,CAAA;AACN,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,8BAA8B,EAAE,CAAC,CAAC,EAAE,EAAE;IACnD,MAAM,KAAK,GAAG,8BAA8B,CAC1C,EAAE,MAAM,EAAE,KAAK,EAAE,iBAAiB,EAAE,KAAK,EAAE,OAAO,EAAE,IAAI,EAAE,EAC1D,EAAE,UAAU,EAAE,CAAC,EAAE,CAClB,CAAA;IACD,KAAK;SACF,GAAG,CAAC,GAAG,CAAC;SACR,MAAM,CAAC,GAAG,CAAC;SACX,IAAI,CAAC,GAAG,EAAE;QACT,KAAK;aACF,GAAG,CAAC,GAAG,CAAC;aACR,MAAM,CAAC,GAAG,CAAC;aACX,GAAG,CAAC,CAAC,GAAG,EAAE,GAAG,EAAE,EAAE;YAChB,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;YACf,CAAC,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,EAAE,EAAE,KAAK,EAAE,CAAC,EAAE,CAAC,CAAA;YACnC,IAAI,OAAO,CAAO,CAAC,OAAO,EAAE,EAAE;gBAC5B,UAAU,CAAC,GAAG,EAAE;oBACd,OAAO,EAAE,CAAA;gBACX,CAAC,EAAE,IAAI,CAAC,CAAA;YACV,CAAC,CAAC,CAAC,IAAI,CAAC,GAAG,EAAE;gBACX,KAAK;qBACF,GAAG,CAAC,OAAO,CAAC;qBACZ,MAAM,CAAC,GAAG,CAAC;qBACX,GAAG,CAAC,CAAC,GAAG,EAAE,GAAG,EAAE,EAAE;oBAChB,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;oBACf,CAAC,CAAC,SAAS,CAAC,GAAG,CAAC,IAAI,EAAE,EAAE,KAAK,EAAE,CAAC,EAAE,CAAC,CAAA;oBACnC,OAAO,CAAC,CAAC,GAAG,EAAE,CAAA;gBAChB,CAAC,CAAC,CAAA;YACN,CAAC,CAAC,CAAA;QACJ,CAAC,CAAC,CAAA;IACN,CAAC,CAAC,CAAA;AACN,CAAC,CAAC,CAAA"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"5cc2e0e5af8795eb1edff22d6b1ff20b48bd7e46"},"/Users/jerome/jdesboeufs/connect-mongo/build/main/index.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/index.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":62}},"2":{"start":{"line":5,"column":21},"end":{"line":5,"column":65}},"3":{"start":{"line":6,"column":0},"end":{"line":6,"column":38}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":56},"end":{"line":2,"column":57}},"loc":{"start":{"line":2,"column":71},"end":{"line":4,"column":1}},"line":2}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":56},"end":{"line":4,"column":1}}],"line":2},"1":{"loc":{"start":{"line":3,"column":11},"end":{"line":3,"column":61}},"type":"cond-expr","locations":[{"start":{"line":3,"column":37},"end":{"line":3,"column":40}},{"start":{"line":3,"column":43},"end":{"line":3,"column":61}}],"line":3},"2":{"loc":{"start":{"line":3,"column":12},"end":{"line":3,"column":33}},"type":"binary-expr","locations":[{"start":{"line":3,"column":12},"end":{"line":3,"column":15}},{"start":{"line":3,"column":19},"end":{"line":3,"column":33}}],"line":3}},"s":{"0":1,"1":1,"2":1,"3":1},"f":{"0":1},"b":{"0":[1,1,1],"1":[1,0],"2":[1,1]},"inputSourceMap":{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":";;;;AAAA,kEAAyC;AACzC,iBAAS,oBAAU,CAAA"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"cc66d41cec6904fdd340d5385251c15fd101ea0b"},"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":12,"column":3}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},"2":{"start":{"line":3,"column":26},"end":{"line":3,"column":33}},"3":{"start":{"line":4,"column":15},"end":{"line":4,"column":52}},"4":{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},"5":{"start":{"line":6,"column":6},"end":{"line":6,"column":68}},"6":{"start":{"line":6,"column":51},"end":{"line":6,"column":63}},"7":{"start":{"line":8,"column":4},"end":{"line":8,"column":39}},"8":{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},"9":{"start":{"line":10,"column":26},"end":{"line":10,"column":33}},"10":{"start":{"line":11,"column":4},"end":{"line":11,"column":17}},"11":{"start":{"line":13,"column":25},"end":{"line":17,"column":2}},"12":{"start":{"line":14,"column":4},"end":{"line":14,"column":72}},"13":{"start":{"line":16,"column":4},"end":{"line":16,"column":21}},"14":{"start":{"line":18,"column":19},"end":{"line":24,"column":1}},"15":{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},"16":{"start":{"line":19,"column":31},"end":{"line":19,"column":42}},"17":{"start":{"line":20,"column":17},"end":{"line":20,"column":19}},"18":{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},"19":{"start":{"line":21,"column":21},"end":{"line":21,"column":141}},"20":{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},"21":{"start":{"line":21,"column":109},"end":{"line":21,"column":141}},"22":{"start":{"line":22,"column":4},"end":{"line":22,"column":36}},"23":{"start":{"line":23,"column":4},"end":{"line":23,"column":18}},"24":{"start":{"line":25,"column":22},"end":{"line":27,"column":1}},"25":{"start":{"line":26,"column":4},"end":{"line":26,"column":62}},"26":{"start":{"line":28,"column":0},"end":{"line":28,"column":62}},"27":{"start":{"line":29,"column":18},"end":{"line":29,"column":36}},"28":{"start":{"line":30,"column":15},"end":{"line":30,"column":47}},"29":{"start":{"line":31,"column":16},"end":{"line":31,"column":56}},"30":{"start":{"line":32,"column":18},"end":{"line":32,"column":36}},"31":{"start":{"line":33,"column":16},"end":{"line":33,"column":49}},"32":{"start":{"line":34,"column":14},"end":{"line":34,"column":51}},"33":{"start":{"line":36,"column":13},"end":{"line":36,"column":22}},"34":{"start":{"line":37,"column":13},"end":{"line":37,"column":21}},"35":{"start":{"line":37,"column":20},"end":{"line":37,"column":21}},"36":{"start":{"line":40,"column":16},"end":{"line":40,"column":18}},"37":{"start":{"line":42,"column":4},"end":{"line":56,"column":5}},"38":{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},"39":{"start":{"line":47,"column":12},"end":{"line":50,"column":33}},"40":{"start":{"line":54,"column":12},"end":{"line":54,"column":38}},"41":{"start":{"line":57,"column":4},"end":{"line":57,"column":15}},"42":{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},"43":{"start":{"line":61,"column":8},"end":{"line":64,"column":10}},"44":{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},"45":{"start":{"line":67,"column":8},"end":{"line":70,"column":10}},"46":{"start":{"line":73,"column":4},"end":{"line":76,"column":6}},"47":{"start":{"line":80,"column":8},"end":{"line":80,"column":16}},"48":{"start":{"line":81,"column":8},"end":{"line":81,"column":27}},"49":{"start":{"line":82,"column":8},"end":{"line":82,"column":44}},"50":{"start":{"line":83,"column":24},"end":{"line":104,"column":9}},"51":{"start":{"line":106,"column":8},"end":{"line":106,"column":159}},"52":{"start":{"line":107,"column":8},"end":{"line":108,"column":141}},"53":{"start":{"line":109,"column":8},"end":{"line":110,"column":153}},"54":{"start":{"line":111,"column":8},"end":{"line":111,"column":69}},"55":{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},"56":{"start":{"line":114,"column":12},"end":{"line":114,"column":93}},"57":{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},"58":{"start":{"line":117,"column":12},"end":{"line":117,"column":45}},"59":{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},"60":{"start":{"line":120,"column":12},"end":{"line":120,"column":55}},"61":{"start":{"line":123,"column":12},"end":{"line":123,"column":82}},"62":{"start":{"line":125,"column":8},"end":{"line":125,"column":70}},"63":{"start":{"line":126,"column":8},"end":{"line":126,"column":32}},"64":{"start":{"line":127,"column":8},"end":{"line":127,"column":31}},"65":{"start":{"line":128,"column":8},"end":{"line":134,"column":11}},"66":{"start":{"line":129,"column":31},"end":{"line":131,"column":51}},"67":{"start":{"line":132,"column":12},"end":{"line":132,"column":49}},"68":{"start":{"line":133,"column":12},"end":{"line":133,"column":30}},"69":{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},"70":{"start":{"line":136,"column":12},"end":{"line":136,"column":62}},"71":{"start":{"line":140,"column":8},"end":{"line":140,"column":39}},"72":{"start":{"line":143,"column":28},"end":{"line":147,"column":10}},"73":{"start":{"line":143,"column":35},"end":{"line":147,"column":9}},"74":{"start":{"line":148,"column":8},"end":{"line":168,"column":9}},"75":{"start":{"line":150,"column":16},"end":{"line":150,"column":52}},"76":{"start":{"line":151,"column":16},"end":{"line":154,"column":19}},"77":{"start":{"line":156,"column":16},"end":{"line":156,"column":65}},"78":{"start":{"line":157,"column":16},"end":{"line":162,"column":65}},"79":{"start":{"line":157,"column":47},"end":{"line":162,"column":18}},"80":{"start":{"line":163,"column":16},"end":{"line":163,"column":35}},"81":{"start":{"line":164,"column":16},"end":{"line":164,"column":41}},"82":{"start":{"line":167,"column":16},"end":{"line":167,"column":41}},"83":{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},"84":{"start":{"line":173,"column":12},"end":{"line":173,"column":55}},"85":{"start":{"line":175,"column":8},"end":{"line":175,"column":25}},"86":{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},"87":{"start":{"line":183,"column":12},"end":{"line":183,"column":80}},"88":{"start":{"line":185,"column":8},"end":{"line":185,"column":75}},"89":{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},"90":{"start":{"line":193,"column":30},"end":{"line":195,"column":14}},"91":{"start":{"line":194,"column":16},"end":{"line":194,"column":37}},"92":{"start":{"line":197,"column":12},"end":{"line":197,"column":52}},"93":{"start":{"line":206,"column":8},"end":{"line":230,"column":13}},"94":{"start":{"line":207,"column":12},"end":{"line":229,"column":13}},"95":{"start":{"line":208,"column":16},"end":{"line":208,"column":47}},"96":{"start":{"line":209,"column":35},"end":{"line":209,"column":57}},"97":{"start":{"line":210,"column":32},"end":{"line":216,"column":18}},"98":{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},"99":{"start":{"line":218,"column":20},"end":{"line":218,"column":85}},"100":{"start":{"line":218,"column":70},"end":{"line":218,"column":83}},"101":{"start":{"line":220,"column":26},"end":{"line":220,"column":89}},"102":{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},"103":{"start":{"line":222,"column":20},"end":{"line":222,"column":58}},"104":{"start":{"line":224,"column":16},"end":{"line":224,"column":38}},"105":{"start":{"line":225,"column":16},"end":{"line":225,"column":59}},"106":{"start":{"line":228,"column":16},"end":{"line":228,"column":32}},"107":{"start":{"line":239,"column":8},"end":{"line":295,"column":13}},"108":{"start":{"line":241,"column":12},"end":{"line":293,"column":13}},"109":{"start":{"line":242,"column":16},"end":{"line":242,"column":47}},"110":{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},"111":{"start":{"line":247,"column":20},"end":{"line":247,"column":48}},"112":{"start":{"line":249,"column":26},"end":{"line":252,"column":17}},"113":{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},"114":{"start":{"line":255,"column":20},"end":{"line":255,"column":65}},"115":{"start":{"line":265,"column":20},"end":{"line":265,"column":79}},"116":{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},"117":{"start":{"line":269,"column":20},"end":{"line":269,"column":48}},"118":{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},"119":{"start":{"line":272,"column":38},"end":{"line":272,"column":97}},"120":{"start":{"line":273,"column":33},"end":{"line":275,"column":22}},"121":{"start":{"line":274,"column":24},"end":{"line":274,"column":45}},"122":{"start":{"line":276,"column":20},"end":{"line":276,"column":37}},"123":{"start":{"line":278,"column":35},"end":{"line":278,"column":57}},"124":{"start":{"line":279,"column":32},"end":{"line":282,"column":18}},"125":{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},"126":{"start":{"line":284,"column":20},"end":{"line":284,"column":45}},"127":{"start":{"line":287,"column":20},"end":{"line":287,"column":45}},"128":{"start":{"line":289,"column":16},"end":{"line":289,"column":38}},"129":{"start":{"line":292,"column":16},"end":{"line":292,"column":39}},"130":{"start":{"line":294,"column":12},"end":{"line":294,"column":34}},"131":{"start":{"line":299,"column":8},"end":{"line":339,"column":13}},"132":{"start":{"line":301,"column":12},"end":{"line":338,"column":13}},"133":{"start":{"line":302,"column":16},"end":{"line":302,"column":49}},"134":{"start":{"line":303,"column":37},"end":{"line":303,"column":39}},"135":{"start":{"line":304,"column":35},"end":{"line":304,"column":65}},"136":{"start":{"line":305,"column":37},"end":{"line":307,"column":23}},"137":{"start":{"line":308,"column":36},"end":{"line":308,"column":46}},"138":{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},"139":{"start":{"line":313,"column":40},"end":{"line":313,"column":76}},"140":{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},"141":{"start":{"line":315,"column":24},"end":{"line":315,"column":62}},"142":{"start":{"line":316,"column":24},"end":{"line":316,"column":46}},"143":{"start":{"line":318,"column":20},"end":{"line":318,"column":60}},"144":{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},"145":{"start":{"line":321,"column":20},"end":{"line":321,"column":76}},"146":{"start":{"line":324,"column":20},"end":{"line":324,"column":90}},"147":{"start":{"line":326,"column":35},"end":{"line":326,"column":57}},"148":{"start":{"line":327,"column":32},"end":{"line":327,"column":173}},"149":{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},"150":{"start":{"line":329,"column":20},"end":{"line":329,"column":86}},"151":{"start":{"line":332,"column":20},"end":{"line":332,"column":53}},"152":{"start":{"line":333,"column":20},"end":{"line":333,"column":42}},"153":{"start":{"line":337,"column":16},"end":{"line":337,"column":39}},"154":{"start":{"line":346,"column":8},"end":{"line":369,"column":13}},"155":{"start":{"line":347,"column":12},"end":{"line":368,"column":13}},"156":{"start":{"line":348,"column":16},"end":{"line":348,"column":42}},"157":{"start":{"line":349,"column":35},"end":{"line":349,"column":57}},"158":{"start":{"line":350,"column":33},"end":{"line":355,"column":18}},"159":{"start":{"line":356,"column":32},"end":{"line":356,"column":34}},"160":{"start":{"line":357,"column":16},"end":{"line":362,"column":17}},"161":{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},"162":{"start":{"line":359,"column":24},"end":{"line":359,"column":59}},"163":{"start":{"line":361,"column":20},"end":{"line":361,"column":87}},"164":{"start":{"line":363,"column":16},"end":{"line":363,"column":42}},"165":{"start":{"line":364,"column":16},"end":{"line":364,"column":40}},"166":{"start":{"line":367,"column":16},"end":{"line":367,"column":32}},"167":{"start":{"line":376,"column":8},"end":{"line":376,"column":43}},"168":{"start":{"line":377,"column":8},"end":{"line":383,"column":43}},"169":{"start":{"line":378,"column":34},"end":{"line":378,"column":145}},"170":{"start":{"line":380,"column":12},"end":{"line":380,"column":38}},"171":{"start":{"line":381,"column":12},"end":{"line":381,"column":27}},"172":{"start":{"line":383,"column":28},"end":{"line":383,"column":41}},"173":{"start":{"line":389,"column":8},"end":{"line":389,"column":37}},"174":{"start":{"line":390,"column":8},"end":{"line":394,"column":43}},"175":{"start":{"line":391,"column":34},"end":{"line":391,"column":61}},"176":{"start":{"line":392,"column":25},"end":{"line":392,"column":42}},"177":{"start":{"line":394,"column":28},"end":{"line":394,"column":41}},"178":{"start":{"line":400,"column":8},"end":{"line":400,"column":36}},"179":{"start":{"line":401,"column":8},"end":{"line":404,"column":43}},"180":{"start":{"line":402,"column":34},"end":{"line":402,"column":51}},"181":{"start":{"line":403,"column":24},"end":{"line":403,"column":38}},"182":{"start":{"line":404,"column":28},"end":{"line":404,"column":41}},"183":{"start":{"line":410,"column":8},"end":{"line":410,"column":36}},"184":{"start":{"line":411,"column":8},"end":{"line":411,"column":51}},"185":{"start":{"line":411,"column":40},"end":{"line":411,"column":49}},"186":{"start":{"line":414,"column":0},"end":{"line":414,"column":29}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":74},"end":{"line":2,"column":75}},"loc":{"start":{"line":2,"column":96},"end":{"line":9,"column":1}},"line":2},"1":{"name":"(anonymous_1)","decl":{"start":{"line":6,"column":38},"end":{"line":6,"column":39}},"loc":{"start":{"line":6,"column":49},"end":{"line":6,"column":65}},"line":6},"2":{"name":"(anonymous_2)","decl":{"start":{"line":9,"column":6},"end":{"line":9,"column":7}},"loc":{"start":{"line":9,"column":28},"end":{"line":12,"column":1}},"line":9},"3":{"name":"(anonymous_3)","decl":{"start":{"line":13,"column":80},"end":{"line":13,"column":81}},"loc":{"start":{"line":13,"column":95},"end":{"line":15,"column":1}},"line":13},"4":{"name":"(anonymous_4)","decl":{"start":{"line":15,"column":5},"end":{"line":15,"column":6}},"loc":{"start":{"line":15,"column":20},"end":{"line":17,"column":1}},"line":15},"5":{"name":"(anonymous_5)","decl":{"start":{"line":18,"column":50},"end":{"line":18,"column":51}},"loc":{"start":{"line":18,"column":65},"end":{"line":24,"column":1}},"line":18},"6":{"name":"(anonymous_6)","decl":{"start":{"line":25,"column":56},"end":{"line":25,"column":57}},"loc":{"start":{"line":25,"column":71},"end":{"line":27,"column":1}},"line":25},"7":{"name":"(anonymous_7)","decl":{"start":{"line":36,"column":13},"end":{"line":36,"column":14}},"loc":{"start":{"line":36,"column":19},"end":{"line":36,"column":22}},"line":36},"8":{"name":"(anonymous_8)","decl":{"start":{"line":37,"column":13},"end":{"line":37,"column":14}},"loc":{"start":{"line":37,"column":20},"end":{"line":37,"column":21}},"line":37},"9":{"name":"defaultSerializeFunction","decl":{"start":{"line":38,"column":9},"end":{"line":38,"column":33}},"loc":{"start":{"line":38,"column":43},"end":{"line":58,"column":1}},"line":38},"10":{"name":"computeTransformFunctions","decl":{"start":{"line":59,"column":9},"end":{"line":59,"column":34}},"loc":{"start":{"line":59,"column":44},"end":{"line":77,"column":1}},"line":59},"11":{"name":"(anonymous_11)","decl":{"start":{"line":79,"column":4},"end":{"line":79,"column":5}},"loc":{"start":{"line":79,"column":186},"end":{"line":138,"column":5}},"line":79},"12":{"name":"(anonymous_12)","decl":{"start":{"line":128,"column":41},"end":{"line":128,"column":42}},"loc":{"start":{"line":128,"column":56},"end":{"line":134,"column":9}},"line":128},"13":{"name":"(anonymous_13)","decl":{"start":{"line":139,"column":4},"end":{"line":139,"column":5}},"loc":{"start":{"line":139,"column":27},"end":{"line":141,"column":5}},"line":139},"14":{"name":"(anonymous_14)","decl":{"start":{"line":142,"column":4},"end":{"line":142,"column":5}},"loc":{"start":{"line":142,"column":30},"end":{"line":169,"column":5}},"line":142},"15":{"name":"(anonymous_15)","decl":{"start":{"line":143,"column":28},"end":{"line":143,"column":29}},"loc":{"start":{"line":143,"column":35},"end":{"line":147,"column":9}},"line":143},"16":{"name":"(anonymous_16)","decl":{"start":{"line":157,"column":41},"end":{"line":157,"column":42}},"loc":{"start":{"line":157,"column":47},"end":{"line":162,"column":18}},"line":157},"17":{"name":"(anonymous_17)","decl":{"start":{"line":170,"column":4},"end":{"line":170,"column":5}},"loc":{"start":{"line":170,"column":32},"end":{"line":176,"column":5}},"line":170},"18":{"name":"(anonymous_18)","decl":{"start":{"line":181,"column":4},"end":{"line":181,"column":5}},"loc":{"start":{"line":181,"column":20},"end":{"line":186,"column":5}},"line":181},"19":{"name":"(anonymous_19)","decl":{"start":{"line":191,"column":4},"end":{"line":191,"column":5}},"loc":{"start":{"line":191,"column":34},"end":{"line":199,"column":5}},"line":191},"20":{"name":"(anonymous_20)","decl":{"start":{"line":193,"column":102},"end":{"line":193,"column":103}},"loc":{"start":{"line":193,"column":111},"end":{"line":195,"column":13}},"line":193},"21":{"name":"(anonymous_21)","decl":{"start":{"line":204,"column":4},"end":{"line":204,"column":5}},"loc":{"start":{"line":204,"column":23},"end":{"line":231,"column":5}},"line":204},"22":{"name":"(anonymous_22)","decl":{"start":{"line":206,"column":9},"end":{"line":206,"column":10}},"loc":{"start":{"line":206,"column":21},"end":{"line":230,"column":9}},"line":206},"23":{"name":"(anonymous_23)","decl":{"start":{"line":218,"column":61},"end":{"line":218,"column":62}},"loc":{"start":{"line":218,"column":70},"end":{"line":218,"column":83}},"line":218},"24":{"name":"(anonymous_24)","decl":{"start":{"line":237,"column":4},"end":{"line":237,"column":5}},"loc":{"start":{"line":237,"column":39},"end":{"line":296,"column":5}},"line":237},"25":{"name":"(anonymous_25)","decl":{"start":{"line":239,"column":9},"end":{"line":239,"column":10}},"loc":{"start":{"line":239,"column":21},"end":{"line":295,"column":9}},"line":239},"26":{"name":"(anonymous_26)","decl":{"start":{"line":273,"column":94},"end":{"line":273,"column":95}},"loc":{"start":{"line":273,"column":103},"end":{"line":275,"column":21}},"line":273},"27":{"name":"(anonymous_27)","decl":{"start":{"line":297,"column":4},"end":{"line":297,"column":5}},"loc":{"start":{"line":297,"column":41},"end":{"line":340,"column":5}},"line":297},"28":{"name":"(anonymous_28)","decl":{"start":{"line":299,"column":9},"end":{"line":299,"column":10}},"loc":{"start":{"line":299,"column":21},"end":{"line":339,"column":9}},"line":299},"29":{"name":"(anonymous_29)","decl":{"start":{"line":344,"column":4},"end":{"line":344,"column":5}},"loc":{"start":{"line":344,"column":18},"end":{"line":370,"column":5}},"line":344},"30":{"name":"(anonymous_30)","decl":{"start":{"line":346,"column":9},"end":{"line":346,"column":10}},"loc":{"start":{"line":346,"column":21},"end":{"line":369,"column":9}},"line":346},"31":{"name":"(anonymous_31)","decl":{"start":{"line":375,"column":4},"end":{"line":375,"column":5}},"loc":{"start":{"line":375,"column":34},"end":{"line":384,"column":5}},"line":375},"32":{"name":"(anonymous_32)","decl":{"start":{"line":378,"column":18},"end":{"line":378,"column":19}},"loc":{"start":{"line":378,"column":34},"end":{"line":378,"column":145}},"line":378},"33":{"name":"(anonymous_33)","decl":{"start":{"line":379,"column":18},"end":{"line":379,"column":19}},"loc":{"start":{"line":379,"column":24},"end":{"line":382,"column":9}},"line":379},"34":{"name":"(anonymous_34)","decl":{"start":{"line":383,"column":19},"end":{"line":383,"column":20}},"loc":{"start":{"line":383,"column":28},"end":{"line":383,"column":41}},"line":383},"35":{"name":"(anonymous_35)","decl":{"start":{"line":388,"column":4},"end":{"line":388,"column":5}},"loc":{"start":{"line":388,"column":21},"end":{"line":395,"column":5}},"line":388},"36":{"name":"(anonymous_36)","decl":{"start":{"line":391,"column":18},"end":{"line":391,"column":19}},"loc":{"start":{"line":391,"column":34},"end":{"line":391,"column":61}},"line":391},"37":{"name":"(anonymous_37)","decl":{"start":{"line":392,"column":18},"end":{"line":392,"column":19}},"loc":{"start":{"line":392,"column":25},"end":{"line":392,"column":42}},"line":392},"38":{"name":"(anonymous_38)","decl":{"start":{"line":394,"column":19},"end":{"line":394,"column":20}},"loc":{"start":{"line":394,"column":28},"end":{"line":394,"column":41}},"line":394},"39":{"name":"(anonymous_39)","decl":{"start":{"line":399,"column":4},"end":{"line":399,"column":5}},"loc":{"start":{"line":399,"column":27},"end":{"line":405,"column":5}},"line":399},"40":{"name":"(anonymous_40)","decl":{"start":{"line":402,"column":18},"end":{"line":402,"column":19}},"loc":{"start":{"line":402,"column":34},"end":{"line":402,"column":51}},"line":402},"41":{"name":"(anonymous_41)","decl":{"start":{"line":403,"column":18},"end":{"line":403,"column":19}},"loc":{"start":{"line":403,"column":24},"end":{"line":403,"column":38}},"line":403},"42":{"name":"(anonymous_42)","decl":{"start":{"line":404,"column":19},"end":{"line":404,"column":20}},"loc":{"start":{"line":404,"column":28},"end":{"line":404,"column":41}},"line":404},"43":{"name":"(anonymous_43)","decl":{"start":{"line":409,"column":4},"end":{"line":409,"column":5}},"loc":{"start":{"line":409,"column":12},"end":{"line":412,"column":5}},"line":409},"44":{"name":"(anonymous_44)","decl":{"start":{"line":411,"column":33},"end":{"line":411,"column":34}},"loc":{"start":{"line":411,"column":40},"end":{"line":411,"column":49}},"line":411}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":12,"column":3}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":57},"end":{"line":12,"column":2}}],"line":2},"1":{"loc":{"start":{"line":2,"column":57},"end":{"line":12,"column":2}},"type":"cond-expr","locations":[{"start":{"line":2,"column":74},"end":{"line":9,"column":1}},{"start":{"line":9,"column":6},"end":{"line":12,"column":1}}],"line":2},"2":{"loc":{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},"type":"if","locations":[{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},{"start":{"line":3,"column":4},"end":{"line":3,"column":33}}],"line":3},"3":{"loc":{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},"type":"if","locations":[{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},{"start":{"line":5,"column":4},"end":{"line":7,"column":5}}],"line":5},"4":{"loc":{"start":{"line":5,"column":8},"end":{"line":5,"column":85}},"type":"binary-expr","locations":[{"start":{"line":5,"column":8},"end":{"line":5,"column":13}},{"start":{"line":5,"column":18},"end":{"line":5,"column":84}}],"line":5},"5":{"loc":{"start":{"line":5,"column":18},"end":{"line":5,"column":84}},"type":"cond-expr","locations":[{"start":{"line":5,"column":34},"end":{"line":5,"column":47}},{"start":{"line":5,"column":50},"end":{"line":5,"column":84}}],"line":5},"6":{"loc":{"start":{"line":5,"column":50},"end":{"line":5,"column":84}},"type":"binary-expr","locations":[{"start":{"line":5,"column":50},"end":{"line":5,"column":63}},{"start":{"line":5,"column":67},"end":{"line":5,"column":84}}],"line":5},"7":{"loc":{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},"type":"if","locations":[{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},{"start":{"line":10,"column":4},"end":{"line":10,"column":33}}],"line":10},"8":{"loc":{"start":{"line":13,"column":25},"end":{"line":17,"column":2}},"type":"binary-expr","locations":[{"start":{"line":13,"column":26},"end":{"line":13,"column":30}},{"start":{"line":13,"column":34},"end":{"line":13,"column":57}},{"start":{"line":13,"column":63},"end":{"line":17,"column":1}}],"line":13},"9":{"loc":{"start":{"line":13,"column":63},"end":{"line":17,"column":1}},"type":"cond-expr","locations":[{"start":{"line":13,"column":80},"end":{"line":15,"column":1}},{"start":{"line":15,"column":5},"end":{"line":17,"column":1}}],"line":13},"10":{"loc":{"start":{"line":18,"column":19},"end":{"line":24,"column":1}},"type":"binary-expr","locations":[{"start":{"line":18,"column":20},"end":{"line":18,"column":24}},{"start":{"line":18,"column":28},"end":{"line":18,"column":45}},{"start":{"line":18,"column":50},"end":{"line":24,"column":1}}],"line":18},"11":{"loc":{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},"type":"if","locations":[{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},{"start":{"line":19,"column":4},"end":{"line":19,"column":42}}],"line":19},"12":{"loc":{"start":{"line":19,"column":8},"end":{"line":19,"column":29}},"type":"binary-expr","locations":[{"start":{"line":19,"column":8},"end":{"line":19,"column":11}},{"start":{"line":19,"column":15},"end":{"line":19,"column":29}}],"line":19},"13":{"loc":{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},"type":"if","locations":[{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},{"start":{"line":21,"column":4},"end":{"line":21,"column":141}}],"line":21},"14":{"loc":{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},"type":"if","locations":[{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},{"start":{"line":21,"column":40},"end":{"line":21,"column":141}}],"line":21},"15":{"loc":{"start":{"line":21,"column":44},"end":{"line":21,"column":107}},"type":"binary-expr","locations":[{"start":{"line":21,"column":44},"end":{"line":21,"column":59}},{"start":{"line":21,"column":63},"end":{"line":21,"column":107}}],"line":21},"16":{"loc":{"start":{"line":25,"column":22},"end":{"line":27,"column":1}},"type":"binary-expr","locations":[{"start":{"line":25,"column":23},"end":{"line":25,"column":27}},{"start":{"line":25,"column":31},"end":{"line":25,"column":51}},{"start":{"line":25,"column":56},"end":{"line":27,"column":1}}],"line":25},"17":{"loc":{"start":{"line":26,"column":11},"end":{"line":26,"column":61}},"type":"cond-expr","locations":[{"start":{"line":26,"column":37},"end":{"line":26,"column":40}},{"start":{"line":26,"column":43},"end":{"line":26,"column":61}}],"line":26},"18":{"loc":{"start":{"line":26,"column":12},"end":{"line":26,"column":33}},"type":"binary-expr","locations":[{"start":{"line":26,"column":12},"end":{"line":26,"column":15}},{"start":{"line":26,"column":19},"end":{"line":26,"column":33}}],"line":26},"19":{"loc":{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},"type":"if","locations":[{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},{"start":{"line":43,"column":8},"end":{"line":55,"column":9}}],"line":43},"20":{"loc":{"start":{"line":47,"column":25},"end":{"line":50,"column":32}},"type":"cond-expr","locations":[{"start":{"line":49,"column":20},"end":{"line":49,"column":43}},{"start":{"line":50,"column":18},"end":{"line":50,"column":32}}],"line":47},"21":{"loc":{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},"type":"if","locations":[{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},{"start":{"line":60,"column":4},"end":{"line":65,"column":5}}],"line":60},"22":{"loc":{"start":{"line":60,"column":8},"end":{"line":60,"column":48}},"type":"binary-expr","locations":[{"start":{"line":60,"column":8},"end":{"line":60,"column":25}},{"start":{"line":60,"column":29},"end":{"line":60,"column":48}}],"line":60},"23":{"loc":{"start":{"line":62,"column":23},"end":{"line":62,"column":68}},"type":"binary-expr","locations":[{"start":{"line":62,"column":23},"end":{"line":62,"column":40}},{"start":{"line":62,"column":44},"end":{"line":62,"column":68}}],"line":62},"24":{"loc":{"start":{"line":63,"column":25},"end":{"line":63,"column":52}},"type":"binary-expr","locations":[{"start":{"line":63,"column":25},"end":{"line":63,"column":44}},{"start":{"line":63,"column":48},"end":{"line":63,"column":52}}],"line":63},"25":{"loc":{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},"type":"if","locations":[{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},{"start":{"line":66,"column":4},"end":{"line":71,"column":5}}],"line":66},"26":{"loc":{"start":{"line":79,"column":18},"end":{"line":79,"column":45}},"type":"default-arg","locations":[{"start":{"line":79,"column":35},"end":{"line":79,"column":45}}],"line":79},"27":{"loc":{"start":{"line":79,"column":47},"end":{"line":79,"column":60}},"type":"default-arg","locations":[{"start":{"line":79,"column":53},"end":{"line":79,"column":60}}],"line":79},"28":{"loc":{"start":{"line":79,"column":62},"end":{"line":79,"column":79}},"type":"default-arg","locations":[{"start":{"line":79,"column":77},"end":{"line":79,"column":79}}],"line":79},"29":{"loc":{"start":{"line":79,"column":81},"end":{"line":79,"column":102}},"type":"default-arg","locations":[{"start":{"line":79,"column":94},"end":{"line":79,"column":102}}],"line":79},"30":{"loc":{"start":{"line":79,"column":104},"end":{"line":79,"column":127}},"type":"default-arg","locations":[{"start":{"line":79,"column":125},"end":{"line":79,"column":127}}],"line":79},"31":{"loc":{"start":{"line":79,"column":129},"end":{"line":79,"column":143}},"type":"default-arg","locations":[{"start":{"line":79,"column":142},"end":{"line":79,"column":143}}],"line":79},"32":{"loc":{"start":{"line":79,"column":145},"end":{"line":79,"column":161}},"type":"default-arg","locations":[{"start":{"line":79,"column":157},"end":{"line":79,"column":161}}],"line":79},"33":{"loc":{"start":{"line":106,"column":30},"end":{"line":106,"column":89}},"type":"binary-expr","locations":[{"start":{"line":106,"column":30},"end":{"line":106,"column":46}},{"start":{"line":106,"column":50},"end":{"line":106,"column":71}},{"start":{"line":106,"column":75},"end":{"line":106,"column":89}}],"line":106},"34":{"loc":{"start":{"line":107,"column":30},"end":{"line":108,"column":53}},"type":"binary-expr","locations":[{"start":{"line":107,"column":30},"end":{"line":107,"column":66}},{"start":{"line":108,"column":12},"end":{"line":108,"column":53}}],"line":107},"35":{"loc":{"start":{"line":109,"column":30},"end":{"line":109,"column":96}},"type":"binary-expr","locations":[{"start":{"line":109,"column":30},"end":{"line":109,"column":57}},{"start":{"line":109,"column":61},"end":{"line":109,"column":96}}],"line":109},"36":{"loc":{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},{"start":{"line":113,"column":8},"end":{"line":124,"column":9}}],"line":113},"37":{"loc":{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},{"start":{"line":116,"column":13},"end":{"line":124,"column":9}}],"line":116},"38":{"loc":{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},{"start":{"line":119,"column":13},"end":{"line":124,"column":9}}],"line":119},"39":{"loc":{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},"type":"if","locations":[{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},{"start":{"line":135,"column":8},"end":{"line":137,"column":9}}],"line":135},"40":{"loc":{"start":{"line":148,"column":8},"end":{"line":168,"column":9}},"type":"switch","locations":[{"start":{"line":149,"column":12},"end":{"line":154,"column":19}},{"start":{"line":155,"column":12},"end":{"line":164,"column":41}},{"start":{"line":165,"column":12},"end":{"line":165,"column":28}},{"start":{"line":166,"column":12},"end":{"line":167,"column":41}}],"line":148},"41":{"loc":{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},"type":"if","locations":[{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},{"start":{"line":171,"column":8},"end":{"line":174,"column":9}}],"line":171},"42":{"loc":{"start":{"line":171,"column":12},"end":{"line":172,"column":58}},"type":"binary-expr","locations":[{"start":{"line":171,"column":12},"end":{"line":171,"column":36}},{"start":{"line":172,"column":12},"end":{"line":172,"column":58}}],"line":171},"43":{"loc":{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},"type":"if","locations":[{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},{"start":{"line":182,"column":8},"end":{"line":184,"column":9}}],"line":182},"44":{"loc":{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},"type":"if","locations":[{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},{"start":{"line":192,"column":8},"end":{"line":198,"column":9}}],"line":192},"45":{"loc":{"start":{"line":192,"column":12},"end":{"line":192,"column":34}},"type":"binary-expr","locations":[{"start":{"line":192,"column":12},"end":{"line":192,"column":23}},{"start":{"line":192,"column":27},"end":{"line":192,"column":34}}],"line":192},"46":{"loc":{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},"type":"if","locations":[{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},{"start":{"line":217,"column":16},"end":{"line":219,"column":17}}],"line":217},"47":{"loc":{"start":{"line":217,"column":20},"end":{"line":217,"column":42}},"type":"binary-expr","locations":[{"start":{"line":217,"column":20},"end":{"line":217,"column":31}},{"start":{"line":217,"column":35},"end":{"line":217,"column":42}}],"line":217},"48":{"loc":{"start":{"line":220,"column":26},"end":{"line":220,"column":89}},"type":"binary-expr","locations":[{"start":{"line":220,"column":26},"end":{"line":220,"column":33}},{"start":{"line":220,"column":37},"end":{"line":220,"column":89}}],"line":220},"49":{"loc":{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},"type":"if","locations":[{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},{"start":{"line":221,"column":16},"end":{"line":223,"column":17}}],"line":221},"50":{"loc":{"start":{"line":221,"column":20},"end":{"line":221,"column":123}},"type":"binary-expr","locations":[{"start":{"line":221,"column":20},"end":{"line":221,"column":47}},{"start":{"line":221,"column":52},"end":{"line":221,"column":122}}],"line":221},"51":{"loc":{"start":{"line":221,"column":52},"end":{"line":221,"column":122}},"type":"cond-expr","locations":[{"start":{"line":221,"column":93},"end":{"line":221,"column":99}},{"start":{"line":221,"column":102},"end":{"line":221,"column":122}}],"line":221},"52":{"loc":{"start":{"line":221,"column":52},"end":{"line":221,"column":90}},"type":"binary-expr","locations":[{"start":{"line":221,"column":52},"end":{"line":221,"column":68}},{"start":{"line":221,"column":72},"end":{"line":221,"column":90}}],"line":221},"53":{"loc":{"start":{"line":225,"column":31},"end":{"line":225,"column":57}},"type":"cond-expr","locations":[{"start":{"line":225,"column":49},"end":{"line":225,"column":53}},{"start":{"line":225,"column":56},"end":{"line":225,"column":57}}],"line":225},"54":{"loc":{"start":{"line":237,"column":22},"end":{"line":237,"column":37}},"type":"default-arg","locations":[{"start":{"line":237,"column":33},"end":{"line":237,"column":37}}],"line":237},"55":{"loc":{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},"type":"if","locations":[{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},{"start":{"line":245,"column":16},"end":{"line":248,"column":17}}],"line":245},"56":{"loc":{"start":{"line":245,"column":20},"end":{"line":245,"column":123}},"type":"binary-expr","locations":[{"start":{"line":245,"column":20},"end":{"line":245,"column":47}},{"start":{"line":245,"column":52},"end":{"line":245,"column":122}}],"line":245},"57":{"loc":{"start":{"line":245,"column":52},"end":{"line":245,"column":122}},"type":"cond-expr","locations":[{"start":{"line":245,"column":93},"end":{"line":245,"column":99}},{"start":{"line":245,"column":102},"end":{"line":245,"column":122}}],"line":245},"58":{"loc":{"start":{"line":245,"column":52},"end":{"line":245,"column":90}},"type":"binary-expr","locations":[{"start":{"line":245,"column":52},"end":{"line":245,"column":68}},{"start":{"line":245,"column":72},"end":{"line":245,"column":90}}],"line":245},"59":{"loc":{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},"type":"if","locations":[{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},{"start":{"line":254,"column":16},"end":{"line":266,"column":17}}],"line":254},"60":{"loc":{"start":{"line":254,"column":20},"end":{"line":254,"column":139}},"type":"cond-expr","locations":[{"start":{"line":254,"column":120},"end":{"line":254,"column":126}},{"start":{"line":254,"column":129},"end":{"line":254,"column":139}}],"line":254},"61":{"loc":{"start":{"line":254,"column":20},"end":{"line":254,"column":117}},"type":"binary-expr","locations":[{"start":{"line":254,"column":20},"end":{"line":254,"column":100}},{"start":{"line":254,"column":104},"end":{"line":254,"column":117}}],"line":254},"62":{"loc":{"start":{"line":254,"column":26},"end":{"line":254,"column":90}},"type":"cond-expr","locations":[{"start":{"line":254,"column":67},"end":{"line":254,"column":73}},{"start":{"line":254,"column":76},"end":{"line":254,"column":90}}],"line":254},"63":{"loc":{"start":{"line":254,"column":26},"end":{"line":254,"column":64}},"type":"binary-expr","locations":[{"start":{"line":254,"column":26},"end":{"line":254,"column":42}},{"start":{"line":254,"column":46},"end":{"line":254,"column":64}}],"line":254},"64":{"loc":{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},"type":"if","locations":[{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},{"start":{"line":268,"column":16},"end":{"line":270,"column":17}}],"line":268},"65":{"loc":{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},"type":"if","locations":[{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},{"start":{"line":271,"column":16},"end":{"line":277,"column":17}}],"line":271},"66":{"loc":{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},"type":"if","locations":[{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},{"start":{"line":283,"column":16},"end":{"line":288,"column":17}}],"line":283},"67":{"loc":{"start":{"line":297,"column":24},"end":{"line":297,"column":39}},"type":"default-arg","locations":[{"start":{"line":297,"column":35},"end":{"line":297,"column":39}}],"line":297},"68":{"loc":{"start":{"line":305,"column":37},"end":{"line":307,"column":23}},"type":"cond-expr","locations":[{"start":{"line":306,"column":22},"end":{"line":306,"column":52}},{"start":{"line":307,"column":22},"end":{"line":307,"column":23}}],"line":305},"69":{"loc":{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},"type":"if","locations":[{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},{"start":{"line":312,"column":16},"end":{"line":319,"column":17}}],"line":312},"70":{"loc":{"start":{"line":312,"column":20},"end":{"line":312,"column":54}},"type":"binary-expr","locations":[{"start":{"line":312,"column":20},"end":{"line":312,"column":34}},{"start":{"line":312,"column":38},"end":{"line":312,"column":54}}],"line":312},"71":{"loc":{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},"type":"if","locations":[{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},{"start":{"line":314,"column":20},"end":{"line":317,"column":21}}],"line":314},"72":{"loc":{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},"type":"if","locations":[{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},{"start":{"line":320,"column":16},"end":{"line":325,"column":17}}],"line":320},"73":{"loc":{"start":{"line":320,"column":20},"end":{"line":320,"column":139}},"type":"cond-expr","locations":[{"start":{"line":320,"column":120},"end":{"line":320,"column":126}},{"start":{"line":320,"column":129},"end":{"line":320,"column":139}}],"line":320},"74":{"loc":{"start":{"line":320,"column":20},"end":{"line":320,"column":117}},"type":"binary-expr","locations":[{"start":{"line":320,"column":20},"end":{"line":320,"column":100}},{"start":{"line":320,"column":104},"end":{"line":320,"column":117}}],"line":320},"75":{"loc":{"start":{"line":320,"column":26},"end":{"line":320,"column":90}},"type":"cond-expr","locations":[{"start":{"line":320,"column":67},"end":{"line":320,"column":73}},{"start":{"line":320,"column":76},"end":{"line":320,"column":90}}],"line":320},"76":{"loc":{"start":{"line":320,"column":26},"end":{"line":320,"column":64}},"type":"binary-expr","locations":[{"start":{"line":320,"column":26},"end":{"line":320,"column":42}},{"start":{"line":320,"column":46},"end":{"line":320,"column":64}}],"line":320},"77":{"loc":{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},"type":"if","locations":[{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},{"start":{"line":328,"column":16},"end":{"line":334,"column":17}}],"line":328},"78":{"loc":{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},"type":"if","locations":[{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},{"start":{"line":358,"column":20},"end":{"line":360,"column":21}}],"line":358},"79":{"loc":{"start":{"line":358,"column":24},"end":{"line":358,"column":46}},"type":"binary-expr","locations":[{"start":{"line":358,"column":24},"end":{"line":358,"column":35}},{"start":{"line":358,"column":39},"end":{"line":358,"column":46}}],"line":358},"80":{"loc":{"start":{"line":375,"column":17},"end":{"line":375,"column":32}},"type":"default-arg","locations":[{"start":{"line":375,"column":28},"end":{"line":375,"column":32}}],"line":375},"81":{"loc":{"start":{"line":399,"column":10},"end":{"line":399,"column":25}},"type":"default-arg","locations":[{"start":{"line":399,"column":21},"end":{"line":399,"column":25}}],"line":399}},"s":{"0":1,"1":4,"2":4,"3":4,"4":4,"5":4,"6":1,"7":4,"8":0,"9":0,"10":0,"11":1,"12":1,"13":0,"14":1,"15":1,"16":0,"17":1,"18":1,"19":1,"20":4,"21":4,"22":1,"23":1,"24":1,"25":2,"26":1,"27":1,"28":1,"29":1,"30":1,"31":1,"32":1,"33":1,"34":1,"35":0,"36":1,"37":1,"38":2,"39":1,"40":1,"41":1,"42":1,"43":0,"44":1,"45":1,"46":0,"47":1,"48":1,"49":1,"50":1,"51":1,"52":1,"53":1,"54":1,"55":1,"56":1,"57":0,"58":0,"59":0,"60":0,"61":0,"62":1,"63":1,"64":1,"65":1,"66":0,"67":0,"68":0,"69":1,"70":0,"71":1,"72":0,"73":0,"74":0,"75":0,"76":0,"77":0,"78":0,"79":0,"80":0,"81":0,"82":0,"83":1,"84":0,"85":1,"86":0,"87":0,"88":0,"89":0,"90":0,"91":0,"92":0,"93":1,"94":1,"95":1,"96":1,"97":0,"98":0,"99":0,"100":0,"101":0,"102":0,"103":0,"104":0,"105":0,"106":1,"107":1,"108":1,"109":1,"110":1,"111":0,"112":1,"113":1,"114":0,"115":1,"116":1,"117":0,"118":1,"119":0,"120":0,"121":0,"122":0,"123":1,"124":0,"125":0,"126":0,"127":0,"128":0,"129":1,"130":0,"131":0,"132":0,"133":0,"134":0,"135":0,"136":0,"137":0,"138":0,"139":0,"140":0,"141":0,"142":0,"143":0,"144":0,"145":0,"146":0,"147":0,"148":0,"149":0,"150":0,"151":0,"152":0,"153":0,"154":0,"155":0,"156":0,"157":0,"158":0,"159":0,"160":0,"161":0,"162":0,"163":0,"164":0,"165":0,"166":0,"167":0,"168":0,"169":0,"170":0,"171":0,"172":0,"173":0,"174":0,"175":0,"176":0,"177":0,"178":0,"179":0,"180":0,"181":0,"182":0,"183":0,"184":0,"185":0,"186":1},"f":{"0":4,"1":1,"2":0,"3":1,"4":0,"5":1,"6":2,"7":0,"8":0,"9":1,"10":1,"11":1,"12":0,"13":1,"14":0,"15":0,"16":0,"17":1,"18":0,"19":0,"20":0,"21":1,"22":1,"23":0,"24":1,"25":1,"26":0,"27":0,"28":0,"29":0,"30":0,"31":0,"32":0,"33":0,"34":0,"35":0,"36":0,"37":0,"38":0,"39":0,"40":0,"41":0,"42":0,"43":0,"44":0},"b":{"0":[1,1,1],"1":[1,0],"2":[4,0],"3":[4,0],"4":[4,4],"5":[0,4],"6":[4,0],"7":[0,0],"8":[1,1,1],"9":[1,0],"10":[1,1,1],"11":[0,1],"12":[1,1],"13":[1,0],"14":[4,0],"15":[4,4],"16":[1,1,1],"17":[0,2],"18":[2,2],"19":[1,1],"20":[1,0],"21":[0,1],"22":[1,1],"23":[0,0],"24":[0,0],"25":[1,0],"26":[1],"27":[1],"28":[1],"29":[1],"30":[1],"31":[1],"32":[0],"33":[1,0,0],"34":[1,1],"35":[1,1],"36":[1,0],"37":[0,0],"38":[0,0],"39":[0,1],"40":[0,0,0,0],"41":[0,1],"42":[1,0],"43":[0,0],"44":[0,0],"45":[0,0],"46":[0,0],"47":[0,0],"48":[0,0],"49":[0,0],"50":[0,0],"51":[0,0],"52":[0,0],"53":[0,0],"54":[0],"55":[0,1],"56":[1,0],"57":[0,0],"58":[0,0],"59":[0,1],"60":[0,1],"61":[1,1],"62":[0,1],"63":[1,1],"64":[0,1],"65":[0,1],"66":[0,0],"67":[0],"68":[0,0],"69":[0,0],"70":[0,0],"71":[0,0],"72":[0,0],"73":[0,0],"74":[0,0],"75":[0,0],"76":[0,0],"77":[0,0],"78":[0,0],"79":[0,0],"80":[0],"81":[0]},"inputSourceMap":{"version":3,"file":"MongoStore.js","sourceRoot":"","sources":["../../../src/lib/MongoStore.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,qCAAgC;AAChC,gDAAuB;AACvB,yDAA0C;AAC1C,qCAKgB;AAChB,kDAAyB;AAGzB,MAAM,KAAK,GAAG,IAAA,eAAK,EAAC,eAAe,CAAC,CAAA;AAgEpC,gEAAgE;AAChE,MAAM,IAAI,GAAG,GAAG,EAAE,GAAE,CAAC,CAAA;AACrB,MAAM,IAAI,GAAmB,CAAC,CAAC,EAAE,EAAE,CAAC,CAAC,CAAA;AAErC,SAAS,wBAAwB,CAC/B,OAA4B;IAE5B,oDAAoD;IACpD,MAAM,GAAG,GAAG,EAAE,CAAA;IACd,IAAI,IAAI,CAAA;IACR,KAAK,IAAI,IAAI,OAAO,EAAE;QACpB,IAAI,IAAI,KAAK,QAAQ,EAAE;YACrB,wDAAwD;YACxD,2EAA2E;YAC3E,oBAAoB;YACpB,GAAG,CAAC,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC,MAAM;gBAChC,CAAC,CAAC,oBAAoB;oBACpB,OAAO,CAAC,MAAM,CAAC,MAAM,EAAE;gBACzB,CAAC,CAAC,OAAO,CAAC,MAAM,CAAA;SACnB;aAAM;YACL,oBAAoB;YACpB,GAAG,CAAC,IAAI,CAAC,GAAG,OAAO,CAAC,IAAI,CAAC,CAAA;SAC1B;KACF;IAED,OAAO,GAA0B,CAAA;AACnC,CAAC;AAED,SAAS,yBAAyB,CAAC,OAAmC;IACpE,IAAI,OAAO,CAAC,SAAS,IAAI,OAAO,CAAC,WAAW,EAAE;QAC5C,OAAO;YACL,SAAS,EAAE,OAAO,CAAC,SAAS,IAAI,wBAAwB;YACxD,WAAW,EAAE,OAAO,CAAC,WAAW,IAAI,IAAI;SACzC,CAAA;KACF;IAED,IAAI,OAAO,CAAC,SAAS,KAAK,KAAK,EAAE;QAC/B,OAAO;YACL,SAAS,EAAE,wBAAwB;YACnC,WAAW,EAAE,IAAI;SAClB,CAAA;KACF;IACD,eAAe;IACf,OAAO;QACL,SAAS,EAAE,IAAI,CAAC,SAAS;QACzB,WAAW,EAAE,IAAI,CAAC,KAAK;KACxB,CAAA;AACH,CAAC;AAED,MAAqB,UAAW,SAAQ,OAAO,CAAC,KAAK;IAYnD,YAAY,EACV,cAAc,GAAG,UAAU,EAC3B,GAAG,GAAG,OAAO,EACb,YAAY,GAAG,EAAE,EACjB,UAAU,GAAG,QAAQ,EACrB,kBAAkB,GAAG,EAAE,EACvB,UAAU,GAAG,CAAC,EACd,SAAS,GAAG,IAAI,EAChB,MAAM,EACN,GAAG,QAAQ,EACS;QACpB,KAAK,EAAE,CAAA;QArBD,WAAM,GAAoB,IAAI,CAAA;QAsBpC,KAAK,CAAC,4BAA4B,CAAC,CAAA;QACnC,MAAM,OAAO,GAA+B;YAC1C,cAAc;YACd,GAAG;YACH,YAAY;YACZ,UAAU;YACV,kBAAkB;YAClB,UAAU;YACV,SAAS;YACT,MAAM,EAAE;gBACN,GAAG;oBACD,MAAM,EAAE,KAAK;oBACb,SAAS,EAAE,aAAa;oBACxB,OAAO,EAAE,QAAQ;oBACjB,QAAQ,EAAE,QAAQ;oBAClB,QAAQ,EAAE,EAAE;oBACZ,OAAO,EAAE,EAAE;oBACX,OAAO,EAAE,EAAE;iBACZ;gBACD,GAAG,MAAM;aACV;YACD,GAAG,QAAQ;SACZ,CAAA;QACD,eAAe;QACf,IAAA,gBAAM,EACJ,OAAO,CAAC,QAAQ,IAAI,OAAO,CAAC,aAAa,IAAI,OAAO,CAAC,MAAM,EAC3D,kEAAkE,CACnE,CAAA;QACD,IAAA,gBAAM,EACJ,OAAO,CAAC,mBAAmB,KAAK,IAAI;YAClC,OAAO,CAAC,mBAAmB,KAAK,SAAS,EAC3C,oFAAoF,CACrF,CAAA;QACD,IAAA,gBAAM,EACJ,CAAC,OAAO,CAAC,kBAAkB,IAAI,OAAO,CAAC,kBAAkB,IAAI,KAAK;QAClE,yCAAyC,CAAC,qGAAqG,CAChJ,CAAA;QACD,IAAI,CAAC,kBAAkB,GAAG,yBAAyB,CAAC,OAAO,CAAC,CAAA;QAC5D,IAAI,QAA8B,CAAA;QAClC,IAAI,OAAO,CAAC,QAAQ,EAAE;YACpB,QAAQ,GAAG,qBAAW,CAAC,OAAO,CAAC,OAAO,CAAC,QAAQ,EAAE,OAAO,CAAC,YAAY,CAAC,CAAA;SACvE;aAAM,IAAI,OAAO,CAAC,aAAa,EAAE;YAChC,QAAQ,GAAG,OAAO,CAAC,aAAa,CAAA;SACjC;aAAM,IAAI,OAAO,CAAC,MAAM,EAAE;YACzB,QAAQ,GAAG,OAAO,CAAC,OAAO,CAAC,OAAO,CAAC,MAAM,CAAC,CAAA;SAC3C;aAAM;YACL,MAAM,IAAI,KAAK,CAAC,oDAAoD,CAAC,CAAA;SACtE;QACD,IAAA,gBAAM,EAAC,CAAC,CAAC,QAAQ,EAAE,0BAA0B,CAAC,CAAA;QAC9C,IAAI,CAAC,OAAO,GAAG,QAAQ,CAAA;QACvB,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;QACtB,IAAI,CAAC,WAAW,GAAG,QAAQ,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,EAAE,EAAE;YAC7C,MAAM,UAAU,GAAG,GAAG;iBACnB,EAAE,CAAC,OAAO,CAAC,MAAM,CAAC;iBAClB,UAAU,CAAsB,OAAO,CAAC,cAAc,CAAC,CAAA;YAC1D,MAAM,IAAI,CAAC,aAAa,CAAC,UAAU,CAAC,CAAA;YACpC,OAAO,UAAU,CAAA;QACnB,CAAC,CAAC,CAAA;QACF,IAAI,OAAO,CAAC,MAAM,CAAC,MAAM,EAAE;YACzB,IAAI,CAAC,MAAM,GAAG,OAAO,CAAC,UAAU,CAAC,CAAC,OAAO,CAAC,MAAM,CAAC,CAAA;SAClD;IACH,CAAC;IAED,MAAM,CAAC,MAAM,CAAC,OAA4B;QACxC,OAAO,IAAI,UAAU,CAAC,OAAO,CAAC,CAAA;IAChC,CAAC;IAEO,aAAa,CACnB,UAA2C;QAE3C,MAAM,WAAW,GAAG,GAAG,EAAE,CAAC,CAAC;YACzB,OAAO,EAAE;gBACP,GAAG,EAAE,IAAI,IAAI,EAAE;aAChB;SACF,CAAC,CAAA;QACF,QAAQ,IAAI,CAAC,OAAO,CAAC,UAAU,EAAE;YAC/B,KAAK,QAAQ;gBACX,KAAK,CAAC,4BAA4B,CAAC,CAAA;gBACnC,OAAO,UAAU,CAAC,WAAW,CAC3B,EAAE,OAAO,EAAE,CAAC,EAAE,EACd;oBACE,UAAU,EAAE,IAAI;oBAChB,kBAAkB,EAAE,CAAC;iBACtB,CACF,CAAA;YACH,KAAK,UAAU;gBACb,KAAK,CAAC,yCAAyC,CAAC,CAAA;gBAChD,IAAI,CAAC,KAAK,GAAG,WAAW,CACtB,GAAG,EAAE,CACH,UAAU,CAAC,UAAU,CAAC,WAAW,EAAE,EAAE;oBACnC,YAAY,EAAE;wBACZ,CAAC,EAAE,CAAC;wBACJ,CAAC,EAAE,KAAK;qBACT;iBACF,CAAC,EACJ,IAAI,CAAC,OAAO,CAAC,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAC5C,CAAA;gBACD,IAAI,CAAC,KAAK,CAAC,KAAK,EAAE,CAAA;gBAClB,OAAO,OAAO,CAAC,OAAO,EAAE,CAAA;YAC1B,KAAK,UAAU,CAAC;YAChB;gBACE,OAAO,OAAO,CAAC,OAAO,EAAE,CAAA;SAC3B;IACH,CAAC;IAEO,gBAAgB,CAAC,SAAiB;QACxC,IACE,IAAI,CAAC,OAAO,CAAC,WAAW;YACxB,OAAO,IAAI,CAAC,OAAO,CAAC,WAAW,KAAK,UAAU,EAC9C;YACA,OAAO,IAAI,CAAC,OAAO,CAAC,WAAW,CAAC,SAAS,CAAC,CAAA;SAC3C;QACD,OAAO,SAAS,CAAA;IAClB,CAAC;IAED;;;OAGG;IACH,IAAY,SAAS;QACnB,IAAI,CAAC,IAAI,CAAC,MAAM,EAAE;YAChB,MAAM,IAAI,KAAK,CAAC,kDAAkD,CAAC,CAAA;SACpE;QACD,OAAO,cAAI,CAAC,SAAS,CAAC,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,CAAC,CAAA;IAC1D,CAAC;IAED;;;OAGG;IACK,KAAK,CAAC,cAAc,CAC1B,OAA+C;QAE/C,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;YAC1B,MAAM,SAAS,GAAG,MAAM,IAAI,CAAC,SAAS,CACpC,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,MAAgB,EACpC,OAAO,CAAC,OAAO,CAChB,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE;gBACd,MAAM,IAAI,KAAK,CAAC,GAAG,CAAC,CAAA;YACtB,CAAC,CAAC,CAAA;YACF,aAAa;YACb,OAAO,CAAC,OAAO,GAAG,IAAI,CAAC,KAAK,CAAC,SAAS,CAAC,CAAA;SACxC;IACH,CAAC;IAED;;;OAGG;IACH,GAAG,CACD,GAAW,EACX,QAAkE;QAElE,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,GAAG,EAAE,CAAC,CAAA;gBAC9B,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC;oBACvC,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC;oBAC/B,GAAG,EAAE;wBACH,EAAE,OAAO,EAAE,EAAE,OAAO,EAAE,KAAK,EAAE,EAAE;wBAC/B,EAAE,OAAO,EAAE,EAAE,GAAG,EAAE,IAAI,IAAI,EAAE,EAAE,EAAE;qBACjC;iBACF,CAAC,CAAA;gBACF,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;oBAC1B,MAAM,IAAI,CAAC,cAAc,CACvB,OAAyC,CAC1C,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;iBAChC;gBACD,MAAM,CAAC,GACL,OAAO,IAAI,IAAI,CAAC,kBAAkB,CAAC,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAA;gBACjE,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,KAAI,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,CAAA,EAAE;oBACxD,CAAC,CAAC,YAAY,GAAG,OAAO,CAAC,YAAY,CAAA;iBACtC;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,CAAC,CAAA;gBACrB,QAAQ,CAAC,IAAI,EAAE,CAAC,KAAK,SAAS,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;aAC3C;YAAC,OAAO,KAAK,EAAE;gBACd,QAAQ,CAAC,KAAK,CAAC,CAAA;aAChB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;;;OAIG;IACH,GAAG,CACD,GAAW,EACX,OAA4B,EAC5B,WAA+B,IAAI;QAEnC,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,GAAG,EAAE,CAAC,CAAA;gBAC9B,uEAAuE;gBACvE,aAAa;gBACb,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,KAAI,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,CAAA,EAAE;oBACxD,aAAa;oBACb,OAAO,OAAO,CAAC,YAAY,CAAA;iBAC5B;gBACD,MAAM,CAAC,GAAwB;oBAC7B,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC;oBAC/B,OAAO,EAAE,IAAI,CAAC,kBAAkB,CAAC,SAAS,CAAC,OAAO,CAAC;iBACpD,CAAA;gBACD,kBAAkB;gBAClB,IAAI,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,MAAM,0CAAE,OAAO,EAAE;oBAC5B,CAAC,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;iBAC7C;qBAAM;oBACL,iDAAiD;oBACjD,uDAAuD;oBACvD,2BAA2B;oBAC3B,EAAE;oBACF,iDAAiD;oBACjD,yDAAyD;oBACzD,2CAA2C;oBAC3C,CAAC,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,IAAI,CAAC,GAAG,EAAE,GAAG,IAAI,CAAC,OAAO,CAAC,GAAG,GAAG,IAAI,CAAC,CAAA;iBAC3D;gBACD,uBAAuB;gBACvB,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,EAAE;oBAC/B,CAAC,CAAC,YAAY,GAAG,IAAI,IAAI,EAAE,CAAA;iBAC5B;gBACD,IAAI,IAAI,CAAC,MAAM,EAAE;oBACf,MAAM,SAAS,GAAG,cAAI,CAAC,SAAS,CAAC,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,CAAC,CAAA;oBACnE,MAAM,IAAI,GAAG,MAAM,SAAS,CAC1B,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,MAAgB,EACpC,CAAC,CAAC,OAAO,CACV,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE;wBACd,MAAM,IAAI,KAAK,CAAC,GAAG,CAAC,CAAA;oBACtB,CAAC,CAAC,CAAA;oBACF,CAAC,CAAC,OAAO,GAAG,IAAsC,CAAA;iBACnD;gBACD,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,SAAS,CACxC,EAAE,GAAG,EAAE,CAAC,CAAC,GAAG,EAAE,EACd,EAAE,IAAI,EAAE,CAAC,EAAE,EACX;oBACE,MAAM,EAAE,IAAI;oBACZ,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB;iBACjD,CACF,CAAA;gBACD,IAAI,OAAO,CAAC,aAAa,GAAG,CAAC,EAAE;oBAC7B,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,GAAG,CAAC,CAAA;iBACzB;qBAAM;oBACL,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,GAAG,CAAC,CAAA;iBACzB;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,CAAC,CAAA;aACtB;YAAC,OAAO,KAAK,EAAE;gBACd,OAAO,QAAQ,CAAC,KAAK,CAAC,CAAA;aACvB;YACD,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;QACvB,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED,KAAK,CACH,GAAW,EACX,OAAsD,EACtD,WAA+B,IAAI;QAEnC,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;;YACX,IAAI;gBACF,KAAK,CAAC,oBAAoB,GAAG,EAAE,CAAC,CAAA;gBAChC,MAAM,YAAY,GAId,EAAE,CAAA;gBACN,MAAM,UAAU,GAAG,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,IAAI,CAAA;gBACjD,MAAM,YAAY,GAAG,OAAO,CAAC,YAAY;oBACvC,CAAC,CAAC,OAAO,CAAC,YAAY,CAAC,OAAO,EAAE;oBAChC,CAAC,CAAC,CAAC,CAAA;gBACL,MAAM,WAAW,GAAG,IAAI,IAAI,EAAE,CAAA;gBAE9B,+DAA+D;gBAC/D,4DAA4D;gBAC5D,sDAAsD;gBACtD,IAAI,UAAU,GAAG,CAAC,IAAI,YAAY,GAAG,CAAC,EAAE;oBACtC,MAAM,WAAW,GAAG,WAAW,CAAC,OAAO,EAAE,GAAG,YAAY,CAAA;oBACxD,IAAI,WAAW,GAAG,UAAU,EAAE;wBAC5B,KAAK,CAAC,yBAAyB,GAAG,EAAE,CAAC,CAAA;wBACrC,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;qBACtB;oBACD,YAAY,CAAC,YAAY,GAAG,WAAW,CAAA;iBACxC;gBAED,IAAI,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,MAAM,0CAAE,OAAO,EAAE;oBAC5B,YAAY,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;iBACxD;qBAAM;oBACL,YAAY,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,IAAI,CAAC,GAAG,EAAE,GAAG,IAAI,CAAC,OAAO,CAAC,GAAG,GAAG,IAAI,CAAC,CAAA;iBACtE;gBACD,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,SAAS,CACxC,EAAE,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC,EAAE,EACnC,EAAE,IAAI,EAAE,YAAY,EAAE,EACtB,EAAE,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB,EAAE,CACrD,CAAA;gBACD,IAAI,OAAO,CAAC,YAAY,KAAK,CAAC,EAAE;oBAC9B,OAAO,QAAQ,CAAC,IAAI,KAAK,CAAC,qCAAqC,CAAC,CAAC,CAAA;iBAClE;qBAAM;oBACL,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,EAAE,OAAO,CAAC,CAAA;oBAChC,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;iBACtB;aACF;YAAC,OAAO,KAAK,EAAE;gBACd,OAAO,QAAQ,CAAC,KAAK,CAAC,CAAA;aACvB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;OAEG;IACH,GAAG,CACD,QAMS;QAET,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,CAAC,CAAA;gBACzB,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,QAAQ,GAAG,UAAU,CAAC,IAAI,CAAC;oBAC/B,GAAG,EAAE;wBACH,EAAE,OAAO,EAAE,EAAE,OAAO,EAAE,KAAK,EAAE,EAAE;wBAC/B,EAAE,OAAO,EAAE,EAAE,GAAG,EAAE,IAAI,IAAI,EAAE,EAAE,EAAE;qBACjC;iBACF,CAAC,CAAA;gBACF,MAAM,OAAO,GAA0B,EAAE,CAAA;gBACzC,IAAI,KAAK,EAAE,MAAM,OAAO,IAAI,QAAQ,EAAE;oBACpC,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;wBAC1B,MAAM,IAAI,CAAC,cAAc,CAAC,OAAyC,CAAC,CAAA;qBACrE;oBACD,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,kBAAkB,CAAC,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAA;iBACnE;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,OAAO,CAAC,CAAA;gBACzB,QAAQ,CAAC,IAAI,EAAE,OAAO,CAAC,CAAA;aACxB;YAAC,OAAO,KAAK,EAAE;gBACd,QAAQ,CAAC,KAAK,CAAC,CAAA;aAChB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;;OAGG;IACH,OAAO,CAAC,GAAW,EAAE,WAA+B,IAAI;QACtD,KAAK,CAAC,sBAAsB,GAAG,EAAE,CAAC,CAAA;QAClC,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CACnB,UAAU,CAAC,SAAS,CAClB,EAAE,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC,EAAE,EACnC,EAAE,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB,EAAE,CACrD,CACF;aACA,IAAI,CAAC,GAAG,EAAE;YACT,IAAI,CAAC,IAAI,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;YACzB,QAAQ,CAAC,IAAI,CAAC,CAAA;QAChB,CAAC,CAAC;aACD,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,MAAM,CAAC,QAA4C;QACjD,KAAK,CAAC,qBAAqB,CAAC,CAAA;QAC5B,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CAAC,UAAU,CAAC,cAAc,EAAE,CAAC;aACjD,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,QAAQ,CAAC,IAAI,EAAE,CAAC,CAAC,CAAC;YAC/B,aAAa;aACZ,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,KAAK,CAAC,WAA+B,IAAI;QACvC,KAAK,CAAC,oBAAoB,CAAC,CAAA;QAC3B,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CAAC,UAAU,CAAC,IAAI,EAAE,CAAC;aACvC,IAAI,CAAC,GAAG,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC;aAC1B,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,KAAK;QACH,KAAK,CAAC,oBAAoB,CAAC,CAAA;QAC3B,OAAO,IAAI,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,CAAC,CAAC,KAAK,EAAE,CAAC,CAAA;IAC5C,CAAC;CACF;AAnaD,6BAmaC"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"20eabd216415cd719c2a4e898ac63b448cf93fc9"}} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json b/node_modules/connect-mongo/.nyc_output/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json new file mode 100644 index 0000000..e5530f1 --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json @@ -0,0 +1 @@ +{"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.spec.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.spec.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":62}},"2":{"start":{"line":5,"column":0},"end":{"line":5,"column":62}},"3":{"start":{"line":6,"column":14},"end":{"line":6,"column":45}},"4":{"start":{"line":7,"column":18},"end":{"line":7,"column":36}},"5":{"start":{"line":8,"column":21},"end":{"line":8,"column":61}},"6":{"start":{"line":9,"column":21},"end":{"line":9,"column":50}},"7":{"start":{"line":10,"column":30},"end":{"line":10,"column":67}},"8":{"start":{"line":11,"column":0},"end":{"line":20,"column":3}},"9":{"start":{"line":12,"column":4},"end":{"line":19,"column":7}},"10":{"start":{"line":13,"column":8},"end":{"line":18,"column":9}},"11":{"start":{"line":14,"column":12},"end":{"line":14,"column":24}},"12":{"start":{"line":17,"column":12},"end":{"line":17,"column":22}},"13":{"start":{"line":21,"column":0},"end":{"line":23,"column":3}},"14":{"start":{"line":22,"column":4},"end":{"line":22,"column":31}},"15":{"start":{"line":24,"column":0},"end":{"line":28,"column":3}},"16":{"start":{"line":25,"column":4},"end":{"line":27,"column":7}},"17":{"start":{"line":25,"column":19},"end":{"line":25,"column":50}},"18":{"start":{"line":29,"column":0},"end":{"line":36,"column":3}},"19":{"start":{"line":30,"column":20},"end":{"line":30,"column":91}},"20":{"start":{"line":31,"column":18},"end":{"line":31,"column":73}},"21":{"start":{"line":32,"column":4},"end":{"line":32,"column":23}},"22":{"start":{"line":33,"column":4},"end":{"line":33,"column":28}},"23":{"start":{"line":34,"column":4},"end":{"line":34,"column":28}},"24":{"start":{"line":35,"column":4},"end":{"line":35,"column":18}},"25":{"start":{"line":37,"column":0},"end":{"line":44,"column":3}},"26":{"start":{"line":38,"column":19},"end":{"line":38,"column":96}},"27":{"start":{"line":39,"column":18},"end":{"line":39,"column":65}},"28":{"start":{"line":40,"column":4},"end":{"line":40,"column":23}},"29":{"start":{"line":41,"column":4},"end":{"line":41,"column":28}},"30":{"start":{"line":42,"column":4},"end":{"line":42,"column":28}},"31":{"start":{"line":43,"column":4},"end":{"line":43,"column":18}},"32":{"start":{"line":45,"column":0},"end":{"line":50,"column":3}},"33":{"start":{"line":47,"column":4},"end":{"line":47,"column":70}},"34":{"start":{"line":48,"column":19},"end":{"line":48,"column":46}},"35":{"start":{"line":49,"column":4},"end":{"line":49,"column":20}},"36":{"start":{"line":51,"column":0},"end":{"line":56,"column":3}},"37":{"start":{"line":53,"column":4},"end":{"line":53,"column":70}},"38":{"start":{"line":54,"column":16},"end":{"line":54,"column":50}},"39":{"start":{"line":55,"column":4},"end":{"line":55,"column":20}},"40":{"start":{"line":57,"column":0},"end":{"line":62,"column":3}},"41":{"start":{"line":59,"column":4},"end":{"line":59,"column":70}},"42":{"start":{"line":60,"column":24},"end":{"line":60,"column":48}},"43":{"start":{"line":61,"column":4},"end":{"line":61,"column":33}},"44":{"start":{"line":63,"column":0},"end":{"line":80,"column":3}},"45":{"start":{"line":65,"column":4},"end":{"line":65,"column":70}},"46":{"start":{"line":66,"column":21},"end":{"line":66,"column":49}},"47":{"start":{"line":67,"column":16},"end":{"line":67,"column":33}},"48":{"start":{"line":68,"column":16},"end":{"line":68,"column":55}},"49":{"start":{"line":69,"column":4},"end":{"line":69,"column":25}},"50":{"start":{"line":70,"column":20},"end":{"line":70,"column":47}},"51":{"start":{"line":71,"column":4},"end":{"line":71,"column":35}},"52":{"start":{"line":72,"column":4},"end":{"line":72,"column":56}},"53":{"start":{"line":73,"column":4},"end":{"line":73,"column":37}},"54":{"start":{"line":74,"column":24},"end":{"line":74,"column":48}},"55":{"start":{"line":75,"column":4},"end":{"line":75,"column":43}},"56":{"start":{"line":76,"column":4},"end":{"line":76,"column":41}},"57":{"start":{"line":77,"column":16},"end":{"line":77,"column":47}},"58":{"start":{"line":78,"column":4},"end":{"line":78,"column":25}},"59":{"start":{"line":79,"column":4},"end":{"line":79,"column":41}},"60":{"start":{"line":81,"column":0},"end":{"line":97,"column":3}},"61":{"start":{"line":83,"column":4},"end":{"line":83,"column":70}},"62":{"start":{"line":84,"column":21},"end":{"line":84,"column":49}},"63":{"start":{"line":85,"column":16},"end":{"line":85,"column":32}},"64":{"start":{"line":86,"column":4},"end":{"line":86,"column":31}},"65":{"start":{"line":87,"column":4},"end":{"line":87,"column":56}},"66":{"start":{"line":88,"column":4},"end":{"line":96,"column":7}},"67":{"start":{"line":89,"column":8},"end":{"line":89,"column":29}},"68":{"start":{"line":90,"column":8},"end":{"line":95,"column":11}},"69":{"start":{"line":91,"column":12},"end":{"line":91,"column":28}},"70":{"start":{"line":92,"column":12},"end":{"line":92,"column":43}},"71":{"start":{"line":93,"column":12},"end":{"line":93,"column":45}},"72":{"start":{"line":94,"column":12},"end":{"line":94,"column":20}},"73":{"start":{"line":98,"column":0},"end":{"line":108,"column":3}},"74":{"start":{"line":100,"column":4},"end":{"line":100,"column":70}},"75":{"start":{"line":101,"column":23},"end":{"line":101,"column":51}},"76":{"start":{"line":102,"column":16},"end":{"line":102,"column":35}},"77":{"start":{"line":103,"column":4},"end":{"line":103,"column":31}},"78":{"start":{"line":104,"column":4},"end":{"line":107,"column":7}},"79":{"start":{"line":105,"column":8},"end":{"line":105,"column":29}},"80":{"start":{"line":106,"column":8},"end":{"line":106,"column":16}},"81":{"start":{"line":109,"column":0},"end":{"line":120,"column":3}},"82":{"start":{"line":111,"column":4},"end":{"line":111,"column":70}},"83":{"start":{"line":112,"column":23},"end":{"line":112,"column":51}},"84":{"start":{"line":113,"column":16},"end":{"line":113,"column":35}},"85":{"start":{"line":114,"column":4},"end":{"line":114,"column":31}},"86":{"start":{"line":115,"column":4},"end":{"line":115,"column":54}},"87":{"start":{"line":116,"column":4},"end":{"line":119,"column":7}},"88":{"start":{"line":117,"column":8},"end":{"line":117,"column":29}},"89":{"start":{"line":118,"column":8},"end":{"line":118,"column":16}},"90":{"start":{"line":121,"column":0},"end":{"line":139,"column":3}},"91":{"start":{"line":123,"column":4},"end":{"line":123,"column":90}},"92":{"start":{"line":124,"column":23},"end":{"line":124,"column":51}},"93":{"start":{"line":125,"column":19},"end":{"line":125,"column":36}},"94":{"start":{"line":126,"column":16},"end":{"line":126,"column":35}},"95":{"start":{"line":127,"column":16},"end":{"line":127,"column":55}},"96":{"start":{"line":128,"column":4},"end":{"line":128,"column":25}},"97":{"start":{"line":129,"column":20},"end":{"line":129,"column":47}},"98":{"start":{"line":130,"column":4},"end":{"line":130,"column":35}},"99":{"start":{"line":131,"column":4},"end":{"line":131,"column":43}},"100":{"start":{"line":133,"column":4},"end":{"line":133,"column":74}},"101":{"start":{"line":135,"column":4},"end":{"line":135,"column":54}},"102":{"start":{"line":136,"column":16},"end":{"line":136,"column":42}},"103":{"start":{"line":137,"column":4},"end":{"line":137,"column":25}},"104":{"start":{"line":138,"column":4},"end":{"line":138,"column":41}},"105":{"start":{"line":140,"column":0},"end":{"line":152,"column":3}},"106":{"start":{"line":142,"column":4},"end":{"line":142,"column":70}},"107":{"start":{"line":143,"column":23},"end":{"line":143,"column":51}},"108":{"start":{"line":144,"column":16},"end":{"line":144,"column":36}},"109":{"start":{"line":145,"column":4},"end":{"line":148,"column":7}},"110":{"start":{"line":146,"column":8},"end":{"line":146,"column":29}},"111":{"start":{"line":147,"column":8},"end":{"line":147,"column":16}},"112":{"start":{"line":149,"column":4},"end":{"line":151,"column":7}},"113":{"start":{"line":150,"column":8},"end":{"line":150,"column":27}},"114":{"start":{"line":153,"column":0},"end":{"line":173,"column":3}},"115":{"start":{"line":155,"column":23},"end":{"line":155,"column":25}},"116":{"start":{"line":156,"column":4},"end":{"line":158,"column":8}},"117":{"start":{"line":159,"column":23},"end":{"line":159,"column":59}},"118":{"start":{"line":160,"column":16},"end":{"line":160,"column":38}},"119":{"start":{"line":161,"column":26},"end":{"line":161,"column":46}},"120":{"start":{"line":163,"column":4},"end":{"line":163,"column":44}},"121":{"start":{"line":164,"column":23},"end":{"line":164,"column":46}},"122":{"start":{"line":165,"column":20},"end":{"line":165,"column":58}},"123":{"start":{"line":166,"column":25},"end":{"line":166,"column":45}},"124":{"start":{"line":167,"column":20},"end":{"line":167,"column":142}},"125":{"start":{"line":168,"column":4},"end":{"line":168,"column":22}},"126":{"start":{"line":169,"column":4},"end":{"line":172,"column":5}},"127":{"start":{"line":170,"column":8},"end":{"line":170,"column":63}},"128":{"start":{"line":171,"column":8},"end":{"line":171,"column":62}},"129":{"start":{"line":174,"column":0},"end":{"line":192,"column":3}},"130":{"start":{"line":176,"column":34},"end":{"line":176,"column":58}},"131":{"start":{"line":177,"column":4},"end":{"line":177,"column":70}},"132":{"start":{"line":178,"column":23},"end":{"line":178,"column":59}},"133":{"start":{"line":179,"column":16},"end":{"line":179,"column":41}},"134":{"start":{"line":180,"column":26},"end":{"line":180,"column":46}},"135":{"start":{"line":182,"column":4},"end":{"line":182,"column":44}},"136":{"start":{"line":183,"column":23},"end":{"line":183,"column":46}},"137":{"start":{"line":184,"column":20},"end":{"line":184,"column":58}},"138":{"start":{"line":185,"column":25},"end":{"line":185,"column":45}},"139":{"start":{"line":186,"column":20},"end":{"line":186,"column":142}},"140":{"start":{"line":187,"column":4},"end":{"line":187,"column":22}},"141":{"start":{"line":188,"column":4},"end":{"line":191,"column":5}},"142":{"start":{"line":189,"column":8},"end":{"line":189,"column":67}},"143":{"start":{"line":190,"column":8},"end":{"line":190,"column":66}},"144":{"start":{"line":193,"column":0},"end":{"line":211,"column":3}},"145":{"start":{"line":195,"column":4},"end":{"line":200,"column":8}},"146":{"start":{"line":197,"column":12},"end":{"line":197,"column":44}},"147":{"start":{"line":198,"column":12},"end":{"line":198,"column":39}},"148":{"start":{"line":201,"column":23},"end":{"line":201,"column":51}},"149":{"start":{"line":202,"column":16},"end":{"line":202,"column":40}},"150":{"start":{"line":203,"column":4},"end":{"line":203,"column":44}},"151":{"start":{"line":204,"column":20},"end":{"line":204,"column":47}},"152":{"start":{"line":205,"column":4},"end":{"line":205,"column":35}},"153":{"start":{"line":206,"column":4},"end":{"line":206,"column":30}},"154":{"start":{"line":208,"column":4},"end":{"line":208,"column":43}},"155":{"start":{"line":210,"column":4},"end":{"line":210,"column":46}},"156":{"start":{"line":212,"column":0},"end":{"line":231,"column":3}},"157":{"start":{"line":214,"column":4},"end":{"line":219,"column":8}},"158":{"start":{"line":216,"column":12},"end":{"line":216,"column":46}},"159":{"start":{"line":217,"column":12},"end":{"line":217,"column":23}},"160":{"start":{"line":220,"column":23},"end":{"line":220,"column":51}},"161":{"start":{"line":221,"column":16},"end":{"line":221,"column":42}},"162":{"start":{"line":222,"column":4},"end":{"line":222,"column":44}},"163":{"start":{"line":223,"column":20},"end":{"line":223,"column":47}},"164":{"start":{"line":224,"column":4},"end":{"line":224,"column":35}},"165":{"start":{"line":226,"column":4},"end":{"line":226,"column":51}},"166":{"start":{"line":228,"column":4},"end":{"line":228,"column":45}},"167":{"start":{"line":229,"column":4},"end":{"line":229,"column":30}},"168":{"start":{"line":230,"column":4},"end":{"line":230,"column":37}},"169":{"start":{"line":232,"column":0},"end":{"line":253,"column":3}},"170":{"start":{"line":235,"column":4},"end":{"line":235,"column":70}},"171":{"start":{"line":236,"column":23},"end":{"line":236,"column":59}},"172":{"start":{"line":237,"column":16},"end":{"line":237,"column":28}},"173":{"start":{"line":239,"column":4},"end":{"line":239,"column":44}},"174":{"start":{"line":240,"column":23},"end":{"line":240,"column":46}},"175":{"start":{"line":241,"column":20},"end":{"line":241,"column":58}},"176":{"start":{"line":242,"column":4},"end":{"line":242,"column":61}},"177":{"start":{"line":242,"column":35},"end":{"line":242,"column":59}},"178":{"start":{"line":243,"column":4},"end":{"line":243,"column":30}},"179":{"start":{"line":244,"column":4},"end":{"line":244,"column":101}},"180":{"start":{"line":245,"column":21},"end":{"line":245,"column":59}},"181":{"start":{"line":246,"column":4},"end":{"line":246,"column":31}},"182":{"start":{"line":248,"column":4},"end":{"line":248,"column":140}},"183":{"start":{"line":249,"column":4},"end":{"line":249,"column":137}},"184":{"start":{"line":250,"column":4},"end":{"line":252,"column":5}},"185":{"start":{"line":251,"column":8},"end":{"line":251,"column":179}},"186":{"start":{"line":254,"column":0},"end":{"line":272,"column":3}},"187":{"start":{"line":257,"column":4},"end":{"line":257,"column":87}},"188":{"start":{"line":258,"column":23},"end":{"line":258,"column":59}},"189":{"start":{"line":259,"column":16},"end":{"line":259,"column":44}},"190":{"start":{"line":261,"column":4},"end":{"line":261,"column":44}},"191":{"start":{"line":262,"column":23},"end":{"line":262,"column":46}},"192":{"start":{"line":263,"column":20},"end":{"line":263,"column":58}},"193":{"start":{"line":264,"column":36},"end":{"line":264,"column":163}},"194":{"start":{"line":265,"column":4},"end":{"line":265,"column":30}},"195":{"start":{"line":266,"column":4},"end":{"line":266,"column":43}},"196":{"start":{"line":267,"column":21},"end":{"line":267,"column":59}},"197":{"start":{"line":268,"column":4},"end":{"line":268,"column":31}},"198":{"start":{"line":269,"column":35},"end":{"line":269,"column":165}},"199":{"start":{"line":271,"column":4},"end":{"line":271,"column":58}},"200":{"start":{"line":273,"column":0},"end":{"line":296,"column":3}},"201":{"start":{"line":276,"column":4},"end":{"line":276,"column":87}},"202":{"start":{"line":277,"column":23},"end":{"line":277,"column":59}},"203":{"start":{"line":278,"column":16},"end":{"line":278,"column":57}},"204":{"start":{"line":280,"column":4},"end":{"line":280,"column":44}},"205":{"start":{"line":281,"column":23},"end":{"line":281,"column":46}},"206":{"start":{"line":282,"column":20},"end":{"line":282,"column":58}},"207":{"start":{"line":283,"column":36},"end":{"line":283,"column":163}},"208":{"start":{"line":284,"column":4},"end":{"line":284,"column":62}},"209":{"start":{"line":284,"column":35},"end":{"line":284,"column":60}},"210":{"start":{"line":285,"column":4},"end":{"line":285,"column":30}},"211":{"start":{"line":286,"column":4},"end":{"line":286,"column":43}},"212":{"start":{"line":287,"column":21},"end":{"line":287,"column":59}},"213":{"start":{"line":288,"column":4},"end":{"line":288,"column":31}},"214":{"start":{"line":289,"column":35},"end":{"line":289,"column":165}},"215":{"start":{"line":291,"column":4},"end":{"line":291,"column":37}},"216":{"start":{"line":292,"column":4},"end":{"line":292,"column":38}},"217":{"start":{"line":293,"column":4},"end":{"line":295,"column":5}},"218":{"start":{"line":294,"column":8},"end":{"line":294,"column":67}},"219":{"start":{"line":297,"column":0},"end":{"line":316,"column":3}},"220":{"start":{"line":299,"column":4},"end":{"line":303,"column":8}},"221":{"start":{"line":304,"column":21},"end":{"line":304,"column":49}},"222":{"start":{"line":305,"column":16},"end":{"line":305,"column":45}},"223":{"start":{"line":306,"column":16},"end":{"line":306,"column":55}},"224":{"start":{"line":307,"column":4},"end":{"line":307,"column":25}},"225":{"start":{"line":308,"column":20},"end":{"line":308,"column":47}},"226":{"start":{"line":309,"column":4},"end":{"line":309,"column":56}},"227":{"start":{"line":311,"column":4},"end":{"line":311,"column":37}},"228":{"start":{"line":312,"column":21},"end":{"line":312,"column":45}},"229":{"start":{"line":313,"column":4},"end":{"line":313,"column":31}},"230":{"start":{"line":314,"column":4},"end":{"line":314,"column":26}},"231":{"start":{"line":315,"column":4},"end":{"line":315,"column":81}},"232":{"start":{"line":317,"column":0},"end":{"line":325,"column":3}},"233":{"start":{"line":319,"column":4},"end":{"line":321,"column":8}},"234":{"start":{"line":322,"column":16},"end":{"line":322,"column":47}},"235":{"start":{"line":323,"column":16},"end":{"line":323,"column":43}},"236":{"start":{"line":324,"column":4},"end":{"line":324,"column":20}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":56},"end":{"line":2,"column":57}},"loc":{"start":{"line":2,"column":71},"end":{"line":4,"column":1}},"line":2},"1":{"name":"(anonymous_1)","decl":{"start":{"line":11,"column":21},"end":{"line":11,"column":22}},"loc":{"start":{"line":11,"column":33},"end":{"line":20,"column":1}},"line":11},"2":{"name":"(anonymous_2)","decl":{"start":{"line":12,"column":37},"end":{"line":12,"column":38}},"loc":{"start":{"line":12,"column":46},"end":{"line":19,"column":5}},"line":12},"3":{"name":"(anonymous_3)","decl":{"start":{"line":21,"column":31},"end":{"line":21,"column":32}},"loc":{"start":{"line":21,"column":43},"end":{"line":23,"column":1}},"line":21},"4":{"name":"(anonymous_4)","decl":{"start":{"line":24,"column":66},"end":{"line":24,"column":67}},"loc":{"start":{"line":24,"column":73},"end":{"line":28,"column":1}},"line":24},"5":{"name":"(anonymous_5)","decl":{"start":{"line":25,"column":13},"end":{"line":25,"column":14}},"loc":{"start":{"line":25,"column":19},"end":{"line":25,"column":50}},"line":25},"6":{"name":"(anonymous_6)","decl":{"start":{"line":29,"column":56},"end":{"line":29,"column":57}},"loc":{"start":{"line":29,"column":69},"end":{"line":36,"column":1}},"line":29},"7":{"name":"(anonymous_7)","decl":{"start":{"line":37,"column":49},"end":{"line":37,"column":50}},"loc":{"start":{"line":37,"column":62},"end":{"line":44,"column":1}},"line":37},"8":{"name":"(anonymous_8)","decl":{"start":{"line":45,"column":43},"end":{"line":45,"column":44}},"loc":{"start":{"line":45,"column":56},"end":{"line":50,"column":1}},"line":45},"9":{"name":"(anonymous_9)","decl":{"start":{"line":51,"column":65},"end":{"line":51,"column":66}},"loc":{"start":{"line":51,"column":78},"end":{"line":56,"column":1}},"line":51},"10":{"name":"(anonymous_10)","decl":{"start":{"line":57,"column":67},"end":{"line":57,"column":68}},"loc":{"start":{"line":57,"column":80},"end":{"line":62,"column":1}},"line":57},"11":{"name":"(anonymous_11)","decl":{"start":{"line":63,"column":45},"end":{"line":63,"column":46}},"loc":{"start":{"line":63,"column":58},"end":{"line":80,"column":1}},"line":63},"12":{"name":"(anonymous_12)","decl":{"start":{"line":81,"column":51},"end":{"line":81,"column":52}},"loc":{"start":{"line":81,"column":58},"end":{"line":97,"column":1}},"line":81},"13":{"name":"(anonymous_13)","decl":{"start":{"line":88,"column":20},"end":{"line":88,"column":21}},"loc":{"start":{"line":88,"column":35},"end":{"line":96,"column":5}},"line":88},"14":{"name":"(anonymous_14)","decl":{"start":{"line":90,"column":23},"end":{"line":90,"column":24}},"loc":{"start":{"line":90,"column":41},"end":{"line":95,"column":9}},"line":90},"15":{"name":"(anonymous_15)","decl":{"start":{"line":98,"column":58},"end":{"line":98,"column":59}},"loc":{"start":{"line":98,"column":65},"end":{"line":108,"column":1}},"line":98},"16":{"name":"(anonymous_16)","decl":{"start":{"line":104,"column":23},"end":{"line":104,"column":24}},"loc":{"start":{"line":104,"column":38},"end":{"line":107,"column":5}},"line":104},"17":{"name":"(anonymous_17)","decl":{"start":{"line":109,"column":58},"end":{"line":109,"column":59}},"loc":{"start":{"line":109,"column":65},"end":{"line":120,"column":1}},"line":109},"18":{"name":"(anonymous_18)","decl":{"start":{"line":116,"column":23},"end":{"line":116,"column":24}},"loc":{"start":{"line":116,"column":38},"end":{"line":119,"column":5}},"line":116},"19":{"name":"(anonymous_19)","decl":{"start":{"line":121,"column":46},"end":{"line":121,"column":47}},"loc":{"start":{"line":121,"column":59},"end":{"line":139,"column":1}},"line":121},"20":{"name":"(anonymous_20)","decl":{"start":{"line":140,"column":46},"end":{"line":140,"column":47}},"loc":{"start":{"line":140,"column":53},"end":{"line":152,"column":1}},"line":140},"21":{"name":"(anonymous_21)","decl":{"start":{"line":145,"column":24},"end":{"line":145,"column":25}},"loc":{"start":{"line":145,"column":39},"end":{"line":148,"column":5}},"line":145},"22":{"name":"(anonymous_22)","decl":{"start":{"line":149,"column":43},"end":{"line":149,"column":44}},"loc":{"start":{"line":149,"column":49},"end":{"line":151,"column":5}},"line":149},"23":{"name":"(anonymous_23)","decl":{"start":{"line":153,"column":45},"end":{"line":153,"column":46}},"loc":{"start":{"line":153,"column":58},"end":{"line":173,"column":1}},"line":153},"24":{"name":"(anonymous_24)","decl":{"start":{"line":174,"column":41},"end":{"line":174,"column":42}},"loc":{"start":{"line":174,"column":54},"end":{"line":192,"column":1}},"line":174},"25":{"name":"(anonymous_25)","decl":{"start":{"line":193,"column":47},"end":{"line":193,"column":48}},"loc":{"start":{"line":193,"column":60},"end":{"line":211,"column":1}},"line":193},"26":{"name":"(anonymous_26)","decl":{"start":{"line":196,"column":19},"end":{"line":196,"column":20}},"loc":{"start":{"line":196,"column":28},"end":{"line":199,"column":9}},"line":196},"27":{"name":"(anonymous_27)","decl":{"start":{"line":212,"column":49},"end":{"line":212,"column":50}},"loc":{"start":{"line":212,"column":62},"end":{"line":231,"column":1}},"line":212},"28":{"name":"(anonymous_28)","decl":{"start":{"line":215,"column":21},"end":{"line":215,"column":22}},"loc":{"start":{"line":215,"column":30},"end":{"line":218,"column":9}},"line":215},"29":{"name":"(anonymous_29)","decl":{"start":{"line":232,"column":34},"end":{"line":232,"column":35}},"loc":{"start":{"line":232,"column":47},"end":{"line":253,"column":1}},"line":232},"30":{"name":"(anonymous_30)","decl":{"start":{"line":242,"column":22},"end":{"line":242,"column":23}},"loc":{"start":{"line":242,"column":35},"end":{"line":242,"column":59}},"line":242},"31":{"name":"(anonymous_31)","decl":{"start":{"line":254,"column":50},"end":{"line":254,"column":51}},"loc":{"start":{"line":254,"column":63},"end":{"line":272,"column":1}},"line":254},"32":{"name":"(anonymous_32)","decl":{"start":{"line":273,"column":61},"end":{"line":273,"column":62}},"loc":{"start":{"line":273,"column":74},"end":{"line":296,"column":1}},"line":273},"33":{"name":"(anonymous_33)","decl":{"start":{"line":284,"column":22},"end":{"line":284,"column":23}},"loc":{"start":{"line":284,"column":35},"end":{"line":284,"column":60}},"line":284},"34":{"name":"(anonymous_34)","decl":{"start":{"line":297,"column":57},"end":{"line":297,"column":58}},"loc":{"start":{"line":297,"column":70},"end":{"line":316,"column":1}},"line":297},"35":{"name":"(anonymous_35)","decl":{"start":{"line":317,"column":67},"end":{"line":317,"column":68}},"loc":{"start":{"line":317,"column":80},"end":{"line":325,"column":1}},"line":317}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":56},"end":{"line":4,"column":1}}],"line":2},"1":{"loc":{"start":{"line":3,"column":11},"end":{"line":3,"column":61}},"type":"cond-expr","locations":[{"start":{"line":3,"column":37},"end":{"line":3,"column":40}},{"start":{"line":3,"column":43},"end":{"line":3,"column":61}}],"line":3},"2":{"loc":{"start":{"line":3,"column":12},"end":{"line":3,"column":33}},"type":"binary-expr","locations":[{"start":{"line":3,"column":12},"end":{"line":3,"column":15}},{"start":{"line":3,"column":19},"end":{"line":3,"column":33}}],"line":3},"3":{"loc":{"start":{"line":13,"column":8},"end":{"line":18,"column":9}},"type":"if","locations":[{"start":{"line":13,"column":8},"end":{"line":18,"column":9}},{"start":{"line":13,"column":8},"end":{"line":18,"column":9}}],"line":13},"4":{"loc":{"start":{"line":167,"column":20},"end":{"line":167,"column":142}},"type":"cond-expr","locations":[{"start":{"line":167,"column":121},"end":{"line":167,"column":127}},{"start":{"line":167,"column":130},"end":{"line":167,"column":142}}],"line":167},"5":{"loc":{"start":{"line":167,"column":20},"end":{"line":167,"column":118}},"type":"binary-expr","locations":[{"start":{"line":167,"column":20},"end":{"line":167,"column":101}},{"start":{"line":167,"column":105},"end":{"line":167,"column":118}}],"line":167},"6":{"loc":{"start":{"line":167,"column":26},"end":{"line":167,"column":91}},"type":"cond-expr","locations":[{"start":{"line":167,"column":67},"end":{"line":167,"column":73}},{"start":{"line":167,"column":76},"end":{"line":167,"column":91}}],"line":167},"7":{"loc":{"start":{"line":167,"column":26},"end":{"line":167,"column":64}},"type":"binary-expr","locations":[{"start":{"line":167,"column":26},"end":{"line":167,"column":42}},{"start":{"line":167,"column":46},"end":{"line":167,"column":64}}],"line":167},"8":{"loc":{"start":{"line":169,"column":4},"end":{"line":172,"column":5}},"type":"if","locations":[{"start":{"line":169,"column":4},"end":{"line":172,"column":5}},{"start":{"line":169,"column":4},"end":{"line":172,"column":5}}],"line":169},"9":{"loc":{"start":{"line":186,"column":20},"end":{"line":186,"column":142}},"type":"cond-expr","locations":[{"start":{"line":186,"column":121},"end":{"line":186,"column":127}},{"start":{"line":186,"column":130},"end":{"line":186,"column":142}}],"line":186},"10":{"loc":{"start":{"line":186,"column":20},"end":{"line":186,"column":118}},"type":"binary-expr","locations":[{"start":{"line":186,"column":20},"end":{"line":186,"column":101}},{"start":{"line":186,"column":105},"end":{"line":186,"column":118}}],"line":186},"11":{"loc":{"start":{"line":186,"column":26},"end":{"line":186,"column":91}},"type":"cond-expr","locations":[{"start":{"line":186,"column":67},"end":{"line":186,"column":73}},{"start":{"line":186,"column":76},"end":{"line":186,"column":91}}],"line":186},"12":{"loc":{"start":{"line":186,"column":26},"end":{"line":186,"column":64}},"type":"binary-expr","locations":[{"start":{"line":186,"column":26},"end":{"line":186,"column":42}},{"start":{"line":186,"column":46},"end":{"line":186,"column":64}}],"line":186},"13":{"loc":{"start":{"line":188,"column":4},"end":{"line":191,"column":5}},"type":"if","locations":[{"start":{"line":188,"column":4},"end":{"line":191,"column":5}},{"start":{"line":188,"column":4},"end":{"line":191,"column":5}}],"line":188},"14":{"loc":{"start":{"line":244,"column":34},"end":{"line":244,"column":99}},"type":"cond-expr","locations":[{"start":{"line":244,"column":75},"end":{"line":244,"column":81}},{"start":{"line":244,"column":84},"end":{"line":244,"column":99}}],"line":244},"15":{"loc":{"start":{"line":244,"column":34},"end":{"line":244,"column":72}},"type":"binary-expr","locations":[{"start":{"line":244,"column":34},"end":{"line":244,"column":50}},{"start":{"line":244,"column":54},"end":{"line":244,"column":72}}],"line":244},"16":{"loc":{"start":{"line":248,"column":13},"end":{"line":248,"column":138}},"type":"cond-expr","locations":[{"start":{"line":248,"column":117},"end":{"line":248,"column":123}},{"start":{"line":248,"column":126},"end":{"line":248,"column":138}}],"line":248},"17":{"loc":{"start":{"line":248,"column":13},"end":{"line":248,"column":114}},"type":"binary-expr","locations":[{"start":{"line":248,"column":13},"end":{"line":248,"column":97}},{"start":{"line":248,"column":101},"end":{"line":248,"column":114}}],"line":248},"18":{"loc":{"start":{"line":248,"column":19},"end":{"line":248,"column":87}},"type":"cond-expr","locations":[{"start":{"line":248,"column":62},"end":{"line":248,"column":68}},{"start":{"line":248,"column":71},"end":{"line":248,"column":87}}],"line":248},"19":{"loc":{"start":{"line":248,"column":19},"end":{"line":248,"column":59}},"type":"binary-expr","locations":[{"start":{"line":248,"column":19},"end":{"line":248,"column":36}},{"start":{"line":248,"column":40},"end":{"line":248,"column":59}}],"line":248},"20":{"loc":{"start":{"line":249,"column":13},"end":{"line":249,"column":135}},"type":"cond-expr","locations":[{"start":{"line":249,"column":114},"end":{"line":249,"column":120}},{"start":{"line":249,"column":123},"end":{"line":249,"column":135}}],"line":249},"21":{"loc":{"start":{"line":249,"column":13},"end":{"line":249,"column":111}},"type":"binary-expr","locations":[{"start":{"line":249,"column":13},"end":{"line":249,"column":94}},{"start":{"line":249,"column":98},"end":{"line":249,"column":111}}],"line":249},"22":{"loc":{"start":{"line":249,"column":19},"end":{"line":249,"column":84}},"type":"cond-expr","locations":[{"start":{"line":249,"column":60},"end":{"line":249,"column":66}},{"start":{"line":249,"column":69},"end":{"line":249,"column":84}}],"line":249},"23":{"loc":{"start":{"line":249,"column":19},"end":{"line":249,"column":57}},"type":"binary-expr","locations":[{"start":{"line":249,"column":19},"end":{"line":249,"column":35}},{"start":{"line":249,"column":39},"end":{"line":249,"column":57}}],"line":249},"24":{"loc":{"start":{"line":250,"column":4},"end":{"line":252,"column":5}},"type":"if","locations":[{"start":{"line":250,"column":4},"end":{"line":252,"column":5}},{"start":{"line":250,"column":4},"end":{"line":252,"column":5}}],"line":250},"25":{"loc":{"start":{"line":250,"column":8},"end":{"line":250,"column":263}},"type":"binary-expr","locations":[{"start":{"line":250,"column":9},"end":{"line":250,"column":131}},{"start":{"line":250,"column":137},"end":{"line":250,"column":262}}],"line":250},"26":{"loc":{"start":{"line":250,"column":9},"end":{"line":250,"column":131}},"type":"cond-expr","locations":[{"start":{"line":250,"column":110},"end":{"line":250,"column":116}},{"start":{"line":250,"column":119},"end":{"line":250,"column":131}}],"line":250},"27":{"loc":{"start":{"line":250,"column":9},"end":{"line":250,"column":107}},"type":"binary-expr","locations":[{"start":{"line":250,"column":9},"end":{"line":250,"column":90}},{"start":{"line":250,"column":94},"end":{"line":250,"column":107}}],"line":250},"28":{"loc":{"start":{"line":250,"column":15},"end":{"line":250,"column":80}},"type":"cond-expr","locations":[{"start":{"line":250,"column":56},"end":{"line":250,"column":62}},{"start":{"line":250,"column":65},"end":{"line":250,"column":80}}],"line":250},"29":{"loc":{"start":{"line":250,"column":15},"end":{"line":250,"column":53}},"type":"binary-expr","locations":[{"start":{"line":250,"column":15},"end":{"line":250,"column":31}},{"start":{"line":250,"column":35},"end":{"line":250,"column":53}}],"line":250},"30":{"loc":{"start":{"line":250,"column":137},"end":{"line":250,"column":262}},"type":"cond-expr","locations":[{"start":{"line":250,"column":241},"end":{"line":250,"column":247}},{"start":{"line":250,"column":250},"end":{"line":250,"column":262}}],"line":250},"31":{"loc":{"start":{"line":250,"column":137},"end":{"line":250,"column":238}},"type":"binary-expr","locations":[{"start":{"line":250,"column":137},"end":{"line":250,"column":221}},{"start":{"line":250,"column":225},"end":{"line":250,"column":238}}],"line":250},"32":{"loc":{"start":{"line":250,"column":143},"end":{"line":250,"column":211}},"type":"cond-expr","locations":[{"start":{"line":250,"column":186},"end":{"line":250,"column":192}},{"start":{"line":250,"column":195},"end":{"line":250,"column":211}}],"line":250},"33":{"loc":{"start":{"line":250,"column":143},"end":{"line":250,"column":183}},"type":"binary-expr","locations":[{"start":{"line":250,"column":143},"end":{"line":250,"column":160}},{"start":{"line":250,"column":164},"end":{"line":250,"column":183}}],"line":250},"34":{"loc":{"start":{"line":251,"column":18},"end":{"line":251,"column":96}},"type":"cond-expr","locations":[{"start":{"line":251,"column":61},"end":{"line":251,"column":67}},{"start":{"line":251,"column":70},"end":{"line":251,"column":96}}],"line":251},"35":{"loc":{"start":{"line":251,"column":18},"end":{"line":251,"column":58}},"type":"binary-expr","locations":[{"start":{"line":251,"column":18},"end":{"line":251,"column":35}},{"start":{"line":251,"column":39},"end":{"line":251,"column":58}}],"line":251},"36":{"loc":{"start":{"line":251,"column":101},"end":{"line":251,"column":176}},"type":"cond-expr","locations":[{"start":{"line":251,"column":142},"end":{"line":251,"column":148}},{"start":{"line":251,"column":151},"end":{"line":251,"column":176}}],"line":251},"37":{"loc":{"start":{"line":251,"column":101},"end":{"line":251,"column":139}},"type":"binary-expr","locations":[{"start":{"line":251,"column":101},"end":{"line":251,"column":117}},{"start":{"line":251,"column":121},"end":{"line":251,"column":139}}],"line":251},"38":{"loc":{"start":{"line":264,"column":36},"end":{"line":264,"column":163}},"type":"cond-expr","locations":[{"start":{"line":264,"column":142},"end":{"line":264,"column":148}},{"start":{"line":264,"column":151},"end":{"line":264,"column":163}}],"line":264},"39":{"loc":{"start":{"line":264,"column":36},"end":{"line":264,"column":139}},"type":"binary-expr","locations":[{"start":{"line":264,"column":36},"end":{"line":264,"column":122}},{"start":{"line":264,"column":126},"end":{"line":264,"column":139}}],"line":264},"40":{"loc":{"start":{"line":264,"column":42},"end":{"line":264,"column":112}},"type":"cond-expr","locations":[{"start":{"line":264,"column":83},"end":{"line":264,"column":89}},{"start":{"line":264,"column":92},"end":{"line":264,"column":112}}],"line":264},"41":{"loc":{"start":{"line":264,"column":42},"end":{"line":264,"column":80}},"type":"binary-expr","locations":[{"start":{"line":264,"column":42},"end":{"line":264,"column":58}},{"start":{"line":264,"column":62},"end":{"line":264,"column":80}}],"line":264},"42":{"loc":{"start":{"line":269,"column":35},"end":{"line":269,"column":165}},"type":"cond-expr","locations":[{"start":{"line":269,"column":144},"end":{"line":269,"column":150}},{"start":{"line":269,"column":153},"end":{"line":269,"column":165}}],"line":269},"43":{"loc":{"start":{"line":269,"column":35},"end":{"line":269,"column":141}},"type":"binary-expr","locations":[{"start":{"line":269,"column":35},"end":{"line":269,"column":124}},{"start":{"line":269,"column":128},"end":{"line":269,"column":141}}],"line":269},"44":{"loc":{"start":{"line":269,"column":41},"end":{"line":269,"column":114}},"type":"cond-expr","locations":[{"start":{"line":269,"column":84},"end":{"line":269,"column":90}},{"start":{"line":269,"column":93},"end":{"line":269,"column":114}}],"line":269},"45":{"loc":{"start":{"line":269,"column":41},"end":{"line":269,"column":81}},"type":"binary-expr","locations":[{"start":{"line":269,"column":41},"end":{"line":269,"column":58}},{"start":{"line":269,"column":62},"end":{"line":269,"column":81}}],"line":269},"46":{"loc":{"start":{"line":283,"column":36},"end":{"line":283,"column":163}},"type":"cond-expr","locations":[{"start":{"line":283,"column":142},"end":{"line":283,"column":148}},{"start":{"line":283,"column":151},"end":{"line":283,"column":163}}],"line":283},"47":{"loc":{"start":{"line":283,"column":36},"end":{"line":283,"column":139}},"type":"binary-expr","locations":[{"start":{"line":283,"column":36},"end":{"line":283,"column":122}},{"start":{"line":283,"column":126},"end":{"line":283,"column":139}}],"line":283},"48":{"loc":{"start":{"line":283,"column":42},"end":{"line":283,"column":112}},"type":"cond-expr","locations":[{"start":{"line":283,"column":83},"end":{"line":283,"column":89}},{"start":{"line":283,"column":92},"end":{"line":283,"column":112}}],"line":283},"49":{"loc":{"start":{"line":283,"column":42},"end":{"line":283,"column":80}},"type":"binary-expr","locations":[{"start":{"line":283,"column":42},"end":{"line":283,"column":58}},{"start":{"line":283,"column":62},"end":{"line":283,"column":80}}],"line":283},"50":{"loc":{"start":{"line":289,"column":35},"end":{"line":289,"column":165}},"type":"cond-expr","locations":[{"start":{"line":289,"column":144},"end":{"line":289,"column":150}},{"start":{"line":289,"column":153},"end":{"line":289,"column":165}}],"line":289},"51":{"loc":{"start":{"line":289,"column":35},"end":{"line":289,"column":141}},"type":"binary-expr","locations":[{"start":{"line":289,"column":35},"end":{"line":289,"column":124}},{"start":{"line":289,"column":128},"end":{"line":289,"column":141}}],"line":289},"52":{"loc":{"start":{"line":289,"column":41},"end":{"line":289,"column":114}},"type":"cond-expr","locations":[{"start":{"line":289,"column":84},"end":{"line":289,"column":90}},{"start":{"line":289,"column":93},"end":{"line":289,"column":114}}],"line":289},"53":{"loc":{"start":{"line":289,"column":41},"end":{"line":289,"column":81}},"type":"binary-expr","locations":[{"start":{"line":289,"column":41},"end":{"line":289,"column":58}},{"start":{"line":289,"column":62},"end":{"line":289,"column":81}}],"line":289},"54":{"loc":{"start":{"line":293,"column":4},"end":{"line":295,"column":5}},"type":"if","locations":[{"start":{"line":293,"column":4},"end":{"line":295,"column":5}},{"start":{"line":293,"column":4},"end":{"line":295,"column":5}}],"line":293},"55":{"loc":{"start":{"line":293,"column":8},"end":{"line":293,"column":57}},"type":"binary-expr","locations":[{"start":{"line":293,"column":8},"end":{"line":293,"column":30}},{"start":{"line":293,"column":34},"end":{"line":293,"column":57}}],"line":293},"56":{"loc":{"start":{"line":315,"column":9},"end":{"line":315,"column":76}},"type":"cond-expr","locations":[{"start":{"line":315,"column":52},"end":{"line":315,"column":58}},{"start":{"line":315,"column":61},"end":{"line":315,"column":76}}],"line":315},"57":{"loc":{"start":{"line":315,"column":9},"end":{"line":315,"column":49}},"type":"binary-expr","locations":[{"start":{"line":315,"column":9},"end":{"line":315,"column":26}},{"start":{"line":315,"column":30},"end":{"line":315,"column":49}}],"line":315}},"s":{"0":1,"1":2,"2":1,"3":1,"4":1,"5":1,"6":1,"7":1,"8":1,"9":1,"10":1,"11":0,"12":1,"13":1,"14":0,"15":1,"16":0,"17":0,"18":1,"19":0,"20":0,"21":0,"22":0,"23":0,"24":0,"25":1,"26":0,"27":0,"28":0,"29":0,"30":0,"31":0,"32":1,"33":0,"34":0,"35":0,"36":1,"37":0,"38":0,"39":0,"40":1,"41":0,"42":0,"43":0,"44":1,"45":0,"46":0,"47":0,"48":0,"49":0,"50":0,"51":0,"52":0,"53":0,"54":0,"55":0,"56":0,"57":0,"58":0,"59":0,"60":1,"61":0,"62":0,"63":0,"64":0,"65":0,"66":0,"67":0,"68":0,"69":0,"70":0,"71":0,"72":0,"73":1,"74":0,"75":0,"76":0,"77":0,"78":0,"79":0,"80":0,"81":1,"82":0,"83":0,"84":0,"85":0,"86":0,"87":0,"88":0,"89":0,"90":1,"91":0,"92":0,"93":0,"94":0,"95":0,"96":0,"97":0,"98":0,"99":0,"100":0,"101":0,"102":0,"103":0,"104":0,"105":1,"106":0,"107":0,"108":0,"109":0,"110":0,"111":0,"112":0,"113":0,"114":1,"115":0,"116":0,"117":0,"118":0,"119":0,"120":0,"121":0,"122":0,"123":0,"124":0,"125":0,"126":0,"127":0,"128":0,"129":1,"130":0,"131":0,"132":0,"133":0,"134":0,"135":0,"136":0,"137":0,"138":0,"139":0,"140":0,"141":0,"142":0,"143":0,"144":1,"145":0,"146":0,"147":0,"148":0,"149":0,"150":0,"151":0,"152":0,"153":0,"154":0,"155":0,"156":1,"157":0,"158":0,"159":0,"160":0,"161":0,"162":0,"163":0,"164":0,"165":0,"166":0,"167":0,"168":0,"169":1,"170":0,"171":0,"172":0,"173":0,"174":0,"175":0,"176":0,"177":0,"178":0,"179":0,"180":0,"181":0,"182":0,"183":0,"184":0,"185":0,"186":1,"187":0,"188":0,"189":0,"190":0,"191":0,"192":0,"193":0,"194":0,"195":0,"196":0,"197":0,"198":0,"199":0,"200":1,"201":0,"202":0,"203":0,"204":0,"205":0,"206":0,"207":0,"208":0,"209":0,"210":0,"211":0,"212":0,"213":0,"214":0,"215":0,"216":0,"217":0,"218":0,"219":1,"220":0,"221":0,"222":0,"223":0,"224":0,"225":0,"226":0,"227":0,"228":0,"229":0,"230":0,"231":0,"232":1,"233":0,"234":0,"235":0,"236":0},"f":{"0":2,"1":1,"2":1,"3":0,"4":0,"5":0,"6":0,"7":0,"8":0,"9":0,"10":0,"11":0,"12":0,"13":0,"14":0,"15":0,"16":0,"17":0,"18":0,"19":0,"20":0,"21":0,"22":0,"23":0,"24":0,"25":0,"26":0,"27":0,"28":0,"29":0,"30":0,"31":0,"32":0,"33":0,"34":0,"35":0},"b":{"0":[1,1,1],"1":[2,0],"2":[2,2],"3":[0,1],"4":[0,0],"5":[0,0],"6":[0,0],"7":[0,0],"8":[0,0],"9":[0,0],"10":[0,0],"11":[0,0],"12":[0,0],"13":[0,0],"14":[0,0],"15":[0,0],"16":[0,0],"17":[0,0],"18":[0,0],"19":[0,0],"20":[0,0],"21":[0,0],"22":[0,0],"23":[0,0],"24":[0,0],"25":[0,0],"26":[0,0],"27":[0,0],"28":[0,0],"29":[0,0],"30":[0,0],"31":[0,0],"32":[0,0],"33":[0,0],"34":[0,0],"35":[0,0],"36":[0,0],"37":[0,0],"38":[0,0],"39":[0,0],"40":[0,0],"41":[0,0],"42":[0,0],"43":[0,0],"44":[0,0],"45":[0,0],"46":[0,0],"47":[0,0],"48":[0,0],"49":[0,0],"50":[0,0],"51":[0,0],"52":[0,0],"53":[0,0],"54":[0,0],"55":[0,0],"56":[0,0],"57":[0,0]},"inputSourceMap":{"version":3,"file":"MongoStore.spec.js","sourceRoot":"","sources":["../../../src/lib/MongoStore.spec.ts"],"names":[],"mappings":";;;;;AAAA,8CAAsB;AAEtB,qCAAqC;AAErC,8DAAqC;AACrC,mDAI2B;AAE3B,IAAI,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAA;AAEjD,aAAI,CAAC,MAAM,CAAC,KAAK,IAAI,EAAE;IACrB,MAAM,YAAY,CAAC,KAAK,EAAE,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE;QACvC,IAAI,GAAG,CAAC,OAAO,CAAC,KAAK,CAAC,cAAc,CAAC,EAAE;YACrC,OAAO,IAAI,CAAA;SACZ;aAAM;YACL,MAAM,GAAG,CAAA;SACV;IACH,CAAC,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,SAAS,CAAC,MAAM,CAAC,KAAK,IAAI,EAAE;IAC/B,MAAM,YAAY,CAAC,KAAK,EAAE,CAAA;AAC5B,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,2CAA2C,EAAE,CAAC,CAAC,EAAE,EAAE;IAC7D,CAAC,CAAC,MAAM,CAAC,GAAG,EAAE,CAAC,oBAAU,CAAC,MAAM,CAAC,EAAE,CAAC,EAAE;QACpC,OAAO,EAAE,oBAAoB;KAC9B,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,iCAAiC,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IACzD,MAAM,OAAO,GAAG,qBAAW,CAAC,OAAO,CAAC,wCAAwC,CAAC,CAAA;IAC7E,MAAM,KAAK,GAAG,oBAAU,CAAC,MAAM,CAAC,EAAE,aAAa,EAAE,OAAO,EAAE,CAAC,CAAA;IAC3D,CAAC,CAAC,GAAG,CAAC,KAAK,EAAE,IAAI,CAAC,CAAA;IAClB,CAAC,CAAC,GAAG,CAAC,KAAK,EAAE,SAAS,CAAC,CAAA;IACvB,MAAM,KAAK,CAAC,WAAW,CAAA;IACvB,KAAK,CAAC,KAAK,EAAE,CAAA;AACf,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,0BAA0B,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAClD,MAAM,MAAM,GAAG,MAAM,qBAAW,CAAC,OAAO,CACtC,wCAAwC,CACzC,CAAA;IACD,MAAM,KAAK,GAAG,oBAAU,CAAC,MAAM,CAAC,EAAE,MAAM,EAAE,MAAM,EAAE,CAAC,CAAA;IACnD,CAAC,CAAC,GAAG,CAAC,KAAK,EAAE,IAAI,CAAC,CAAA;IAClB,CAAC,CAAC,GAAG,CAAC,KAAK,EAAE,SAAS,CAAC,CAAA;IACvB,MAAM,KAAK,CAAC,WAAW,CAAA;IACvB,KAAK,CAAC,KAAK,EAAE,CAAA;AACf,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,oBAAoB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAC5C,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,MAAM,GAAG,MAAM,YAAY,CAAC,MAAM,EAAE,CAAA;IAC1C,CAAC,CAAC,EAAE,CAAC,MAAM,EAAE,CAAC,CAAC,CAAA;AACjB,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,0CAA0C,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAClE,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,UAAU,CAAC,CAAA;IAC9C,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;AACjB,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,4CAA4C,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IACpE,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,WAAW,GAAG,MAAM,YAAY,CAAC,GAAG,EAAE,CAAA;IAC5C,CAAC,CAAC,SAAS,CAAC,WAAW,EAAE,EAAE,CAAC,CAAA;AAC9B,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,sBAAsB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAC9C,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,IAAI,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC3B,MAAM,GAAG,GAAG,iBAAiB,CAAA;IAC7B,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACnD,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,SAAS,CAAC,CAAA;IACpB,MAAM,OAAO,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IAC3C,CAAC,CAAC,EAAE,CAAC,OAAO,OAAO,EAAE,QAAQ,CAAC,CAAA;IAC9B,UAAU,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,CAAC,UAAU,CAAC,CAAC,CAAA;IACnD,CAAC,CAAC,SAAS,CAAC,OAAO,EAAE,UAAU,CAAC,CAAA;IAChC,MAAM,WAAW,GAAG,MAAM,YAAY,CAAC,GAAG,EAAE,CAAA;IAC5C,CAAC,CAAC,SAAS,CAAC,WAAW,EAAE,CAAC,UAAU,CAAC,CAAC,CAAA;IACtC,CAAC,CAAC,EAAE,CAAC,MAAM,YAAY,CAAC,MAAM,EAAE,EAAE,CAAC,CAAC,CAAA;IACpC,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,OAAO,CAAC,GAAG,CAAC,CAAA;IAC3C,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,SAAS,CAAC,CAAA;IACpB,CAAC,CAAC,EAAE,CAAC,MAAM,YAAY,CAAC,MAAM,EAAE,EAAE,CAAC,CAAC,CAAA;AACtC,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,yBAAyB,EAAE,CAAC,CAAC,EAAE,EAAE;IAC9C,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,IAAI,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC3B,MAAM,GAAG,GAAG,gBAAgB,CAAA;IAC5B,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IAC1B,UAAU,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,CAAC,UAAU,CAAC,CAAC,CAAA;IACnD,KAAK,CAAC,EAAE,CAAC,KAAK,EAAE,CAAC,SAAS,EAAE,EAAE;QAC5B,CAAC,CAAC,EAAE,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;QACpB,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE,CAAC,GAAG,EAAE,OAAO,EAAE,EAAE;YAC9B,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;YACf,CAAC,CAAC,EAAE,CAAC,OAAO,OAAO,EAAE,QAAQ,CAAC,CAAA;YAC9B,CAAC,CAAC,SAAS,CAAC,OAAO,EAAE,UAAU,CAAC,CAAA;YAChC,CAAC,CAAC,GAAG,EAAE,CAAA;QACT,CAAC,CAAC,CAAA;IACJ,CAAC,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,gCAAgC,EAAE,CAAC,CAAC,EAAE,EAAE;IACrD,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,GAAG,GAAG,mBAAmB,CAAA;IAC/B,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IAC1B,KAAK,CAAC,EAAE,CAAC,QAAQ,EAAE,CAAC,SAAS,EAAE,EAAE;QAC/B,CAAC,CAAC,EAAE,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;QACpB,CAAC,CAAC,GAAG,EAAE,CAAA;IACT,CAAC,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,gCAAgC,EAAE,CAAC,CAAC,EAAE,EAAE;IACrD,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,GAAG,GAAG,mBAAmB,CAAA;IAC/B,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IAC1B,KAAK,CAAC,GAAG,CAAC,GAAG,EAAE,EAAE,GAAG,UAAU,EAAE,GAAG,EAAE,SAAS,EAAiB,CAAC,CAAA;IAChE,KAAK,CAAC,EAAE,CAAC,QAAQ,EAAE,CAAC,SAAS,EAAE,EAAE;QAC/B,CAAC,CAAC,EAAE,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;QACpB,CAAC,CAAC,GAAG,EAAE,CAAA;IACT,CAAC,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,uBAAuB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAC/C,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC,EAAE,SAAS,EAAE,KAAK,EAAE,CAAC,CAAC,CAAA;IACpE,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,MAAM,GAAG,UAAU,CAAC,MAAM,CAAA;IAChC,MAAM,GAAG,GAAG,mBAAmB,CAAA;IAC/B,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACnD,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,SAAS,CAAC,CAAA;IACpB,MAAM,OAAO,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IAC3C,CAAC,CAAC,EAAE,CAAC,OAAO,OAAO,EAAE,QAAQ,CAAC,CAAA;IAC9B,CAAC,CAAC,SAAS,CAAC,UAAU,CAAC,MAAM,EAAE,MAAM,CAAC,CAAA;IACtC,aAAa;IACb,CAAC,CAAC,SAAS,CAAC,MAAM,CAAC,OAAO,CAAC,MAAM,EAAE,EAAE,OAAO,CAAC,MAAM,CAAC,OAAO,CAAC,MAAM,EAAE,CAAC,CAAA;IACrE,aAAa;IACb,CAAC,CAAC,SAAS,CAAC,MAAM,CAAC,MAAM,EAAE,OAAO,CAAC,MAAM,CAAC,MAAM,CAAC,CAAA;IACjD,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,KAAK,EAAE,CAAA;IACtC,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,SAAS,CAAC,CAAA;IACpB,CAAC,CAAC,EAAE,CAAC,MAAM,YAAY,CAAC,MAAM,EAAE,EAAE,CAAC,CAAC,CAAA;AACtC,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,EAAE,CAAC,oBAAoB,EAAE,CAAC,CAAC,EAAE,EAAE;IACzC,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,GAAG,GAAG,oBAAoB,CAAA;IAChC,KAAK,CAAC,EAAE,CAAC,SAAS,EAAE,CAAC,SAAS,EAAE,EAAE;QAChC,CAAC,CAAC,EAAE,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;QACpB,CAAC,CAAC,GAAG,EAAE,CAAA;IACT,CAAC,CAAC,CAAA;IACF,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAC,IAAI,CAAC,GAAG,EAAE;QAC1C,KAAK,CAAC,OAAO,CAAC,GAAG,CAAC,CAAA;IACpB,CAAC,CAAC,CAAA;AACJ,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,sBAAsB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;;IAC9C,MAAM,UAAU,GAAG,EAAE,CACpB;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC;QAC5C,GAAG,EAAE,UAAU;KAChB,CAAC,CAAC,CAAA;IACH,MAAM,UAAU,GAAG,IAAA,6BAAgB,GAAE,CAAA;IACrC,MAAM,GAAG,GAAG,sBAAsB,CAAA;IAClC,MAAM,aAAa,GAAG,IAAI,IAAI,EAAE,CAAC,OAAO,EAAE,CAAA;IAC1C,aAAa;IACb,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,UAAU,GAAG,MAAM,KAAK,CAAC,WAAW,CAAA;IAC1C,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACtD,MAAM,YAAY,GAAG,IAAI,IAAI,EAAE,CAAC,OAAO,EAAE,CAAA;IACzC,MAAM,OAAO,GAAG,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,0CAAE,OAAO,EAAE,CAAA;IAC3C,CAAC,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;IACjB,IAAI,OAAO,EAAE;QACX,CAAC,CAAC,MAAM,CAAC,aAAa,GAAG,UAAU,GAAG,IAAI,IAAI,OAAO,CAAC,CAAA;QACtD,CAAC,CAAC,MAAM,CAAC,OAAO,IAAI,YAAY,GAAG,UAAU,GAAG,IAAI,CAAC,CAAA;KACtD;AACH,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,kBAAkB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;;IAC1C,MAAM,qBAAqB,GAAG,IAAI,GAAG,EAAE,GAAG,EAAE,GAAG,EAAE,GAAG,EAAE,CACrD;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,UAAU,GAAG,IAAA,6BAAgB,GAAE,CAAA;IACrC,MAAM,GAAG,GAAG,yBAAyB,CAAA;IACrC,MAAM,aAAa,GAAG,IAAI,IAAI,EAAE,CAAC,OAAO,EAAE,CAAA;IAC1C,aAAa;IACb,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,UAAU,GAAG,MAAM,KAAK,CAAC,WAAW,CAAA;IAC1C,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACtD,MAAM,YAAY,GAAG,IAAI,IAAI,EAAE,CAAC,OAAO,EAAE,CAAA;IACzC,MAAM,OAAO,GAAG,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,0CAAE,OAAO,EAAE,CAAA;IAC3C,CAAC,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;IACjB,IAAI,OAAO,EAAE;QACX,CAAC,CAAC,MAAM,CAAC,aAAa,GAAG,qBAAqB,IAAI,OAAO,CAAC,CAAA;QAC1D,CAAC,CAAC,MAAM,CAAC,OAAO,IAAI,YAAY,GAAG,qBAAqB,CAAC,CAAA;KAC1D;AACH,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,wBAAwB,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAChD,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC;QAC5C,SAAS,EAAE,CAAC,GAAG,EAAE,EAAE;YACjB,GAAG,CAAC,GAAG,GAAG,qBAAqB,CAAA;YAC/B,OAAO,IAAI,CAAC,SAAS,CAAC,GAAG,CAAC,CAAA;QAC5B,CAAC;KACF,CAAC,CAAC,CAAA;IACH,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,GAAG,GAAG,wBAAwB,CAAA;IACpC,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,OAAO,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IAC3C,CAAC,CAAC,EAAE,CAAC,OAAO,OAAO,EAAE,QAAQ,CAAC,CAAA;IAC9B,CAAC,CAAC,GAAG,CAAC,OAAO,EAAE,SAAS,CAAC,CAAA;IACzB,aAAa;IACb,UAAU,CAAC,GAAG,GAAG,qBAAqB,CAAA;IACtC,aAAa;IACb,CAAC,CAAC,EAAE,CAAC,OAAO,EAAE,IAAI,CAAC,SAAS,CAAC,UAAU,CAAC,CAAC,CAAA;AAC3C,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,0BAA0B,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAClD,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC;QAC5C,WAAW,EAAE,CAAC,GAAG,EAAE,EAAE;YACnB,GAAG,CAAC,GAAG,GAAG,uBAAuB,CAAA;YACjC,OAAO,GAAG,CAAA;QACZ,CAAC;KACF,CAAC,CAAC,CAAA;IACH,MAAM,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC7B,MAAM,GAAG,GAAG,0BAA0B,CAAA;IACtC,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,OAAO,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IAC3C,CAAC,CAAC,EAAE,CAAC,OAAO,OAAO,EAAE,QAAQ,CAAC,CAAA;IAC9B,aAAa;IACb,UAAU,CAAC,MAAM,GAAG,UAAU,CAAC,MAAM,CAAC,MAAM,EAAE,CAAA;IAC9C,aAAa;IACb,UAAU,CAAC,GAAG,GAAG,uBAAuB,CAAA;IACxC,CAAC,CAAC,GAAG,CAAC,OAAO,EAAE,SAAS,CAAC,CAAA;IACzB,CAAC,CAAC,SAAS,CAAC,OAAO,EAAE,UAAU,CAAC,CAAA;AAClC,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,WAAW,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;;IACnC,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,GAAE,CAAC,CAAA;IAChD,MAAM,UAAU,GAAG,IAAA,6BAAgB,GAAE,CAAA;IACrC,MAAM,GAAG,GAAG,YAAY,CAAA;IACxB,aAAa;IACb,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,UAAU,GAAG,MAAM,KAAK,CAAC,WAAW,CAAA;IAC1C,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACtD,MAAM,IAAI,OAAO,CAAC,CAAC,OAAO,EAAE,EAAE,CAAC,UAAU,CAAC,OAAO,EAAE,GAAG,CAAC,CAAC,CAAA;IACxD,CAAC,CAAC,GAAG,CAAC,OAAO,EAAE,SAAS,CAAC,CAAA;IACzB,MAAM,YAAY,CAAC,KAAK,CAAC,GAAG,EAAE,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,CAAC,CAAA;IAC/C,MAAM,QAAQ,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACvD,CAAC,CAAC,GAAG,CAAC,QAAQ,EAAE,SAAS,CAAC,CAAA;IAC1B,0CAA0C;IAC1C,CAAC,CAAC,MAAM,CAAC,MAAA,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,OAAO,0CAAE,OAAO,EAAE,CAAC,CAAA;IACtC,CAAC,CAAC,MAAM,CAAC,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,0CAAE,OAAO,EAAE,CAAC,CAAA;IACrC,IAAI,CAAA,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,0CAAE,OAAO,EAAE,MAAI,MAAA,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,OAAO,0CAAE,OAAO,EAAE,CAAA,EAAE;QAC/D,CAAC,CAAC,MAAM,CAAC,CAAA,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,OAAO,CAAC,OAAO,EAAE,KAAG,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,OAAO,CAAC,OAAO,EAAE,CAAA,CAAC,CAAA;KACnE;AACH,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,2BAA2B,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;;IACnD,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC,EAAE,UAAU,EAAE,CAAC,EAAE,CAAC,CAAC,CAAA;IACjE,MAAM,UAAU,GAAG,IAAA,6BAAgB,GAAE,CAAA;IACrC,MAAM,GAAG,GAAG,4BAA4B,CAAA;IACxC,aAAa;IACb,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,UAAU,GAAG,MAAM,KAAK,CAAC,WAAW,CAAA;IAC1C,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACtD,MAAM,uBAAuB,GAAG,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,0CAAE,OAAO,EAAE,CAAA;IAChE,CAAC,CAAC,GAAG,CAAC,OAAO,EAAE,SAAS,CAAC,CAAA;IACzB,MAAM,YAAY,CAAC,KAAK,CAAC,GAAG,EAAE,OAAiC,CAAC,CAAA;IAChE,MAAM,QAAQ,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACvD,CAAC,CAAC,GAAG,CAAC,QAAQ,EAAE,SAAS,CAAC,CAAA;IAC1B,MAAM,sBAAsB,GAAG,MAAA,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,YAAY,0CAAE,OAAO,EAAE,CAAA;IAChE,0CAA0C;IAC1C,CAAC,CAAC,EAAE,CAAC,uBAAuB,EAAE,sBAAsB,CAAC,CAAA;AACvD,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,sCAAsC,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;;IAC9D,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC,EAAE,UAAU,EAAE,CAAC,EAAE,CAAC,CAAC,CAAA;IACjE,MAAM,UAAU,GAAG,IAAA,6BAAgB,GAAE,CAAA;IACrC,MAAM,GAAG,GAAG,yCAAyC,CAAA;IACrD,aAAa;IACb,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACvC,MAAM,UAAU,GAAG,MAAM,KAAK,CAAC,WAAW,CAAA;IAC1C,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACtD,MAAM,uBAAuB,GAAG,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,0CAAE,OAAO,EAAE,CAAA;IAChE,MAAM,IAAI,OAAO,CAAC,CAAC,OAAO,EAAE,EAAE,CAAC,UAAU,CAAC,OAAO,EAAE,IAAI,CAAC,CAAC,CAAA;IACzD,CAAC,CAAC,GAAG,CAAC,OAAO,EAAE,SAAS,CAAC,CAAA;IACzB,MAAM,YAAY,CAAC,KAAK,CAAC,GAAG,EAAE,OAAiC,CAAC,CAAA;IAChE,MAAM,QAAQ,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC,EAAE,GAAG,EAAE,GAAG,EAAE,CAAC,CAAA;IACvD,CAAC,CAAC,GAAG,CAAC,QAAQ,EAAE,SAAS,CAAC,CAAA;IAC1B,MAAM,sBAAsB,GAAG,MAAA,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,YAAY,0CAAE,OAAO,EAAE,CAAA;IAChE,0CAA0C;IAC1C,CAAC,CAAC,MAAM,CAAC,sBAAsB,CAAC,CAAA;IAChC,CAAC,CAAC,MAAM,CAAC,uBAAuB,CAAC,CAAA;IACjC,IAAI,sBAAsB,IAAI,uBAAuB,EAAE;QACrD,CAAC,CAAC,MAAM,CAAC,sBAAsB,GAAG,uBAAuB,CAAC,CAAA;KAC3D;AACH,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,kCAAkC,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IAC1D,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC;QAC5C,MAAM,EAAE,EAAE,MAAM,EAAE,QAAQ,EAAE;QAC5B,cAAc,EAAE,aAAa;QAC7B,UAAU,EAAE,UAAU;KACvB,CAAC,CAAC,CAAA;IACH,IAAI,UAAU,GAAG,IAAA,qBAAQ,GAAE,CAAA;IAC3B,MAAM,GAAG,GAAG,6BAA6B,CAAA;IACzC,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,EAAE,UAAU,CAAC,CAAA;IACnD,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,SAAS,CAAC,CAAA;IACpB,MAAM,OAAO,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IAC3C,UAAU,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,SAAS,CAAC,UAAU,CAAC,CAAC,CAAA;IACnD,aAAa;IACb,CAAC,CAAC,SAAS,CAAC,OAAO,EAAE,UAAU,CAAC,CAAA;IAChC,MAAM,QAAQ,GAAG,MAAM,YAAY,CAAC,GAAG,EAAE,CAAA;IACzC,CAAC,CAAC,GAAG,CAAC,QAAQ,EAAE,SAAS,CAAC,CAAA;IAC1B,CAAC,CAAC,GAAG,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAA;IACrB,CAAC,CAAC,EAAE,CAAC,QAAQ,aAAR,QAAQ,uBAAR,QAAQ,CAAE,MAAM,EAAE,CAAC,CAAC,CAAA;AAC3B,CAAC,CAAC,CAAA;AAEF,aAAI,CAAC,MAAM,CAAC,4CAA4C,EAAE,KAAK,EAAE,CAAC,EAAE,EAAE;IACpE,CAAC;IAAA,CAAC,EAAE,KAAK,EAAE,YAAY,EAAE,GAAG,IAAA,8BAAiB,EAAC;QAC5C,UAAU,EAAE,EAAE;KACf,CAAC,CAAC,CAAA;IACH,MAAM,GAAG,GAAG,+BAA+B,CAAA;IAC3C,MAAM,GAAG,GAAG,MAAM,YAAY,CAAC,GAAG,CAAC,GAAG,CAAC,CAAA;IACvC,CAAC,CAAC,EAAE,CAAC,GAAG,EAAE,IAAI,CAAC,CAAA;AACjB,CAAC,CAAC,CAAA"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"d4ca2c1acdf58b853fc5e855f7188f5d8626fa85"},"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":12,"column":3}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},"2":{"start":{"line":3,"column":26},"end":{"line":3,"column":33}},"3":{"start":{"line":4,"column":15},"end":{"line":4,"column":52}},"4":{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},"5":{"start":{"line":6,"column":6},"end":{"line":6,"column":68}},"6":{"start":{"line":6,"column":51},"end":{"line":6,"column":63}},"7":{"start":{"line":8,"column":4},"end":{"line":8,"column":39}},"8":{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},"9":{"start":{"line":10,"column":26},"end":{"line":10,"column":33}},"10":{"start":{"line":11,"column":4},"end":{"line":11,"column":17}},"11":{"start":{"line":13,"column":25},"end":{"line":17,"column":2}},"12":{"start":{"line":14,"column":4},"end":{"line":14,"column":72}},"13":{"start":{"line":16,"column":4},"end":{"line":16,"column":21}},"14":{"start":{"line":18,"column":19},"end":{"line":24,"column":1}},"15":{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},"16":{"start":{"line":19,"column":31},"end":{"line":19,"column":42}},"17":{"start":{"line":20,"column":17},"end":{"line":20,"column":19}},"18":{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},"19":{"start":{"line":21,"column":21},"end":{"line":21,"column":141}},"20":{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},"21":{"start":{"line":21,"column":109},"end":{"line":21,"column":141}},"22":{"start":{"line":22,"column":4},"end":{"line":22,"column":36}},"23":{"start":{"line":23,"column":4},"end":{"line":23,"column":18}},"24":{"start":{"line":25,"column":22},"end":{"line":27,"column":1}},"25":{"start":{"line":26,"column":4},"end":{"line":26,"column":62}},"26":{"start":{"line":28,"column":0},"end":{"line":28,"column":62}},"27":{"start":{"line":29,"column":18},"end":{"line":29,"column":36}},"28":{"start":{"line":30,"column":15},"end":{"line":30,"column":47}},"29":{"start":{"line":31,"column":16},"end":{"line":31,"column":56}},"30":{"start":{"line":32,"column":18},"end":{"line":32,"column":36}},"31":{"start":{"line":33,"column":16},"end":{"line":33,"column":49}},"32":{"start":{"line":34,"column":14},"end":{"line":34,"column":51}},"33":{"start":{"line":36,"column":13},"end":{"line":36,"column":22}},"34":{"start":{"line":37,"column":13},"end":{"line":37,"column":21}},"35":{"start":{"line":37,"column":20},"end":{"line":37,"column":21}},"36":{"start":{"line":40,"column":16},"end":{"line":40,"column":18}},"37":{"start":{"line":42,"column":4},"end":{"line":56,"column":5}},"38":{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},"39":{"start":{"line":47,"column":12},"end":{"line":50,"column":33}},"40":{"start":{"line":54,"column":12},"end":{"line":54,"column":38}},"41":{"start":{"line":57,"column":4},"end":{"line":57,"column":15}},"42":{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},"43":{"start":{"line":61,"column":8},"end":{"line":64,"column":10}},"44":{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},"45":{"start":{"line":67,"column":8},"end":{"line":70,"column":10}},"46":{"start":{"line":73,"column":4},"end":{"line":76,"column":6}},"47":{"start":{"line":80,"column":8},"end":{"line":80,"column":16}},"48":{"start":{"line":81,"column":8},"end":{"line":81,"column":27}},"49":{"start":{"line":82,"column":8},"end":{"line":82,"column":44}},"50":{"start":{"line":83,"column":24},"end":{"line":104,"column":9}},"51":{"start":{"line":106,"column":8},"end":{"line":106,"column":159}},"52":{"start":{"line":107,"column":8},"end":{"line":108,"column":141}},"53":{"start":{"line":109,"column":8},"end":{"line":110,"column":153}},"54":{"start":{"line":111,"column":8},"end":{"line":111,"column":69}},"55":{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},"56":{"start":{"line":114,"column":12},"end":{"line":114,"column":93}},"57":{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},"58":{"start":{"line":117,"column":12},"end":{"line":117,"column":45}},"59":{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},"60":{"start":{"line":120,"column":12},"end":{"line":120,"column":55}},"61":{"start":{"line":123,"column":12},"end":{"line":123,"column":82}},"62":{"start":{"line":125,"column":8},"end":{"line":125,"column":70}},"63":{"start":{"line":126,"column":8},"end":{"line":126,"column":32}},"64":{"start":{"line":127,"column":8},"end":{"line":127,"column":31}},"65":{"start":{"line":128,"column":8},"end":{"line":134,"column":11}},"66":{"start":{"line":129,"column":31},"end":{"line":131,"column":51}},"67":{"start":{"line":132,"column":12},"end":{"line":132,"column":49}},"68":{"start":{"line":133,"column":12},"end":{"line":133,"column":30}},"69":{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},"70":{"start":{"line":136,"column":12},"end":{"line":136,"column":62}},"71":{"start":{"line":140,"column":8},"end":{"line":140,"column":39}},"72":{"start":{"line":143,"column":28},"end":{"line":147,"column":10}},"73":{"start":{"line":143,"column":35},"end":{"line":147,"column":9}},"74":{"start":{"line":148,"column":8},"end":{"line":168,"column":9}},"75":{"start":{"line":150,"column":16},"end":{"line":150,"column":52}},"76":{"start":{"line":151,"column":16},"end":{"line":154,"column":19}},"77":{"start":{"line":156,"column":16},"end":{"line":156,"column":65}},"78":{"start":{"line":157,"column":16},"end":{"line":162,"column":65}},"79":{"start":{"line":157,"column":47},"end":{"line":162,"column":18}},"80":{"start":{"line":163,"column":16},"end":{"line":163,"column":35}},"81":{"start":{"line":164,"column":16},"end":{"line":164,"column":41}},"82":{"start":{"line":167,"column":16},"end":{"line":167,"column":41}},"83":{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},"84":{"start":{"line":173,"column":12},"end":{"line":173,"column":55}},"85":{"start":{"line":175,"column":8},"end":{"line":175,"column":25}},"86":{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},"87":{"start":{"line":183,"column":12},"end":{"line":183,"column":80}},"88":{"start":{"line":185,"column":8},"end":{"line":185,"column":75}},"89":{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},"90":{"start":{"line":193,"column":30},"end":{"line":195,"column":14}},"91":{"start":{"line":194,"column":16},"end":{"line":194,"column":37}},"92":{"start":{"line":197,"column":12},"end":{"line":197,"column":52}},"93":{"start":{"line":206,"column":8},"end":{"line":230,"column":13}},"94":{"start":{"line":207,"column":12},"end":{"line":229,"column":13}},"95":{"start":{"line":208,"column":16},"end":{"line":208,"column":47}},"96":{"start":{"line":209,"column":35},"end":{"line":209,"column":57}},"97":{"start":{"line":210,"column":32},"end":{"line":216,"column":18}},"98":{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},"99":{"start":{"line":218,"column":20},"end":{"line":218,"column":85}},"100":{"start":{"line":218,"column":70},"end":{"line":218,"column":83}},"101":{"start":{"line":220,"column":26},"end":{"line":220,"column":89}},"102":{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},"103":{"start":{"line":222,"column":20},"end":{"line":222,"column":58}},"104":{"start":{"line":224,"column":16},"end":{"line":224,"column":38}},"105":{"start":{"line":225,"column":16},"end":{"line":225,"column":59}},"106":{"start":{"line":228,"column":16},"end":{"line":228,"column":32}},"107":{"start":{"line":239,"column":8},"end":{"line":295,"column":13}},"108":{"start":{"line":241,"column":12},"end":{"line":293,"column":13}},"109":{"start":{"line":242,"column":16},"end":{"line":242,"column":47}},"110":{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},"111":{"start":{"line":247,"column":20},"end":{"line":247,"column":48}},"112":{"start":{"line":249,"column":26},"end":{"line":252,"column":17}},"113":{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},"114":{"start":{"line":255,"column":20},"end":{"line":255,"column":65}},"115":{"start":{"line":265,"column":20},"end":{"line":265,"column":79}},"116":{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},"117":{"start":{"line":269,"column":20},"end":{"line":269,"column":48}},"118":{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},"119":{"start":{"line":272,"column":38},"end":{"line":272,"column":97}},"120":{"start":{"line":273,"column":33},"end":{"line":275,"column":22}},"121":{"start":{"line":274,"column":24},"end":{"line":274,"column":45}},"122":{"start":{"line":276,"column":20},"end":{"line":276,"column":37}},"123":{"start":{"line":278,"column":35},"end":{"line":278,"column":57}},"124":{"start":{"line":279,"column":32},"end":{"line":282,"column":18}},"125":{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},"126":{"start":{"line":284,"column":20},"end":{"line":284,"column":45}},"127":{"start":{"line":287,"column":20},"end":{"line":287,"column":45}},"128":{"start":{"line":289,"column":16},"end":{"line":289,"column":38}},"129":{"start":{"line":292,"column":16},"end":{"line":292,"column":39}},"130":{"start":{"line":294,"column":12},"end":{"line":294,"column":34}},"131":{"start":{"line":299,"column":8},"end":{"line":339,"column":13}},"132":{"start":{"line":301,"column":12},"end":{"line":338,"column":13}},"133":{"start":{"line":302,"column":16},"end":{"line":302,"column":49}},"134":{"start":{"line":303,"column":37},"end":{"line":303,"column":39}},"135":{"start":{"line":304,"column":35},"end":{"line":304,"column":65}},"136":{"start":{"line":305,"column":37},"end":{"line":307,"column":23}},"137":{"start":{"line":308,"column":36},"end":{"line":308,"column":46}},"138":{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},"139":{"start":{"line":313,"column":40},"end":{"line":313,"column":76}},"140":{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},"141":{"start":{"line":315,"column":24},"end":{"line":315,"column":62}},"142":{"start":{"line":316,"column":24},"end":{"line":316,"column":46}},"143":{"start":{"line":318,"column":20},"end":{"line":318,"column":60}},"144":{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},"145":{"start":{"line":321,"column":20},"end":{"line":321,"column":76}},"146":{"start":{"line":324,"column":20},"end":{"line":324,"column":90}},"147":{"start":{"line":326,"column":35},"end":{"line":326,"column":57}},"148":{"start":{"line":327,"column":32},"end":{"line":327,"column":173}},"149":{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},"150":{"start":{"line":329,"column":20},"end":{"line":329,"column":86}},"151":{"start":{"line":332,"column":20},"end":{"line":332,"column":53}},"152":{"start":{"line":333,"column":20},"end":{"line":333,"column":42}},"153":{"start":{"line":337,"column":16},"end":{"line":337,"column":39}},"154":{"start":{"line":346,"column":8},"end":{"line":369,"column":13}},"155":{"start":{"line":347,"column":12},"end":{"line":368,"column":13}},"156":{"start":{"line":348,"column":16},"end":{"line":348,"column":42}},"157":{"start":{"line":349,"column":35},"end":{"line":349,"column":57}},"158":{"start":{"line":350,"column":33},"end":{"line":355,"column":18}},"159":{"start":{"line":356,"column":32},"end":{"line":356,"column":34}},"160":{"start":{"line":357,"column":16},"end":{"line":362,"column":17}},"161":{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},"162":{"start":{"line":359,"column":24},"end":{"line":359,"column":59}},"163":{"start":{"line":361,"column":20},"end":{"line":361,"column":87}},"164":{"start":{"line":363,"column":16},"end":{"line":363,"column":42}},"165":{"start":{"line":364,"column":16},"end":{"line":364,"column":40}},"166":{"start":{"line":367,"column":16},"end":{"line":367,"column":32}},"167":{"start":{"line":376,"column":8},"end":{"line":376,"column":43}},"168":{"start":{"line":377,"column":8},"end":{"line":383,"column":43}},"169":{"start":{"line":378,"column":34},"end":{"line":378,"column":145}},"170":{"start":{"line":380,"column":12},"end":{"line":380,"column":38}},"171":{"start":{"line":381,"column":12},"end":{"line":381,"column":27}},"172":{"start":{"line":383,"column":28},"end":{"line":383,"column":41}},"173":{"start":{"line":389,"column":8},"end":{"line":389,"column":37}},"174":{"start":{"line":390,"column":8},"end":{"line":394,"column":43}},"175":{"start":{"line":391,"column":34},"end":{"line":391,"column":61}},"176":{"start":{"line":392,"column":25},"end":{"line":392,"column":42}},"177":{"start":{"line":394,"column":28},"end":{"line":394,"column":41}},"178":{"start":{"line":400,"column":8},"end":{"line":400,"column":36}},"179":{"start":{"line":401,"column":8},"end":{"line":404,"column":43}},"180":{"start":{"line":402,"column":34},"end":{"line":402,"column":51}},"181":{"start":{"line":403,"column":24},"end":{"line":403,"column":38}},"182":{"start":{"line":404,"column":28},"end":{"line":404,"column":41}},"183":{"start":{"line":410,"column":8},"end":{"line":410,"column":36}},"184":{"start":{"line":411,"column":8},"end":{"line":411,"column":51}},"185":{"start":{"line":411,"column":40},"end":{"line":411,"column":49}},"186":{"start":{"line":414,"column":0},"end":{"line":414,"column":29}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":74},"end":{"line":2,"column":75}},"loc":{"start":{"line":2,"column":96},"end":{"line":9,"column":1}},"line":2},"1":{"name":"(anonymous_1)","decl":{"start":{"line":6,"column":38},"end":{"line":6,"column":39}},"loc":{"start":{"line":6,"column":49},"end":{"line":6,"column":65}},"line":6},"2":{"name":"(anonymous_2)","decl":{"start":{"line":9,"column":6},"end":{"line":9,"column":7}},"loc":{"start":{"line":9,"column":28},"end":{"line":12,"column":1}},"line":9},"3":{"name":"(anonymous_3)","decl":{"start":{"line":13,"column":80},"end":{"line":13,"column":81}},"loc":{"start":{"line":13,"column":95},"end":{"line":15,"column":1}},"line":13},"4":{"name":"(anonymous_4)","decl":{"start":{"line":15,"column":5},"end":{"line":15,"column":6}},"loc":{"start":{"line":15,"column":20},"end":{"line":17,"column":1}},"line":15},"5":{"name":"(anonymous_5)","decl":{"start":{"line":18,"column":50},"end":{"line":18,"column":51}},"loc":{"start":{"line":18,"column":65},"end":{"line":24,"column":1}},"line":18},"6":{"name":"(anonymous_6)","decl":{"start":{"line":25,"column":56},"end":{"line":25,"column":57}},"loc":{"start":{"line":25,"column":71},"end":{"line":27,"column":1}},"line":25},"7":{"name":"(anonymous_7)","decl":{"start":{"line":36,"column":13},"end":{"line":36,"column":14}},"loc":{"start":{"line":36,"column":19},"end":{"line":36,"column":22}},"line":36},"8":{"name":"(anonymous_8)","decl":{"start":{"line":37,"column":13},"end":{"line":37,"column":14}},"loc":{"start":{"line":37,"column":20},"end":{"line":37,"column":21}},"line":37},"9":{"name":"defaultSerializeFunction","decl":{"start":{"line":38,"column":9},"end":{"line":38,"column":33}},"loc":{"start":{"line":38,"column":43},"end":{"line":58,"column":1}},"line":38},"10":{"name":"computeTransformFunctions","decl":{"start":{"line":59,"column":9},"end":{"line":59,"column":34}},"loc":{"start":{"line":59,"column":44},"end":{"line":77,"column":1}},"line":59},"11":{"name":"(anonymous_11)","decl":{"start":{"line":79,"column":4},"end":{"line":79,"column":5}},"loc":{"start":{"line":79,"column":186},"end":{"line":138,"column":5}},"line":79},"12":{"name":"(anonymous_12)","decl":{"start":{"line":128,"column":41},"end":{"line":128,"column":42}},"loc":{"start":{"line":128,"column":56},"end":{"line":134,"column":9}},"line":128},"13":{"name":"(anonymous_13)","decl":{"start":{"line":139,"column":4},"end":{"line":139,"column":5}},"loc":{"start":{"line":139,"column":27},"end":{"line":141,"column":5}},"line":139},"14":{"name":"(anonymous_14)","decl":{"start":{"line":142,"column":4},"end":{"line":142,"column":5}},"loc":{"start":{"line":142,"column":30},"end":{"line":169,"column":5}},"line":142},"15":{"name":"(anonymous_15)","decl":{"start":{"line":143,"column":28},"end":{"line":143,"column":29}},"loc":{"start":{"line":143,"column":35},"end":{"line":147,"column":9}},"line":143},"16":{"name":"(anonymous_16)","decl":{"start":{"line":157,"column":41},"end":{"line":157,"column":42}},"loc":{"start":{"line":157,"column":47},"end":{"line":162,"column":18}},"line":157},"17":{"name":"(anonymous_17)","decl":{"start":{"line":170,"column":4},"end":{"line":170,"column":5}},"loc":{"start":{"line":170,"column":32},"end":{"line":176,"column":5}},"line":170},"18":{"name":"(anonymous_18)","decl":{"start":{"line":181,"column":4},"end":{"line":181,"column":5}},"loc":{"start":{"line":181,"column":20},"end":{"line":186,"column":5}},"line":181},"19":{"name":"(anonymous_19)","decl":{"start":{"line":191,"column":4},"end":{"line":191,"column":5}},"loc":{"start":{"line":191,"column":34},"end":{"line":199,"column":5}},"line":191},"20":{"name":"(anonymous_20)","decl":{"start":{"line":193,"column":102},"end":{"line":193,"column":103}},"loc":{"start":{"line":193,"column":111},"end":{"line":195,"column":13}},"line":193},"21":{"name":"(anonymous_21)","decl":{"start":{"line":204,"column":4},"end":{"line":204,"column":5}},"loc":{"start":{"line":204,"column":23},"end":{"line":231,"column":5}},"line":204},"22":{"name":"(anonymous_22)","decl":{"start":{"line":206,"column":9},"end":{"line":206,"column":10}},"loc":{"start":{"line":206,"column":21},"end":{"line":230,"column":9}},"line":206},"23":{"name":"(anonymous_23)","decl":{"start":{"line":218,"column":61},"end":{"line":218,"column":62}},"loc":{"start":{"line":218,"column":70},"end":{"line":218,"column":83}},"line":218},"24":{"name":"(anonymous_24)","decl":{"start":{"line":237,"column":4},"end":{"line":237,"column":5}},"loc":{"start":{"line":237,"column":39},"end":{"line":296,"column":5}},"line":237},"25":{"name":"(anonymous_25)","decl":{"start":{"line":239,"column":9},"end":{"line":239,"column":10}},"loc":{"start":{"line":239,"column":21},"end":{"line":295,"column":9}},"line":239},"26":{"name":"(anonymous_26)","decl":{"start":{"line":273,"column":94},"end":{"line":273,"column":95}},"loc":{"start":{"line":273,"column":103},"end":{"line":275,"column":21}},"line":273},"27":{"name":"(anonymous_27)","decl":{"start":{"line":297,"column":4},"end":{"line":297,"column":5}},"loc":{"start":{"line":297,"column":41},"end":{"line":340,"column":5}},"line":297},"28":{"name":"(anonymous_28)","decl":{"start":{"line":299,"column":9},"end":{"line":299,"column":10}},"loc":{"start":{"line":299,"column":21},"end":{"line":339,"column":9}},"line":299},"29":{"name":"(anonymous_29)","decl":{"start":{"line":344,"column":4},"end":{"line":344,"column":5}},"loc":{"start":{"line":344,"column":18},"end":{"line":370,"column":5}},"line":344},"30":{"name":"(anonymous_30)","decl":{"start":{"line":346,"column":9},"end":{"line":346,"column":10}},"loc":{"start":{"line":346,"column":21},"end":{"line":369,"column":9}},"line":346},"31":{"name":"(anonymous_31)","decl":{"start":{"line":375,"column":4},"end":{"line":375,"column":5}},"loc":{"start":{"line":375,"column":34},"end":{"line":384,"column":5}},"line":375},"32":{"name":"(anonymous_32)","decl":{"start":{"line":378,"column":18},"end":{"line":378,"column":19}},"loc":{"start":{"line":378,"column":34},"end":{"line":378,"column":145}},"line":378},"33":{"name":"(anonymous_33)","decl":{"start":{"line":379,"column":18},"end":{"line":379,"column":19}},"loc":{"start":{"line":379,"column":24},"end":{"line":382,"column":9}},"line":379},"34":{"name":"(anonymous_34)","decl":{"start":{"line":383,"column":19},"end":{"line":383,"column":20}},"loc":{"start":{"line":383,"column":28},"end":{"line":383,"column":41}},"line":383},"35":{"name":"(anonymous_35)","decl":{"start":{"line":388,"column":4},"end":{"line":388,"column":5}},"loc":{"start":{"line":388,"column":21},"end":{"line":395,"column":5}},"line":388},"36":{"name":"(anonymous_36)","decl":{"start":{"line":391,"column":18},"end":{"line":391,"column":19}},"loc":{"start":{"line":391,"column":34},"end":{"line":391,"column":61}},"line":391},"37":{"name":"(anonymous_37)","decl":{"start":{"line":392,"column":18},"end":{"line":392,"column":19}},"loc":{"start":{"line":392,"column":25},"end":{"line":392,"column":42}},"line":392},"38":{"name":"(anonymous_38)","decl":{"start":{"line":394,"column":19},"end":{"line":394,"column":20}},"loc":{"start":{"line":394,"column":28},"end":{"line":394,"column":41}},"line":394},"39":{"name":"(anonymous_39)","decl":{"start":{"line":399,"column":4},"end":{"line":399,"column":5}},"loc":{"start":{"line":399,"column":27},"end":{"line":405,"column":5}},"line":399},"40":{"name":"(anonymous_40)","decl":{"start":{"line":402,"column":18},"end":{"line":402,"column":19}},"loc":{"start":{"line":402,"column":34},"end":{"line":402,"column":51}},"line":402},"41":{"name":"(anonymous_41)","decl":{"start":{"line":403,"column":18},"end":{"line":403,"column":19}},"loc":{"start":{"line":403,"column":24},"end":{"line":403,"column":38}},"line":403},"42":{"name":"(anonymous_42)","decl":{"start":{"line":404,"column":19},"end":{"line":404,"column":20}},"loc":{"start":{"line":404,"column":28},"end":{"line":404,"column":41}},"line":404},"43":{"name":"(anonymous_43)","decl":{"start":{"line":409,"column":4},"end":{"line":409,"column":5}},"loc":{"start":{"line":409,"column":12},"end":{"line":412,"column":5}},"line":409},"44":{"name":"(anonymous_44)","decl":{"start":{"line":411,"column":33},"end":{"line":411,"column":34}},"loc":{"start":{"line":411,"column":40},"end":{"line":411,"column":49}},"line":411}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":12,"column":3}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":57},"end":{"line":12,"column":2}}],"line":2},"1":{"loc":{"start":{"line":2,"column":57},"end":{"line":12,"column":2}},"type":"cond-expr","locations":[{"start":{"line":2,"column":74},"end":{"line":9,"column":1}},{"start":{"line":9,"column":6},"end":{"line":12,"column":1}}],"line":2},"2":{"loc":{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},"type":"if","locations":[{"start":{"line":3,"column":4},"end":{"line":3,"column":33}},{"start":{"line":3,"column":4},"end":{"line":3,"column":33}}],"line":3},"3":{"loc":{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},"type":"if","locations":[{"start":{"line":5,"column":4},"end":{"line":7,"column":5}},{"start":{"line":5,"column":4},"end":{"line":7,"column":5}}],"line":5},"4":{"loc":{"start":{"line":5,"column":8},"end":{"line":5,"column":85}},"type":"binary-expr","locations":[{"start":{"line":5,"column":8},"end":{"line":5,"column":13}},{"start":{"line":5,"column":18},"end":{"line":5,"column":84}}],"line":5},"5":{"loc":{"start":{"line":5,"column":18},"end":{"line":5,"column":84}},"type":"cond-expr","locations":[{"start":{"line":5,"column":34},"end":{"line":5,"column":47}},{"start":{"line":5,"column":50},"end":{"line":5,"column":84}}],"line":5},"6":{"loc":{"start":{"line":5,"column":50},"end":{"line":5,"column":84}},"type":"binary-expr","locations":[{"start":{"line":5,"column":50},"end":{"line":5,"column":63}},{"start":{"line":5,"column":67},"end":{"line":5,"column":84}}],"line":5},"7":{"loc":{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},"type":"if","locations":[{"start":{"line":10,"column":4},"end":{"line":10,"column":33}},{"start":{"line":10,"column":4},"end":{"line":10,"column":33}}],"line":10},"8":{"loc":{"start":{"line":13,"column":25},"end":{"line":17,"column":2}},"type":"binary-expr","locations":[{"start":{"line":13,"column":26},"end":{"line":13,"column":30}},{"start":{"line":13,"column":34},"end":{"line":13,"column":57}},{"start":{"line":13,"column":63},"end":{"line":17,"column":1}}],"line":13},"9":{"loc":{"start":{"line":13,"column":63},"end":{"line":17,"column":1}},"type":"cond-expr","locations":[{"start":{"line":13,"column":80},"end":{"line":15,"column":1}},{"start":{"line":15,"column":5},"end":{"line":17,"column":1}}],"line":13},"10":{"loc":{"start":{"line":18,"column":19},"end":{"line":24,"column":1}},"type":"binary-expr","locations":[{"start":{"line":18,"column":20},"end":{"line":18,"column":24}},{"start":{"line":18,"column":28},"end":{"line":18,"column":45}},{"start":{"line":18,"column":50},"end":{"line":24,"column":1}}],"line":18},"11":{"loc":{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},"type":"if","locations":[{"start":{"line":19,"column":4},"end":{"line":19,"column":42}},{"start":{"line":19,"column":4},"end":{"line":19,"column":42}}],"line":19},"12":{"loc":{"start":{"line":19,"column":8},"end":{"line":19,"column":29}},"type":"binary-expr","locations":[{"start":{"line":19,"column":8},"end":{"line":19,"column":11}},{"start":{"line":19,"column":15},"end":{"line":19,"column":29}}],"line":19},"13":{"loc":{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},"type":"if","locations":[{"start":{"line":21,"column":4},"end":{"line":21,"column":141}},{"start":{"line":21,"column":4},"end":{"line":21,"column":141}}],"line":21},"14":{"loc":{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},"type":"if","locations":[{"start":{"line":21,"column":40},"end":{"line":21,"column":141}},{"start":{"line":21,"column":40},"end":{"line":21,"column":141}}],"line":21},"15":{"loc":{"start":{"line":21,"column":44},"end":{"line":21,"column":107}},"type":"binary-expr","locations":[{"start":{"line":21,"column":44},"end":{"line":21,"column":59}},{"start":{"line":21,"column":63},"end":{"line":21,"column":107}}],"line":21},"16":{"loc":{"start":{"line":25,"column":22},"end":{"line":27,"column":1}},"type":"binary-expr","locations":[{"start":{"line":25,"column":23},"end":{"line":25,"column":27}},{"start":{"line":25,"column":31},"end":{"line":25,"column":51}},{"start":{"line":25,"column":56},"end":{"line":27,"column":1}}],"line":25},"17":{"loc":{"start":{"line":26,"column":11},"end":{"line":26,"column":61}},"type":"cond-expr","locations":[{"start":{"line":26,"column":37},"end":{"line":26,"column":40}},{"start":{"line":26,"column":43},"end":{"line":26,"column":61}}],"line":26},"18":{"loc":{"start":{"line":26,"column":12},"end":{"line":26,"column":33}},"type":"binary-expr","locations":[{"start":{"line":26,"column":12},"end":{"line":26,"column":15}},{"start":{"line":26,"column":19},"end":{"line":26,"column":33}}],"line":26},"19":{"loc":{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},"type":"if","locations":[{"start":{"line":43,"column":8},"end":{"line":55,"column":9}},{"start":{"line":43,"column":8},"end":{"line":55,"column":9}}],"line":43},"20":{"loc":{"start":{"line":47,"column":25},"end":{"line":50,"column":32}},"type":"cond-expr","locations":[{"start":{"line":49,"column":20},"end":{"line":49,"column":43}},{"start":{"line":50,"column":18},"end":{"line":50,"column":32}}],"line":47},"21":{"loc":{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},"type":"if","locations":[{"start":{"line":60,"column":4},"end":{"line":65,"column":5}},{"start":{"line":60,"column":4},"end":{"line":65,"column":5}}],"line":60},"22":{"loc":{"start":{"line":60,"column":8},"end":{"line":60,"column":48}},"type":"binary-expr","locations":[{"start":{"line":60,"column":8},"end":{"line":60,"column":25}},{"start":{"line":60,"column":29},"end":{"line":60,"column":48}}],"line":60},"23":{"loc":{"start":{"line":62,"column":23},"end":{"line":62,"column":68}},"type":"binary-expr","locations":[{"start":{"line":62,"column":23},"end":{"line":62,"column":40}},{"start":{"line":62,"column":44},"end":{"line":62,"column":68}}],"line":62},"24":{"loc":{"start":{"line":63,"column":25},"end":{"line":63,"column":52}},"type":"binary-expr","locations":[{"start":{"line":63,"column":25},"end":{"line":63,"column":44}},{"start":{"line":63,"column":48},"end":{"line":63,"column":52}}],"line":63},"25":{"loc":{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},"type":"if","locations":[{"start":{"line":66,"column":4},"end":{"line":71,"column":5}},{"start":{"line":66,"column":4},"end":{"line":71,"column":5}}],"line":66},"26":{"loc":{"start":{"line":79,"column":18},"end":{"line":79,"column":45}},"type":"default-arg","locations":[{"start":{"line":79,"column":35},"end":{"line":79,"column":45}}],"line":79},"27":{"loc":{"start":{"line":79,"column":47},"end":{"line":79,"column":60}},"type":"default-arg","locations":[{"start":{"line":79,"column":53},"end":{"line":79,"column":60}}],"line":79},"28":{"loc":{"start":{"line":79,"column":62},"end":{"line":79,"column":79}},"type":"default-arg","locations":[{"start":{"line":79,"column":77},"end":{"line":79,"column":79}}],"line":79},"29":{"loc":{"start":{"line":79,"column":81},"end":{"line":79,"column":102}},"type":"default-arg","locations":[{"start":{"line":79,"column":94},"end":{"line":79,"column":102}}],"line":79},"30":{"loc":{"start":{"line":79,"column":104},"end":{"line":79,"column":127}},"type":"default-arg","locations":[{"start":{"line":79,"column":125},"end":{"line":79,"column":127}}],"line":79},"31":{"loc":{"start":{"line":79,"column":129},"end":{"line":79,"column":143}},"type":"default-arg","locations":[{"start":{"line":79,"column":142},"end":{"line":79,"column":143}}],"line":79},"32":{"loc":{"start":{"line":79,"column":145},"end":{"line":79,"column":161}},"type":"default-arg","locations":[{"start":{"line":79,"column":157},"end":{"line":79,"column":161}}],"line":79},"33":{"loc":{"start":{"line":106,"column":30},"end":{"line":106,"column":89}},"type":"binary-expr","locations":[{"start":{"line":106,"column":30},"end":{"line":106,"column":46}},{"start":{"line":106,"column":50},"end":{"line":106,"column":71}},{"start":{"line":106,"column":75},"end":{"line":106,"column":89}}],"line":106},"34":{"loc":{"start":{"line":107,"column":30},"end":{"line":108,"column":53}},"type":"binary-expr","locations":[{"start":{"line":107,"column":30},"end":{"line":107,"column":66}},{"start":{"line":108,"column":12},"end":{"line":108,"column":53}}],"line":107},"35":{"loc":{"start":{"line":109,"column":30},"end":{"line":109,"column":96}},"type":"binary-expr","locations":[{"start":{"line":109,"column":30},"end":{"line":109,"column":57}},{"start":{"line":109,"column":61},"end":{"line":109,"column":96}}],"line":109},"36":{"loc":{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":113,"column":8},"end":{"line":124,"column":9}},{"start":{"line":113,"column":8},"end":{"line":124,"column":9}}],"line":113},"37":{"loc":{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":116,"column":13},"end":{"line":124,"column":9}},{"start":{"line":116,"column":13},"end":{"line":124,"column":9}}],"line":116},"38":{"loc":{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},"type":"if","locations":[{"start":{"line":119,"column":13},"end":{"line":124,"column":9}},{"start":{"line":119,"column":13},"end":{"line":124,"column":9}}],"line":119},"39":{"loc":{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},"type":"if","locations":[{"start":{"line":135,"column":8},"end":{"line":137,"column":9}},{"start":{"line":135,"column":8},"end":{"line":137,"column":9}}],"line":135},"40":{"loc":{"start":{"line":148,"column":8},"end":{"line":168,"column":9}},"type":"switch","locations":[{"start":{"line":149,"column":12},"end":{"line":154,"column":19}},{"start":{"line":155,"column":12},"end":{"line":164,"column":41}},{"start":{"line":165,"column":12},"end":{"line":165,"column":28}},{"start":{"line":166,"column":12},"end":{"line":167,"column":41}}],"line":148},"41":{"loc":{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},"type":"if","locations":[{"start":{"line":171,"column":8},"end":{"line":174,"column":9}},{"start":{"line":171,"column":8},"end":{"line":174,"column":9}}],"line":171},"42":{"loc":{"start":{"line":171,"column":12},"end":{"line":172,"column":58}},"type":"binary-expr","locations":[{"start":{"line":171,"column":12},"end":{"line":171,"column":36}},{"start":{"line":172,"column":12},"end":{"line":172,"column":58}}],"line":171},"43":{"loc":{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},"type":"if","locations":[{"start":{"line":182,"column":8},"end":{"line":184,"column":9}},{"start":{"line":182,"column":8},"end":{"line":184,"column":9}}],"line":182},"44":{"loc":{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},"type":"if","locations":[{"start":{"line":192,"column":8},"end":{"line":198,"column":9}},{"start":{"line":192,"column":8},"end":{"line":198,"column":9}}],"line":192},"45":{"loc":{"start":{"line":192,"column":12},"end":{"line":192,"column":34}},"type":"binary-expr","locations":[{"start":{"line":192,"column":12},"end":{"line":192,"column":23}},{"start":{"line":192,"column":27},"end":{"line":192,"column":34}}],"line":192},"46":{"loc":{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},"type":"if","locations":[{"start":{"line":217,"column":16},"end":{"line":219,"column":17}},{"start":{"line":217,"column":16},"end":{"line":219,"column":17}}],"line":217},"47":{"loc":{"start":{"line":217,"column":20},"end":{"line":217,"column":42}},"type":"binary-expr","locations":[{"start":{"line":217,"column":20},"end":{"line":217,"column":31}},{"start":{"line":217,"column":35},"end":{"line":217,"column":42}}],"line":217},"48":{"loc":{"start":{"line":220,"column":26},"end":{"line":220,"column":89}},"type":"binary-expr","locations":[{"start":{"line":220,"column":26},"end":{"line":220,"column":33}},{"start":{"line":220,"column":37},"end":{"line":220,"column":89}}],"line":220},"49":{"loc":{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},"type":"if","locations":[{"start":{"line":221,"column":16},"end":{"line":223,"column":17}},{"start":{"line":221,"column":16},"end":{"line":223,"column":17}}],"line":221},"50":{"loc":{"start":{"line":221,"column":20},"end":{"line":221,"column":123}},"type":"binary-expr","locations":[{"start":{"line":221,"column":20},"end":{"line":221,"column":47}},{"start":{"line":221,"column":52},"end":{"line":221,"column":122}}],"line":221},"51":{"loc":{"start":{"line":221,"column":52},"end":{"line":221,"column":122}},"type":"cond-expr","locations":[{"start":{"line":221,"column":93},"end":{"line":221,"column":99}},{"start":{"line":221,"column":102},"end":{"line":221,"column":122}}],"line":221},"52":{"loc":{"start":{"line":221,"column":52},"end":{"line":221,"column":90}},"type":"binary-expr","locations":[{"start":{"line":221,"column":52},"end":{"line":221,"column":68}},{"start":{"line":221,"column":72},"end":{"line":221,"column":90}}],"line":221},"53":{"loc":{"start":{"line":225,"column":31},"end":{"line":225,"column":57}},"type":"cond-expr","locations":[{"start":{"line":225,"column":49},"end":{"line":225,"column":53}},{"start":{"line":225,"column":56},"end":{"line":225,"column":57}}],"line":225},"54":{"loc":{"start":{"line":237,"column":22},"end":{"line":237,"column":37}},"type":"default-arg","locations":[{"start":{"line":237,"column":33},"end":{"line":237,"column":37}}],"line":237},"55":{"loc":{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},"type":"if","locations":[{"start":{"line":245,"column":16},"end":{"line":248,"column":17}},{"start":{"line":245,"column":16},"end":{"line":248,"column":17}}],"line":245},"56":{"loc":{"start":{"line":245,"column":20},"end":{"line":245,"column":123}},"type":"binary-expr","locations":[{"start":{"line":245,"column":20},"end":{"line":245,"column":47}},{"start":{"line":245,"column":52},"end":{"line":245,"column":122}}],"line":245},"57":{"loc":{"start":{"line":245,"column":52},"end":{"line":245,"column":122}},"type":"cond-expr","locations":[{"start":{"line":245,"column":93},"end":{"line":245,"column":99}},{"start":{"line":245,"column":102},"end":{"line":245,"column":122}}],"line":245},"58":{"loc":{"start":{"line":245,"column":52},"end":{"line":245,"column":90}},"type":"binary-expr","locations":[{"start":{"line":245,"column":52},"end":{"line":245,"column":68}},{"start":{"line":245,"column":72},"end":{"line":245,"column":90}}],"line":245},"59":{"loc":{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},"type":"if","locations":[{"start":{"line":254,"column":16},"end":{"line":266,"column":17}},{"start":{"line":254,"column":16},"end":{"line":266,"column":17}}],"line":254},"60":{"loc":{"start":{"line":254,"column":20},"end":{"line":254,"column":139}},"type":"cond-expr","locations":[{"start":{"line":254,"column":120},"end":{"line":254,"column":126}},{"start":{"line":254,"column":129},"end":{"line":254,"column":139}}],"line":254},"61":{"loc":{"start":{"line":254,"column":20},"end":{"line":254,"column":117}},"type":"binary-expr","locations":[{"start":{"line":254,"column":20},"end":{"line":254,"column":100}},{"start":{"line":254,"column":104},"end":{"line":254,"column":117}}],"line":254},"62":{"loc":{"start":{"line":254,"column":26},"end":{"line":254,"column":90}},"type":"cond-expr","locations":[{"start":{"line":254,"column":67},"end":{"line":254,"column":73}},{"start":{"line":254,"column":76},"end":{"line":254,"column":90}}],"line":254},"63":{"loc":{"start":{"line":254,"column":26},"end":{"line":254,"column":64}},"type":"binary-expr","locations":[{"start":{"line":254,"column":26},"end":{"line":254,"column":42}},{"start":{"line":254,"column":46},"end":{"line":254,"column":64}}],"line":254},"64":{"loc":{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},"type":"if","locations":[{"start":{"line":268,"column":16},"end":{"line":270,"column":17}},{"start":{"line":268,"column":16},"end":{"line":270,"column":17}}],"line":268},"65":{"loc":{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},"type":"if","locations":[{"start":{"line":271,"column":16},"end":{"line":277,"column":17}},{"start":{"line":271,"column":16},"end":{"line":277,"column":17}}],"line":271},"66":{"loc":{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},"type":"if","locations":[{"start":{"line":283,"column":16},"end":{"line":288,"column":17}},{"start":{"line":283,"column":16},"end":{"line":288,"column":17}}],"line":283},"67":{"loc":{"start":{"line":297,"column":24},"end":{"line":297,"column":39}},"type":"default-arg","locations":[{"start":{"line":297,"column":35},"end":{"line":297,"column":39}}],"line":297},"68":{"loc":{"start":{"line":305,"column":37},"end":{"line":307,"column":23}},"type":"cond-expr","locations":[{"start":{"line":306,"column":22},"end":{"line":306,"column":52}},{"start":{"line":307,"column":22},"end":{"line":307,"column":23}}],"line":305},"69":{"loc":{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},"type":"if","locations":[{"start":{"line":312,"column":16},"end":{"line":319,"column":17}},{"start":{"line":312,"column":16},"end":{"line":319,"column":17}}],"line":312},"70":{"loc":{"start":{"line":312,"column":20},"end":{"line":312,"column":54}},"type":"binary-expr","locations":[{"start":{"line":312,"column":20},"end":{"line":312,"column":34}},{"start":{"line":312,"column":38},"end":{"line":312,"column":54}}],"line":312},"71":{"loc":{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},"type":"if","locations":[{"start":{"line":314,"column":20},"end":{"line":317,"column":21}},{"start":{"line":314,"column":20},"end":{"line":317,"column":21}}],"line":314},"72":{"loc":{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},"type":"if","locations":[{"start":{"line":320,"column":16},"end":{"line":325,"column":17}},{"start":{"line":320,"column":16},"end":{"line":325,"column":17}}],"line":320},"73":{"loc":{"start":{"line":320,"column":20},"end":{"line":320,"column":139}},"type":"cond-expr","locations":[{"start":{"line":320,"column":120},"end":{"line":320,"column":126}},{"start":{"line":320,"column":129},"end":{"line":320,"column":139}}],"line":320},"74":{"loc":{"start":{"line":320,"column":20},"end":{"line":320,"column":117}},"type":"binary-expr","locations":[{"start":{"line":320,"column":20},"end":{"line":320,"column":100}},{"start":{"line":320,"column":104},"end":{"line":320,"column":117}}],"line":320},"75":{"loc":{"start":{"line":320,"column":26},"end":{"line":320,"column":90}},"type":"cond-expr","locations":[{"start":{"line":320,"column":67},"end":{"line":320,"column":73}},{"start":{"line":320,"column":76},"end":{"line":320,"column":90}}],"line":320},"76":{"loc":{"start":{"line":320,"column":26},"end":{"line":320,"column":64}},"type":"binary-expr","locations":[{"start":{"line":320,"column":26},"end":{"line":320,"column":42}},{"start":{"line":320,"column":46},"end":{"line":320,"column":64}}],"line":320},"77":{"loc":{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},"type":"if","locations":[{"start":{"line":328,"column":16},"end":{"line":334,"column":17}},{"start":{"line":328,"column":16},"end":{"line":334,"column":17}}],"line":328},"78":{"loc":{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},"type":"if","locations":[{"start":{"line":358,"column":20},"end":{"line":360,"column":21}},{"start":{"line":358,"column":20},"end":{"line":360,"column":21}}],"line":358},"79":{"loc":{"start":{"line":358,"column":24},"end":{"line":358,"column":46}},"type":"binary-expr","locations":[{"start":{"line":358,"column":24},"end":{"line":358,"column":35}},{"start":{"line":358,"column":39},"end":{"line":358,"column":46}}],"line":358},"80":{"loc":{"start":{"line":375,"column":17},"end":{"line":375,"column":32}},"type":"default-arg","locations":[{"start":{"line":375,"column":28},"end":{"line":375,"column":32}}],"line":375},"81":{"loc":{"start":{"line":399,"column":10},"end":{"line":399,"column":25}},"type":"default-arg","locations":[{"start":{"line":399,"column":21},"end":{"line":399,"column":25}}],"line":399}},"s":{"0":1,"1":4,"2":4,"3":4,"4":4,"5":4,"6":1,"7":4,"8":0,"9":0,"10":0,"11":1,"12":1,"13":0,"14":1,"15":1,"16":0,"17":1,"18":1,"19":1,"20":4,"21":4,"22":1,"23":1,"24":1,"25":2,"26":1,"27":1,"28":1,"29":1,"30":1,"31":1,"32":1,"33":1,"34":1,"35":0,"36":0,"37":0,"38":0,"39":0,"40":0,"41":0,"42":1,"43":0,"44":1,"45":0,"46":1,"47":1,"48":1,"49":1,"50":1,"51":1,"52":1,"53":1,"54":1,"55":1,"56":1,"57":0,"58":0,"59":0,"60":0,"61":0,"62":1,"63":1,"64":1,"65":1,"66":0,"67":0,"68":0,"69":1,"70":0,"71":1,"72":0,"73":0,"74":0,"75":0,"76":0,"77":0,"78":0,"79":0,"80":0,"81":0,"82":0,"83":0,"84":0,"85":0,"86":0,"87":0,"88":0,"89":0,"90":0,"91":0,"92":0,"93":0,"94":0,"95":0,"96":0,"97":0,"98":0,"99":0,"100":0,"101":0,"102":0,"103":0,"104":0,"105":0,"106":0,"107":0,"108":0,"109":0,"110":0,"111":0,"112":0,"113":0,"114":0,"115":0,"116":0,"117":0,"118":0,"119":0,"120":0,"121":0,"122":0,"123":0,"124":0,"125":0,"126":0,"127":0,"128":0,"129":0,"130":0,"131":0,"132":0,"133":0,"134":0,"135":0,"136":0,"137":0,"138":0,"139":0,"140":0,"141":0,"142":0,"143":0,"144":0,"145":0,"146":0,"147":0,"148":0,"149":0,"150":0,"151":0,"152":0,"153":0,"154":0,"155":0,"156":0,"157":0,"158":0,"159":0,"160":0,"161":0,"162":0,"163":0,"164":0,"165":0,"166":0,"167":0,"168":0,"169":0,"170":0,"171":0,"172":0,"173":0,"174":0,"175":0,"176":0,"177":0,"178":1,"179":1,"180":0,"181":0,"182":1,"183":0,"184":0,"185":0,"186":1},"f":{"0":4,"1":1,"2":0,"3":1,"4":0,"5":1,"6":2,"7":0,"8":0,"9":0,"10":1,"11":1,"12":0,"13":1,"14":0,"15":0,"16":0,"17":0,"18":0,"19":0,"20":0,"21":0,"22":0,"23":0,"24":0,"25":0,"26":0,"27":0,"28":0,"29":0,"30":0,"31":0,"32":0,"33":0,"34":0,"35":0,"36":0,"37":0,"38":0,"39":1,"40":0,"41":0,"42":1,"43":0,"44":0},"b":{"0":[1,1,1],"1":[1,0],"2":[4,0],"3":[4,0],"4":[4,4],"5":[0,4],"6":[4,0],"7":[0,0],"8":[1,1,1],"9":[1,0],"10":[1,1,1],"11":[0,1],"12":[1,1],"13":[1,0],"14":[4,0],"15":[4,4],"16":[1,1,1],"17":[0,2],"18":[2,2],"19":[0,0],"20":[0,0],"21":[0,1],"22":[1,1],"23":[0,0],"24":[0,0],"25":[0,1],"26":[0],"27":[1],"28":[0],"29":[1],"30":[1],"31":[1],"32":[1],"33":[1,0,0],"34":[1,1],"35":[1,1],"36":[1,0],"37":[0,0],"38":[0,0],"39":[0,1],"40":[0,0,0,0],"41":[0,0],"42":[0,0],"43":[0,0],"44":[0,0],"45":[0,0],"46":[0,0],"47":[0,0],"48":[0,0],"49":[0,0],"50":[0,0],"51":[0,0],"52":[0,0],"53":[0,0],"54":[0],"55":[0,0],"56":[0,0],"57":[0,0],"58":[0,0],"59":[0,0],"60":[0,0],"61":[0,0],"62":[0,0],"63":[0,0],"64":[0,0],"65":[0,0],"66":[0,0],"67":[0],"68":[0,0],"69":[0,0],"70":[0,0],"71":[0,0],"72":[0,0],"73":[0,0],"74":[0,0],"75":[0,0],"76":[0,0],"77":[0,0],"78":[0,0],"79":[0,0],"80":[0],"81":[0]},"inputSourceMap":{"version":3,"file":"MongoStore.js","sourceRoot":"","sources":["../../../src/lib/MongoStore.ts"],"names":[],"mappings":";;;;;;;;;;;;;;;;;;;;;;;;;;;;AAAA,qCAAgC;AAChC,gDAAuB;AACvB,yDAA0C;AAC1C,qCAKgB;AAChB,kDAAyB;AAGzB,MAAM,KAAK,GAAG,IAAA,eAAK,EAAC,eAAe,CAAC,CAAA;AAgEpC,gEAAgE;AAChE,MAAM,IAAI,GAAG,GAAG,EAAE,GAAE,CAAC,CAAA;AACrB,MAAM,IAAI,GAAmB,CAAC,CAAC,EAAE,EAAE,CAAC,CAAC,CAAA;AAErC,SAAS,wBAAwB,CAC/B,OAA4B;IAE5B,oDAAoD;IACpD,MAAM,GAAG,GAAG,EAAE,CAAA;IACd,IAAI,IAAI,CAAA;IACR,KAAK,IAAI,IAAI,OAAO,EAAE;QACpB,IAAI,IAAI,KAAK,QAAQ,EAAE;YACrB,wDAAwD;YACxD,2EAA2E;YAC3E,oBAAoB;YACpB,GAAG,CAAC,MAAM,GAAG,OAAO,CAAC,MAAM,CAAC,MAAM;gBAChC,CAAC,CAAC,oBAAoB;oBACpB,OAAO,CAAC,MAAM,CAAC,MAAM,EAAE;gBACzB,CAAC,CAAC,OAAO,CAAC,MAAM,CAAA;SACnB;aAAM;YACL,oBAAoB;YACpB,GAAG,CAAC,IAAI,CAAC,GAAG,OAAO,CAAC,IAAI,CAAC,CAAA;SAC1B;KACF;IAED,OAAO,GAA0B,CAAA;AACnC,CAAC;AAED,SAAS,yBAAyB,CAAC,OAAmC;IACpE,IAAI,OAAO,CAAC,SAAS,IAAI,OAAO,CAAC,WAAW,EAAE;QAC5C,OAAO;YACL,SAAS,EAAE,OAAO,CAAC,SAAS,IAAI,wBAAwB;YACxD,WAAW,EAAE,OAAO,CAAC,WAAW,IAAI,IAAI;SACzC,CAAA;KACF;IAED,IAAI,OAAO,CAAC,SAAS,KAAK,KAAK,EAAE;QAC/B,OAAO;YACL,SAAS,EAAE,wBAAwB;YACnC,WAAW,EAAE,IAAI;SAClB,CAAA;KACF;IACD,eAAe;IACf,OAAO;QACL,SAAS,EAAE,IAAI,CAAC,SAAS;QACzB,WAAW,EAAE,IAAI,CAAC,KAAK;KACxB,CAAA;AACH,CAAC;AAED,MAAqB,UAAW,SAAQ,OAAO,CAAC,KAAK;IAYnD,YAAY,EACV,cAAc,GAAG,UAAU,EAC3B,GAAG,GAAG,OAAO,EACb,YAAY,GAAG,EAAE,EACjB,UAAU,GAAG,QAAQ,EACrB,kBAAkB,GAAG,EAAE,EACvB,UAAU,GAAG,CAAC,EACd,SAAS,GAAG,IAAI,EAChB,MAAM,EACN,GAAG,QAAQ,EACS;QACpB,KAAK,EAAE,CAAA;QArBD,WAAM,GAAoB,IAAI,CAAA;QAsBpC,KAAK,CAAC,4BAA4B,CAAC,CAAA;QACnC,MAAM,OAAO,GAA+B;YAC1C,cAAc;YACd,GAAG;YACH,YAAY;YACZ,UAAU;YACV,kBAAkB;YAClB,UAAU;YACV,SAAS;YACT,MAAM,EAAE;gBACN,GAAG;oBACD,MAAM,EAAE,KAAK;oBACb,SAAS,EAAE,aAAa;oBACxB,OAAO,EAAE,QAAQ;oBACjB,QAAQ,EAAE,QAAQ;oBAClB,QAAQ,EAAE,EAAE;oBACZ,OAAO,EAAE,EAAE;oBACX,OAAO,EAAE,EAAE;iBACZ;gBACD,GAAG,MAAM;aACV;YACD,GAAG,QAAQ;SACZ,CAAA;QACD,eAAe;QACf,IAAA,gBAAM,EACJ,OAAO,CAAC,QAAQ,IAAI,OAAO,CAAC,aAAa,IAAI,OAAO,CAAC,MAAM,EAC3D,kEAAkE,CACnE,CAAA;QACD,IAAA,gBAAM,EACJ,OAAO,CAAC,mBAAmB,KAAK,IAAI;YAClC,OAAO,CAAC,mBAAmB,KAAK,SAAS,EAC3C,oFAAoF,CACrF,CAAA;QACD,IAAA,gBAAM,EACJ,CAAC,OAAO,CAAC,kBAAkB,IAAI,OAAO,CAAC,kBAAkB,IAAI,KAAK;QAClE,yCAAyC,CAAC,qGAAqG,CAChJ,CAAA;QACD,IAAI,CAAC,kBAAkB,GAAG,yBAAyB,CAAC,OAAO,CAAC,CAAA;QAC5D,IAAI,QAA8B,CAAA;QAClC,IAAI,OAAO,CAAC,QAAQ,EAAE;YACpB,QAAQ,GAAG,qBAAW,CAAC,OAAO,CAAC,OAAO,CAAC,QAAQ,EAAE,OAAO,CAAC,YAAY,CAAC,CAAA;SACvE;aAAM,IAAI,OAAO,CAAC,aAAa,EAAE;YAChC,QAAQ,GAAG,OAAO,CAAC,aAAa,CAAA;SACjC;aAAM,IAAI,OAAO,CAAC,MAAM,EAAE;YACzB,QAAQ,GAAG,OAAO,CAAC,OAAO,CAAC,OAAO,CAAC,MAAM,CAAC,CAAA;SAC3C;aAAM;YACL,MAAM,IAAI,KAAK,CAAC,oDAAoD,CAAC,CAAA;SACtE;QACD,IAAA,gBAAM,EAAC,CAAC,CAAC,QAAQ,EAAE,0BAA0B,CAAC,CAAA;QAC9C,IAAI,CAAC,OAAO,GAAG,QAAQ,CAAA;QACvB,IAAI,CAAC,OAAO,GAAG,OAAO,CAAA;QACtB,IAAI,CAAC,WAAW,GAAG,QAAQ,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,EAAE,EAAE;YAC7C,MAAM,UAAU,GAAG,GAAG;iBACnB,EAAE,CAAC,OAAO,CAAC,MAAM,CAAC;iBAClB,UAAU,CAAsB,OAAO,CAAC,cAAc,CAAC,CAAA;YAC1D,MAAM,IAAI,CAAC,aAAa,CAAC,UAAU,CAAC,CAAA;YACpC,OAAO,UAAU,CAAA;QACnB,CAAC,CAAC,CAAA;QACF,IAAI,OAAO,CAAC,MAAM,CAAC,MAAM,EAAE;YACzB,IAAI,CAAC,MAAM,GAAG,OAAO,CAAC,UAAU,CAAC,CAAC,OAAO,CAAC,MAAM,CAAC,CAAA;SAClD;IACH,CAAC;IAED,MAAM,CAAC,MAAM,CAAC,OAA4B;QACxC,OAAO,IAAI,UAAU,CAAC,OAAO,CAAC,CAAA;IAChC,CAAC;IAEO,aAAa,CACnB,UAA2C;QAE3C,MAAM,WAAW,GAAG,GAAG,EAAE,CAAC,CAAC;YACzB,OAAO,EAAE;gBACP,GAAG,EAAE,IAAI,IAAI,EAAE;aAChB;SACF,CAAC,CAAA;QACF,QAAQ,IAAI,CAAC,OAAO,CAAC,UAAU,EAAE;YAC/B,KAAK,QAAQ;gBACX,KAAK,CAAC,4BAA4B,CAAC,CAAA;gBACnC,OAAO,UAAU,CAAC,WAAW,CAC3B,EAAE,OAAO,EAAE,CAAC,EAAE,EACd;oBACE,UAAU,EAAE,IAAI;oBAChB,kBAAkB,EAAE,CAAC;iBACtB,CACF,CAAA;YACH,KAAK,UAAU;gBACb,KAAK,CAAC,yCAAyC,CAAC,CAAA;gBAChD,IAAI,CAAC,KAAK,GAAG,WAAW,CACtB,GAAG,EAAE,CACH,UAAU,CAAC,UAAU,CAAC,WAAW,EAAE,EAAE;oBACnC,YAAY,EAAE;wBACZ,CAAC,EAAE,CAAC;wBACJ,CAAC,EAAE,KAAK;qBACT;iBACF,CAAC,EACJ,IAAI,CAAC,OAAO,CAAC,kBAAkB,GAAG,IAAI,GAAG,EAAE,CAC5C,CAAA;gBACD,IAAI,CAAC,KAAK,CAAC,KAAK,EAAE,CAAA;gBAClB,OAAO,OAAO,CAAC,OAAO,EAAE,CAAA;YAC1B,KAAK,UAAU,CAAC;YAChB;gBACE,OAAO,OAAO,CAAC,OAAO,EAAE,CAAA;SAC3B;IACH,CAAC;IAEO,gBAAgB,CAAC,SAAiB;QACxC,IACE,IAAI,CAAC,OAAO,CAAC,WAAW;YACxB,OAAO,IAAI,CAAC,OAAO,CAAC,WAAW,KAAK,UAAU,EAC9C;YACA,OAAO,IAAI,CAAC,OAAO,CAAC,WAAW,CAAC,SAAS,CAAC,CAAA;SAC3C;QACD,OAAO,SAAS,CAAA;IAClB,CAAC;IAED;;;OAGG;IACH,IAAY,SAAS;QACnB,IAAI,CAAC,IAAI,CAAC,MAAM,EAAE;YAChB,MAAM,IAAI,KAAK,CAAC,kDAAkD,CAAC,CAAA;SACpE;QACD,OAAO,cAAI,CAAC,SAAS,CAAC,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,CAAC,CAAA;IAC1D,CAAC;IAED;;;OAGG;IACK,KAAK,CAAC,cAAc,CAC1B,OAA+C;QAE/C,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;YAC1B,MAAM,SAAS,GAAG,MAAM,IAAI,CAAC,SAAS,CACpC,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,MAAgB,EACpC,OAAO,CAAC,OAAO,CAChB,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE;gBACd,MAAM,IAAI,KAAK,CAAC,GAAG,CAAC,CAAA;YACtB,CAAC,CAAC,CAAA;YACF,aAAa;YACb,OAAO,CAAC,OAAO,GAAG,IAAI,CAAC,KAAK,CAAC,SAAS,CAAC,CAAA;SACxC;IACH,CAAC;IAED;;;OAGG;IACH,GAAG,CACD,GAAW,EACX,QAAkE;QAElE,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,GAAG,EAAE,CAAC,CAAA;gBAC9B,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,OAAO,CAAC;oBACvC,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC;oBAC/B,GAAG,EAAE;wBACH,EAAE,OAAO,EAAE,EAAE,OAAO,EAAE,KAAK,EAAE,EAAE;wBAC/B,EAAE,OAAO,EAAE,EAAE,GAAG,EAAE,IAAI,IAAI,EAAE,EAAE,EAAE;qBACjC;iBACF,CAAC,CAAA;gBACF,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;oBAC1B,MAAM,IAAI,CAAC,cAAc,CACvB,OAAyC,CAC1C,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;iBAChC;gBACD,MAAM,CAAC,GACL,OAAO,IAAI,IAAI,CAAC,kBAAkB,CAAC,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAA;gBACjE,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,KAAI,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,CAAA,EAAE;oBACxD,CAAC,CAAC,YAAY,GAAG,OAAO,CAAC,YAAY,CAAA;iBACtC;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,CAAC,CAAA;gBACrB,QAAQ,CAAC,IAAI,EAAE,CAAC,KAAK,SAAS,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC,CAAA;aAC3C;YAAC,OAAO,KAAK,EAAE;gBACd,QAAQ,CAAC,KAAK,CAAC,CAAA;aAChB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;;;OAIG;IACH,GAAG,CACD,GAAW,EACX,OAA4B,EAC5B,WAA+B,IAAI;QAEnC,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,GAAG,EAAE,CAAC,CAAA;gBAC9B,uEAAuE;gBACvE,aAAa;gBACb,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,KAAI,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,YAAY,CAAA,EAAE;oBACxD,aAAa;oBACb,OAAO,OAAO,CAAC,YAAY,CAAA;iBAC5B;gBACD,MAAM,CAAC,GAAwB;oBAC7B,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC;oBAC/B,OAAO,EAAE,IAAI,CAAC,kBAAkB,CAAC,SAAS,CAAC,OAAO,CAAC;iBACpD,CAAA;gBACD,kBAAkB;gBAClB,IAAI,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,MAAM,0CAAE,OAAO,EAAE;oBAC5B,CAAC,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;iBAC7C;qBAAM;oBACL,iDAAiD;oBACjD,uDAAuD;oBACvD,2BAA2B;oBAC3B,EAAE;oBACF,iDAAiD;oBACjD,yDAAyD;oBACzD,2CAA2C;oBAC3C,CAAC,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,IAAI,CAAC,GAAG,EAAE,GAAG,IAAI,CAAC,OAAO,CAAC,GAAG,GAAG,IAAI,CAAC,CAAA;iBAC3D;gBACD,uBAAuB;gBACvB,IAAI,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,CAAC,EAAE;oBAC/B,CAAC,CAAC,YAAY,GAAG,IAAI,IAAI,EAAE,CAAA;iBAC5B;gBACD,IAAI,IAAI,CAAC,MAAM,EAAE;oBACf,MAAM,SAAS,GAAG,cAAI,CAAC,SAAS,CAAC,IAAI,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,IAAI,CAAC,MAAM,CAAC,CAAA;oBACnE,MAAM,IAAI,GAAG,MAAM,SAAS,CAC1B,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,MAAgB,EACpC,CAAC,CAAC,OAAO,CACV,CAAC,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE;wBACd,MAAM,IAAI,KAAK,CAAC,GAAG,CAAC,CAAA;oBACtB,CAAC,CAAC,CAAA;oBACF,CAAC,CAAC,OAAO,GAAG,IAAsC,CAAA;iBACnD;gBACD,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,SAAS,CACxC,EAAE,GAAG,EAAE,CAAC,CAAC,GAAG,EAAE,EACd,EAAE,IAAI,EAAE,CAAC,EAAE,EACX;oBACE,MAAM,EAAE,IAAI;oBACZ,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB;iBACjD,CACF,CAAA;gBACD,IAAI,OAAO,CAAC,aAAa,GAAG,CAAC,EAAE;oBAC7B,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,GAAG,CAAC,CAAA;iBACzB;qBAAM;oBACL,IAAI,CAAC,IAAI,CAAC,QAAQ,EAAE,GAAG,CAAC,CAAA;iBACzB;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,GAAG,CAAC,CAAA;aACtB;YAAC,OAAO,KAAK,EAAE;gBACd,OAAO,QAAQ,CAAC,KAAK,CAAC,CAAA;aACvB;YACD,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;QACvB,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED,KAAK,CACH,GAAW,EACX,OAAsD,EACtD,WAA+B,IAAI;QAEnC,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;;YACX,IAAI;gBACF,KAAK,CAAC,oBAAoB,GAAG,EAAE,CAAC,CAAA;gBAChC,MAAM,YAAY,GAId,EAAE,CAAA;gBACN,MAAM,UAAU,GAAG,IAAI,CAAC,OAAO,CAAC,UAAU,GAAG,IAAI,CAAA;gBACjD,MAAM,YAAY,GAAG,OAAO,CAAC,YAAY;oBACvC,CAAC,CAAC,OAAO,CAAC,YAAY,CAAC,OAAO,EAAE;oBAChC,CAAC,CAAC,CAAC,CAAA;gBACL,MAAM,WAAW,GAAG,IAAI,IAAI,EAAE,CAAA;gBAE9B,+DAA+D;gBAC/D,4DAA4D;gBAC5D,sDAAsD;gBACtD,IAAI,UAAU,GAAG,CAAC,IAAI,YAAY,GAAG,CAAC,EAAE;oBACtC,MAAM,WAAW,GAAG,WAAW,CAAC,OAAO,EAAE,GAAG,YAAY,CAAA;oBACxD,IAAI,WAAW,GAAG,UAAU,EAAE;wBAC5B,KAAK,CAAC,yBAAyB,GAAG,EAAE,CAAC,CAAA;wBACrC,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;qBACtB;oBACD,YAAY,CAAC,YAAY,GAAG,WAAW,CAAA;iBACxC;gBAED,IAAI,MAAA,OAAO,aAAP,OAAO,uBAAP,OAAO,CAAE,MAAM,0CAAE,OAAO,EAAE;oBAC5B,YAAY,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,OAAO,CAAC,MAAM,CAAC,OAAO,CAAC,CAAA;iBACxD;qBAAM;oBACL,YAAY,CAAC,OAAO,GAAG,IAAI,IAAI,CAAC,IAAI,CAAC,GAAG,EAAE,GAAG,IAAI,CAAC,OAAO,CAAC,GAAG,GAAG,IAAI,CAAC,CAAA;iBACtE;gBACD,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,OAAO,GAAG,MAAM,UAAU,CAAC,SAAS,CACxC,EAAE,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC,EAAE,EACnC,EAAE,IAAI,EAAE,YAAY,EAAE,EACtB,EAAE,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB,EAAE,CACrD,CAAA;gBACD,IAAI,OAAO,CAAC,YAAY,KAAK,CAAC,EAAE;oBAC9B,OAAO,QAAQ,CAAC,IAAI,KAAK,CAAC,qCAAqC,CAAC,CAAC,CAAA;iBAClE;qBAAM;oBACL,IAAI,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,EAAE,OAAO,CAAC,CAAA;oBAChC,OAAO,QAAQ,CAAC,IAAI,CAAC,CAAA;iBACtB;aACF;YAAC,OAAO,KAAK,EAAE;gBACd,OAAO,QAAQ,CAAC,KAAK,CAAC,CAAA;aACvB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;OAEG;IACH,GAAG,CACD,QAMS;QAET,CAAC;QAAA,CAAC,KAAK,IAAI,EAAE;YACX,IAAI;gBACF,KAAK,CAAC,kBAAkB,CAAC,CAAA;gBACzB,MAAM,UAAU,GAAG,MAAM,IAAI,CAAC,WAAW,CAAA;gBACzC,MAAM,QAAQ,GAAG,UAAU,CAAC,IAAI,CAAC;oBAC/B,GAAG,EAAE;wBACH,EAAE,OAAO,EAAE,EAAE,OAAO,EAAE,KAAK,EAAE,EAAE;wBAC/B,EAAE,OAAO,EAAE,EAAE,GAAG,EAAE,IAAI,IAAI,EAAE,EAAE,EAAE;qBACjC;iBACF,CAAC,CAAA;gBACF,MAAM,OAAO,GAA0B,EAAE,CAAA;gBACzC,IAAI,KAAK,EAAE,MAAM,OAAO,IAAI,QAAQ,EAAE;oBACpC,IAAI,IAAI,CAAC,MAAM,IAAI,OAAO,EAAE;wBAC1B,MAAM,IAAI,CAAC,cAAc,CAAC,OAAyC,CAAC,CAAA;qBACrE;oBACD,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,kBAAkB,CAAC,WAAW,CAAC,OAAO,CAAC,OAAO,CAAC,CAAC,CAAA;iBACnE;gBACD,IAAI,CAAC,IAAI,CAAC,KAAK,EAAE,OAAO,CAAC,CAAA;gBACzB,QAAQ,CAAC,IAAI,EAAE,OAAO,CAAC,CAAA;aACxB;YAAC,OAAO,KAAK,EAAE;gBACd,QAAQ,CAAC,KAAK,CAAC,CAAA;aAChB;QACH,CAAC,CAAC,EAAE,CAAA;IACN,CAAC;IAED;;;OAGG;IACH,OAAO,CAAC,GAAW,EAAE,WAA+B,IAAI;QACtD,KAAK,CAAC,sBAAsB,GAAG,EAAE,CAAC,CAAA;QAClC,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CACnB,UAAU,CAAC,SAAS,CAClB,EAAE,GAAG,EAAE,IAAI,CAAC,gBAAgB,CAAC,GAAG,CAAC,EAAE,EACnC,EAAE,YAAY,EAAE,IAAI,CAAC,OAAO,CAAC,qBAAqB,EAAE,CACrD,CACF;aACA,IAAI,CAAC,GAAG,EAAE;YACT,IAAI,CAAC,IAAI,CAAC,SAAS,EAAE,GAAG,CAAC,CAAA;YACzB,QAAQ,CAAC,IAAI,CAAC,CAAA;QAChB,CAAC,CAAC;aACD,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,MAAM,CAAC,QAA4C;QACjD,KAAK,CAAC,qBAAqB,CAAC,CAAA;QAC5B,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CAAC,UAAU,CAAC,cAAc,EAAE,CAAC;aACjD,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,QAAQ,CAAC,IAAI,EAAE,CAAC,CAAC,CAAC;YAC/B,aAAa;aACZ,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,KAAK,CAAC,WAA+B,IAAI;QACvC,KAAK,CAAC,oBAAoB,CAAC,CAAA;QAC3B,IAAI,CAAC,WAAW;aACb,IAAI,CAAC,CAAC,UAAU,EAAE,EAAE,CAAC,UAAU,CAAC,IAAI,EAAE,CAAC;aACvC,IAAI,CAAC,GAAG,EAAE,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC;aAC1B,KAAK,CAAC,CAAC,GAAG,EAAE,EAAE,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC,CAAA;IAClC,CAAC;IAED;;OAEG;IACH,KAAK;QACH,KAAK,CAAC,oBAAoB,CAAC,CAAA;QAC3B,OAAO,IAAI,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,CAAC,CAAC,KAAK,EAAE,CAAC,CAAA;IAC5C,CAAC;CACF;AAnaD,6BAmaC"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"20eabd216415cd719c2a4e898ac63b448cf93fc9"},"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/testHelper.js":{"path":"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/testHelper.js","statementMap":{"0":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"1":{"start":{"line":3,"column":4},"end":{"line":3,"column":62}},"2":{"start":{"line":5,"column":0},"end":{"line":5,"column":62}},"3":{"start":{"line":6,"column":0},"end":{"line":6,"column":102}},"4":{"start":{"line":9,"column":15},"end":{"line":9,"column":47}},"5":{"start":{"line":10,"column":26},"end":{"line":10,"column":69}},"6":{"start":{"line":11,"column":21},"end":{"line":11,"column":66}},"7":{"start":{"line":13,"column":19},"end":{"line":20,"column":1}},"8":{"start":{"line":14,"column":19},"end":{"line":14,"column":57}},"9":{"start":{"line":15,"column":4},"end":{"line":15,"column":26}},"10":{"start":{"line":16,"column":4},"end":{"line":16,"column":25}},"11":{"start":{"line":17,"column":4},"end":{"line":17,"column":30}},"12":{"start":{"line":18,"column":4},"end":{"line":18,"column":28}},"13":{"start":{"line":19,"column":4},"end":{"line":19,"column":18}},"14":{"start":{"line":21,"column":0},"end":{"line":21,"column":32}},"15":{"start":{"line":23,"column":17},"end":{"line":33,"column":1}},"16":{"start":{"line":24,"column":4},"end":{"line":32,"column":6}},"17":{"start":{"line":34,"column":0},"end":{"line":34,"column":28}},"18":{"start":{"line":35,"column":25},"end":{"line":45,"column":1}},"19":{"start":{"line":36,"column":4},"end":{"line":44,"column":6}},"20":{"start":{"line":46,"column":0},"end":{"line":46,"column":44}},"21":{"start":{"line":47,"column":26},"end":{"line":66,"column":1}},"22":{"start":{"line":48,"column":18},"end":{"line":54,"column":6}},"23":{"start":{"line":55,"column":25},"end":{"line":64,"column":5}},"24":{"start":{"line":65,"column":4},"end":{"line":65,"column":35}},"25":{"start":{"line":67,"column":0},"end":{"line":67,"column":46}}},"fnMap":{"0":{"name":"(anonymous_0)","decl":{"start":{"line":2,"column":56},"end":{"line":2,"column":57}},"loc":{"start":{"line":2,"column":71},"end":{"line":4,"column":1}},"line":2},"1":{"name":"(anonymous_1)","decl":{"start":{"line":13,"column":19},"end":{"line":13,"column":20}},"loc":{"start":{"line":13,"column":25},"end":{"line":20,"column":1}},"line":13},"2":{"name":"(anonymous_2)","decl":{"start":{"line":23,"column":17},"end":{"line":23,"column":18}},"loc":{"start":{"line":23,"column":23},"end":{"line":33,"column":1}},"line":23},"3":{"name":"(anonymous_3)","decl":{"start":{"line":35,"column":25},"end":{"line":35,"column":26}},"loc":{"start":{"line":35,"column":31},"end":{"line":45,"column":1}},"line":35},"4":{"name":"(anonymous_4)","decl":{"start":{"line":47,"column":26},"end":{"line":47,"column":27}},"loc":{"start":{"line":47,"column":40},"end":{"line":66,"column":1}},"line":47}},"branchMap":{"0":{"loc":{"start":{"line":2,"column":22},"end":{"line":4,"column":1}},"type":"binary-expr","locations":[{"start":{"line":2,"column":23},"end":{"line":2,"column":27}},{"start":{"line":2,"column":31},"end":{"line":2,"column":51}},{"start":{"line":2,"column":56},"end":{"line":4,"column":1}}],"line":2},"1":{"loc":{"start":{"line":3,"column":11},"end":{"line":3,"column":61}},"type":"cond-expr","locations":[{"start":{"line":3,"column":37},"end":{"line":3,"column":40}},{"start":{"line":3,"column":43},"end":{"line":3,"column":61}}],"line":3},"2":{"loc":{"start":{"line":3,"column":12},"end":{"line":3,"column":33}},"type":"binary-expr","locations":[{"start":{"line":3,"column":12},"end":{"line":3,"column":15}},{"start":{"line":3,"column":19},"end":{"line":3,"column":33}}],"line":3},"3":{"loc":{"start":{"line":47,"column":27},"end":{"line":47,"column":35}},"type":"default-arg","locations":[{"start":{"line":47,"column":33},"end":{"line":47,"column":35}}],"line":47}},"s":{"0":1,"1":3,"2":1,"3":1,"4":1,"5":1,"6":1,"7":1,"8":0,"9":0,"10":0,"11":0,"12":0,"13":0,"14":1,"15":1,"16":0,"17":1,"18":1,"19":0,"20":1,"21":1,"22":1,"23":1,"24":1,"25":1},"f":{"0":3,"1":0,"2":0,"3":0,"4":1},"b":{"0":[1,1,1],"1":[1,2],"2":[3,3],"3":[1]},"inputSourceMap":{"version":3,"file":"testHelper.js","sourceRoot":"","sources":["../../../src/test/testHelper.ts"],"names":[],"mappings":";;;;;;AAAA,+DAA+D;AAC/D,sEAAsE;AACtE,gDAAuB;AACvB,sEAA4C;AAE5C,mEAAmE;AAEnE,mCAAmC;AAC5B,MAAM,UAAU,GAAG,GAAG,EAAE;IAC7B,MAAM,MAAM,GAAG,IAAI,yBAAc,CAAC,MAAM,EAAE,CAAA;IAC1C,MAAM,CAAC,MAAM,GAAG,KAAK,CAAA,CAAC,2CAA2C;IACjE,MAAM,CAAC,MAAM,GAAG,IAAI,CAAA;IACpB,MAAM,CAAC,MAAM,GAAG,SAAS,CAAA;IACzB,MAAM,CAAC,QAAQ,GAAG,KAAK,CAAA;IAEvB,OAAO,MAAM,CAAA;AACf,CAAC,CAAA;AARY,QAAA,UAAU,cAQtB;AAED,sBAAsB;AACf,MAAM,QAAQ,GAAG,GAAG,EAAE;IAC3B,OAAO;QACL,GAAG,EAAE,KAAK;QACV,GAAG,EAAE;YACH,GAAG,EAAE,KAAK;YACV,OAAO,EAAE,OAAO;SACjB;QACD,GAAG,EAAE,CAAC;QACN,MAAM,EAAE,IAAA,kBAAU,GAAE;KACrB,CAAA;AACH,CAAC,CAAA;AAVY,QAAA,QAAQ,YAUpB;AAEM,MAAM,gBAAgB,GAAG,GAAG,EAAE;IACnC,OAAO;QACL,GAAG,EAAE,KAAK;QACV,GAAG,EAAE;YACH,GAAG,EAAE,KAAK;YACV,IAAI,EAAE,MAAM;YACZ,GAAG,EAAE,eAAe;SACrB;QACD,GAAG,EAAE,CAAC;KACP,CAAA;AACH,CAAC,CAAA;AAVY,QAAA,gBAAgB,oBAU5B;AAEM,MAAM,iBAAiB,GAAG,CAAC,MAAoC,EAAE,EAAE,EAAE;IAC1E,MAAM,KAAK,GAAG,oBAAU,CAAC,MAAM,CAAC;QAC9B,QAAQ,EAAE,wCAAwC;QAClD,YAAY,EAAE,EAAE;QAChB,MAAM,EAAE,QAAQ;QAChB,cAAc,EAAE,iBAAiB;QACjC,GAAG,GAAG;KACP,CAAC,CAAA;IAEF,MAAM,YAAY,GAAG;QACnB,MAAM,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,MAAM,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAChD,KAAK,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAC9C,GAAG,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAC1C,GAAG,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAC1C,GAAG,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAC1C,KAAK,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAC9C,OAAO,EAAE,cAAI,CAAC,SAAS,CAAC,KAAK,CAAC,OAAO,CAAC,CAAC,IAAI,CAAC,KAAK,CAAC;QAClD,KAAK,EAAE,KAAK,CAAC,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC;KAC/B,CAAA;IACD,OAAO,EAAE,KAAK,EAAE,YAAY,EAAE,CAAA;AAChC,CAAC,CAAA;AApBY,QAAA,iBAAiB,qBAoB7B"},"_coverageSchema":"1a1c01bbd47fc00a2c39e90264f33305004495a9","hash":"f0fa8c8f93133a3c9309052178a7e16e9cb2ab01"}} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/caee767b-c4ce-4448-9074-a8212c1e2643.json b/node_modules/connect-mongo/.nyc_output/caee767b-c4ce-4448-9074-a8212c1e2643.json new file mode 100644 index 0000000..9e26dfe --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/caee767b-c4ce-4448-9074-a8212c1e2643.json @@ -0,0 +1 @@ +{} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/processinfo/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json b/node_modules/connect-mongo/.nyc_output/processinfo/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json new file mode 100644 index 0000000..6cfa4c2 --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/processinfo/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json @@ -0,0 +1 @@ +{"parent":"caee767b-c4ce-4448-9074-a8212c1e2643","pid":7507,"argv":["/Users/jerome/.nvm/versions/node/v18.16.0/bin/node","/Users/jerome/jdesboeufs/connect-mongo/node_modules/ava/lib/worker/subprocess.js"],"execArgv":[],"cwd":"/Users/jerome/jdesboeufs/connect-mongo","time":1697308499298,"ppid":7505,"coverageFilename":"/Users/jerome/jdesboeufs/connect-mongo/.nyc_output/a2fabf40-3b97-45f1-94a2-9ed31c01ffd2.json","externalId":"","uuid":"a2fabf40-3b97-45f1-94a2-9ed31c01ffd2","files":["/Users/jerome/jdesboeufs/connect-mongo/build/main/test/integration.spec.js","/Users/jerome/jdesboeufs/connect-mongo/build/main/index.js","/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js"]} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/processinfo/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json b/node_modules/connect-mongo/.nyc_output/processinfo/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json new file mode 100644 index 0000000..0ef2dcd --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/processinfo/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json @@ -0,0 +1 @@ +{"parent":"caee767b-c4ce-4448-9074-a8212c1e2643","pid":7506,"argv":["/Users/jerome/.nvm/versions/node/v18.16.0/bin/node","/Users/jerome/jdesboeufs/connect-mongo/node_modules/ava/lib/worker/subprocess.js"],"execArgv":[],"cwd":"/Users/jerome/jdesboeufs/connect-mongo","time":1697308499298,"ppid":7505,"coverageFilename":"/Users/jerome/jdesboeufs/connect-mongo/.nyc_output/a45b74f9-8ef2-4938-b880-8baaf3d007ab.json","externalId":"","uuid":"a45b74f9-8ef2-4938-b880-8baaf3d007ab","files":["/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.spec.js","/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js","/Users/jerome/jdesboeufs/connect-mongo/build/main/test/testHelper.js"]} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/processinfo/caee767b-c4ce-4448-9074-a8212c1e2643.json b/node_modules/connect-mongo/.nyc_output/processinfo/caee767b-c4ce-4448-9074-a8212c1e2643.json new file mode 100644 index 0000000..695bd7b --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/processinfo/caee767b-c4ce-4448-9074-a8212c1e2643.json @@ -0,0 +1 @@ +{"parent":null,"pid":7505,"argv":["/Users/jerome/.nvm/versions/node/v18.16.0/bin/node","/Users/jerome/jdesboeufs/connect-mongo/node_modules/.bin/ava"],"execArgv":[],"cwd":"/Users/jerome/jdesboeufs/connect-mongo","time":1697308499074,"ppid":7502,"coverageFilename":"/Users/jerome/jdesboeufs/connect-mongo/.nyc_output/caee767b-c4ce-4448-9074-a8212c1e2643.json","externalId":"","uuid":"caee767b-c4ce-4448-9074-a8212c1e2643","files":[]} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nyc_output/processinfo/index.json b/node_modules/connect-mongo/.nyc_output/processinfo/index.json new file mode 100644 index 0000000..1b0e4e0 --- /dev/null +++ b/node_modules/connect-mongo/.nyc_output/processinfo/index.json @@ -0,0 +1 @@ +{"processes":{"a2fabf40-3b97-45f1-94a2-9ed31c01ffd2":{"parent":"caee767b-c4ce-4448-9074-a8212c1e2643","children":[]},"a45b74f9-8ef2-4938-b880-8baaf3d007ab":{"parent":"caee767b-c4ce-4448-9074-a8212c1e2643","children":[]},"caee767b-c4ce-4448-9074-a8212c1e2643":{"parent":null,"children":["a2fabf40-3b97-45f1-94a2-9ed31c01ffd2","a45b74f9-8ef2-4938-b880-8baaf3d007ab"]}},"files":{"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/integration.spec.js":["a2fabf40-3b97-45f1-94a2-9ed31c01ffd2"],"/Users/jerome/jdesboeufs/connect-mongo/build/main/index.js":["a2fabf40-3b97-45f1-94a2-9ed31c01ffd2"],"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.js":["a2fabf40-3b97-45f1-94a2-9ed31c01ffd2","a45b74f9-8ef2-4938-b880-8baaf3d007ab"],"/Users/jerome/jdesboeufs/connect-mongo/build/main/lib/MongoStore.spec.js":["a45b74f9-8ef2-4938-b880-8baaf3d007ab"],"/Users/jerome/jdesboeufs/connect-mongo/build/main/test/testHelper.js":["a45b74f9-8ef2-4938-b880-8baaf3d007ab"]},"externalIds":{}} \ No newline at end of file diff --git a/node_modules/connect-mongo/.nycrc.json b/node_modules/connect-mongo/.nycrc.json new file mode 100644 index 0000000..d1d2f5a --- /dev/null +++ b/node_modules/connect-mongo/.nycrc.json @@ -0,0 +1,7 @@ +{ + "branches": 75, + "lines": 80, + "functions": 78, + "statements": 80, + "exclude": ["src/test", "src/lib/MongoStore.spec.ts"] +} diff --git a/node_modules/connect-mongo/.prettierignore b/node_modules/connect-mongo/.prettierignore new file mode 100644 index 0000000..0e80a3c --- /dev/null +++ b/node_modules/connect-mongo/.prettierignore @@ -0,0 +1,2 @@ +# package.json is formatted by package managers, so we ignore it here +package.json \ No newline at end of file diff --git a/node_modules/connect-mongo/.vscode/launch.json b/node_modules/connect-mongo/.vscode/launch.json new file mode 100644 index 0000000..171e54a --- /dev/null +++ b/node_modules/connect-mongo/.vscode/launch.json @@ -0,0 +1,29 @@ +{ + "version": "0.2.0", + "configurations": [ + // To debug, make sure a *.spec.ts file is active in the editor, then run a configuration + { + "type": "node", + "request": "launch", + "name": "Debug Active Spec", + "runtimeExecutable": "${workspaceFolder}/node_modules/.bin/ava", + "runtimeArgs": ["debug", "--break", "--serial", "${file}"], + "port": 9229, + "outputCapture": "std", + "skipFiles": ["<node_internals>/**/*.js"], + "preLaunchTask": "npm: build" + // "smartStep": true + }, + { + // Use this one if you're already running `yarn watch` + "type": "node", + "request": "launch", + "name": "Debug Active Spec (no build)", + "runtimeExecutable": "${workspaceFolder}/node_modules/.bin/ava", + "runtimeArgs": ["debug", "--break", "--serial", "${file}"], + "port": 9229, + "outputCapture": "std", + "skipFiles": ["<node_internals>/**/*.js"] + // "smartStep": true + }] +} diff --git a/node_modules/connect-mongo/.vscode/settings.json b/node_modules/connect-mongo/.vscode/settings.json new file mode 100644 index 0000000..a379bd9 --- /dev/null +++ b/node_modules/connect-mongo/.vscode/settings.json @@ -0,0 +1,5 @@ +{ + "editor.formatOnSave": true, + "typescript.tsdk": "node_modules/typescript/lib", + "typescript.enablePromptUseWorkspaceTsdk": true +} diff --git a/node_modules/connect-mongo/CHANGELOG.md b/node_modules/connect-mongo/CHANGELOG.md new file mode 100644 index 0000000..475eb6e --- /dev/null +++ b/node_modules/connect-mongo/CHANGELOG.md @@ -0,0 +1,385 @@ +# Changelog +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [Unreleased] + +## [5.1.0] - 2023-10-14 + +### Changed + +- Extend `mongodb` peer dependency allowed versions to `6.x` +- Upgrade dependency + +## [5.0.0] - 2023-03-14 + +### **BREAKING CHANGES** + +- Upgraded peer dependency `mongodb` to 5.0.0 +- Change `engines` to require Node 12.9 or newer, matching the upgrade to `mongodb` that occurred in `v4.5.0` + +### Fixed + +- Declare `express-session` as a peer dependency. + +## [4.6.0] - 2021-09-17 + +### Changed + +- Moved `mongodb` to a peer dependency (and also as a dev dependency for `connect-mongo` developers). `connect-mongo` is no longer pinned to a specific version of `mongodb`. This allows end users to avoid errors due to Typescript definition changes when moving to new versions of `mongodb`. Users can use any version of `mongodb` that provides a compatible (non-breaking) interface to `mongodb ^4.1.0`. Tested on `mongodb` `4.1.0` and `4.1.1`. Should fix: [#433](https://github.com/jdesboeufs/connect-mongo/issues/433) [#434](https://github.com/jdesboeufs/connect-mongo/issues/434) [#436](https://github.com/jdesboeufs/connect-mongo/issues/436) + +### Fixed + +- Fixed "Callback was already called" when some code throws immediately after calling the set function + +## [4.5.0] - 2021-08-17 + +### **BREAKING CHANGES** + +- Drop Node 10 support + +### Changed + +- Upgrade `mongodb` to V4 [#422] [#426] + +### Fixed + +- Move `writeConcern` away from top-level option to fix deprecation warning [#422](https://github.com/jdesboeufs/connect-mongo/issues/422) + +## [4.4.1] - 2021-03-23 + +### Fixed + +- `store.all()` method not working with encrypted store [#410](https://github.com/jdesboeufs/connect-mongo/issues/410) [#411](https://github.com/jdesboeufs/connect-mongo/issues/411) +- Update and unpin `mongodb` dependency due to upstream fix has been deployed [#409](https://github.com/jdesboeufs/connect-mongo/issues/409) + +## [4.4.0] - 2021-03-11 + +### **BREAKING CHANGES** + +- Use `export =` for better cjs require without `.default` + +### Added + +- Add typescript example + +## [4.3.1] - 2021-03-09 + +### Fixed + +- Fix incorrect assertion checking after adding `client` options + +## [4.3.0] - 2021-03-08 + +### Added + +- Add `client` option for non-promise client + +## [4.2.2] - 2021-03-02 + +### Fixed + +- Fix crypto parsing error by upgrading `kruptein` to `v3.0.0` and change encodeas to `base64` + +## [4.2.0] - 2021-02-24 + +### Added + +- Added mongoose example +- Revert `createAutoRemoveIdx` and add back `autoRemove` and `autoRemoveInterval` + +### Fixed + +- Use `matchedCount` instead of `modifiedCount` to avoid throwing exceptions when nothing to modify [#390](https://github.com/jdesboeufs/connect-mongo/issues/390) +- Fixed `Warning: Accessing non-existent property 'MongoError' of module exports inside circular dependency` by downgrade to `mongodb@3.6.3` +- Revert update session when touch #351 +- Fix cannot read property `lastModified` of null +- Fix TS typing error + +## [4.1.0] - 2021-02-22 + +### **BREAKING CHANGES** + +- Support Node.Js 10.x, 12.x and 14.x and drop older support. +- Review method to connect to MongoDB and keep only `mongoUrl` and `clientPromise` options. +- Remove the "Remove expired sessions compatibility mode". Now library user can choose to create auto remove index on startup or not. +- Remove `fallbackMemory` options. +- Rewrite the library and test case using typescript. + +> Checkout the complete [migration guide](MIGRATION_V4.md) for more details. + +## [3.2.0] - 2019-11-29 + +### Added + +- Add dbName option (#343) + +### Fixed + +- Add missing `secret` option to TS definition (#342) + +## [3.1.2] - 2019-11-01 + +### Fixed + +- Add @types/ dev dependencies for tsc. fixes #340 (#341) + +## [3.1.1] - 2019-10-30 + +### Added + +- Add TS type definition + +## [3.1.0] - 2019-10-23 + +### Added + +- Added `useUnifiedTopology=true` to mongo options + +### Changed + +- Refactor merge config logic +- chore: update depns (#326) + +## [3.0.0] - 2019-06-17 + +### **BREAKING CHANGES** + +- Drop Node.js 4 & 6 support +- Upgrade `mongoose` to v5 and `mongodb` to v3 and drop old version support +- Replace deprecated mongo operation +- MongoStore need to supply client/clientPromise instead of db/dbPromise due to depns upgrade + +## Added + +- Add Node.js 10 & 12 support +- Implement store.all function (#291) +- Add option `writeOperationOptions` (#295) +- Add Transparent crypto support (#314) + +## Changed + +* Change test framework from Mocha to Jest +* Change linter from `xo` to `eslint` + +## [2.0.3] - 2018-12-03 + +## Fixed + +- Fixed interval autoremove mode to use current date with every interval (#304, #305) (jlampise) + +## [2.0.2] - 2018-11-20 + +## Fixed + +- Fxi #300 DeprecationWarning: collection.remove is deprecated. Use deleteOne, deleteMany, or bulkWrite instead +- Fxi #297 DeprecationWarning: collection.update is deprecated. Use updateOne, updateMany, or bulkWrite instead + +## [2.0.1] - 2018-01-04 + +## Fixed + +- Fixed #271 TypeError: cb is not a function (brainthinks) + +## [2.0.0] - 2017-10-09 + +### **BREAKING CHANGES** + +* __Drop__ Node.js 0.12 and io.js support +* __Drop__ MongoDB 2.x support +* __Drop__ mongodb driver < 2.0.36 support +* __Drop__ mongoose < 4.1.2 support + +## Changed + +* __Fix__ `ensureIndex` deprecation warning ([#268](https://github.com/jdesboeufs/connect-mongo/issues/268), [#269](https://github.com/jdesboeufs/connect-mongo/pulls/269), [#270](https://github.com/jdesboeufs/connect-mongo/pulls/270)) +* Improve `get()` ([#246](https://github.com/jdesboeufs/connect-mongo/pulls/246)) +* Pass session in `touch` event +* Remove `bluebird` from dependencies + +<!-- Legacy changelog format --> + +1.3.2 / 2016-07-27 +================= + +* __Fix__ #228 Broken with mongodb@1.x + +1.3.1 / 2016-07-23 +================= + +* Restrict `bluebird` accepted versions to 3.x + +1.3.0 / 2016-07-23 +================= + +* __Add__ `create` and `update` events ([#215](https://github.com/jdesboeufs/connect-mongo/issues/215)) +* Extend `mongodb` compatibility to `2.x` + +1.2.1 / 2016-06-20 +================= + +* __Fix__ bluebird warning (Awk34) + +1.2.0 / 2016-05-13 +================= + +* Accept `dbPromise` as connection param +* __Add__ `close()` method to close current connection + +1.1.0 / 2015-12-24 +================= + +* Support mongodb `2.1.x` + +1.0.2 / 2015-12-18 +================= + +* Enforce entry-points + +1.0.1 / 2015-12-17 +================= + +* __Fix__ entry-point + +1.0.0 (deprecated) / 2015-12-17 +================== + +__Breaking changes:__ +* __For older Node.js version (`< 4.0`), the module must be loaded using `require('connect-mongo/es5')`__ +* __Drop__ `hash` option (advanced) + +__Others changes:__ +* __Add__ `transformId` option to allow custom transformation on session id (advanced) +* __Rewrite in ES6__ (w/ fallback) +* Update dependencies +* Improve compatibility + +0.8.2 / 2015-07-14 +================== + +* Bug fixes and improvements (whitef0x0, TimothyGu, behcet-li) + + +0.8.1 / 2015-04-21 +================== + +* __Fix__ initialization when a connecting `mongodb` `2.0.x` instance is given (1999) + + +0.8.0 / 2015-03-24 +================== + +* __Add__ `touchAfter` option to enable lazy update behavior on `touch()` method (rafaelcardoso) +* __Add__ `fallbackMemory` option to switch to `MemoryStore` in some case. + + +0.7.0 / 2015-01-24 +================== + +* __Add__ `touch()` method to be fully compliant with `express-session` `>= 1.10` (rafaelcardoso) + + +0.6.0 / 2015-01-12 +================== + +* __Add__ `ttl` option +* __Add__ `autoRemove` option +* __Deprecate__ `defaultExpirationTime` option. Use `ttl` instead (in seconds) + + +0.5.3 / 2014-12-30 +================== + +* Make callbacks optional + + +0.5.2 / 2014-12-29 +================== + +* Extend compatibility to `mongodb` `2.0.x` + + +0.5.1 / 2014-12-28 +================== + +* [bugfix] #143 Missing Sessions from DB should still make callback (brekkehj) + + +0.5.0 (deprecated) / 2014-12-25 +================== + +* Accept full-featured [MongoDB connection strings](http://docs.mongodb.org/manual/reference/connection-string/) as `url` + [advanced options](http://mongodb.github.io/node-mongodb-native/1.4/driver-articles/mongoclient.html) +* Re-use existing or upcoming mongoose connection +* [DEPRECATED] `mongoose_connection` is renamed `mongooseConnection` +* [DEPRECATED] `auto_reconnect` is renamed `autoReconnect` +* [BREAKING] `autoReconnect` option is now `true` by default +* [BREAKING] Insert `collection` option in `url` in not possible any more +* [BREAKING] Replace for-testing-purpose `callback` by `connected` event +* Add debug (use with `DEBUG=connect-mongo`) +* Improve error management +* Compatibility with `mongodb` `>= 1.2.0` and `< 2.0.0` +* Fix many bugs + + +0.4.2 / 2014-12-18 +================== + + * Bumped mongodb version from 1.3.x to 1.4.x (B0k0) + * Add `sid` hash capability (ZheFeng) + * Add `serialize` and `unserialize` options (ksheedlo) + + +0.3.3 / 2013-07-04 +================== + + * Merged a change which reduces data duplication + + +0.3.0 / 2013-01-20 +================== + + * Merged several changes by Ken Pratt, including Write Concern support + * Updated to `mongodb` version 1.2 + +0.2.0 / 2012-09-09 +================== + + * Integrated pull request for `mongoose_connection` option + * Move to mongodb 1.0.x + +0.1.5 / 2010-07-07 +================== + + * Made collection setup more robust to avoid race condition + + +0.1.4 / 2010-06-28 +================== + + * Added session expiry + + +0.1.3 / 2010-06-27 +================== + + * Added url support + + +0.1.2 / 2010-05-18 +================== + + * Added auto_reconnect option + + +0.1.1 / 2010-03-18 +================== + + * Fixed authentication + + +0.1.0 / 2010-03-08 +================== + + * Initial release diff --git a/node_modules/connect-mongo/LICENSE b/node_modules/connect-mongo/LICENSE new file mode 100644 index 0000000..5b25248 --- /dev/null +++ b/node_modules/connect-mongo/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Jérôme Desboeufs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/connect-mongo/MIGRATION_V4.md b/node_modules/connect-mongo/MIGRATION_V4.md new file mode 100644 index 0000000..0fea32d --- /dev/null +++ b/node_modules/connect-mongo/MIGRATION_V4.md @@ -0,0 +1,59 @@ +# V4 migration guide + +To migrate the library from V3 to V4, re-install the dependencies. + +If you are using `npm` + +``` +npm uninstall connect-mongo +npm uninstall @types/connect-mongo +npm install connect-mongo +``` + +If you are using `yarn` + +``` +yarn remove connect-mongo +yarn remove @types/connect-mongo +yarn add connect-mongo +``` + +Next step is to import the dependencies + +Javascript: +```js +const MongoStore = require('connect-mongo'); +``` + +Typescript: +```ts +import MongoStore from 'connect-mongo'; +``` + +Create the store using `MongoStore.create(options)` instead of `new MongoStore(options)` + +```js +app.use(session({ + secret: 'foo', + store: MongoStore.create(options) +})); +``` + +For the options, you should make the following changes: + +* Change `url` to `mongoUrl` +* Change `collection` to `collectionName` if you are using it +* Keep `clientPromise` if you are using it +* `mongooseConnection` has been removed. Please update your application code to use either `mongoUrl`, `client` or `clientPromise` +* To reuse an existing mongoose connection retreive the mongoDb driver from you mongoose connection using `Connection.prototype.getClient()` and pass it to the store in the `client`-option. +* Remove `fallbackMemory` option and if you are using it, you can import from: + +```js +const session = require('express-session'); + +app.use(session({ + store: isDev ? new session.MemoryStore() : MongoStore.create(options) +})); +``` + +> You can also take a look at [example](example) directory for example usage. diff --git a/node_modules/connect-mongo/README.md b/node_modules/connect-mongo/README.md new file mode 100644 index 0000000..d4e422a --- /dev/null +++ b/node_modules/connect-mongo/README.md @@ -0,0 +1,336 @@ +# connect-mongo + +MongoDB session store for [Connect](https://github.com/senchalabs/connect) and [Express](http://expressjs.com/) written in Typescript. + +[](https://www.npmjs.com/package/connect-mongo) +[](https://www.npmjs.com/package/connect-mongo) +[](https://github.com/jdesboeufs/connect-mongo/actions/workflows/sanity.yml) +[](https://coveralls.io/github/jdesboeufs/connect-mongo?branch=master) + +> Breaking change in V4 and rewritten the whole project using Typescript. Please checkout the [migration guide](MIGRATION_V4.md) and [changelog](CHANGELOG.md) for details. + +- [Install](#install) +- [Compatibility](#compatibility) +- [Usage](#usage) + - [Express or Connect integration](#express-or-connect-integration) + - [Connection to MongoDB](#connection-to-mongodb) +- [Known issues](#known-issues) + - [Native autoRemove causing error on close](#native-autoremove-causing-error-on-close) + - [MongoError exports circular dependency](#mongoerror-exports-circular-dependency) + - [Existing encrypted v3.2.0 sessions are not decrypted correctly by v4](#existing-encrypted-v320-sessions-are-not-decrypted-correctly-by-v4) +- [Events](#events) +- [Session expiration](#session-expiration) +- [Remove expired sessions](#remove-expired-sessions) + - [Set MongoDB to clean expired sessions (default mode)](#set-mongodb-to-clean-expired-sessions-default-mode) + - [Set the compatibility mode](#set-the-compatibility-mode) + - [Disable expired sessions cleaning](#disable-expired-sessions-cleaning) +- [Lazy session update](#lazy-session-update) +- [Transparent encryption/decryption of session data](#transparent-encryptiondecryption-of-session-data) +- [Options](#options) + - [Connection-related options (required)](#connection-related-options-required) + - [More options](#more-options) + - [Crypto-related options](#crypto-related-options) +- [Development](#development) + - [Example application](#example-application) + - [Release](#release) +- [License](#license) + +## Install + +``` +npm install connect-mongo +yarn add connect-mongo +``` + +* You may also need to run install `mongodb` if you do not have it installed already because `mongodb` is not a `peerDependencies` instead. +* If you are upgrading from v3.x to v4, please checkout the [migration guide](./MIGRATION_V4.md) for details. +* If you are upgrading v4.x to latest version, you may check the [example](./example) and [options](#options) for details. + +## Compatibility + +* Support Express up to `5.0` +* Support [native MongoDB driver](http://mongodb.github.io/node-mongodb-native/) `5` and `6` +* Support Node.js 14, 16 and 18 +* Support [MongoDB](https://www.mongodb.com/) `3.6+` + +For extended compatibility, see previous versions [v3.x](https://github.com/jdesboeufs/connect-mongo/tree/v3.x). +But please note that we are not maintaining v3.x anymore. + +## Usage + +### Express or Connect integration + +Express `4.x`, `5.0` and Connect `3.x`: + +```js +const session = require('express-session'); +const MongoStore = require('connect-mongo'); + +app.use(session({ + secret: 'foo', + store: MongoStore.create(options) +})); +``` + +```ts +import session from 'express-session' +import MongoStore from 'connect-mongo' + +app.use(session({ + secret: 'foo', + store: MongoStore.create(options) +})); +``` + +### Connection to MongoDB + +In many circumstances, `connect-mongo` will not be the only part of your application which need a connection to a MongoDB database. It could be interesting to re-use an existing connection. + +Alternatively, you can configure `connect-mongo` to establish a new connection. + +#### Create a new connection from a MongoDB connection string + +[MongoDB connection strings](http://docs.mongodb.org/manual/reference/connection-string/) are __the best way__ to configure a new connection. For advanced usage, [more options](http://mongodb.github.io/node-mongodb-native/driver-articles/mongoclient.html#mongoclient-connect-options) can be configured with `mongoOptions` property. + +```js +// Basic usage +app.use(session({ + store: MongoStore.create({ mongoUrl: 'mongodb://localhost/test-app' }) +})); + +// Advanced usage +app.use(session({ + store: MongoStore.create({ + mongoUrl: 'mongodb://user12345:foobar@localhost/test-app?authSource=admin&w=1', + mongoOptions: advancedOptions // See below for details + }) +})); +``` + +#### Re-use an existing native MongoDB driver client promise + +In this case, you just have to give your `MongoClient` instance to `connect-mongo`. + +```js +/* +** There are many ways to create MongoClient. +** You should refer to the driver documentation. +*/ + +// Database name present in the connection string will be used +app.use(session({ + store: MongoStore.create({ clientPromise }) +})); + +// Explicitly specifying database name +app.use(session({ + store: MongoStore.create({ + clientPromise, + dbName: 'test-app' + }) +})); +``` + +## Known issues + +[Known issues](https://github.com/jdesboeufs/connect-mongo/issues?q=is%3Aopen+is%3Aissue+label%3Abug) in GitHub Issues page. + +### Native autoRemove causing error on close + +- Calling `close()` immediately after creating the session store may cause error when the async index creation is in process when `autoRemove: 'native'`. You may want to manually manage the autoRemove index. [#413](https://github.com/jdesboeufs/connect-mongo/issues/413) + +### MongoError exports circular dependency + +The following error can be safely ignored from [official reply](https://developer.mongodb.com/community/forums/t/warning-accessing-non-existent-property-mongoerror-of-module-exports-inside-circular-dependency/15411/5). + +``` +(node:16580) Warning: Accessing non-existent property 'MongoError' of module exports inside circular dependency +(Use `node --trace-warnings ...` to show where the warning was created) +``` + +### Existing encrypted v3.2.0 sessions are not decrypted correctly by v4 + +v4 cannot decrypt the session encrypted from v3.2 due to a bug. Please take a look on this issue for possible workaround. [#420](https://github.com/jdesboeufs/connect-mongo/issues/420) + +## Events + +A `MongoStore` instance will emit the following events: + +| Event name | Description | Payload +| ----- | ----- | ----- | +| `create` | A session has been created | `sessionId` | +| `touch` | A session has been touched (but not modified) | `sessionId` | +| `update` | A session has been updated | `sessionId` | +| `set` | A session has been created OR updated _(for compatibility purpose)_ | `sessionId` | +| `destroy` | A session has been destroyed manually | `sessionId` | + +## Session expiration + +When the session cookie has an expiration date, `connect-mongo` will use it. + +Otherwise, it will create a new one, using `ttl` option. + +```js +app.use(session({ + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + ttl: 14 * 24 * 60 * 60 // = 14 days. Default + }) +})); +``` + +__Note:__ Each time a user interacts with the server, its session expiration date is refreshed. + +## Remove expired sessions + +By default, `connect-mongo` uses MongoDB's TTL collection feature (2.2+) to have mongodb automatically remove expired sessions. But you can change this behavior. + +### Set MongoDB to clean expired sessions (default mode) + +`connect-mongo` will create a TTL index for you at startup. You MUST have MongoDB 2.2+ and administration permissions. + +```js +app.use(session({ + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + autoRemove: 'native' // Default + }) +})); +``` + +__Note:__ If you use `connect-mongo` in a very concurrent environment, you should avoid this mode and prefer setting the index yourself, once! + +### Set the compatibility mode + +In some cases you can't or don't want to create a TTL index, e.g. Azure Cosmos DB. + +`connect-mongo` will take care of removing expired sessions, using defined interval. + +```js +app.use(session({ + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + autoRemove: 'interval', + autoRemoveInterval: 10 // In minutes. Default + }) +})); +``` + +### Disable expired sessions cleaning + +You are in production environnement and/or you manage the TTL index elsewhere. + +```js +app.use(session({ + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + autoRemove: 'disabled' + }) +})); +``` + +## Lazy session update + +If you are using [express-session](https://github.com/expressjs/session) >= [1.10.0](https://github.com/expressjs/session/releases/tag/v1.10.0) and don't want to resave all the session on database every single time that the user refreshes the page, you can lazy update the session, by limiting a period of time. + +```js +app.use(express.session({ + secret: 'keyboard cat', + saveUninitialized: false, // don't create session until something stored + resave: false, //don't save session if unmodified + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + touchAfter: 24 * 3600 // time period in seconds + }) +})); +``` + +by doing this, setting `touchAfter: 24 * 3600` you are saying to the session be updated only one time in a period of 24 hours, does not matter how many request's are made (with the exception of those that change something on the session data) + + +## Transparent encryption/decryption of session data + +When working with sensitive session data it is [recommended](https://github.com/OWASP/CheatSheetSeries/blob/master/cheatsheets/Session_Management_Cheat_Sheet.md) to use encryption + +```js +const store = MongoStore.create({ + mongoUrl: 'mongodb://localhost/test-app', + crypto: { + secret: 'squirrel' + } +}) +``` + +## Options + +### Connection-related options (required) + +One of the following options should be provided. If more than one option are provided, each option will take precedence over others according to priority. + +|Priority|Option|Description| +|:------:|------|-----------| +|1|`mongoUrl`|A [connection string](https://docs.mongodb.com/manual/reference/connection-string/) for creating a new MongoClient connection. If database name is not present in the connection string, database name should be provided using `dbName` option. | +|2|`clientPromise`|A Promise that is resolved with MongoClient connection. If the connection was established without database name being present in the connection string, database name should be provided using `dbName` option.| +|3|`client`|An existing MongoClient connection. If the connection was established without database name being present in the connection string, database name should be provided using `dbName` option.| + +### More options + +|Option|Default|Description| +|------|:-----:|-----------| +|`mongoOptions`|`{ useUnifiedTopology: true }`|Options object for [`MongoClient.connect()`](https://mongodb.github.io/node-mongodb-native/3.3/api/MongoClient.html#.connect) method. Can be used with `mongoUrl` option.| +|`dbName`||A name of database used for storing sessions. Can be used with `mongoUrl`, or `clientPromise` options. Takes precedence over database name present in the connection string.| +|`collectionName`|`'sessions'`|A name of collection used for storing sessions.| +|`ttl`|`1209600`|The maximum lifetime (in seconds) of the session which will be used to set `session.cookie.expires` if it is not yet set. Default is 14 days.| +|`autoRemove`|`'native'`|Behavior for removing expired sessions. Possible values: `'native'`, `'interval'` and `'disabled'`.| +|`autoRemoveInterval`|`10`|Interval (in minutes) used when `autoRemove` option is set to `interval`.| +|`touchAfter`|`0`|Interval (in seconds) between session updates.| +|`stringify`|`true`|If `true`, connect-mongo will serialize sessions using `JSON.stringify` before setting them, and deserialize them with `JSON.parse` when getting them. This is useful if you are using types that MongoDB doesn't support.| +|`serialize`||Custom hook for serializing sessions to MongoDB. This is helpful if you need to modify the session before writing it out.| +|`unserialize`||Custom hook for unserializing sessions from MongoDB. This can be used in scenarios where you need to support different types of serializations (e.g., objects and JSON strings) or need to modify the session before using it in your app.| +|`writeOperationOptions`||Options object to pass to every MongoDB write operation call that supports it (e.g. `update`, `remove`). Useful for adjusting the write concern. Only exception: If `autoRemove` is set to `'interval'`, the write concern from the `writeOperationOptions` object will get overwritten.| +|`transformId`||Transform original `sessionId` in whatever you want to use as storage key.| +|`crypto`||Crypto related options. See below.| + +### Crypto-related options + +|Option|Default|Description| +|------|:-----:|-----------| +|`secret`|`false`|Enables transparent crypto in accordance with [OWASP session management recommendations](https://github.com/OWASP/CheatSheetSeries/blob/master/cheatsheets/Session_Management_Cheat_Sheet.md).| +|`algorithm`|`'aes-256-gcm'`|Allows for changes to the default symmetric encryption cipher. See [`crypto.getCiphers()`](https://nodejs.org/api/crypto.html#crypto_crypto_getciphers) for supported algorithms.| +|`hashing`|`'sha512'`|May be used to change the default hashing algorithm. See [`crypto.getHashes()`](https://nodejs.org/api/crypto.html#crypto_crypto_gethashes) for supported hashing algorithms.| +|`encodeas`|`'hex'`|Specify to change the session data cipher text encoding.| +|`key_size`|`32`|When using varying algorithms the key size may be used. Default value `32` is based on the `AES` blocksize.| +|`iv_size`|`16`|This can be used to adjust the default [IV](https://csrc.nist.gov/glossary/term/IV) size if a different algorithm requires a different size.| +|`at_size`|`16`|When using newer `AES` modes such as the default `GCM` or `CCM` an authentication tag size can be defined.| + +## Development + +``` +yarn install +docker-compose up -d +# Run these 2 lines in 2 shell +yarn watch:build +yarn watch:test +``` + +### Example application + +``` +yarn link +cd example +yarn link "connect-mongo" +yarn install +yarn start +``` + +### Release + +Since I cannot access the setting page. I can only do it manually. + +1. Bump version, update `CHANGELOG.md` and README. Commit and push. +2. Run `yarn build && yarn test && npm publish` +3. `git tag vX.Y.Z && git push --tags` + +## License + +The MIT License diff --git a/node_modules/connect-mongo/build/main/index.d.ts b/node_modules/connect-mongo/build/main/index.d.ts new file mode 100644 index 0000000..9a3afc7 --- /dev/null +++ b/node_modules/connect-mongo/build/main/index.d.ts @@ -0,0 +1,2 @@ +import MongoStore from './lib/MongoStore'; +export = MongoStore; diff --git a/node_modules/connect-mongo/build/main/index.js b/node_modules/connect-mongo/build/main/index.js new file mode 100644 index 0000000..2e808ac --- /dev/null +++ b/node_modules/connect-mongo/build/main/index.js @@ -0,0 +1,7 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +const MongoStore_1 = __importDefault(require("./lib/MongoStore")); +module.exports = MongoStore_1.default; +//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiaW5kZXguanMiLCJzb3VyY2VSb290IjoiIiwic291cmNlcyI6WyIuLi8uLi9zcmMvaW5kZXgudHMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6Ijs7OztBQUFBLGtFQUF5QztBQUN6QyxpQkFBUyxvQkFBVSxDQUFBIn0= \ No newline at end of file diff --git a/node_modules/connect-mongo/build/main/lib/MongoStore.d.ts b/node_modules/connect-mongo/build/main/lib/MongoStore.d.ts new file mode 100644 index 0000000..73cdbd4 --- /dev/null +++ b/node_modules/connect-mongo/build/main/lib/MongoStore.d.ts @@ -0,0 +1,96 @@ +import * as session from 'express-session'; +import { Collection, MongoClient, MongoClientOptions, WriteConcernSettings } from 'mongodb'; +export type CryptoOptions = { + secret: false | string; + algorithm?: string; + hashing?: string; + encodeas?: string; + key_size?: number; + iv_size?: number; + at_size?: number; +}; +export type ConnectMongoOptions = { + mongoUrl?: string; + clientPromise?: Promise<MongoClient>; + client?: MongoClient; + collectionName?: string; + mongoOptions?: MongoClientOptions; + dbName?: string; + ttl?: number; + touchAfter?: number; + stringify?: boolean; + createAutoRemoveIdx?: boolean; + autoRemove?: 'native' | 'interval' | 'disabled'; + autoRemoveInterval?: number; + serialize?: (a: any) => any; + unserialize?: (a: any) => any; + writeOperationOptions?: WriteConcernSettings; + transformId?: (a: any) => any; + crypto?: CryptoOptions; +}; +type InternalSessionType = { + _id: string; + session: any; + expires?: Date; + lastModified?: Date; +}; +export default class MongoStore extends session.Store { + private clientP; + private crypto; + private timer?; + collectionP: Promise<Collection<InternalSessionType>>; + private options; + private transformFunctions; + constructor({ collectionName, ttl, mongoOptions, autoRemove, autoRemoveInterval, touchAfter, stringify, crypto, ...required }: ConnectMongoOptions); + static create(options: ConnectMongoOptions): MongoStore; + private setAutoRemove; + private computeStorageId; + /** + * promisify and bind the `this.crypto.get` function. + * Please check !!this.crypto === true before using this getter! + */ + private get cryptoGet(); + /** + * Decrypt given session data + * @param session session data to be decrypt. Mutate the input session. + */ + private decryptSession; + /** + * Get a session from the store given a session ID (sid) + * @param sid session ID + */ + get(sid: string, callback: (err: any, session?: session.SessionData | null) => void): void; + /** + * Upsert a session into the store given a session ID (sid) and session (session) object. + * @param sid session ID + * @param session session object + */ + set(sid: string, session: session.SessionData, callback?: (err: any) => void): void; + touch(sid: string, session: session.SessionData & { + lastModified?: Date; + }, callback?: (err: any) => void): void; + /** + * Get all sessions in the store as an array + */ + all(callback: (err: any, obj?: session.SessionData[] | { + [sid: string]: session.SessionData; + } | null) => void): void; + /** + * Destroy/delete a session from the store given a session ID (sid) + * @param sid session ID + */ + destroy(sid: string, callback?: (err: any) => void): void; + /** + * Get the count of all sessions in the store + */ + length(callback: (err: any, length: number) => void): void; + /** + * Delete all sessions from the store. + */ + clear(callback?: (err: any) => void): void; + /** + * Close database connection + */ + close(): Promise<void>; +} +export {}; diff --git a/node_modules/connect-mongo/build/main/lib/MongoStore.js b/node_modules/connect-mongo/build/main/lib/MongoStore.js new file mode 100644 index 0000000..ed72742 --- /dev/null +++ b/node_modules/connect-mongo/build/main/lib/MongoStore.js @@ -0,0 +1,415 @@ +"use strict"; +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const console_1 = require("console"); +const util_1 = __importDefault(require("util")); +const session = __importStar(require("express-session")); +const mongodb_1 = require("mongodb"); +const debug_1 = __importDefault(require("debug")); +const debug = (0, debug_1.default)('connect-mongo'); +// eslint-disable-next-line @typescript-eslint/no-empty-function +const noop = () => { }; +const unit = (a) => a; +function defaultSerializeFunction(session) { + // Copy each property of the session to a new object + const obj = {}; + let prop; + for (prop in session) { + if (prop === 'cookie') { + // Convert the cookie instance to an object, if possible + // This gets rid of the duplicate object under session.cookie.data property + // @ts-ignore FIXME: + obj.cookie = session.cookie.toJSON + ? // @ts-ignore FIXME: + session.cookie.toJSON() + : session.cookie; + } + else { + // @ts-ignore FIXME: + obj[prop] = session[prop]; + } + } + return obj; +} +function computeTransformFunctions(options) { + if (options.serialize || options.unserialize) { + return { + serialize: options.serialize || defaultSerializeFunction, + unserialize: options.unserialize || unit, + }; + } + if (options.stringify === false) { + return { + serialize: defaultSerializeFunction, + unserialize: unit, + }; + } + // Default case + return { + serialize: JSON.stringify, + unserialize: JSON.parse, + }; +} +class MongoStore extends session.Store { + constructor({ collectionName = 'sessions', ttl = 1209600, mongoOptions = {}, autoRemove = 'native', autoRemoveInterval = 10, touchAfter = 0, stringify = true, crypto, ...required }) { + super(); + this.crypto = null; + debug('create MongoStore instance'); + const options = { + collectionName, + ttl, + mongoOptions, + autoRemove, + autoRemoveInterval, + touchAfter, + stringify, + crypto: { + ...{ + secret: false, + algorithm: 'aes-256-gcm', + hashing: 'sha512', + encodeas: 'base64', + key_size: 32, + iv_size: 16, + at_size: 16, + }, + ...crypto, + }, + ...required, + }; + // Check params + (0, console_1.assert)(options.mongoUrl || options.clientPromise || options.client, 'You must provide either mongoUrl|clientPromise|client in options'); + (0, console_1.assert)(options.createAutoRemoveIdx === null || + options.createAutoRemoveIdx === undefined, 'options.createAutoRemoveIdx has been reverted to autoRemove and autoRemoveInterval'); + (0, console_1.assert)(!options.autoRemoveInterval || options.autoRemoveInterval <= 71582, + /* (Math.pow(2, 32) - 1) / (1000 * 60) */ 'autoRemoveInterval is too large. options.autoRemoveInterval is in minutes but not seconds nor mills'); + this.transformFunctions = computeTransformFunctions(options); + let _clientP; + if (options.mongoUrl) { + _clientP = mongodb_1.MongoClient.connect(options.mongoUrl, options.mongoOptions); + } + else if (options.clientPromise) { + _clientP = options.clientPromise; + } + else if (options.client) { + _clientP = Promise.resolve(options.client); + } + else { + throw new Error('Cannot init client. Please provide correct options'); + } + (0, console_1.assert)(!!_clientP, 'Client is null|undefined'); + this.clientP = _clientP; + this.options = options; + this.collectionP = _clientP.then(async (con) => { + const collection = con + .db(options.dbName) + .collection(options.collectionName); + await this.setAutoRemove(collection); + return collection; + }); + if (options.crypto.secret) { + this.crypto = require('kruptein')(options.crypto); + } + } + static create(options) { + return new MongoStore(options); + } + setAutoRemove(collection) { + const removeQuery = () => ({ + expires: { + $lt: new Date(), + }, + }); + switch (this.options.autoRemove) { + case 'native': + debug('Creating MongoDB TTL index'); + return collection.createIndex({ expires: 1 }, { + background: true, + expireAfterSeconds: 0, + }); + case 'interval': + debug('create Timer to remove expired sessions'); + this.timer = setInterval(() => collection.deleteMany(removeQuery(), { + writeConcern: { + w: 0, + j: false, + }, + }), this.options.autoRemoveInterval * 1000 * 60); + this.timer.unref(); + return Promise.resolve(); + case 'disabled': + default: + return Promise.resolve(); + } + } + computeStorageId(sessionId) { + if (this.options.transformId && + typeof this.options.transformId === 'function') { + return this.options.transformId(sessionId); + } + return sessionId; + } + /** + * promisify and bind the `this.crypto.get` function. + * Please check !!this.crypto === true before using this getter! + */ + get cryptoGet() { + if (!this.crypto) { + throw new Error('Check this.crypto before calling this.cryptoGet!'); + } + return util_1.default.promisify(this.crypto.get).bind(this.crypto); + } + /** + * Decrypt given session data + * @param session session data to be decrypt. Mutate the input session. + */ + async decryptSession(session) { + if (this.crypto && session) { + const plaintext = await this.cryptoGet(this.options.crypto.secret, session.session).catch((err) => { + throw new Error(err); + }); + // @ts-ignore + session.session = JSON.parse(plaintext); + } + } + /** + * Get a session from the store given a session ID (sid) + * @param sid session ID + */ + get(sid, callback) { + ; + (async () => { + try { + debug(`MongoStore#get=${sid}`); + const collection = await this.collectionP; + const session = await collection.findOne({ + _id: this.computeStorageId(sid), + $or: [ + { expires: { $exists: false } }, + { expires: { $gt: new Date() } }, + ], + }); + if (this.crypto && session) { + await this.decryptSession(session).catch((err) => callback(err)); + } + const s = session && this.transformFunctions.unserialize(session.session); + if (this.options.touchAfter > 0 && (session === null || session === void 0 ? void 0 : session.lastModified)) { + s.lastModified = session.lastModified; + } + this.emit('get', sid); + callback(null, s === undefined ? null : s); + } + catch (error) { + callback(error); + } + })(); + } + /** + * Upsert a session into the store given a session ID (sid) and session (session) object. + * @param sid session ID + * @param session session object + */ + set(sid, session, callback = noop) { + ; + (async () => { + var _a; + try { + debug(`MongoStore#set=${sid}`); + // Removing the lastModified prop from the session object before update + // @ts-ignore + if (this.options.touchAfter > 0 && (session === null || session === void 0 ? void 0 : session.lastModified)) { + // @ts-ignore + delete session.lastModified; + } + const s = { + _id: this.computeStorageId(sid), + session: this.transformFunctions.serialize(session), + }; + // Expire handling + if ((_a = session === null || session === void 0 ? void 0 : session.cookie) === null || _a === void 0 ? void 0 : _a.expires) { + s.expires = new Date(session.cookie.expires); + } + else { + // If there's no expiration date specified, it is + // browser-session cookie or there is no cookie at all, + // as per the connect docs. + // + // So we set the expiration to two-weeks from now + // - as is common practice in the industry (e.g Django) - + // or the default specified in the options. + s.expires = new Date(Date.now() + this.options.ttl * 1000); + } + // Last modify handling + if (this.options.touchAfter > 0) { + s.lastModified = new Date(); + } + if (this.crypto) { + const cryptoSet = util_1.default.promisify(this.crypto.set).bind(this.crypto); + const data = await cryptoSet(this.options.crypto.secret, s.session).catch((err) => { + throw new Error(err); + }); + s.session = data; + } + const collection = await this.collectionP; + const rawResp = await collection.updateOne({ _id: s._id }, { $set: s }, { + upsert: true, + writeConcern: this.options.writeOperationOptions, + }); + if (rawResp.upsertedCount > 0) { + this.emit('create', sid); + } + else { + this.emit('update', sid); + } + this.emit('set', sid); + } + catch (error) { + return callback(error); + } + return callback(null); + })(); + } + touch(sid, session, callback = noop) { + ; + (async () => { + var _a; + try { + debug(`MongoStore#touch=${sid}`); + const updateFields = {}; + const touchAfter = this.options.touchAfter * 1000; + const lastModified = session.lastModified + ? session.lastModified.getTime() + : 0; + const currentDate = new Date(); + // If the given options has a touchAfter property, check if the + // current timestamp - lastModified timestamp is bigger than + // the specified, if it's not, don't touch the session + if (touchAfter > 0 && lastModified > 0) { + const timeElapsed = currentDate.getTime() - lastModified; + if (timeElapsed < touchAfter) { + debug(`Skip touching session=${sid}`); + return callback(null); + } + updateFields.lastModified = currentDate; + } + if ((_a = session === null || session === void 0 ? void 0 : session.cookie) === null || _a === void 0 ? void 0 : _a.expires) { + updateFields.expires = new Date(session.cookie.expires); + } + else { + updateFields.expires = new Date(Date.now() + this.options.ttl * 1000); + } + const collection = await this.collectionP; + const rawResp = await collection.updateOne({ _id: this.computeStorageId(sid) }, { $set: updateFields }, { writeConcern: this.options.writeOperationOptions }); + if (rawResp.matchedCount === 0) { + return callback(new Error('Unable to find the session to touch')); + } + else { + this.emit('touch', sid, session); + return callback(null); + } + } + catch (error) { + return callback(error); + } + })(); + } + /** + * Get all sessions in the store as an array + */ + all(callback) { + ; + (async () => { + try { + debug('MongoStore#all()'); + const collection = await this.collectionP; + const sessions = collection.find({ + $or: [ + { expires: { $exists: false } }, + { expires: { $gt: new Date() } }, + ], + }); + const results = []; + for await (const session of sessions) { + if (this.crypto && session) { + await this.decryptSession(session); + } + results.push(this.transformFunctions.unserialize(session.session)); + } + this.emit('all', results); + callback(null, results); + } + catch (error) { + callback(error); + } + })(); + } + /** + * Destroy/delete a session from the store given a session ID (sid) + * @param sid session ID + */ + destroy(sid, callback = noop) { + debug(`MongoStore#destroy=${sid}`); + this.collectionP + .then((colleciton) => colleciton.deleteOne({ _id: this.computeStorageId(sid) }, { writeConcern: this.options.writeOperationOptions })) + .then(() => { + this.emit('destroy', sid); + callback(null); + }) + .catch((err) => callback(err)); + } + /** + * Get the count of all sessions in the store + */ + length(callback) { + debug('MongoStore#length()'); + this.collectionP + .then((collection) => collection.countDocuments()) + .then((c) => callback(null, c)) + // @ts-ignore + .catch((err) => callback(err)); + } + /** + * Delete all sessions from the store. + */ + clear(callback = noop) { + debug('MongoStore#clear()'); + this.collectionP + .then((collection) => collection.drop()) + .then(() => callback(null)) + .catch((err) => callback(err)); + } + /** + * Close database connection + */ + close() { + debug('MongoStore#close()'); + return this.clientP.then((c) => c.close()); + } +} +exports.default = MongoStore; +//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiTW9uZ29TdG9yZS5qcyIsInNvdXJjZVJvb3QiOiIiLCJzb3VyY2VzIjpbIi4uLy4uLy4uL3NyYy9saWIvTW9uZ29TdG9yZS50cyJdLCJuYW1lcyI6W10sIm1hcHBpbmdzIjoiOzs7Ozs7Ozs7Ozs7Ozs7Ozs7Ozs7Ozs7Ozs7O0FBQUEscUNBQWdDO0FBQ2hDLGdEQUF1QjtBQUN2Qix5REFBMEM7QUFDMUMscUNBS2dCO0FBQ2hCLGtEQUF5QjtBQUd6QixNQUFNLEtBQUssR0FBRyxJQUFBLGVBQUssRUFBQyxlQUFlLENBQUMsQ0FBQTtBQWdFcEMsZ0VBQWdFO0FBQ2hFLE1BQU0sSUFBSSxHQUFHLEdBQUcsRUFBRSxHQUFFLENBQUMsQ0FBQTtBQUNyQixNQUFNLElBQUksR0FBbUIsQ0FBQyxDQUFDLEVBQUUsRUFBRSxDQUFDLENBQUMsQ0FBQTtBQUVyQyxTQUFTLHdCQUF3QixDQUMvQixPQUE0QjtJQUU1QixvREFBb0Q7SUFDcEQsTUFBTSxHQUFHLEdBQUcsRUFBRSxDQUFBO0lBQ2QsSUFBSSxJQUFJLENBQUE7SUFDUixLQUFLLElBQUksSUFBSSxPQUFPLEVBQUU7UUFDcEIsSUFBSSxJQUFJLEtBQUssUUFBUSxFQUFFO1lBQ3JCLHdEQUF3RDtZQUN4RCwyRUFBMkU7WUFDM0Usb0JBQW9CO1lBQ3BCLEdBQUcsQ0FBQyxNQUFNLEdBQUcsT0FBTyxDQUFDLE1BQU0sQ0FBQyxNQUFNO2dCQUNoQyxDQUFDLENBQUMsb0JBQW9CO29CQUNwQixPQUFPLENBQUMsTUFBTSxDQUFDLE1BQU0sRUFBRTtnQkFDekIsQ0FBQyxDQUFDLE9BQU8sQ0FBQyxNQUFNLENBQUE7U0FDbkI7YUFBTTtZQUNMLG9CQUFvQjtZQUNwQixHQUFHLENBQUMsSUFBSSxDQUFDLEdBQUcsT0FBTyxDQUFDLElBQUksQ0FBQyxDQUFBO1NBQzFCO0tBQ0Y7SUFFRCxPQUFPLEdBQTBCLENBQUE7QUFDbkMsQ0FBQztBQUVELFNBQVMseUJBQXlCLENBQUMsT0FBbUM7SUFDcEUsSUFBSSxPQUFPLENBQUMsU0FBUyxJQUFJLE9BQU8sQ0FBQyxXQUFXLEVBQUU7UUFDNUMsT0FBTztZQUNMLFNBQVMsRUFBRSxPQUFPLENBQUMsU0FBUyxJQUFJLHdCQUF3QjtZQUN4RCxXQUFXLEVBQUUsT0FBTyxDQUFDLFdBQVcsSUFBSSxJQUFJO1NBQ3pDLENBQUE7S0FDRjtJQUVELElBQUksT0FBTyxDQUFDLFNBQVMsS0FBSyxLQUFLLEVBQUU7UUFDL0IsT0FBTztZQUNMLFNBQVMsRUFBRSx3QkFBd0I7WUFDbkMsV0FBVyxFQUFFLElBQUk7U0FDbEIsQ0FBQTtLQUNGO0lBQ0QsZUFBZTtJQUNmLE9BQU87UUFDTCxTQUFTLEVBQUUsSUFBSSxDQUFDLFNBQVM7UUFDekIsV0FBVyxFQUFFLElBQUksQ0FBQyxLQUFLO0tBQ3hCLENBQUE7QUFDSCxDQUFDO0FBRUQsTUFBcUIsVUFBVyxTQUFRLE9BQU8sQ0FBQyxLQUFLO0lBWW5ELFlBQVksRUFDVixjQUFjLEdBQUcsVUFBVSxFQUMzQixHQUFHLEdBQUcsT0FBTyxFQUNiLFlBQVksR0FBRyxFQUFFLEVBQ2pCLFVBQVUsR0FBRyxRQUFRLEVBQ3JCLGtCQUFrQixHQUFHLEVBQUUsRUFDdkIsVUFBVSxHQUFHLENBQUMsRUFDZCxTQUFTLEdBQUcsSUFBSSxFQUNoQixNQUFNLEVBQ04sR0FBRyxRQUFRLEVBQ1M7UUFDcEIsS0FBSyxFQUFFLENBQUE7UUFyQkQsV0FBTSxHQUFvQixJQUFJLENBQUE7UUFzQnBDLEtBQUssQ0FBQyw0QkFBNEIsQ0FBQyxDQUFBO1FBQ25DLE1BQU0sT0FBTyxHQUErQjtZQUMxQyxjQUFjO1lBQ2QsR0FBRztZQUNILFlBQVk7WUFDWixVQUFVO1lBQ1Ysa0JBQWtCO1lBQ2xCLFVBQVU7WUFDVixTQUFTO1lBQ1QsTUFBTSxFQUFFO2dCQUNOLEdBQUc7b0JBQ0QsTUFBTSxFQUFFLEtBQUs7b0JBQ2IsU0FBUyxFQUFFLGFBQWE7b0JBQ3hCLE9BQU8sRUFBRSxRQUFRO29CQUNqQixRQUFRLEVBQUUsUUFBUTtvQkFDbEIsUUFBUSxFQUFFLEVBQUU7b0JBQ1osT0FBTyxFQUFFLEVBQUU7b0JBQ1gsT0FBTyxFQUFFLEVBQUU7aUJBQ1o7Z0JBQ0QsR0FBRyxNQUFNO2FBQ1Y7WUFDRCxHQUFHLFFBQVE7U0FDWixDQUFBO1FBQ0QsZUFBZTtRQUNmLElBQUEsZ0JBQU0sRUFDSixPQUFPLENBQUMsUUFBUSxJQUFJLE9BQU8sQ0FBQyxhQUFhLElBQUksT0FBTyxDQUFDLE1BQU0sRUFDM0Qsa0VBQWtFLENBQ25FLENBQUE7UUFDRCxJQUFBLGdCQUFNLEVBQ0osT0FBTyxDQUFDLG1CQUFtQixLQUFLLElBQUk7WUFDbEMsT0FBTyxDQUFDLG1CQUFtQixLQUFLLFNBQVMsRUFDM0Msb0ZBQW9GLENBQ3JGLENBQUE7UUFDRCxJQUFBLGdCQUFNLEVBQ0osQ0FBQyxPQUFPLENBQUMsa0JBQWtCLElBQUksT0FBTyxDQUFDLGtCQUFrQixJQUFJLEtBQUs7UUFDbEUseUNBQXlDLENBQUMscUdBQXFHLENBQ2hKLENBQUE7UUFDRCxJQUFJLENBQUMsa0JBQWtCLEdBQUcseUJBQXlCLENBQUMsT0FBTyxDQUFDLENBQUE7UUFDNUQsSUFBSSxRQUE4QixDQUFBO1FBQ2xDLElBQUksT0FBTyxDQUFDLFFBQVEsRUFBRTtZQUNwQixRQUFRLEdBQUcscUJBQVcsQ0FBQyxPQUFPLENBQUMsT0FBTyxDQUFDLFFBQVEsRUFBRSxPQUFPLENBQUMsWUFBWSxDQUFDLENBQUE7U0FDdkU7YUFBTSxJQUFJLE9BQU8sQ0FBQyxhQUFhLEVBQUU7WUFDaEMsUUFBUSxHQUFHLE9BQU8sQ0FBQyxhQUFhLENBQUE7U0FDakM7YUFBTSxJQUFJLE9BQU8sQ0FBQyxNQUFNLEVBQUU7WUFDekIsUUFBUSxHQUFHLE9BQU8sQ0FBQyxPQUFPLENBQUMsT0FBTyxDQUFDLE1BQU0sQ0FBQyxDQUFBO1NBQzNDO2FBQU07WUFDTCxNQUFNLElBQUksS0FBSyxDQUFDLG9EQUFvRCxDQUFDLENBQUE7U0FDdEU7UUFDRCxJQUFBLGdCQUFNLEVBQUMsQ0FBQyxDQUFDLFFBQVEsRUFBRSwwQkFBMEIsQ0FBQyxDQUFBO1FBQzlDLElBQUksQ0FBQyxPQUFPLEdBQUcsUUFBUSxDQUFBO1FBQ3ZCLElBQUksQ0FBQyxPQUFPLEdBQUcsT0FBTyxDQUFBO1FBQ3RCLElBQUksQ0FBQyxXQUFXLEdBQUcsUUFBUSxDQUFDLElBQUksQ0FBQyxLQUFLLEVBQUUsR0FBRyxFQUFFLEVBQUU7WUFDN0MsTUFBTSxVQUFVLEdBQUcsR0FBRztpQkFDbkIsRUFBRSxDQUFDLE9BQU8sQ0FBQyxNQUFNLENBQUM7aUJBQ2xCLFVBQVUsQ0FBc0IsT0FBTyxDQUFDLGNBQWMsQ0FBQyxDQUFBO1lBQzFELE1BQU0sSUFBSSxDQUFDLGFBQWEsQ0FBQyxVQUFVLENBQUMsQ0FBQTtZQUNwQyxPQUFPLFVBQVUsQ0FBQTtRQUNuQixDQUFDLENBQUMsQ0FBQTtRQUNGLElBQUksT0FBTyxDQUFDLE1BQU0sQ0FBQyxNQUFNLEVBQUU7WUFDekIsSUFBSSxDQUFDLE1BQU0sR0FBRyxPQUFPLENBQUMsVUFBVSxDQUFDLENBQUMsT0FBTyxDQUFDLE1BQU0sQ0FBQyxDQUFBO1NBQ2xEO0lBQ0gsQ0FBQztJQUVELE1BQU0sQ0FBQyxNQUFNLENBQUMsT0FBNEI7UUFDeEMsT0FBTyxJQUFJLFVBQVUsQ0FBQyxPQUFPLENBQUMsQ0FBQTtJQUNoQyxDQUFDO0lBRU8sYUFBYSxDQUNuQixVQUEyQztRQUUzQyxNQUFNLFdBQVcsR0FBRyxHQUFHLEVBQUUsQ0FBQyxDQUFDO1lBQ3pCLE9BQU8sRUFBRTtnQkFDUCxHQUFHLEVBQUUsSUFBSSxJQUFJLEVBQUU7YUFDaEI7U0FDRixDQUFDLENBQUE7UUFDRixRQUFRLElBQUksQ0FBQyxPQUFPLENBQUMsVUFBVSxFQUFFO1lBQy9CLEtBQUssUUFBUTtnQkFDWCxLQUFLLENBQUMsNEJBQTRCLENBQUMsQ0FBQTtnQkFDbkMsT0FBTyxVQUFVLENBQUMsV0FBVyxDQUMzQixFQUFFLE9BQU8sRUFBRSxDQUFDLEVBQUUsRUFDZDtvQkFDRSxVQUFVLEVBQUUsSUFBSTtvQkFDaEIsa0JBQWtCLEVBQUUsQ0FBQztpQkFDdEIsQ0FDRixDQUFBO1lBQ0gsS0FBSyxVQUFVO2dCQUNiLEtBQUssQ0FBQyx5Q0FBeUMsQ0FBQyxDQUFBO2dCQUNoRCxJQUFJLENBQUMsS0FBSyxHQUFHLFdBQVcsQ0FDdEIsR0FBRyxFQUFFLENBQ0gsVUFBVSxDQUFDLFVBQVUsQ0FBQyxXQUFXLEVBQUUsRUFBRTtvQkFDbkMsWUFBWSxFQUFFO3dCQUNaLENBQUMsRUFBRSxDQUFDO3dCQUNKLENBQUMsRUFBRSxLQUFLO3FCQUNUO2lCQUNGLENBQUMsRUFDSixJQUFJLENBQUMsT0FBTyxDQUFDLGtCQUFrQixHQUFHLElBQUksR0FBRyxFQUFFLENBQzVDLENBQUE7Z0JBQ0QsSUFBSSxDQUFDLEtBQUssQ0FBQyxLQUFLLEVBQUUsQ0FBQTtnQkFDbEIsT0FBTyxPQUFPLENBQUMsT0FBTyxFQUFFLENBQUE7WUFDMUIsS0FBSyxVQUFVLENBQUM7WUFDaEI7Z0JBQ0UsT0FBTyxPQUFPLENBQUMsT0FBTyxFQUFFLENBQUE7U0FDM0I7SUFDSCxDQUFDO0lBRU8sZ0JBQWdCLENBQUMsU0FBaUI7UUFDeEMsSUFDRSxJQUFJLENBQUMsT0FBTyxDQUFDLFdBQVc7WUFDeEIsT0FBTyxJQUFJLENBQUMsT0FBTyxDQUFDLFdBQVcsS0FBSyxVQUFVLEVBQzlDO1lBQ0EsT0FBTyxJQUFJLENBQUMsT0FBTyxDQUFDLFdBQVcsQ0FBQyxTQUFTLENBQUMsQ0FBQTtTQUMzQztRQUNELE9BQU8sU0FBUyxDQUFBO0lBQ2xCLENBQUM7SUFFRDs7O09BR0c7SUFDSCxJQUFZLFNBQVM7UUFDbkIsSUFBSSxDQUFDLElBQUksQ0FBQyxNQUFNLEVBQUU7WUFDaEIsTUFBTSxJQUFJLEtBQUssQ0FBQyxrREFBa0QsQ0FBQyxDQUFBO1NBQ3BFO1FBQ0QsT0FBTyxjQUFJLENBQUMsU0FBUyxDQUFDLElBQUksQ0FBQyxNQUFNLENBQUMsR0FBRyxDQUFDLENBQUMsSUFBSSxDQUFDLElBQUksQ0FBQyxNQUFNLENBQUMsQ0FBQTtJQUMxRCxDQUFDO0lBRUQ7OztPQUdHO0lBQ0ssS0FBSyxDQUFDLGNBQWMsQ0FDMUIsT0FBK0M7UUFFL0MsSUFBSSxJQUFJLENBQUMsTUFBTSxJQUFJLE9BQU8sRUFBRTtZQUMxQixNQUFNLFNBQVMsR0FBRyxNQUFNLElBQUksQ0FBQyxTQUFTLENBQ3BDLElBQUksQ0FBQyxPQUFPLENBQUMsTUFBTSxDQUFDLE1BQWdCLEVBQ3BDLE9BQU8sQ0FBQyxPQUFPLENBQ2hCLENBQUMsS0FBSyxDQUFDLENBQUMsR0FBRyxFQUFFLEVBQUU7Z0JBQ2QsTUFBTSxJQUFJLEtBQUssQ0FBQyxHQUFHLENBQUMsQ0FBQTtZQUN0QixDQUFDLENBQUMsQ0FBQTtZQUNGLGFBQWE7WUFDYixPQUFPLENBQUMsT0FBTyxHQUFHLElBQUksQ0FBQyxLQUFLLENBQUMsU0FBUyxDQUFDLENBQUE7U0FDeEM7SUFDSCxDQUFDO0lBRUQ7OztPQUdHO0lBQ0gsR0FBRyxDQUNELEdBQVcsRUFDWCxRQUFrRTtRQUVsRSxDQUFDO1FBQUEsQ0FBQyxLQUFLLElBQUksRUFBRTtZQUNYLElBQUk7Z0JBQ0YsS0FBSyxDQUFDLGtCQUFrQixHQUFHLEVBQUUsQ0FBQyxDQUFBO2dCQUM5QixNQUFNLFVBQVUsR0FBRyxNQUFNLElBQUksQ0FBQyxXQUFXLENBQUE7Z0JBQ3pDLE1BQU0sT0FBTyxHQUFHLE1BQU0sVUFBVSxDQUFDLE9BQU8sQ0FBQztvQkFDdkMsR0FBRyxFQUFFLElBQUksQ0FBQyxnQkFBZ0IsQ0FBQyxHQUFHLENBQUM7b0JBQy9CLEdBQUcsRUFBRTt3QkFDSCxFQUFFLE9BQU8sRUFBRSxFQUFFLE9BQU8sRUFBRSxLQUFLLEVBQUUsRUFBRTt3QkFDL0IsRUFBRSxPQUFPLEVBQUUsRUFBRSxHQUFHLEVBQUUsSUFBSSxJQUFJLEVBQUUsRUFBRSxFQUFFO3FCQUNqQztpQkFDRixDQUFDLENBQUE7Z0JBQ0YsSUFBSSxJQUFJLENBQUMsTUFBTSxJQUFJLE9BQU8sRUFBRTtvQkFDMUIsTUFBTSxJQUFJLENBQUMsY0FBYyxDQUN2QixPQUF5QyxDQUMxQyxDQUFDLEtBQUssQ0FBQyxDQUFDLEdBQUcsRUFBRSxFQUFFLENBQUMsUUFBUSxDQUFDLEdBQUcsQ0FBQyxDQUFDLENBQUE7aUJBQ2hDO2dCQUNELE1BQU0sQ0FBQyxHQUNMLE9BQU8sSUFBSSxJQUFJLENBQUMsa0JBQWtCLENBQUMsV0FBVyxDQUFDLE9BQU8sQ0FBQyxPQUFPLENBQUMsQ0FBQTtnQkFDakUsSUFBSSxJQUFJLENBQUMsT0FBTyxDQUFDLFVBQVUsR0FBRyxDQUFDLEtBQUksT0FBTyxhQUFQLE9BQU8sdUJBQVAsT0FBTyxDQUFFLFlBQVksQ0FBQSxFQUFFO29CQUN4RCxDQUFDLENBQUMsWUFBWSxHQUFHLE9BQU8sQ0FBQyxZQUFZLENBQUE7aUJBQ3RDO2dCQUNELElBQUksQ0FBQyxJQUFJLENBQUMsS0FBSyxFQUFFLEdBQUcsQ0FBQyxDQUFBO2dCQUNyQixRQUFRLENBQUMsSUFBSSxFQUFFLENBQUMsS0FBSyxTQUFTLENBQUMsQ0FBQyxDQUFDLElBQUksQ0FBQyxDQUFDLENBQUMsQ0FBQyxDQUFDLENBQUE7YUFDM0M7WUFBQyxPQUFPLEtBQUssRUFBRTtnQkFDZCxRQUFRLENBQUMsS0FBSyxDQUFDLENBQUE7YUFDaEI7UUFDSCxDQUFDLENBQUMsRUFBRSxDQUFBO0lBQ04sQ0FBQztJQUVEOzs7O09BSUc7SUFDSCxHQUFHLENBQ0QsR0FBVyxFQUNYLE9BQTRCLEVBQzVCLFdBQStCLElBQUk7UUFFbkMsQ0FBQztRQUFBLENBQUMsS0FBSyxJQUFJLEVBQUU7O1lBQ1gsSUFBSTtnQkFDRixLQUFLLENBQUMsa0JBQWtCLEdBQUcsRUFBRSxDQUFDLENBQUE7Z0JBQzlCLHVFQUF1RTtnQkFDdkUsYUFBYTtnQkFDYixJQUFJLElBQUksQ0FBQyxPQUFPLENBQUMsVUFBVSxHQUFHLENBQUMsS0FBSSxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsWUFBWSxDQUFBLEVBQUU7b0JBQ3hELGFBQWE7b0JBQ2IsT0FBTyxPQUFPLENBQUMsWUFBWSxDQUFBO2lCQUM1QjtnQkFDRCxNQUFNLENBQUMsR0FBd0I7b0JBQzdCLEdBQUcsRUFBRSxJQUFJLENBQUMsZ0JBQWdCLENBQUMsR0FBRyxDQUFDO29CQUMvQixPQUFPLEVBQUUsSUFBSSxDQUFDLGtCQUFrQixDQUFDLFNBQVMsQ0FBQyxPQUFPLENBQUM7aUJBQ3BELENBQUE7Z0JBQ0Qsa0JBQWtCO2dCQUNsQixJQUFJLE1BQUEsT0FBTyxhQUFQLE9BQU8sdUJBQVAsT0FBTyxDQUFFLE1BQU0sMENBQUUsT0FBTyxFQUFFO29CQUM1QixDQUFDLENBQUMsT0FBTyxHQUFHLElBQUksSUFBSSxDQUFDLE9BQU8sQ0FBQyxNQUFNLENBQUMsT0FBTyxDQUFDLENBQUE7aUJBQzdDO3FCQUFNO29CQUNMLGlEQUFpRDtvQkFDakQsdURBQXVEO29CQUN2RCwyQkFBMkI7b0JBQzNCLEVBQUU7b0JBQ0YsaURBQWlEO29CQUNqRCx5REFBeUQ7b0JBQ3pELDJDQUEyQztvQkFDM0MsQ0FBQyxDQUFDLE9BQU8sR0FBRyxJQUFJLElBQUksQ0FBQyxJQUFJLENBQUMsR0FBRyxFQUFFLEdBQUcsSUFBSSxDQUFDLE9BQU8sQ0FBQyxHQUFHLEdBQUcsSUFBSSxDQUFDLENBQUE7aUJBQzNEO2dCQUNELHVCQUF1QjtnQkFDdkIsSUFBSSxJQUFJLENBQUMsT0FBTyxDQUFDLFVBQVUsR0FBRyxDQUFDLEVBQUU7b0JBQy9CLENBQUMsQ0FBQyxZQUFZLEdBQUcsSUFBSSxJQUFJLEVBQUUsQ0FBQTtpQkFDNUI7Z0JBQ0QsSUFBSSxJQUFJLENBQUMsTUFBTSxFQUFFO29CQUNmLE1BQU0sU0FBUyxHQUFHLGNBQUksQ0FBQyxTQUFTLENBQUMsSUFBSSxDQUFDLE1BQU0sQ0FBQyxHQUFHLENBQUMsQ0FBQyxJQUFJLENBQUMsSUFBSSxDQUFDLE1BQU0sQ0FBQyxDQUFBO29CQUNuRSxNQUFNLElBQUksR0FBRyxNQUFNLFNBQVMsQ0FDMUIsSUFBSSxDQUFDLE9BQU8sQ0FBQyxNQUFNLENBQUMsTUFBZ0IsRUFDcEMsQ0FBQyxDQUFDLE9BQU8sQ0FDVixDQUFDLEtBQUssQ0FBQyxDQUFDLEdBQUcsRUFBRSxFQUFFO3dCQUNkLE1BQU0sSUFBSSxLQUFLLENBQUMsR0FBRyxDQUFDLENBQUE7b0JBQ3RCLENBQUMsQ0FBQyxDQUFBO29CQUNGLENBQUMsQ0FBQyxPQUFPLEdBQUcsSUFBc0MsQ0FBQTtpQkFDbkQ7Z0JBQ0QsTUFBTSxVQUFVLEdBQUcsTUFBTSxJQUFJLENBQUMsV0FBVyxDQUFBO2dCQUN6QyxNQUFNLE9BQU8sR0FBRyxNQUFNLFVBQVUsQ0FBQyxTQUFTLENBQ3hDLEVBQUUsR0FBRyxFQUFFLENBQUMsQ0FBQyxHQUFHLEVBQUUsRUFDZCxFQUFFLElBQUksRUFBRSxDQUFDLEVBQUUsRUFDWDtvQkFDRSxNQUFNLEVBQUUsSUFBSTtvQkFDWixZQUFZLEVBQUUsSUFBSSxDQUFDLE9BQU8sQ0FBQyxxQkFBcUI7aUJBQ2pELENBQ0YsQ0FBQTtnQkFDRCxJQUFJLE9BQU8sQ0FBQyxhQUFhLEdBQUcsQ0FBQyxFQUFFO29CQUM3QixJQUFJLENBQUMsSUFBSSxDQUFDLFFBQVEsRUFBRSxHQUFHLENBQUMsQ0FBQTtpQkFDekI7cUJBQU07b0JBQ0wsSUFBSSxDQUFDLElBQUksQ0FBQyxRQUFRLEVBQUUsR0FBRyxDQUFDLENBQUE7aUJBQ3pCO2dCQUNELElBQUksQ0FBQyxJQUFJLENBQUMsS0FBSyxFQUFFLEdBQUcsQ0FBQyxDQUFBO2FBQ3RCO1lBQUMsT0FBTyxLQUFLLEVBQUU7Z0JBQ2QsT0FBTyxRQUFRLENBQUMsS0FBSyxDQUFDLENBQUE7YUFDdkI7WUFDRCxPQUFPLFFBQVEsQ0FBQyxJQUFJLENBQUMsQ0FBQTtRQUN2QixDQUFDLENBQUMsRUFBRSxDQUFBO0lBQ04sQ0FBQztJQUVELEtBQUssQ0FDSCxHQUFXLEVBQ1gsT0FBc0QsRUFDdEQsV0FBK0IsSUFBSTtRQUVuQyxDQUFDO1FBQUEsQ0FBQyxLQUFLLElBQUksRUFBRTs7WUFDWCxJQUFJO2dCQUNGLEtBQUssQ0FBQyxvQkFBb0IsR0FBRyxFQUFFLENBQUMsQ0FBQTtnQkFDaEMsTUFBTSxZQUFZLEdBSWQsRUFBRSxDQUFBO2dCQUNOLE1BQU0sVUFBVSxHQUFHLElBQUksQ0FBQyxPQUFPLENBQUMsVUFBVSxHQUFHLElBQUksQ0FBQTtnQkFDakQsTUFBTSxZQUFZLEdBQUcsT0FBTyxDQUFDLFlBQVk7b0JBQ3ZDLENBQUMsQ0FBQyxPQUFPLENBQUMsWUFBWSxDQUFDLE9BQU8sRUFBRTtvQkFDaEMsQ0FBQyxDQUFDLENBQUMsQ0FBQTtnQkFDTCxNQUFNLFdBQVcsR0FBRyxJQUFJLElBQUksRUFBRSxDQUFBO2dCQUU5QiwrREFBK0Q7Z0JBQy9ELDREQUE0RDtnQkFDNUQsc0RBQXNEO2dCQUN0RCxJQUFJLFVBQVUsR0FBRyxDQUFDLElBQUksWUFBWSxHQUFHLENBQUMsRUFBRTtvQkFDdEMsTUFBTSxXQUFXLEdBQUcsV0FBVyxDQUFDLE9BQU8sRUFBRSxHQUFHLFlBQVksQ0FBQTtvQkFDeEQsSUFBSSxXQUFXLEdBQUcsVUFBVSxFQUFFO3dCQUM1QixLQUFLLENBQUMseUJBQXlCLEdBQUcsRUFBRSxDQUFDLENBQUE7d0JBQ3JDLE9BQU8sUUFBUSxDQUFDLElBQUksQ0FBQyxDQUFBO3FCQUN0QjtvQkFDRCxZQUFZLENBQUMsWUFBWSxHQUFHLFdBQVcsQ0FBQTtpQkFDeEM7Z0JBRUQsSUFBSSxNQUFBLE9BQU8sYUFBUCxPQUFPLHVCQUFQLE9BQU8sQ0FBRSxNQUFNLDBDQUFFLE9BQU8sRUFBRTtvQkFDNUIsWUFBWSxDQUFDLE9BQU8sR0FBRyxJQUFJLElBQUksQ0FBQyxPQUFPLENBQUMsTUFBTSxDQUFDLE9BQU8sQ0FBQyxDQUFBO2lCQUN4RDtxQkFBTTtvQkFDTCxZQUFZLENBQUMsT0FBTyxHQUFHLElBQUksSUFBSSxDQUFDLElBQUksQ0FBQyxHQUFHLEVBQUUsR0FBRyxJQUFJLENBQUMsT0FBTyxDQUFDLEdBQUcsR0FBRyxJQUFJLENBQUMsQ0FBQTtpQkFDdEU7Z0JBQ0QsTUFBTSxVQUFVLEdBQUcsTUFBTSxJQUFJLENBQUMsV0FBVyxDQUFBO2dCQUN6QyxNQUFNLE9BQU8sR0FBRyxNQUFNLFVBQVUsQ0FBQyxTQUFTLENBQ3hDLEVBQUUsR0FBRyxFQUFFLElBQUksQ0FBQyxnQkFBZ0IsQ0FBQyxHQUFHLENBQUMsRUFBRSxFQUNuQyxFQUFFLElBQUksRUFBRSxZQUFZLEVBQUUsRUFDdEIsRUFBRSxZQUFZLEVBQUUsSUFBSSxDQUFDLE9BQU8sQ0FBQyxxQkFBcUIsRUFBRSxDQUNyRCxDQUFBO2dCQUNELElBQUksT0FBTyxDQUFDLFlBQVksS0FBSyxDQUFDLEVBQUU7b0JBQzlCLE9BQU8sUUFBUSxDQUFDLElBQUksS0FBSyxDQUFDLHFDQUFxQyxDQUFDLENBQUMsQ0FBQTtpQkFDbEU7cUJBQU07b0JBQ0wsSUFBSSxDQUFDLElBQUksQ0FBQyxPQUFPLEVBQUUsR0FBRyxFQUFFLE9BQU8sQ0FBQyxDQUFBO29CQUNoQyxPQUFPLFFBQVEsQ0FBQyxJQUFJLENBQUMsQ0FBQTtpQkFDdEI7YUFDRjtZQUFDLE9BQU8sS0FBSyxFQUFFO2dCQUNkLE9BQU8sUUFBUSxDQUFDLEtBQUssQ0FBQyxDQUFBO2FBQ3ZCO1FBQ0gsQ0FBQyxDQUFDLEVBQUUsQ0FBQTtJQUNOLENBQUM7SUFFRDs7T0FFRztJQUNILEdBQUcsQ0FDRCxRQU1TO1FBRVQsQ0FBQztRQUFBLENBQUMsS0FBSyxJQUFJLEVBQUU7WUFDWCxJQUFJO2dCQUNGLEtBQUssQ0FBQyxrQkFBa0IsQ0FBQyxDQUFBO2dCQUN6QixNQUFNLFVBQVUsR0FBRyxNQUFNLElBQUksQ0FBQyxXQUFXLENBQUE7Z0JBQ3pDLE1BQU0sUUFBUSxHQUFHLFVBQVUsQ0FBQyxJQUFJLENBQUM7b0JBQy9CLEdBQUcsRUFBRTt3QkFDSCxFQUFFLE9BQU8sRUFBRSxFQUFFLE9BQU8sRUFBRSxLQUFLLEVBQUUsRUFBRTt3QkFDL0IsRUFBRSxPQUFPLEVBQUUsRUFBRSxHQUFHLEVBQUUsSUFBSSxJQUFJLEVBQUUsRUFBRSxFQUFFO3FCQUNqQztpQkFDRixDQUFDLENBQUE7Z0JBQ0YsTUFBTSxPQUFPLEdBQTBCLEVBQUUsQ0FBQTtnQkFDekMsSUFBSSxLQUFLLEVBQUUsTUFBTSxPQUFPLElBQUksUUFBUSxFQUFFO29CQUNwQyxJQUFJLElBQUksQ0FBQyxNQUFNLElBQUksT0FBTyxFQUFFO3dCQUMxQixNQUFNLElBQUksQ0FBQyxjQUFjLENBQUMsT0FBeUMsQ0FBQyxDQUFBO3FCQUNyRTtvQkFDRCxPQUFPLENBQUMsSUFBSSxDQUFDLElBQUksQ0FBQyxrQkFBa0IsQ0FBQyxXQUFXLENBQUMsT0FBTyxDQUFDLE9BQU8sQ0FBQyxDQUFDLENBQUE7aUJBQ25FO2dCQUNELElBQUksQ0FBQyxJQUFJLENBQUMsS0FBSyxFQUFFLE9BQU8sQ0FBQyxDQUFBO2dCQUN6QixRQUFRLENBQUMsSUFBSSxFQUFFLE9BQU8sQ0FBQyxDQUFBO2FBQ3hCO1lBQUMsT0FBTyxLQUFLLEVBQUU7Z0JBQ2QsUUFBUSxDQUFDLEtBQUssQ0FBQyxDQUFBO2FBQ2hCO1FBQ0gsQ0FBQyxDQUFDLEVBQUUsQ0FBQTtJQUNOLENBQUM7SUFFRDs7O09BR0c7SUFDSCxPQUFPLENBQUMsR0FBVyxFQUFFLFdBQStCLElBQUk7UUFDdEQsS0FBSyxDQUFDLHNCQUFzQixHQUFHLEVBQUUsQ0FBQyxDQUFBO1FBQ2xDLElBQUksQ0FBQyxXQUFXO2FBQ2IsSUFBSSxDQUFDLENBQUMsVUFBVSxFQUFFLEVBQUUsQ0FDbkIsVUFBVSxDQUFDLFNBQVMsQ0FDbEIsRUFBRSxHQUFHLEVBQUUsSUFBSSxDQUFDLGdCQUFnQixDQUFDLEdBQUcsQ0FBQyxFQUFFLEVBQ25DLEVBQUUsWUFBWSxFQUFFLElBQUksQ0FBQyxPQUFPLENBQUMscUJBQXFCLEVBQUUsQ0FDckQsQ0FDRjthQUNBLElBQUksQ0FBQyxHQUFHLEVBQUU7WUFDVCxJQUFJLENBQUMsSUFBSSxDQUFDLFNBQVMsRUFBRSxHQUFHLENBQUMsQ0FBQTtZQUN6QixRQUFRLENBQUMsSUFBSSxDQUFDLENBQUE7UUFDaEIsQ0FBQyxDQUFDO2FBQ0QsS0FBSyxDQUFDLENBQUMsR0FBRyxFQUFFLEVBQUUsQ0FBQyxRQUFRLENBQUMsR0FBRyxDQUFDLENBQUMsQ0FBQTtJQUNsQyxDQUFDO0lBRUQ7O09BRUc7SUFDSCxNQUFNLENBQUMsUUFBNEM7UUFDakQsS0FBSyxDQUFDLHFCQUFxQixDQUFDLENBQUE7UUFDNUIsSUFBSSxDQUFDLFdBQVc7YUFDYixJQUFJLENBQUMsQ0FBQyxVQUFVLEVBQUUsRUFBRSxDQUFDLFVBQVUsQ0FBQyxjQUFjLEVBQUUsQ0FBQzthQUNqRCxJQUFJLENBQUMsQ0FBQyxDQUFDLEVBQUUsRUFBRSxDQUFDLFFBQVEsQ0FBQyxJQUFJLEVBQUUsQ0FBQyxDQUFDLENBQUM7WUFDL0IsYUFBYTthQUNaLEtBQUssQ0FBQyxDQUFDLEdBQUcsRUFBRSxFQUFFLENBQUMsUUFBUSxDQUFDLEdBQUcsQ0FBQyxDQUFDLENBQUE7SUFDbEMsQ0FBQztJQUVEOztPQUVHO0lBQ0gsS0FBSyxDQUFDLFdBQStCLElBQUk7UUFDdkMsS0FBSyxDQUFDLG9CQUFvQixDQUFDLENBQUE7UUFDM0IsSUFBSSxDQUFDLFdBQVc7YUFDYixJQUFJLENBQUMsQ0FBQyxVQUFVLEVBQUUsRUFBRSxDQUFDLFVBQVUsQ0FBQyxJQUFJLEVBQUUsQ0FBQzthQUN2QyxJQUFJLENBQUMsR0FBRyxFQUFFLENBQUMsUUFBUSxDQUFDLElBQUksQ0FBQyxDQUFDO2FBQzFCLEtBQUssQ0FBQyxDQUFDLEdBQUcsRUFBRSxFQUFFLENBQUMsUUFBUSxDQUFDLEdBQUcsQ0FBQyxDQUFDLENBQUE7SUFDbEMsQ0FBQztJQUVEOztPQUVHO0lBQ0gsS0FBSztRQUNILEtBQUssQ0FBQyxvQkFBb0IsQ0FBQyxDQUFBO1FBQzNCLE9BQU8sSUFBSSxDQUFDLE9BQU8sQ0FBQyxJQUFJLENBQUMsQ0FBQyxDQUFDLEVBQUUsRUFBRSxDQUFDLENBQUMsQ0FBQyxLQUFLLEVBQUUsQ0FBQyxDQUFBO0lBQzVDLENBQUM7Q0FDRjtBQW5hRCw2QkFtYUMifQ== \ No newline at end of file diff --git a/node_modules/connect-mongo/build/main/lib/MongoStore.spec.d.ts b/node_modules/connect-mongo/build/main/lib/MongoStore.spec.d.ts new file mode 100644 index 0000000..cb0ff5c --- /dev/null +++ b/node_modules/connect-mongo/build/main/lib/MongoStore.spec.d.ts @@ -0,0 +1 @@ +export {}; diff --git a/node_modules/connect-mongo/build/main/lib/MongoStore.spec.js b/node_modules/connect-mongo/build/main/lib/MongoStore.spec.js new file mode 100644 index 0000000..09f72c7 --- /dev/null +++ b/node_modules/connect-mongo/build/main/lib/MongoStore.spec.js @@ -0,0 +1,326 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const ava_1 = __importDefault(require("ava")); +const mongodb_1 = require("mongodb"); +const MongoStore_1 = __importDefault(require("./MongoStore")); +const testHelper_1 = require("../test/testHelper"); +let { store, storePromise } = (0, testHelper_1.createStoreHelper)(); +ava_1.default.before(async () => { + await storePromise.clear().catch((err) => { + if (err.message.match(/ns not found/)) { + return null; + } + else { + throw err; + } + }); +}); +ava_1.default.afterEach.always(async () => { + await storePromise.close(); +}); +ava_1.default.serial('create store w/o provide required options', (t) => { + t.throws(() => MongoStore_1.default.create({}), { + message: /Cannot init client/, + }); +}); +ava_1.default.serial('create store with clientPromise', async (t) => { + const clientP = mongodb_1.MongoClient.connect('mongodb://root:example@127.0.0.1:27017'); + const store = MongoStore_1.default.create({ clientPromise: clientP }); + t.not(store, null); + t.not(store, undefined); + await store.collectionP; + store.close(); +}); +ava_1.default.serial('create store with client', async (t) => { + const client = await mongodb_1.MongoClient.connect('mongodb://root:example@127.0.0.1:27017'); + const store = MongoStore_1.default.create({ client: client }); + t.not(store, null); + t.not(store, undefined); + await store.collectionP; + store.close(); +}); +ava_1.default.serial('length should be 0', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const length = await storePromise.length(); + t.is(length, 0); +}); +ava_1.default.serial('get non-exist session should throw error', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const res = await storePromise.get('fake-sid'); + t.is(res, null); +}); +ava_1.default.serial('get all session should work for no session', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const allSessions = await storePromise.all(); + t.deepEqual(allSessions, []); +}); +ava_1.default.serial('basic operation flow', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + let orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-basic-flow'; + const res = await storePromise.set(sid, orgSession); + t.is(res, undefined); + const session = await storePromise.get(sid); + t.is(typeof session, 'object'); + orgSession = JSON.parse(JSON.stringify(orgSession)); + t.deepEqual(session, orgSession); + const allSessions = await storePromise.all(); + t.deepEqual(allSessions, [orgSession]); + t.is(await storePromise.length(), 1); + const err = await storePromise.destroy(sid); + t.is(err, undefined); + t.is(await storePromise.length(), 0); +}); +ava_1.default.serial.cb('set and listen to event', (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + let orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-set-event'; + store.set(sid, orgSession); + orgSession = JSON.parse(JSON.stringify(orgSession)); + store.on('set', (sessionId) => { + t.is(sessionId, sid); + store.get(sid, (err, session) => { + t.is(err, null); + t.is(typeof session, 'object'); + t.deepEqual(session, orgSession); + t.end(); + }); + }); +}); +ava_1.default.serial.cb('set and listen to create event', (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-create-event'; + store.set(sid, orgSession); + store.on('create', (sessionId) => { + t.is(sessionId, sid); + t.end(); + }); +}); +ava_1.default.serial.cb('set and listen to update event', (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-update-event'; + store.set(sid, orgSession); + store.set(sid, { ...orgSession, foo: 'new-bar' }); + store.on('update', (sessionId) => { + t.is(sessionId, sid); + t.end(); + }); +}); +ava_1.default.serial('set with no stringify', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ stringify: false })); + const orgSession = (0, testHelper_1.makeData)(); + const cookie = orgSession.cookie; + const sid = 'test-no-stringify'; + const res = await storePromise.set(sid, orgSession); + t.is(res, undefined); + const session = await storePromise.get(sid); + t.is(typeof session, 'object'); + t.deepEqual(orgSession.cookie, cookie); + // @ts-ignore + t.deepEqual(cookie.expires.toJSON(), session.cookie.expires.toJSON()); + // @ts-ignore + t.deepEqual(cookie.secure, session.cookie.secure); + const err = await storePromise.clear(); + t.is(err, undefined); + t.is(await storePromise.length(), 0); +}); +ava_1.default.serial.cb('test destory event', (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-destory-event'; + store.on('destroy', (sessionId) => { + t.is(sessionId, sid); + t.end(); + }); + storePromise.set(sid, orgSession).then(() => { + store.destroy(sid); + }); +}); +ava_1.default.serial('test set default TTL', async (t) => { + var _a; + const defaultTTL = 10; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ + ttl: defaultTTL, + })); + const orgSession = (0, testHelper_1.makeDataNoCookie)(); + const sid = 'test-set-default-ttl'; + const timeBeforeSet = new Date().valueOf(); + // @ts-ignore + await storePromise.set(sid, orgSession); + const collection = await store.collectionP; + const session = await collection.findOne({ _id: sid }); + const timeAfterSet = new Date().valueOf(); + const expires = (_a = session === null || session === void 0 ? void 0 : session.expires) === null || _a === void 0 ? void 0 : _a.valueOf(); + t.truthy(expires); + if (expires) { + t.truthy(timeBeforeSet + defaultTTL * 1000 <= expires); + t.truthy(expires <= timeAfterSet + defaultTTL * 1000); + } +}); +ava_1.default.serial('test default TTL', async (t) => { + var _a; + const defaultExpirationTime = 1000 * 60 * 60 * 24 * 14; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const orgSession = (0, testHelper_1.makeDataNoCookie)(); + const sid = 'test-no-set-default-ttl'; + const timeBeforeSet = new Date().valueOf(); + // @ts-ignore + await storePromise.set(sid, orgSession); + const collection = await store.collectionP; + const session = await collection.findOne({ _id: sid }); + const timeAfterSet = new Date().valueOf(); + const expires = (_a = session === null || session === void 0 ? void 0 : session.expires) === null || _a === void 0 ? void 0 : _a.valueOf(); + t.truthy(expires); + if (expires) { + t.truthy(timeBeforeSet + defaultExpirationTime <= expires); + t.truthy(expires <= timeAfterSet + defaultExpirationTime); + } +}); +ava_1.default.serial('test custom serializer', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ + serialize: (obj) => { + obj.ice = 'test-ice-serializer'; + return JSON.stringify(obj); + }, + })); + const orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-custom-serializer'; + await storePromise.set(sid, orgSession); + const session = await storePromise.get(sid); + t.is(typeof session, 'string'); + t.not(session, undefined); + // @ts-ignore + orgSession.ice = 'test-ice-serializer'; + // @ts-ignore + t.is(session, JSON.stringify(orgSession)); +}); +ava_1.default.serial('test custom deserializer', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ + unserialize: (obj) => { + obj.ice = 'test-ice-deserializer'; + return obj; + }, + })); + const orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-custom-deserializer'; + await storePromise.set(sid, orgSession); + const session = await storePromise.get(sid); + t.is(typeof session, 'object'); + // @ts-ignore + orgSession.cookie = orgSession.cookie.toJSON(); + // @ts-ignore + orgSession.ice = 'test-ice-deserializer'; + t.not(session, undefined); + t.deepEqual(session, orgSession); +}); +ava_1.default.serial('touch ops', async (t) => { + var _a, _b, _c, _d; + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)()); + const orgSession = (0, testHelper_1.makeDataNoCookie)(); + const sid = 'test-touch'; + // @ts-ignore + await storePromise.set(sid, orgSession); + const collection = await store.collectionP; + const session = await collection.findOne({ _id: sid }); + await new Promise((resolve) => setTimeout(resolve, 500)); + t.not(session, undefined); + await storePromise.touch(sid, session === null || session === void 0 ? void 0 : session.session); + const session2 = await collection.findOne({ _id: sid }); + t.not(session2, undefined); + // Check if both expiry date are different + t.truthy((_a = session2 === null || session2 === void 0 ? void 0 : session2.expires) === null || _a === void 0 ? void 0 : _a.getTime()); + t.truthy((_b = session === null || session === void 0 ? void 0 : session.expires) === null || _b === void 0 ? void 0 : _b.getTime()); + if (((_c = session === null || session === void 0 ? void 0 : session.expires) === null || _c === void 0 ? void 0 : _c.getTime()) && ((_d = session2 === null || session2 === void 0 ? void 0 : session2.expires) === null || _d === void 0 ? void 0 : _d.getTime())) { + t.truthy((session2 === null || session2 === void 0 ? void 0 : session2.expires.getTime()) > (session === null || session === void 0 ? void 0 : session.expires.getTime())); + } +}); +ava_1.default.serial('touch ops with touchAfter', async (t) => { + var _a, _b; + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ touchAfter: 1 })); + const orgSession = (0, testHelper_1.makeDataNoCookie)(); + const sid = 'test-touch-with-touchAfter'; + // @ts-ignore + await storePromise.set(sid, orgSession); + const collection = await store.collectionP; + const session = await collection.findOne({ _id: sid }); + const lastModifiedBeforeTouch = (_a = session === null || session === void 0 ? void 0 : session.lastModified) === null || _a === void 0 ? void 0 : _a.getTime(); + t.not(session, undefined); + await storePromise.touch(sid, session); + const session2 = await collection.findOne({ _id: sid }); + t.not(session2, undefined); + const lastModifiedAfterTouch = (_b = session2 === null || session2 === void 0 ? void 0 : session2.lastModified) === null || _b === void 0 ? void 0 : _b.getTime(); + // Check if both expiry date are different + t.is(lastModifiedBeforeTouch, lastModifiedAfterTouch); +}); +ava_1.default.serial('touch ops with touchAfter with touch', async (t) => { + var _a, _b; + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ touchAfter: 1 })); + const orgSession = (0, testHelper_1.makeDataNoCookie)(); + const sid = 'test-touch-with-touchAfter-should-touch'; + // @ts-ignore + await storePromise.set(sid, orgSession); + const collection = await store.collectionP; + const session = await collection.findOne({ _id: sid }); + const lastModifiedBeforeTouch = (_a = session === null || session === void 0 ? void 0 : session.lastModified) === null || _a === void 0 ? void 0 : _a.getTime(); + await new Promise((resolve) => setTimeout(resolve, 1200)); + t.not(session, undefined); + await storePromise.touch(sid, session); + const session2 = await collection.findOne({ _id: sid }); + t.not(session2, undefined); + const lastModifiedAfterTouch = (_b = session2 === null || session2 === void 0 ? void 0 : session2.lastModified) === null || _b === void 0 ? void 0 : _b.getTime(); + // Check if both expiry date are different + t.truthy(lastModifiedAfterTouch); + t.truthy(lastModifiedBeforeTouch); + if (lastModifiedAfterTouch && lastModifiedBeforeTouch) { + t.truthy(lastModifiedAfterTouch > lastModifiedBeforeTouch); + } +}); +ava_1.default.serial('basic operation flow with crypto', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ + crypto: { secret: 'secret' }, + collectionName: 'crypto-test', + autoRemove: 'disabled', + })); + let orgSession = (0, testHelper_1.makeData)(); + const sid = 'test-basic-flow-with-crypto'; + const res = await storePromise.set(sid, orgSession); + t.is(res, undefined); + const session = await storePromise.get(sid); + orgSession = JSON.parse(JSON.stringify(orgSession)); + // @ts-ignore + t.deepEqual(session, orgSession); + const sessions = await storePromise.all(); + t.not(sessions, undefined); + t.not(sessions, null); + t.is(sessions === null || sessions === void 0 ? void 0 : sessions.length, 1); +}); +ava_1.default.serial('with touch after and get non-exist session', async (t) => { + ; + ({ store, storePromise } = (0, testHelper_1.createStoreHelper)({ + touchAfter: 10, + })); + const sid = 'fake-sid-for-test-touch-after'; + const res = await storePromise.get(sid); + t.is(res, null); +}); +//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiTW9uZ29TdG9yZS5zcGVjLmpzIiwic291cmNlUm9vdCI6IiIsInNvdXJjZXMiOlsiLi4vLi4vLi4vc3JjL2xpYi9Nb25nb1N0b3JlLnNwZWMudHMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6Ijs7Ozs7QUFBQSw4Q0FBc0I7QUFFdEIscUNBQXFDO0FBRXJDLDhEQUFxQztBQUNyQyxtREFJMkI7QUFFM0IsSUFBSSxFQUFFLEtBQUssRUFBRSxZQUFZLEVBQUUsR0FBRyxJQUFBLDhCQUFpQixHQUFFLENBQUE7QUFFakQsYUFBSSxDQUFDLE1BQU0sQ0FBQyxLQUFLLElBQUksRUFBRTtJQUNyQixNQUFNLFlBQVksQ0FBQyxLQUFLLEVBQUUsQ0FBQyxLQUFLLENBQUMsQ0FBQyxHQUFHLEVBQUUsRUFBRTtRQUN2QyxJQUFJLEdBQUcsQ0FBQyxPQUFPLENBQUMsS0FBSyxDQUFDLGNBQWMsQ0FBQyxFQUFFO1lBQ3JDLE9BQU8sSUFBSSxDQUFBO1NBQ1o7YUFBTTtZQUNMLE1BQU0sR0FBRyxDQUFBO1NBQ1Y7SUFDSCxDQUFDLENBQUMsQ0FBQTtBQUNKLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLFNBQVMsQ0FBQyxNQUFNLENBQUMsS0FBSyxJQUFJLEVBQUU7SUFDL0IsTUFBTSxZQUFZLENBQUMsS0FBSyxFQUFFLENBQUE7QUFDNUIsQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLDJDQUEyQyxFQUFFLENBQUMsQ0FBQyxFQUFFLEVBQUU7SUFDN0QsQ0FBQyxDQUFDLE1BQU0sQ0FBQyxHQUFHLEVBQUUsQ0FBQyxvQkFBVSxDQUFDLE1BQU0sQ0FBQyxFQUFFLENBQUMsRUFBRTtRQUNwQyxPQUFPLEVBQUUsb0JBQW9CO0tBQzlCLENBQUMsQ0FBQTtBQUNKLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyxpQ0FBaUMsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7SUFDekQsTUFBTSxPQUFPLEdBQUcscUJBQVcsQ0FBQyxPQUFPLENBQUMsd0NBQXdDLENBQUMsQ0FBQTtJQUM3RSxNQUFNLEtBQUssR0FBRyxvQkFBVSxDQUFDLE1BQU0sQ0FBQyxFQUFFLGFBQWEsRUFBRSxPQUFPLEVBQUUsQ0FBQyxDQUFBO0lBQzNELENBQUMsQ0FBQyxHQUFHLENBQUMsS0FBSyxFQUFFLElBQUksQ0FBQyxDQUFBO0lBQ2xCLENBQUMsQ0FBQyxHQUFHLENBQUMsS0FBSyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3ZCLE1BQU0sS0FBSyxDQUFDLFdBQVcsQ0FBQTtJQUN2QixLQUFLLENBQUMsS0FBSyxFQUFFLENBQUE7QUFDZixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsMEJBQTBCLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFO0lBQ2xELE1BQU0sTUFBTSxHQUFHLE1BQU0scUJBQVcsQ0FBQyxPQUFPLENBQ3RDLHdDQUF3QyxDQUN6QyxDQUFBO0lBQ0QsTUFBTSxLQUFLLEdBQUcsb0JBQVUsQ0FBQyxNQUFNLENBQUMsRUFBRSxNQUFNLEVBQUUsTUFBTSxFQUFFLENBQUMsQ0FBQTtJQUNuRCxDQUFDLENBQUMsR0FBRyxDQUFDLEtBQUssRUFBRSxJQUFJLENBQUMsQ0FBQTtJQUNsQixDQUFDLENBQUMsR0FBRyxDQUFDLEtBQUssRUFBRSxTQUFTLENBQUMsQ0FBQTtJQUN2QixNQUFNLEtBQUssQ0FBQyxXQUFXLENBQUE7SUFDdkIsS0FBSyxDQUFDLEtBQUssRUFBRSxDQUFBO0FBQ2YsQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLG9CQUFvQixFQUFFLEtBQUssRUFBRSxDQUFDLEVBQUUsRUFBRTtJQUM1QyxDQUFDO0lBQUEsQ0FBQyxFQUFFLEtBQUssRUFBRSxZQUFZLEVBQUUsR0FBRyxJQUFBLDhCQUFpQixHQUFFLENBQUMsQ0FBQTtJQUNoRCxNQUFNLE1BQU0sR0FBRyxNQUFNLFlBQVksQ0FBQyxNQUFNLEVBQUUsQ0FBQTtJQUMxQyxDQUFDLENBQUMsRUFBRSxDQUFDLE1BQU0sRUFBRSxDQUFDLENBQUMsQ0FBQTtBQUNqQixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsMENBQTBDLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFO0lBQ2xFLENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEdBQUUsQ0FBQyxDQUFBO0lBQ2hELE1BQU0sR0FBRyxHQUFHLE1BQU0sWUFBWSxDQUFDLEdBQUcsQ0FBQyxVQUFVLENBQUMsQ0FBQTtJQUM5QyxDQUFDLENBQUMsRUFBRSxDQUFDLEdBQUcsRUFBRSxJQUFJLENBQUMsQ0FBQTtBQUNqQixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsNENBQTRDLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFO0lBQ3BFLENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEdBQUUsQ0FBQyxDQUFBO0lBQ2hELE1BQU0sV0FBVyxHQUFHLE1BQU0sWUFBWSxDQUFDLEdBQUcsRUFBRSxDQUFBO0lBQzVDLENBQUMsQ0FBQyxTQUFTLENBQUMsV0FBVyxFQUFFLEVBQUUsQ0FBQyxDQUFBO0FBQzlCLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyxzQkFBc0IsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7SUFDOUMsQ0FBQztJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsR0FBRSxDQUFDLENBQUE7SUFDaEQsSUFBSSxVQUFVLEdBQUcsSUFBQSxxQkFBUSxHQUFFLENBQUE7SUFDM0IsTUFBTSxHQUFHLEdBQUcsaUJBQWlCLENBQUE7SUFDN0IsTUFBTSxHQUFHLEdBQUcsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQTtJQUNuRCxDQUFDLENBQUMsRUFBRSxDQUFDLEdBQUcsRUFBRSxTQUFTLENBQUMsQ0FBQTtJQUNwQixNQUFNLE9BQU8sR0FBRyxNQUFNLFlBQVksQ0FBQyxHQUFHLENBQUMsR0FBRyxDQUFDLENBQUE7SUFDM0MsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxPQUFPLE9BQU8sRUFBRSxRQUFRLENBQUMsQ0FBQTtJQUM5QixVQUFVLEdBQUcsSUFBSSxDQUFDLEtBQUssQ0FBQyxJQUFJLENBQUMsU0FBUyxDQUFDLFVBQVUsQ0FBQyxDQUFDLENBQUE7SUFDbkQsQ0FBQyxDQUFDLFNBQVMsQ0FBQyxPQUFPLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDaEMsTUFBTSxXQUFXLEdBQUcsTUFBTSxZQUFZLENBQUMsR0FBRyxFQUFFLENBQUE7SUFDNUMsQ0FBQyxDQUFDLFNBQVMsQ0FBQyxXQUFXLEVBQUUsQ0FBQyxVQUFVLENBQUMsQ0FBQyxDQUFBO0lBQ3RDLENBQUMsQ0FBQyxFQUFFLENBQUMsTUFBTSxZQUFZLENBQUMsTUFBTSxFQUFFLEVBQUUsQ0FBQyxDQUFDLENBQUE7SUFDcEMsTUFBTSxHQUFHLEdBQUcsTUFBTSxZQUFZLENBQUMsT0FBTyxDQUFDLEdBQUcsQ0FBQyxDQUFBO0lBQzNDLENBQUMsQ0FBQyxFQUFFLENBQUMsR0FBRyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3BCLENBQUMsQ0FBQyxFQUFFLENBQUMsTUFBTSxZQUFZLENBQUMsTUFBTSxFQUFFLEVBQUUsQ0FBQyxDQUFDLENBQUE7QUFDdEMsQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLEVBQUUsQ0FBQyx5QkFBeUIsRUFBRSxDQUFDLENBQUMsRUFBRSxFQUFFO0lBQzlDLENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEdBQUUsQ0FBQyxDQUFBO0lBQ2hELElBQUksVUFBVSxHQUFHLElBQUEscUJBQVEsR0FBRSxDQUFBO0lBQzNCLE1BQU0sR0FBRyxHQUFHLGdCQUFnQixDQUFBO0lBQzVCLEtBQUssQ0FBQyxHQUFHLENBQUMsR0FBRyxFQUFFLFVBQVUsQ0FBQyxDQUFBO0lBQzFCLFVBQVUsR0FBRyxJQUFJLENBQUMsS0FBSyxDQUFDLElBQUksQ0FBQyxTQUFTLENBQUMsVUFBVSxDQUFDLENBQUMsQ0FBQTtJQUNuRCxLQUFLLENBQUMsRUFBRSxDQUFDLEtBQUssRUFBRSxDQUFDLFNBQVMsRUFBRSxFQUFFO1FBQzVCLENBQUMsQ0FBQyxFQUFFLENBQUMsU0FBUyxFQUFFLEdBQUcsQ0FBQyxDQUFBO1FBQ3BCLEtBQUssQ0FBQyxHQUFHLENBQUMsR0FBRyxFQUFFLENBQUMsR0FBRyxFQUFFLE9BQU8sRUFBRSxFQUFFO1lBQzlCLENBQUMsQ0FBQyxFQUFFLENBQUMsR0FBRyxFQUFFLElBQUksQ0FBQyxDQUFBO1lBQ2YsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxPQUFPLE9BQU8sRUFBRSxRQUFRLENBQUMsQ0FBQTtZQUM5QixDQUFDLENBQUMsU0FBUyxDQUFDLE9BQU8sRUFBRSxVQUFVLENBQUMsQ0FBQTtZQUNoQyxDQUFDLENBQUMsR0FBRyxFQUFFLENBQUE7UUFDVCxDQUFDLENBQUMsQ0FBQTtJQUNKLENBQUMsQ0FBQyxDQUFBO0FBQ0osQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLEVBQUUsQ0FBQyxnQ0FBZ0MsRUFBRSxDQUFDLENBQUMsRUFBRSxFQUFFO0lBQ3JELENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEdBQUUsQ0FBQyxDQUFBO0lBQ2hELE1BQU0sVUFBVSxHQUFHLElBQUEscUJBQVEsR0FBRSxDQUFBO0lBQzdCLE1BQU0sR0FBRyxHQUFHLG1CQUFtQixDQUFBO0lBQy9CLEtBQUssQ0FBQyxHQUFHLENBQUMsR0FBRyxFQUFFLFVBQVUsQ0FBQyxDQUFBO0lBQzFCLEtBQUssQ0FBQyxFQUFFLENBQUMsUUFBUSxFQUFFLENBQUMsU0FBUyxFQUFFLEVBQUU7UUFDL0IsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxTQUFTLEVBQUUsR0FBRyxDQUFDLENBQUE7UUFDcEIsQ0FBQyxDQUFDLEdBQUcsRUFBRSxDQUFBO0lBQ1QsQ0FBQyxDQUFDLENBQUE7QUFDSixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsRUFBRSxDQUFDLGdDQUFnQyxFQUFFLENBQUMsQ0FBQyxFQUFFLEVBQUU7SUFDckQsQ0FBQztJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsR0FBRSxDQUFDLENBQUE7SUFDaEQsTUFBTSxVQUFVLEdBQUcsSUFBQSxxQkFBUSxHQUFFLENBQUE7SUFDN0IsTUFBTSxHQUFHLEdBQUcsbUJBQW1CLENBQUE7SUFDL0IsS0FBSyxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDMUIsS0FBSyxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsRUFBRSxHQUFHLFVBQVUsRUFBRSxHQUFHLEVBQUUsU0FBUyxFQUFpQixDQUFDLENBQUE7SUFDaEUsS0FBSyxDQUFDLEVBQUUsQ0FBQyxRQUFRLEVBQUUsQ0FBQyxTQUFTLEVBQUUsRUFBRTtRQUMvQixDQUFDLENBQUMsRUFBRSxDQUFDLFNBQVMsRUFBRSxHQUFHLENBQUMsQ0FBQTtRQUNwQixDQUFDLENBQUMsR0FBRyxFQUFFLENBQUE7SUFDVCxDQUFDLENBQUMsQ0FBQTtBQUNKLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyx1QkFBdUIsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7SUFDL0MsQ0FBQztJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsRUFBQyxFQUFFLFNBQVMsRUFBRSxLQUFLLEVBQUUsQ0FBQyxDQUFDLENBQUE7SUFDcEUsTUFBTSxVQUFVLEdBQUcsSUFBQSxxQkFBUSxHQUFFLENBQUE7SUFDN0IsTUFBTSxNQUFNLEdBQUcsVUFBVSxDQUFDLE1BQU0sQ0FBQTtJQUNoQyxNQUFNLEdBQUcsR0FBRyxtQkFBbUIsQ0FBQTtJQUMvQixNQUFNLEdBQUcsR0FBRyxNQUFNLFlBQVksQ0FBQyxHQUFHLENBQUMsR0FBRyxFQUFFLFVBQVUsQ0FBQyxDQUFBO0lBQ25ELENBQUMsQ0FBQyxFQUFFLENBQUMsR0FBRyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3BCLE1BQU0sT0FBTyxHQUFHLE1BQU0sWUFBWSxDQUFDLEdBQUcsQ0FBQyxHQUFHLENBQUMsQ0FBQTtJQUMzQyxDQUFDLENBQUMsRUFBRSxDQUFDLE9BQU8sT0FBTyxFQUFFLFFBQVEsQ0FBQyxDQUFBO0lBQzlCLENBQUMsQ0FBQyxTQUFTLENBQUMsVUFBVSxDQUFDLE1BQU0sRUFBRSxNQUFNLENBQUMsQ0FBQTtJQUN0QyxhQUFhO0lBQ2IsQ0FBQyxDQUFDLFNBQVMsQ0FBQyxNQUFNLENBQUMsT0FBTyxDQUFDLE1BQU0sRUFBRSxFQUFFLE9BQU8sQ0FBQyxNQUFNLENBQUMsT0FBTyxDQUFDLE1BQU0sRUFBRSxDQUFDLENBQUE7SUFDckUsYUFBYTtJQUNiLENBQUMsQ0FBQyxTQUFTLENBQUMsTUFBTSxDQUFDLE1BQU0sRUFBRSxPQUFPLENBQUMsTUFBTSxDQUFDLE1BQU0sQ0FBQyxDQUFBO0lBQ2pELE1BQU0sR0FBRyxHQUFHLE1BQU0sWUFBWSxDQUFDLEtBQUssRUFBRSxDQUFBO0lBQ3RDLENBQUMsQ0FBQyxFQUFFLENBQUMsR0FBRyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3BCLENBQUMsQ0FBQyxFQUFFLENBQUMsTUFBTSxZQUFZLENBQUMsTUFBTSxFQUFFLEVBQUUsQ0FBQyxDQUFDLENBQUE7QUFDdEMsQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLEVBQUUsQ0FBQyxvQkFBb0IsRUFBRSxDQUFDLENBQUMsRUFBRSxFQUFFO0lBQ3pDLENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEdBQUUsQ0FBQyxDQUFBO0lBQ2hELE1BQU0sVUFBVSxHQUFHLElBQUEscUJBQVEsR0FBRSxDQUFBO0lBQzdCLE1BQU0sR0FBRyxHQUFHLG9CQUFvQixDQUFBO0lBQ2hDLEtBQUssQ0FBQyxFQUFFLENBQUMsU0FBUyxFQUFFLENBQUMsU0FBUyxFQUFFLEVBQUU7UUFDaEMsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxTQUFTLEVBQUUsR0FBRyxDQUFDLENBQUE7UUFDcEIsQ0FBQyxDQUFDLEdBQUcsRUFBRSxDQUFBO0lBQ1QsQ0FBQyxDQUFDLENBQUE7SUFDRixZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQyxJQUFJLENBQUMsR0FBRyxFQUFFO1FBQzFDLEtBQUssQ0FBQyxPQUFPLENBQUMsR0FBRyxDQUFDLENBQUE7SUFDcEIsQ0FBQyxDQUFDLENBQUE7QUFDSixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsc0JBQXNCLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFOztJQUM5QyxNQUFNLFVBQVUsR0FBRyxFQUFFLENBQ3BCO0lBQUEsQ0FBQyxFQUFFLEtBQUssRUFBRSxZQUFZLEVBQUUsR0FBRyxJQUFBLDhCQUFpQixFQUFDO1FBQzVDLEdBQUcsRUFBRSxVQUFVO0tBQ2hCLENBQUMsQ0FBQyxDQUFBO0lBQ0gsTUFBTSxVQUFVLEdBQUcsSUFBQSw2QkFBZ0IsR0FBRSxDQUFBO0lBQ3JDLE1BQU0sR0FBRyxHQUFHLHNCQUFzQixDQUFBO0lBQ2xDLE1BQU0sYUFBYSxHQUFHLElBQUksSUFBSSxFQUFFLENBQUMsT0FBTyxFQUFFLENBQUE7SUFDMUMsYUFBYTtJQUNiLE1BQU0sWUFBWSxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDdkMsTUFBTSxVQUFVLEdBQUcsTUFBTSxLQUFLLENBQUMsV0FBVyxDQUFBO0lBQzFDLE1BQU0sT0FBTyxHQUFHLE1BQU0sVUFBVSxDQUFDLE9BQU8sQ0FBQyxFQUFFLEdBQUcsRUFBRSxHQUFHLEVBQUUsQ0FBQyxDQUFBO0lBQ3RELE1BQU0sWUFBWSxHQUFHLElBQUksSUFBSSxFQUFFLENBQUMsT0FBTyxFQUFFLENBQUE7SUFDekMsTUFBTSxPQUFPLEdBQUcsTUFBQSxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsT0FBTywwQ0FBRSxPQUFPLEVBQUUsQ0FBQTtJQUMzQyxDQUFDLENBQUMsTUFBTSxDQUFDLE9BQU8sQ0FBQyxDQUFBO0lBQ2pCLElBQUksT0FBTyxFQUFFO1FBQ1gsQ0FBQyxDQUFDLE1BQU0sQ0FBQyxhQUFhLEdBQUcsVUFBVSxHQUFHLElBQUksSUFBSSxPQUFPLENBQUMsQ0FBQTtRQUN0RCxDQUFDLENBQUMsTUFBTSxDQUFDLE9BQU8sSUFBSSxZQUFZLEdBQUcsVUFBVSxHQUFHLElBQUksQ0FBQyxDQUFBO0tBQ3REO0FBQ0gsQ0FBQyxDQUFDLENBQUE7QUFFRixhQUFJLENBQUMsTUFBTSxDQUFDLGtCQUFrQixFQUFFLEtBQUssRUFBRSxDQUFDLEVBQUUsRUFBRTs7SUFDMUMsTUFBTSxxQkFBcUIsR0FBRyxJQUFJLEdBQUcsRUFBRSxHQUFHLEVBQUUsR0FBRyxFQUFFLEdBQUcsRUFBRSxDQUNyRDtJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsR0FBRSxDQUFDLENBQUE7SUFDaEQsTUFBTSxVQUFVLEdBQUcsSUFBQSw2QkFBZ0IsR0FBRSxDQUFBO0lBQ3JDLE1BQU0sR0FBRyxHQUFHLHlCQUF5QixDQUFBO0lBQ3JDLE1BQU0sYUFBYSxHQUFHLElBQUksSUFBSSxFQUFFLENBQUMsT0FBTyxFQUFFLENBQUE7SUFDMUMsYUFBYTtJQUNiLE1BQU0sWUFBWSxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDdkMsTUFBTSxVQUFVLEdBQUcsTUFBTSxLQUFLLENBQUMsV0FBVyxDQUFBO0lBQzFDLE1BQU0sT0FBTyxHQUFHLE1BQU0sVUFBVSxDQUFDLE9BQU8sQ0FBQyxFQUFFLEdBQUcsRUFBRSxHQUFHLEVBQUUsQ0FBQyxDQUFBO0lBQ3RELE1BQU0sWUFBWSxHQUFHLElBQUksSUFBSSxFQUFFLENBQUMsT0FBTyxFQUFFLENBQUE7SUFDekMsTUFBTSxPQUFPLEdBQUcsTUFBQSxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsT0FBTywwQ0FBRSxPQUFPLEVBQUUsQ0FBQTtJQUMzQyxDQUFDLENBQUMsTUFBTSxDQUFDLE9BQU8sQ0FBQyxDQUFBO0lBQ2pCLElBQUksT0FBTyxFQUFFO1FBQ1gsQ0FBQyxDQUFDLE1BQU0sQ0FBQyxhQUFhLEdBQUcscUJBQXFCLElBQUksT0FBTyxDQUFDLENBQUE7UUFDMUQsQ0FBQyxDQUFDLE1BQU0sQ0FBQyxPQUFPLElBQUksWUFBWSxHQUFHLHFCQUFxQixDQUFDLENBQUE7S0FDMUQ7QUFDSCxDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsd0JBQXdCLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFO0lBQ2hELENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEVBQUM7UUFDNUMsU0FBUyxFQUFFLENBQUMsR0FBRyxFQUFFLEVBQUU7WUFDakIsR0FBRyxDQUFDLEdBQUcsR0FBRyxxQkFBcUIsQ0FBQTtZQUMvQixPQUFPLElBQUksQ0FBQyxTQUFTLENBQUMsR0FBRyxDQUFDLENBQUE7UUFDNUIsQ0FBQztLQUNGLENBQUMsQ0FBQyxDQUFBO0lBQ0gsTUFBTSxVQUFVLEdBQUcsSUFBQSxxQkFBUSxHQUFFLENBQUE7SUFDN0IsTUFBTSxHQUFHLEdBQUcsd0JBQXdCLENBQUE7SUFDcEMsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQTtJQUN2QyxNQUFNLE9BQU8sR0FBRyxNQUFNLFlBQVksQ0FBQyxHQUFHLENBQUMsR0FBRyxDQUFDLENBQUE7SUFDM0MsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxPQUFPLE9BQU8sRUFBRSxRQUFRLENBQUMsQ0FBQTtJQUM5QixDQUFDLENBQUMsR0FBRyxDQUFDLE9BQU8sRUFBRSxTQUFTLENBQUMsQ0FBQTtJQUN6QixhQUFhO0lBQ2IsVUFBVSxDQUFDLEdBQUcsR0FBRyxxQkFBcUIsQ0FBQTtJQUN0QyxhQUFhO0lBQ2IsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxPQUFPLEVBQUUsSUFBSSxDQUFDLFNBQVMsQ0FBQyxVQUFVLENBQUMsQ0FBQyxDQUFBO0FBQzNDLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQywwQkFBMEIsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7SUFDbEQsQ0FBQztJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsRUFBQztRQUM1QyxXQUFXLEVBQUUsQ0FBQyxHQUFHLEVBQUUsRUFBRTtZQUNuQixHQUFHLENBQUMsR0FBRyxHQUFHLHVCQUF1QixDQUFBO1lBQ2pDLE9BQU8sR0FBRyxDQUFBO1FBQ1osQ0FBQztLQUNGLENBQUMsQ0FBQyxDQUFBO0lBQ0gsTUFBTSxVQUFVLEdBQUcsSUFBQSxxQkFBUSxHQUFFLENBQUE7SUFDN0IsTUFBTSxHQUFHLEdBQUcsMEJBQTBCLENBQUE7SUFDdEMsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQTtJQUN2QyxNQUFNLE9BQU8sR0FBRyxNQUFNLFlBQVksQ0FBQyxHQUFHLENBQUMsR0FBRyxDQUFDLENBQUE7SUFDM0MsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxPQUFPLE9BQU8sRUFBRSxRQUFRLENBQUMsQ0FBQTtJQUM5QixhQUFhO0lBQ2IsVUFBVSxDQUFDLE1BQU0sR0FBRyxVQUFVLENBQUMsTUFBTSxDQUFDLE1BQU0sRUFBRSxDQUFBO0lBQzlDLGFBQWE7SUFDYixVQUFVLENBQUMsR0FBRyxHQUFHLHVCQUF1QixDQUFBO0lBQ3hDLENBQUMsQ0FBQyxHQUFHLENBQUMsT0FBTyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3pCLENBQUMsQ0FBQyxTQUFTLENBQUMsT0FBTyxFQUFFLFVBQVUsQ0FBQyxDQUFBO0FBQ2xDLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyxXQUFXLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFOztJQUNuQyxDQUFDO0lBQUEsQ0FBQyxFQUFFLEtBQUssRUFBRSxZQUFZLEVBQUUsR0FBRyxJQUFBLDhCQUFpQixHQUFFLENBQUMsQ0FBQTtJQUNoRCxNQUFNLFVBQVUsR0FBRyxJQUFBLDZCQUFnQixHQUFFLENBQUE7SUFDckMsTUFBTSxHQUFHLEdBQUcsWUFBWSxDQUFBO0lBQ3hCLGFBQWE7SUFDYixNQUFNLFlBQVksQ0FBQyxHQUFHLENBQUMsR0FBRyxFQUFFLFVBQVUsQ0FBQyxDQUFBO0lBQ3ZDLE1BQU0sVUFBVSxHQUFHLE1BQU0sS0FBSyxDQUFDLFdBQVcsQ0FBQTtJQUMxQyxNQUFNLE9BQU8sR0FBRyxNQUFNLFVBQVUsQ0FBQyxPQUFPLENBQUMsRUFBRSxHQUFHLEVBQUUsR0FBRyxFQUFFLENBQUMsQ0FBQTtJQUN0RCxNQUFNLElBQUksT0FBTyxDQUFDLENBQUMsT0FBTyxFQUFFLEVBQUUsQ0FBQyxVQUFVLENBQUMsT0FBTyxFQUFFLEdBQUcsQ0FBQyxDQUFDLENBQUE7SUFDeEQsQ0FBQyxDQUFDLEdBQUcsQ0FBQyxPQUFPLEVBQUUsU0FBUyxDQUFDLENBQUE7SUFDekIsTUFBTSxZQUFZLENBQUMsS0FBSyxDQUFDLEdBQUcsRUFBRSxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsT0FBTyxDQUFDLENBQUE7SUFDL0MsTUFBTSxRQUFRLEdBQUcsTUFBTSxVQUFVLENBQUMsT0FBTyxDQUFDLEVBQUUsR0FBRyxFQUFFLEdBQUcsRUFBRSxDQUFDLENBQUE7SUFDdkQsQ0FBQyxDQUFDLEdBQUcsQ0FBQyxRQUFRLEVBQUUsU0FBUyxDQUFDLENBQUE7SUFDMUIsMENBQTBDO0lBQzFDLENBQUMsQ0FBQyxNQUFNLENBQUMsTUFBQSxRQUFRLGFBQVIsUUFBUSx1QkFBUixRQUFRLENBQUUsT0FBTywwQ0FBRSxPQUFPLEVBQUUsQ0FBQyxDQUFBO0lBQ3RDLENBQUMsQ0FBQyxNQUFNLENBQUMsTUFBQSxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsT0FBTywwQ0FBRSxPQUFPLEVBQUUsQ0FBQyxDQUFBO0lBQ3JDLElBQUksQ0FBQSxNQUFBLE9BQU8sYUFBUCxPQUFPLHVCQUFQLE9BQU8sQ0FBRSxPQUFPLDBDQUFFLE9BQU8sRUFBRSxNQUFJLE1BQUEsUUFBUSxhQUFSLFFBQVEsdUJBQVIsUUFBUSxDQUFFLE9BQU8sMENBQUUsT0FBTyxFQUFFLENBQUEsRUFBRTtRQUMvRCxDQUFDLENBQUMsTUFBTSxDQUFDLENBQUEsUUFBUSxhQUFSLFFBQVEsdUJBQVIsUUFBUSxDQUFFLE9BQU8sQ0FBQyxPQUFPLEVBQUUsS0FBRyxPQUFPLGFBQVAsT0FBTyx1QkFBUCxPQUFPLENBQUUsT0FBTyxDQUFDLE9BQU8sRUFBRSxDQUFBLENBQUMsQ0FBQTtLQUNuRTtBQUNILENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQywyQkFBMkIsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7O0lBQ25ELENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEVBQUMsRUFBRSxVQUFVLEVBQUUsQ0FBQyxFQUFFLENBQUMsQ0FBQyxDQUFBO0lBQ2pFLE1BQU0sVUFBVSxHQUFHLElBQUEsNkJBQWdCLEdBQUUsQ0FBQTtJQUNyQyxNQUFNLEdBQUcsR0FBRyw0QkFBNEIsQ0FBQTtJQUN4QyxhQUFhO0lBQ2IsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQTtJQUN2QyxNQUFNLFVBQVUsR0FBRyxNQUFNLEtBQUssQ0FBQyxXQUFXLENBQUE7SUFDMUMsTUFBTSxPQUFPLEdBQUcsTUFBTSxVQUFVLENBQUMsT0FBTyxDQUFDLEVBQUUsR0FBRyxFQUFFLEdBQUcsRUFBRSxDQUFDLENBQUE7SUFDdEQsTUFBTSx1QkFBdUIsR0FBRyxNQUFBLE9BQU8sYUFBUCxPQUFPLHVCQUFQLE9BQU8sQ0FBRSxZQUFZLDBDQUFFLE9BQU8sRUFBRSxDQUFBO0lBQ2hFLENBQUMsQ0FBQyxHQUFHLENBQUMsT0FBTyxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQ3pCLE1BQU0sWUFBWSxDQUFDLEtBQUssQ0FBQyxHQUFHLEVBQUUsT0FBaUMsQ0FBQyxDQUFBO0lBQ2hFLE1BQU0sUUFBUSxHQUFHLE1BQU0sVUFBVSxDQUFDLE9BQU8sQ0FBQyxFQUFFLEdBQUcsRUFBRSxHQUFHLEVBQUUsQ0FBQyxDQUFBO0lBQ3ZELENBQUMsQ0FBQyxHQUFHLENBQUMsUUFBUSxFQUFFLFNBQVMsQ0FBQyxDQUFBO0lBQzFCLE1BQU0sc0JBQXNCLEdBQUcsTUFBQSxRQUFRLGFBQVIsUUFBUSx1QkFBUixRQUFRLENBQUUsWUFBWSwwQ0FBRSxPQUFPLEVBQUUsQ0FBQTtJQUNoRSwwQ0FBMEM7SUFDMUMsQ0FBQyxDQUFDLEVBQUUsQ0FBQyx1QkFBdUIsRUFBRSxzQkFBc0IsQ0FBQyxDQUFBO0FBQ3ZELENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyxzQ0FBc0MsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7O0lBQzlELENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEVBQUMsRUFBRSxVQUFVLEVBQUUsQ0FBQyxFQUFFLENBQUMsQ0FBQyxDQUFBO0lBQ2pFLE1BQU0sVUFBVSxHQUFHLElBQUEsNkJBQWdCLEdBQUUsQ0FBQTtJQUNyQyxNQUFNLEdBQUcsR0FBRyx5Q0FBeUMsQ0FBQTtJQUNyRCxhQUFhO0lBQ2IsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsRUFBRSxVQUFVLENBQUMsQ0FBQTtJQUN2QyxNQUFNLFVBQVUsR0FBRyxNQUFNLEtBQUssQ0FBQyxXQUFXLENBQUE7SUFDMUMsTUFBTSxPQUFPLEdBQUcsTUFBTSxVQUFVLENBQUMsT0FBTyxDQUFDLEVBQUUsR0FBRyxFQUFFLEdBQUcsRUFBRSxDQUFDLENBQUE7SUFDdEQsTUFBTSx1QkFBdUIsR0FBRyxNQUFBLE9BQU8sYUFBUCxPQUFPLHVCQUFQLE9BQU8sQ0FBRSxZQUFZLDBDQUFFLE9BQU8sRUFBRSxDQUFBO0lBQ2hFLE1BQU0sSUFBSSxPQUFPLENBQUMsQ0FBQyxPQUFPLEVBQUUsRUFBRSxDQUFDLFVBQVUsQ0FBQyxPQUFPLEVBQUUsSUFBSSxDQUFDLENBQUMsQ0FBQTtJQUN6RCxDQUFDLENBQUMsR0FBRyxDQUFDLE9BQU8sRUFBRSxTQUFTLENBQUMsQ0FBQTtJQUN6QixNQUFNLFlBQVksQ0FBQyxLQUFLLENBQUMsR0FBRyxFQUFFLE9BQWlDLENBQUMsQ0FBQTtJQUNoRSxNQUFNLFFBQVEsR0FBRyxNQUFNLFVBQVUsQ0FBQyxPQUFPLENBQUMsRUFBRSxHQUFHLEVBQUUsR0FBRyxFQUFFLENBQUMsQ0FBQTtJQUN2RCxDQUFDLENBQUMsR0FBRyxDQUFDLFFBQVEsRUFBRSxTQUFTLENBQUMsQ0FBQTtJQUMxQixNQUFNLHNCQUFzQixHQUFHLE1BQUEsUUFBUSxhQUFSLFFBQVEsdUJBQVIsUUFBUSxDQUFFLFlBQVksMENBQUUsT0FBTyxFQUFFLENBQUE7SUFDaEUsMENBQTBDO0lBQzFDLENBQUMsQ0FBQyxNQUFNLENBQUMsc0JBQXNCLENBQUMsQ0FBQTtJQUNoQyxDQUFDLENBQUMsTUFBTSxDQUFDLHVCQUF1QixDQUFDLENBQUE7SUFDakMsSUFBSSxzQkFBc0IsSUFBSSx1QkFBdUIsRUFBRTtRQUNyRCxDQUFDLENBQUMsTUFBTSxDQUFDLHNCQUFzQixHQUFHLHVCQUF1QixDQUFDLENBQUE7S0FDM0Q7QUFDSCxDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsa0NBQWtDLEVBQUUsS0FBSyxFQUFFLENBQUMsRUFBRSxFQUFFO0lBQzFELENBQUM7SUFBQSxDQUFDLEVBQUUsS0FBSyxFQUFFLFlBQVksRUFBRSxHQUFHLElBQUEsOEJBQWlCLEVBQUM7UUFDNUMsTUFBTSxFQUFFLEVBQUUsTUFBTSxFQUFFLFFBQVEsRUFBRTtRQUM1QixjQUFjLEVBQUUsYUFBYTtRQUM3QixVQUFVLEVBQUUsVUFBVTtLQUN2QixDQUFDLENBQUMsQ0FBQTtJQUNILElBQUksVUFBVSxHQUFHLElBQUEscUJBQVEsR0FBRSxDQUFBO0lBQzNCLE1BQU0sR0FBRyxHQUFHLDZCQUE2QixDQUFBO0lBQ3pDLE1BQU0sR0FBRyxHQUFHLE1BQU0sWUFBWSxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDbkQsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxHQUFHLEVBQUUsU0FBUyxDQUFDLENBQUE7SUFDcEIsTUFBTSxPQUFPLEdBQUcsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsQ0FBQyxDQUFBO0lBQzNDLFVBQVUsR0FBRyxJQUFJLENBQUMsS0FBSyxDQUFDLElBQUksQ0FBQyxTQUFTLENBQUMsVUFBVSxDQUFDLENBQUMsQ0FBQTtJQUNuRCxhQUFhO0lBQ2IsQ0FBQyxDQUFDLFNBQVMsQ0FBQyxPQUFPLEVBQUUsVUFBVSxDQUFDLENBQUE7SUFDaEMsTUFBTSxRQUFRLEdBQUcsTUFBTSxZQUFZLENBQUMsR0FBRyxFQUFFLENBQUE7SUFDekMsQ0FBQyxDQUFDLEdBQUcsQ0FBQyxRQUFRLEVBQUUsU0FBUyxDQUFDLENBQUE7SUFDMUIsQ0FBQyxDQUFDLEdBQUcsQ0FBQyxRQUFRLEVBQUUsSUFBSSxDQUFDLENBQUE7SUFDckIsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxRQUFRLGFBQVIsUUFBUSx1QkFBUixRQUFRLENBQUUsTUFBTSxFQUFFLENBQUMsQ0FBQyxDQUFBO0FBQzNCLENBQUMsQ0FBQyxDQUFBO0FBRUYsYUFBSSxDQUFDLE1BQU0sQ0FBQyw0Q0FBNEMsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLEVBQUU7SUFDcEUsQ0FBQztJQUFBLENBQUMsRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLEdBQUcsSUFBQSw4QkFBaUIsRUFBQztRQUM1QyxVQUFVLEVBQUUsRUFBRTtLQUNmLENBQUMsQ0FBQyxDQUFBO0lBQ0gsTUFBTSxHQUFHLEdBQUcsK0JBQStCLENBQUE7SUFDM0MsTUFBTSxHQUFHLEdBQUcsTUFBTSxZQUFZLENBQUMsR0FBRyxDQUFDLEdBQUcsQ0FBQyxDQUFBO0lBQ3ZDLENBQUMsQ0FBQyxFQUFFLENBQUMsR0FBRyxFQUFFLElBQUksQ0FBQyxDQUFBO0FBQ2pCLENBQUMsQ0FBQyxDQUFBIn0= \ No newline at end of file diff --git a/node_modules/connect-mongo/build/main/test/integration.spec.d.ts b/node_modules/connect-mongo/build/main/test/integration.spec.d.ts new file mode 100644 index 0000000..78a151d --- /dev/null +++ b/node_modules/connect-mongo/build/main/test/integration.spec.d.ts @@ -0,0 +1,6 @@ +declare module 'express-session' { + interface SessionData { + [key: string]: any; + } +} +export {}; diff --git a/node_modules/connect-mongo/build/main/test/integration.spec.js b/node_modules/connect-mongo/build/main/test/integration.spec.js new file mode 100644 index 0000000..a3b683f --- /dev/null +++ b/node_modules/connect-mongo/build/main/test/integration.spec.js @@ -0,0 +1,87 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +const ava_1 = __importDefault(require("ava")); +const supertest_1 = __importDefault(require("supertest")); +const express_1 = __importDefault(require("express")); +const express_session_1 = __importDefault(require("express-session")); +const __1 = __importDefault(require("../")); +function createSupertetAgent(sessionOpts, mongoStoreOpts) { + const app = (0, express_1.default)(); + const store = __1.default.create(mongoStoreOpts); + app.use((0, express_session_1.default)({ + ...sessionOpts, + store: store, + })); + app.get('/', function (req, res) { + if (typeof req.session.views === 'number') { + req.session.views++; + } + else { + req.session.views = 0; + } + res.status(200).send({ views: req.session.views }); + }); + app.get('/ping', function (req, res) { + res.status(200).send({ views: req.session.views }); + }); + const agent = supertest_1.default.agent(app); + return agent; +} +function createSupertetAgentWithDefault(sessionOpts = {}, mongoStoreOpts = {}) { + return createSupertetAgent({ secret: 'foo', ...sessionOpts }, { + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + dbName: 'itegration-test-db', + stringify: false, + ...mongoStoreOpts, + }); +} +ava_1.default.serial.cb('simple case', (t) => { + const agent = createSupertetAgentWithDefault(); + agent + .get('/') + .expect(200) + .then((response) => response.headers['set-cookie']) + .then((cookie) => { + agent + .get('/') + .expect(200) + .end((err, res) => { + t.is(err, null); + t.deepEqual(res.body, { views: 1 }); + return t.end(); + }); + }); +}); +ava_1.default.serial.cb('simple case with touch after', (t) => { + const agent = createSupertetAgentWithDefault({ resave: false, saveUninitialized: false, rolling: true }, { touchAfter: 1 }); + agent + .get('/') + .expect(200) + .then(() => { + agent + .get('/') + .expect(200) + .end((err, res) => { + t.is(err, null); + t.deepEqual(res.body, { views: 1 }); + new Promise((resolve) => { + setTimeout(() => { + resolve(); + }, 1200); + }).then(() => { + agent + .get('/ping') + .expect(200) + .end((err, res) => { + t.is(err, null); + t.deepEqual(res.body, { views: 1 }); + return t.end(); + }); + }); + }); + }); +}); +//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoiaW50ZWdyYXRpb24uc3BlYy5qcyIsInNvdXJjZVJvb3QiOiIiLCJzb3VyY2VzIjpbIi4uLy4uLy4uL3NyYy90ZXN0L2ludGVncmF0aW9uLnNwZWMudHMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6Ijs7Ozs7QUFBQSw4Q0FBc0I7QUFDdEIsMERBQStCO0FBQy9CLHNEQUE2QjtBQUM3QixzRUFBeUQ7QUFDekQsNENBQTRCO0FBUzVCLFNBQVMsbUJBQW1CLENBQzFCLFdBQTJCLEVBQzNCLGNBQW1DO0lBRW5DLE1BQU0sR0FBRyxHQUFHLElBQUEsaUJBQU8sR0FBRSxDQUFBO0lBQ3JCLE1BQU0sS0FBSyxHQUFHLFdBQVUsQ0FBQyxNQUFNLENBQUMsY0FBYyxDQUFDLENBQUE7SUFDL0MsR0FBRyxDQUFDLEdBQUcsQ0FDTCxJQUFBLHlCQUFPLEVBQUM7UUFDTixHQUFHLFdBQVc7UUFDZCxLQUFLLEVBQUUsS0FBSztLQUNiLENBQUMsQ0FDSCxDQUFBO0lBQ0QsR0FBRyxDQUFDLEdBQUcsQ0FBQyxHQUFHLEVBQUUsVUFBVSxHQUFHLEVBQUUsR0FBRztRQUM3QixJQUFJLE9BQU8sR0FBRyxDQUFDLE9BQU8sQ0FBQyxLQUFLLEtBQUssUUFBUSxFQUFFO1lBQ3pDLEdBQUcsQ0FBQyxPQUFPLENBQUMsS0FBSyxFQUFFLENBQUE7U0FDcEI7YUFBTTtZQUNMLEdBQUcsQ0FBQyxPQUFPLENBQUMsS0FBSyxHQUFHLENBQUMsQ0FBQTtTQUN0QjtRQUNELEdBQUcsQ0FBQyxNQUFNLENBQUMsR0FBRyxDQUFDLENBQUMsSUFBSSxDQUFDLEVBQUUsS0FBSyxFQUFFLEdBQUcsQ0FBQyxPQUFPLENBQUMsS0FBSyxFQUFFLENBQUMsQ0FBQTtJQUNwRCxDQUFDLENBQUMsQ0FBQTtJQUNGLEdBQUcsQ0FBQyxHQUFHLENBQUMsT0FBTyxFQUFFLFVBQVUsR0FBRyxFQUFFLEdBQUc7UUFDakMsR0FBRyxDQUFDLE1BQU0sQ0FBQyxHQUFHLENBQUMsQ0FBQyxJQUFJLENBQUMsRUFBRSxLQUFLLEVBQUUsR0FBRyxDQUFDLE9BQU8sQ0FBQyxLQUFLLEVBQUUsQ0FBQyxDQUFBO0lBQ3BELENBQUMsQ0FBQyxDQUFBO0lBQ0YsTUFBTSxLQUFLLEdBQUcsbUJBQU8sQ0FBQyxLQUFLLENBQUMsR0FBRyxDQUFDLENBQUE7SUFDaEMsT0FBTyxLQUFLLENBQUE7QUFDZCxDQUFDO0FBRUQsU0FBUyw4QkFBOEIsQ0FDckMsY0FBOEMsRUFBRSxFQUNoRCxpQkFBc0MsRUFBRTtJQUV4QyxPQUFPLG1CQUFtQixDQUN4QixFQUFFLE1BQU0sRUFBRSxLQUFLLEVBQUUsR0FBRyxXQUFXLEVBQUUsRUFDakM7UUFDRSxRQUFRLEVBQUUsd0NBQXdDO1FBQ2xELE1BQU0sRUFBRSxvQkFBb0I7UUFDNUIsU0FBUyxFQUFFLEtBQUs7UUFDaEIsR0FBRyxjQUFjO0tBQ2xCLENBQ0YsQ0FBQTtBQUNILENBQUM7QUFFRCxhQUFJLENBQUMsTUFBTSxDQUFDLEVBQUUsQ0FBQyxhQUFhLEVBQUUsQ0FBQyxDQUFDLEVBQUUsRUFBRTtJQUNsQyxNQUFNLEtBQUssR0FBRyw4QkFBOEIsRUFBRSxDQUFBO0lBQzlDLEtBQUs7U0FDRixHQUFHLENBQUMsR0FBRyxDQUFDO1NBQ1IsTUFBTSxDQUFDLEdBQUcsQ0FBQztTQUNYLElBQUksQ0FBQyxDQUFDLFFBQVEsRUFBRSxFQUFFLENBQUMsUUFBUSxDQUFDLE9BQU8sQ0FBQyxZQUFZLENBQUMsQ0FBQztTQUNsRCxJQUFJLENBQUMsQ0FBQyxNQUFNLEVBQUUsRUFBRTtRQUNmLEtBQUs7YUFDRixHQUFHLENBQUMsR0FBRyxDQUFDO2FBQ1IsTUFBTSxDQUFDLEdBQUcsQ0FBQzthQUNYLEdBQUcsQ0FBQyxDQUFDLEdBQUcsRUFBRSxHQUFHLEVBQUUsRUFBRTtZQUNoQixDQUFDLENBQUMsRUFBRSxDQUFDLEdBQUcsRUFBRSxJQUFJLENBQUMsQ0FBQTtZQUNmLENBQUMsQ0FBQyxTQUFTLENBQUMsR0FBRyxDQUFDLElBQUksRUFBRSxFQUFFLEtBQUssRUFBRSxDQUFDLEVBQUUsQ0FBQyxDQUFBO1lBQ25DLE9BQU8sQ0FBQyxDQUFDLEdBQUcsRUFBRSxDQUFBO1FBQ2hCLENBQUMsQ0FBQyxDQUFBO0lBQ04sQ0FBQyxDQUFDLENBQUE7QUFDTixDQUFDLENBQUMsQ0FBQTtBQUVGLGFBQUksQ0FBQyxNQUFNLENBQUMsRUFBRSxDQUFDLDhCQUE4QixFQUFFLENBQUMsQ0FBQyxFQUFFLEVBQUU7SUFDbkQsTUFBTSxLQUFLLEdBQUcsOEJBQThCLENBQzFDLEVBQUUsTUFBTSxFQUFFLEtBQUssRUFBRSxpQkFBaUIsRUFBRSxLQUFLLEVBQUUsT0FBTyxFQUFFLElBQUksRUFBRSxFQUMxRCxFQUFFLFVBQVUsRUFBRSxDQUFDLEVBQUUsQ0FDbEIsQ0FBQTtJQUNELEtBQUs7U0FDRixHQUFHLENBQUMsR0FBRyxDQUFDO1NBQ1IsTUFBTSxDQUFDLEdBQUcsQ0FBQztTQUNYLElBQUksQ0FBQyxHQUFHLEVBQUU7UUFDVCxLQUFLO2FBQ0YsR0FBRyxDQUFDLEdBQUcsQ0FBQzthQUNSLE1BQU0sQ0FBQyxHQUFHLENBQUM7YUFDWCxHQUFHLENBQUMsQ0FBQyxHQUFHLEVBQUUsR0FBRyxFQUFFLEVBQUU7WUFDaEIsQ0FBQyxDQUFDLEVBQUUsQ0FBQyxHQUFHLEVBQUUsSUFBSSxDQUFDLENBQUE7WUFDZixDQUFDLENBQUMsU0FBUyxDQUFDLEdBQUcsQ0FBQyxJQUFJLEVBQUUsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLENBQUMsQ0FBQTtZQUNuQyxJQUFJLE9BQU8sQ0FBTyxDQUFDLE9BQU8sRUFBRSxFQUFFO2dCQUM1QixVQUFVLENBQUMsR0FBRyxFQUFFO29CQUNkLE9BQU8sRUFBRSxDQUFBO2dCQUNYLENBQUMsRUFBRSxJQUFJLENBQUMsQ0FBQTtZQUNWLENBQUMsQ0FBQyxDQUFDLElBQUksQ0FBQyxHQUFHLEVBQUU7Z0JBQ1gsS0FBSztxQkFDRixHQUFHLENBQUMsT0FBTyxDQUFDO3FCQUNaLE1BQU0sQ0FBQyxHQUFHLENBQUM7cUJBQ1gsR0FBRyxDQUFDLENBQUMsR0FBRyxFQUFFLEdBQUcsRUFBRSxFQUFFO29CQUNoQixDQUFDLENBQUMsRUFBRSxDQUFDLEdBQUcsRUFBRSxJQUFJLENBQUMsQ0FBQTtvQkFDZixDQUFDLENBQUMsU0FBUyxDQUFDLEdBQUcsQ0FBQyxJQUFJLEVBQUUsRUFBRSxLQUFLLEVBQUUsQ0FBQyxFQUFFLENBQUMsQ0FBQTtvQkFDbkMsT0FBTyxDQUFDLENBQUMsR0FBRyxFQUFFLENBQUE7Z0JBQ2hCLENBQUMsQ0FBQyxDQUFBO1lBQ04sQ0FBQyxDQUFDLENBQUE7UUFDSixDQUFDLENBQUMsQ0FBQTtJQUNOLENBQUMsQ0FBQyxDQUFBO0FBQ04sQ0FBQyxDQUFDLENBQUEifQ== \ No newline at end of file diff --git a/node_modules/connect-mongo/build/main/test/testHelper.d.ts b/node_modules/connect-mongo/build/main/test/testHelper.d.ts new file mode 100644 index 0000000..bb64d32 --- /dev/null +++ b/node_modules/connect-mongo/build/main/test/testHelper.d.ts @@ -0,0 +1,38 @@ +import ExpressSession from 'express-session'; +import MongoStore, { ConnectMongoOptions } from '../lib/MongoStore'; +export declare const makeCookie: () => ExpressSession.Cookie; +export declare const makeData: () => { + foo: string; + baz: { + cow: string; + chicken: string; + }; + num: number; + cookie: ExpressSession.Cookie; +}; +export declare const makeDataNoCookie: () => { + foo: string; + baz: { + cow: string; + fish: string; + fox: string; + }; + num: number; +}; +export declare const createStoreHelper: (opt?: Partial<ConnectMongoOptions>) => { + store: MongoStore; + storePromise: { + length: () => Promise<number>; + clear: () => Promise<void>; + get: (arg1: string) => Promise<ExpressSession.SessionData | null | undefined>; + set: (arg1: string, arg2: ExpressSession.SessionData) => Promise<void>; + all: () => Promise<ExpressSession.SessionData[] | { + [sid: string]: ExpressSession.SessionData; + } | null | undefined>; + touch: (arg1: string, arg2: ExpressSession.SessionData & { + lastModified?: Date | undefined; + }) => Promise<void>; + destroy: (arg1: string) => Promise<void>; + close: () => Promise<void>; + }; +}; diff --git a/node_modules/connect-mongo/build/main/test/testHelper.js b/node_modules/connect-mongo/build/main/test/testHelper.js new file mode 100644 index 0000000..6204192 --- /dev/null +++ b/node_modules/connect-mongo/build/main/test/testHelper.js @@ -0,0 +1,68 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.createStoreHelper = exports.makeDataNoCookie = exports.makeData = exports.makeCookie = void 0; +// eslint-disable-next-line eslint-comments/disable-enable-pair +/* eslint-disable @typescript-eslint/explicit-module-boundary-types */ +const util_1 = __importDefault(require("util")); +const express_session_1 = __importDefault(require("express-session")); +const MongoStore_1 = __importDefault(require("../lib/MongoStore")); +// Create a connect cookie instance +const makeCookie = () => { + const cookie = new express_session_1.default.Cookie(); + cookie.maxAge = 10000; // This sets cookie.expire through a setter + cookie.secure = true; + cookie.domain = 'cow.com'; + cookie.sameSite = false; + return cookie; +}; +exports.makeCookie = makeCookie; +// Create session data +const makeData = () => { + return { + foo: 'bar', + baz: { + cow: 'moo', + chicken: 'cluck', + }, + num: 1, + cookie: (0, exports.makeCookie)(), + }; +}; +exports.makeData = makeData; +const makeDataNoCookie = () => { + return { + foo: 'bar', + baz: { + cow: 'moo', + fish: 'blub', + fox: 'nobody knows!', + }, + num: 2, + }; +}; +exports.makeDataNoCookie = makeDataNoCookie; +const createStoreHelper = (opt = {}) => { + const store = MongoStore_1.default.create({ + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + mongoOptions: {}, + dbName: 'testDb', + collectionName: 'test-collection', + ...opt, + }); + const storePromise = { + length: util_1.default.promisify(store.length).bind(store), + clear: util_1.default.promisify(store.clear).bind(store), + get: util_1.default.promisify(store.get).bind(store), + set: util_1.default.promisify(store.set).bind(store), + all: util_1.default.promisify(store.all).bind(store), + touch: util_1.default.promisify(store.touch).bind(store), + destroy: util_1.default.promisify(store.destroy).bind(store), + close: store.close.bind(store), + }; + return { store, storePromise }; +}; +exports.createStoreHelper = createStoreHelper; +//# sourceMappingURL=data:application/json;base64,eyJ2ZXJzaW9uIjozLCJmaWxlIjoidGVzdEhlbHBlci5qcyIsInNvdXJjZVJvb3QiOiIiLCJzb3VyY2VzIjpbIi4uLy4uLy4uL3NyYy90ZXN0L3Rlc3RIZWxwZXIudHMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6Ijs7Ozs7O0FBQUEsK0RBQStEO0FBQy9ELHNFQUFzRTtBQUN0RSxnREFBdUI7QUFDdkIsc0VBQTRDO0FBRTVDLG1FQUFtRTtBQUVuRSxtQ0FBbUM7QUFDNUIsTUFBTSxVQUFVLEdBQUcsR0FBRyxFQUFFO0lBQzdCLE1BQU0sTUFBTSxHQUFHLElBQUkseUJBQWMsQ0FBQyxNQUFNLEVBQUUsQ0FBQTtJQUMxQyxNQUFNLENBQUMsTUFBTSxHQUFHLEtBQUssQ0FBQSxDQUFDLDJDQUEyQztJQUNqRSxNQUFNLENBQUMsTUFBTSxHQUFHLElBQUksQ0FBQTtJQUNwQixNQUFNLENBQUMsTUFBTSxHQUFHLFNBQVMsQ0FBQTtJQUN6QixNQUFNLENBQUMsUUFBUSxHQUFHLEtBQUssQ0FBQTtJQUV2QixPQUFPLE1BQU0sQ0FBQTtBQUNmLENBQUMsQ0FBQTtBQVJZLFFBQUEsVUFBVSxjQVF0QjtBQUVELHNCQUFzQjtBQUNmLE1BQU0sUUFBUSxHQUFHLEdBQUcsRUFBRTtJQUMzQixPQUFPO1FBQ0wsR0FBRyxFQUFFLEtBQUs7UUFDVixHQUFHLEVBQUU7WUFDSCxHQUFHLEVBQUUsS0FBSztZQUNWLE9BQU8sRUFBRSxPQUFPO1NBQ2pCO1FBQ0QsR0FBRyxFQUFFLENBQUM7UUFDTixNQUFNLEVBQUUsSUFBQSxrQkFBVSxHQUFFO0tBQ3JCLENBQUE7QUFDSCxDQUFDLENBQUE7QUFWWSxRQUFBLFFBQVEsWUFVcEI7QUFFTSxNQUFNLGdCQUFnQixHQUFHLEdBQUcsRUFBRTtJQUNuQyxPQUFPO1FBQ0wsR0FBRyxFQUFFLEtBQUs7UUFDVixHQUFHLEVBQUU7WUFDSCxHQUFHLEVBQUUsS0FBSztZQUNWLElBQUksRUFBRSxNQUFNO1lBQ1osR0FBRyxFQUFFLGVBQWU7U0FDckI7UUFDRCxHQUFHLEVBQUUsQ0FBQztLQUNQLENBQUE7QUFDSCxDQUFDLENBQUE7QUFWWSxRQUFBLGdCQUFnQixvQkFVNUI7QUFFTSxNQUFNLGlCQUFpQixHQUFHLENBQUMsTUFBb0MsRUFBRSxFQUFFLEVBQUU7SUFDMUUsTUFBTSxLQUFLLEdBQUcsb0JBQVUsQ0FBQyxNQUFNLENBQUM7UUFDOUIsUUFBUSxFQUFFLHdDQUF3QztRQUNsRCxZQUFZLEVBQUUsRUFBRTtRQUNoQixNQUFNLEVBQUUsUUFBUTtRQUNoQixjQUFjLEVBQUUsaUJBQWlCO1FBQ2pDLEdBQUcsR0FBRztLQUNQLENBQUMsQ0FBQTtJQUVGLE1BQU0sWUFBWSxHQUFHO1FBQ25CLE1BQU0sRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxNQUFNLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQ2hELEtBQUssRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxLQUFLLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQzlDLEdBQUcsRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxHQUFHLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQzFDLEdBQUcsRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxHQUFHLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQzFDLEdBQUcsRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxHQUFHLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQzFDLEtBQUssRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxLQUFLLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQzlDLE9BQU8sRUFBRSxjQUFJLENBQUMsU0FBUyxDQUFDLEtBQUssQ0FBQyxPQUFPLENBQUMsQ0FBQyxJQUFJLENBQUMsS0FBSyxDQUFDO1FBQ2xELEtBQUssRUFBRSxLQUFLLENBQUMsS0FBSyxDQUFDLElBQUksQ0FBQyxLQUFLLENBQUM7S0FDL0IsQ0FBQTtJQUNELE9BQU8sRUFBRSxLQUFLLEVBQUUsWUFBWSxFQUFFLENBQUE7QUFDaEMsQ0FBQyxDQUFBO0FBcEJZLFFBQUEsaUJBQWlCLHFCQW9CN0IifQ== \ No newline at end of file diff --git a/node_modules/connect-mongo/build/tsconfig.tsbuildinfo b/node_modules/connect-mongo/build/tsconfig.tsbuildinfo new file mode 100644 index 0000000..b1da4fd --- /dev/null +++ b/node_modules/connect-mongo/build/tsconfig.tsbuildinfo @@ -0,0 +1 @@ +{"program":{"fileNames":["../node_modules/typescript/lib/lib.es5.d.ts","../node_modules/typescript/lib/lib.es2015.d.ts","../node_modules/typescript/lib/lib.es2016.d.ts","../node_modules/typescript/lib/lib.es2017.d.ts","../node_modules/typescript/lib/lib.es2018.d.ts","../node_modules/typescript/lib/lib.es2015.core.d.ts","../node_modules/typescript/lib/lib.es2015.collection.d.ts","../node_modules/typescript/lib/lib.es2015.generator.d.ts","../node_modules/typescript/lib/lib.es2015.iterable.d.ts","../node_modules/typescript/lib/lib.es2015.promise.d.ts","../node_modules/typescript/lib/lib.es2015.proxy.d.ts","../node_modules/typescript/lib/lib.es2015.reflect.d.ts","../node_modules/typescript/lib/lib.es2015.symbol.d.ts","../node_modules/typescript/lib/lib.es2015.symbol.wellknown.d.ts","../node_modules/typescript/lib/lib.es2016.array.include.d.ts","../node_modules/typescript/lib/lib.es2017.object.d.ts","../node_modules/typescript/lib/lib.es2017.sharedmemory.d.ts","../node_modules/typescript/lib/lib.es2017.string.d.ts","../node_modules/typescript/lib/lib.es2017.intl.d.ts","../node_modules/typescript/lib/lib.es2017.typedarrays.d.ts","../node_modules/typescript/lib/lib.es2018.asyncgenerator.d.ts","../node_modules/typescript/lib/lib.es2018.asynciterable.d.ts","../node_modules/typescript/lib/lib.es2018.intl.d.ts","../node_modules/typescript/lib/lib.es2018.promise.d.ts","../node_modules/typescript/lib/lib.es2018.regexp.d.ts","../node_modules/typescript/lib/lib.es2020.bigint.d.ts","../node_modules/typescript/lib/lib.es2020.intl.d.ts","../node_modules/typescript/lib/lib.esnext.intl.d.ts","../node_modules/@types/node/assert.d.ts","../node_modules/@types/node/globals.d.ts","../node_modules/@types/node/async_hooks.d.ts","../node_modules/@types/node/buffer.d.ts","../node_modules/@types/node/child_process.d.ts","../node_modules/@types/node/cluster.d.ts","../node_modules/@types/node/console.d.ts","../node_modules/@types/node/constants.d.ts","../node_modules/@types/node/crypto.d.ts","../node_modules/@types/node/dgram.d.ts","../node_modules/@types/node/dns.d.ts","../node_modules/@types/node/domain.d.ts","../node_modules/@types/node/events.d.ts","../node_modules/@types/node/fs.d.ts","../node_modules/@types/node/fs/promises.d.ts","../node_modules/@types/node/http.d.ts","../node_modules/@types/node/http2.d.ts","../node_modules/@types/node/https.d.ts","../node_modules/@types/node/inspector.d.ts","../node_modules/@types/node/module.d.ts","../node_modules/@types/node/net.d.ts","../node_modules/@types/node/os.d.ts","../node_modules/@types/node/path.d.ts","../node_modules/@types/node/perf_hooks.d.ts","../node_modules/@types/node/process.d.ts","../node_modules/@types/node/punycode.d.ts","../node_modules/@types/node/querystring.d.ts","../node_modules/@types/node/readline.d.ts","../node_modules/@types/node/repl.d.ts","../node_modules/@types/node/stream.d.ts","../node_modules/@types/node/string_decoder.d.ts","../node_modules/@types/node/timers.d.ts","../node_modules/@types/node/tls.d.ts","../node_modules/@types/node/trace_events.d.ts","../node_modules/@types/node/tty.d.ts","../node_modules/@types/node/url.d.ts","../node_modules/@types/node/util.d.ts","../node_modules/@types/node/v8.d.ts","../node_modules/@types/node/vm.d.ts","../node_modules/@types/node/wasi.d.ts","../node_modules/@types/node/worker_threads.d.ts","../node_modules/@types/node/zlib.d.ts","../node_modules/@types/node/globals.global.d.ts","../node_modules/@types/node/index.d.ts","../node_modules/@types/range-parser/index.d.ts","../node_modules/@types/qs/index.d.ts","../node_modules/@types/express-serve-static-core/index.d.ts","../node_modules/@types/mime/mime.d.ts","../node_modules/@types/mime/index.d.ts","../node_modules/@types/serve-static/index.d.ts","../node_modules/@types/connect/index.d.ts","../node_modules/@types/body-parser/index.d.ts","../node_modules/@types/express/index.d.ts","../node_modules/@types/express-session/index.d.ts","../node_modules/bson/bson.d.ts","../node_modules/mongodb/mongodb.d.ts","../node_modules/@types/ms/index.d.ts","../node_modules/@types/debug/index.d.ts","../src/lib/mongostore.ts","../src/index.ts","../node_modules/ava/index.d.ts","../src/test/testhelper.ts","../src/lib/mongostore.spec.ts","../node_modules/@types/cookiejar/index.d.ts","../node_modules/buffer/index.d.ts","../node_modules/@types/superagent/index.d.ts","../node_modules/@types/supertest/index.d.ts","../src/test/integration.spec.ts","../src/types/kruptein.d.ts"],"fileInfos":[{"version":"8730f4bf322026ff5229336391a18bcaa1f94d4f82416c8b2f3954e2ccaae2ba","affectsGlobalScope":true},"dc47c4fa66b9b9890cf076304de2a9c5201e94b740cffdf09f87296d877d71f6","7a387c58583dfca701b6c85e0adaf43fb17d590fb16d5b2dc0a2fbd89f35c467","8a12173c586e95f4433e0c6dc446bc88346be73ffe9ca6eec7aa63c8f3dca7f9","5f4e733ced4e129482ae2186aae29fde948ab7182844c3a5a51dd346182c7b06",{"version":"adb996790133eb33b33aadb9c09f15c2c575e71fb57a62de8bf74dbf59ec7dfb","affectsGlobalScope":true},{"version":"8cc8c5a3bac513368b0157f3d8b31cfdcfe78b56d3724f30f80ed9715e404af8","affectsGlobalScope":true},{"version":"cdccba9a388c2ee3fd6ad4018c640a471a6c060e96f1232062223063b0a5ac6a","affectsGlobalScope":true},{"version":"c5c05907c02476e4bde6b7e76a79ffcd948aedd14b6a8f56e4674221b0417398","affectsGlobalScope":true},{"version":"5f406584aef28a331c36523df688ca3650288d14f39c5d2e555c95f0d2ff8f6f","affectsGlobalScope":true},{"version":"22f230e544b35349cfb3bd9110b6ef37b41c6d6c43c3314a31bd0d9652fcec72","affectsGlobalScope":true},{"version":"7ea0b55f6b315cf9ac2ad622b0a7813315bb6e97bf4bb3fbf8f8affbca7dc695","affectsGlobalScope":true},{"version":"3013574108c36fd3aaca79764002b3717da09725a36a6fc02eac386593110f93","affectsGlobalScope":true},{"version":"eb26de841c52236d8222f87e9e6a235332e0788af8c87a71e9e210314300410a","affectsGlobalScope":true},{"version":"3be5a1453daa63e031d266bf342f3943603873d890ab8b9ada95e22389389006","affectsGlobalScope":true},{"version":"17bb1fc99591b00515502d264fa55dc8370c45c5298f4a5c2083557dccba5a2a","affectsGlobalScope":true},{"version":"7ce9f0bde3307ca1f944119f6365f2d776d281a393b576a18a2f2893a2d75c98","affectsGlobalScope":true},{"version":"6a6b173e739a6a99629a8594bfb294cc7329bfb7b227f12e1f7c11bc163b8577","affectsGlobalScope":true},{"version":"81cac4cbc92c0c839c70f8ffb94eb61e2d32dc1c3cf6d95844ca099463cf37ea","affectsGlobalScope":true},{"version":"b0124885ef82641903d232172577f2ceb5d3e60aed4da1153bab4221e1f6dd4e","affectsGlobalScope":true},{"version":"0eb85d6c590b0d577919a79e0084fa1744c1beba6fd0d4e951432fa1ede5510a","affectsGlobalScope":true},{"version":"da233fc1c8a377ba9e0bed690a73c290d843c2c3d23a7bd7ec5cd3d7d73ba1e0","affectsGlobalScope":true},{"version":"d154ea5bb7f7f9001ed9153e876b2d5b8f5c2bb9ec02b3ae0d239ec769f1f2ae","affectsGlobalScope":true},{"version":"bb2d3fb05a1d2ffbca947cc7cbc95d23e1d053d6595391bd325deb265a18d36c","affectsGlobalScope":true},{"version":"c80df75850fea5caa2afe43b9949338ce4e2de086f91713e9af1a06f973872b8","affectsGlobalScope":true},{"version":"09aa50414b80c023553090e2f53827f007a301bc34b0495bfb2c3c08ab9ad1eb","affectsGlobalScope":true},{"version":"2768ef564cfc0689a1b76106c421a2909bdff0acbe87da010785adab80efdd5c","affectsGlobalScope":true},{"version":"52d1bb7ab7a3306fd0375c8bff560feed26ed676a5b0457fa8027b563aecb9a4","affectsGlobalScope":true},"4c2c4f53e8eedd970f8afa369d7371544fb6231bf95e659f8602e09abe74d5a5",{"version":"5540267409ab1444c73c786b8ae4caa37d5f0ea41f9255c6123338da790ce5cc","affectsGlobalScope":true},"c2b5085f47e41d6940bbc5b0d3bd7cc0037c752efb18aecd243c9cf83ad0c0b7","3143a5add0467b83150961ecd33773b561a1207aec727002aa1d70333068eb1b","9deb3a5eaf187df1428f0fee83c8c51eedb74f6da3442410bad9688e42a7e2b5","d0fc76a91c828fbe3f0be5d683273634b7b101068333ceed975a8a9ac464137b",{"version":"1a048ff164b8d9609f5de3139d4e37f6e8a82af82087ac414b9208f52ef8aac7","affectsGlobalScope":true},"3111079f3cb5f2b9c812ca3f46161562bce5bfb355e915f46ed46c41714dc1c3","db86f82fac051ae344b47e8fe7ac7990174b41db79b2b220a49dc5a47c71a9b5","b32b6b16cb0bda68199582ad6f22242d07ee75fac9b1f28a98cd838afc5eea45","4441ee4119824bfaebc49308559edd7545978f9cb41a40f115074e1031dde75f",{"version":"60693a88462d0e97900123b5bf7c73e146ce0cc94da46a61fe6775b430d2ff05","affectsGlobalScope":true},{"version":"588c69eda58b9202676ec7ca11a72c3762819b46a0ed72462c769846153c447c","affectsGlobalScope":true},"ae064ed4f855716b7ff348639ddcd6a6d354a72fae82f506608a7dc9266aa24c","92f019c55b21c939616f6a48f678e714ac7b109444cbbf23ad69310ce66ecbdc","cf0a69c71aedf2f8fe45925abd554fd3dc7301ce66d6ab7521fb8c3471c24dd8","56e6722c6013609b3e5e6ed4a8a7e01f41da6c5e3d6f0ecff3d09ef7a81414cf","139fd681eff7771a38d0c025d13c7a11c5474f6aab61e01c41511d71496df173","f614c3f61e46ccc2cb58702d5a158338ea57ee09099fde5db4cfc63ed0ce4d74","44e42ed6ec9c4451ebe89524e80ac8564e9dd0988c56e6c58f393c810730595d","a504c109b872b0e653549bd258eb06584c148c98d79406c7516995865a6d5089","155865f5f76db0996cd5e20cc5760613ea170ee5ad594c1f3d76fcaa05382161","e92852d673c836fc64e10c38640abcd67c463456e5df55723ac699b8e6ab3a8a","4455c78d226d061b1203c7614c6c6eb5f4f9db5f00d44ff47d0112de8766fbc4",{"version":"ec369bb9d97c4dc09dd2a4093b7ca3ba69ad284831fccac8a1977785e9e38ce5","affectsGlobalScope":true},"4465a636f5f6e9665a90e30691862c9e0a3ac2edc0e66296704f10865e924f2a","9af781f03d44f5635ed7844be0ce370d9d595d4b4ec67cad88f0fac03255257e","f9fd4c3ef6de27fa0e256f4e75b61711c4be05a3399f7714621d3edc832e36b0","e49290b7a927995c0d7e6b2b9c8296284b68a9036d9966531de65185269258d7","c3689f70ce7563c2299f2dcb3c72efdf6f87ae510e7456fa6223c767d0ca99fc","874ca809b79276460011480a2829f4c8d4db29416dd411f71efbf8f497f0ac09","6c903bceaf3f3bc04f2d4c7dcd89ce9fb148b3ba0a5f5408d8f6de2b7eecc7ea","504d049d9e550a65466b73ca39da6469ab41786074ea1d16d37c8853f9f6ab2e","23a28f834a078986bbf58f4e3705956983ff81c3c2493f3db3e5f0e8a9507779","4febdf7f3ec92706c58e0b4e8159cd6de718284ef384260b07c9641c13fc70ce",{"version":"eabefc2999c1489cf870e0c85af908900462fa245822d9a4616780a1a129945d","affectsGlobalScope":true},"7335933d9f30dcfd2c4b6080a8b78e81912a7fcefb1dafccb67ca4cb4b3ac23d","a6bfe9de9adef749010c118104b071d14943802ff0614732b47ce4f1c3e383cd","4c3d0e10396646db4a1e917fb852077ee77ae62e512913bef9cccc2bb0f8bd0e","3b220849d58140dcc6718f5b52dcd29fdb79c45bc28f561cbd29eb1cac6cce13","0ee22fce41f7417a24c808d266e91b850629113c104713a35854393d55994beb","22d1b1d965baba05766613e2e6c753bb005d4386c448cafd72c309ba689e8c24",{"version":"2708349d5a11a5c2e5f3a0765259ebe7ee00cdcc8161cb9990cb4910328442a1","affectsGlobalScope":true},"c6c0bd221bb1e94768e94218f8298e47633495529d60cae7d8da9374247a1cf5","16d51f964ec125ad2024cf03f0af444b3bc3ec3614d9345cc54d09bab45c9a4c","ba601641fac98c229ccd4a303f747de376d761babb33229bb7153bed9356c9cc",{"version":"c5dd1fef4cd4aaffc78786047bed5ae6fc1200d19a1946cbc4e2d3ed4d62c8fa","affectsGlobalScope":true},"5b9ecf7da4d71cf3832dbb8336150fa924631811f488ad4690c2dfec2b4fb1d7","951c85f75aac041dddbedfedf565886a7b494e29ec1532e2a9b4a6180560b50e","e6f0cb9d8cb2e38bec66e032e73caa3e7c6671f21ed7196acb821aec462051f2","6d829824ead8999f87b6df21200df3c6150391b894b4e80662caa462bd48d073","afc559c1b93df37c25aef6b3dfa2d64325b0e112e887ee18bf7e6f4ec383fc90","43cdd474c5aa3340da4816bb8f1ae7f3b1bcf9e70d997afc36a0f2c432378c84",{"version":"ac95a3079883f7bde32a463e28af2c8e6d61d6220a1062c4e736df5215f92f77","affectsGlobalScope":true},"de3367f8a20cddb78a9405a7c8836c6e9c1c66d1c585e3aea1fa75237df73df6","15c9f5021b7c9f4ca4674afa26d870dc05da9d7095f107546b92b1480fed436f","6a9c5127096b35264eb7cd21b2417bfc1d42cceca9ba4ce2bb0c3410b7816042","78828b06c0d3b586954015e9ebde5480b009e166c71244763bda328ec0920f41",{"version":"698fdb729cd894c34be04858cb4a5cd338bbaa64c4850f0446aea0bf0c440db5","signature":"3852325cf6d9977f766e4624909b06b1c7345515d0c872c71c8d34a77be764a0"},{"version":"3984e55a01cd37282bfc4caa7a8f2a78eb7e8ec7b47dd8cec3569d907d270cc3","signature":"50d61d1b21fd4452d1b8a3e57eb55e982df4c5eaf9f8a597861e136d16094245"},"0ceec7923fb2a6e540f73682c7acffe9124c9c3517a02eac27632844b8a61251",{"version":"c115e90807f74b9b380e94ad4a11ac4315114c920092aefcef1bd51e450cabed","signature":"38fc4f9c48711d3d441e7caa53a42d85485e985f20dc1213170379ee178b8235"},{"version":"e171f0cd13b54a9c2c2f399d1de747c9a2deeae9343edd4c3b3713eccd64b137","signature":"8e609bb71c20b858c77f0e9f90bb1319db8477b13f9f965f1a1e18524bf50881"},"8d48b8f8a377ade8dd1f000625bc276eea067f2529cc9cafdf082d17142107d6","8e9c23ba78aabc2e0a27033f18737a6df754067731e69dc5f52823957d60a4b6","29c5862cadd1c5e069453c60e8b240870431396921a50afc57bfdf5bdc614e47","76232dbb982272b182a76ad8745a9b02724dc9896e2328ce360e2c56c64c9778",{"version":"a71026942d45c0177d37a40d1239023880767cba7cb57f15a1857ca26dff48c1","signature":"a5bc006cbb01fe402cf0cdf8bff78d8b7c09a175faff0d575972d87f0c1aefb8"},"77b390170976625bb91b4ba2eff90a17d6474a3b9e37121894bee56dcce72e07"],"options":{"declaration":true,"esModuleInterop":true,"inlineSourceMap":true,"module":1,"noFallthroughCasesInSwitch":true,"noImplicitReturns":true,"noUnusedLocals":false,"noUnusedParameters":false,"outDir":"./main","rootDir":"../src","strict":true,"strictFunctionTypes":false,"target":5},"fileIdsList":[[44,72,79],[44,72],[85],[41,44,72,73,74],[41,81],[74,75,78,80],[76],[77],[29],[31],[32,37],[33,41,42,49,58],[33,34,41,49],[35,65],[36,37,42,50],[37,58],[38,39,41,49],[39],[40,41],[41],[41,42,43,58,64],[42,43],[44,49,58,64],[41,42,44,45,49,58,61,64],[44,46,58,61,64],[29,30,31,32,33,34,35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66,67,68,69,70,71],[41,47],[48,64],[39,41,49,58],[50],[51],[31,52],[53,63],[54],[55],[41,56],[56,57,65,67],[41,58],[59],[60],[49,58,61],[62],[49,63],[55,64],[65],[58,66],[67],[68],[41,43,58,64,67,69],[58,70],[44,72,77],[32,42,44,58,72,92],[94],[39,41,49,58,61,72,83],[87],[82,84,87,89,90],[35,65,82,84,86,97],[81,82,87,88,89,95],[65,82,87],[82,84],[82],[82,87]],"referencedMap":[[80,1],[79,2],[86,3],[75,4],[82,5],[81,6],[77,7],[76,8],[29,9],[31,10],[32,11],[33,12],[34,13],[35,14],[36,15],[37,16],[38,17],[39,18],[40,19],[41,20],[42,21],[43,22],[44,23],[45,24],[46,25],[72,26],[47,27],[48,28],[49,29],[50,30],[51,31],[52,32],[53,33],[54,34],[55,35],[56,36],[57,37],[58,38],[59,39],[60,40],[61,41],[62,42],[63,43],[64,44],[65,45],[66,46],[67,47],[68,48],[69,49],[70,50],[78,51],[94,52],[95,53],[84,54],[88,55],[91,56],[87,57],[96,58],[90,59]],"exportedModulesMap":[[80,1],[79,2],[86,3],[75,4],[82,5],[81,6],[77,7],[76,8],[29,9],[31,10],[32,11],[33,12],[34,13],[35,14],[36,15],[37,16],[38,17],[39,18],[40,19],[41,20],[42,21],[43,22],[44,23],[45,24],[46,25],[72,26],[47,27],[48,28],[49,29],[50,30],[51,31],[52,32],[53,33],[54,34],[55,35],[56,36],[57,37],[58,38],[59,39],[60,40],[61,41],[62,42],[63,43],[64,44],[65,45],[66,46],[67,47],[68,48],[69,49],[70,50],[78,51],[94,52],[95,53],[84,54],[88,55],[87,60],[96,61],[90,62]],"semanticDiagnosticsPerFile":[80,79,92,86,75,82,81,77,76,85,29,31,32,33,34,35,36,37,38,39,40,41,42,43,30,71,44,45,46,72,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66,67,68,69,70,74,73,78,94,95,89,83,93,84,7,6,2,8,9,10,11,12,13,14,15,3,4,19,16,17,18,20,21,22,5,23,24,25,26,27,1,28,88,91,87,96,90,97]},"version":"4.9.5"} \ No newline at end of file diff --git a/node_modules/connect-mongo/docker-compose.yaml b/node_modules/connect-mongo/docker-compose.yaml new file mode 100644 index 0000000..f6368d7 --- /dev/null +++ b/node_modules/connect-mongo/docker-compose.yaml @@ -0,0 +1,11 @@ +version: '3.1' + +services: + mongo: + image: mongo:4.4 + restart: always + environment: + MONGO_INITDB_ROOT_USERNAME: root + MONGO_INITDB_ROOT_PASSWORD: example + ports: + - '27017:27017' diff --git a/node_modules/connect-mongo/example/index.js b/node_modules/connect-mongo/example/index.js new file mode 100644 index 0000000..2f270c8 --- /dev/null +++ b/node_modules/connect-mongo/example/index.js @@ -0,0 +1,26 @@ +const express = require('express') +const session = require('express-session') +const MongoStore = require('connect-mongo') + +const app = express() +const port = 3000 + +app.use(session({ + secret: 'foo', + resave: false, + saveUninitialized: false, + store: MongoStore.create({ + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + dbName: "example-db", + stringify: false, + }) +})); + +app.get('/', (req, res) => { + req.session.foo = 'test-id' + res.send('Hello World!') +}) + +app.listen(port, () => { + console.log(`Example app listening at http://localhost:${port}`) +}) diff --git a/node_modules/connect-mongo/example/mongoose-multiple-connections.js b/node_modules/connect-mongo/example/mongoose-multiple-connections.js new file mode 100644 index 0000000..060c1e7 --- /dev/null +++ b/node_modules/connect-mongo/example/mongoose-multiple-connections.js @@ -0,0 +1,68 @@ +const express = require('express') +const mongoose = require('mongoose') +const session = require('express-session') +const MongoStore = require('connect-mongo') + +// App Init +const app = express() +const port = 3000 + +// Starting Server +app.listen(port, () => { + console.log(`Example app listening at http://localhost:${port}`) +}) + +// Mongoose Connection +const appDBConnection = mongoose + .createConnection('mongodb://root:example@127.0.0.1:27017', { + useNewUrlParser: true, + useUnifiedTopology: true, + }) + .then((connection) => { + console.log('Connected to AppDB.') + return connection + }) + +const sessionDBConnection = mongoose + .createConnection('mongodb://root:example@127.0.0.1:27017', { + useNewUrlParser: true, + useUnifiedTopology: true, + }) + .then((connection) => { + console.log('Connected to SessionsDB.') + return connection + }) + +// Session Init +const sessionInit = (client) => { + app.use( + session({ + store: MongoStore.create({ + client: client, + mongoOptions: { + useNewUrlParser: true, + useUnifiedTopology: true, + }, + }), + secret: 'hello', + resave: false, + saveUninitialized: false, + cookie: { maxAge: 24 * 60 * 60 * 1000 }, + }) + ) +} + +// Router Init +const router = express.Router() + +router.get('', (req, res) => { + req.session.foo = 'bar' + res.send('Session Updated') +}) + +(async function () { + const connection = await sessionDBConnection + const mongoClient = connection.getClient() + sessionInit(mongoClient) + app.use('/', router) +})() diff --git a/node_modules/connect-mongo/example/mongoose.js b/node_modules/connect-mongo/example/mongoose.js new file mode 100644 index 0000000..10ac2b6 --- /dev/null +++ b/node_modules/connect-mongo/example/mongoose.js @@ -0,0 +1,34 @@ +const express = require('express') +const session = require('express-session') +const MongoStore = require('connect-mongo') +const mongoose = require('mongoose'); + +const app = express() +const port = 3000 + +const clientP = mongoose.connect( + 'mongodb://root:example@127.0.0.1:27017', + { useNewUrlParser: true, useUnifiedTopology: true } +).then(m => m.connection.getClient()) + +app.use(session({ + secret: 'foo', + resave: false, + saveUninitialized: false, + store: MongoStore.create({ + clientPromise: clientP, + dbName: "example-db-mongoose", + stringify: false, + autoRemove: 'interval', + autoRemoveInterval: 1 + }) +})); + +app.get('/', (req, res) => { + req.session.foo = 'test-id' + res.send('Hello World!') +}) + +app.listen(port, () => { + console.log(`Example app listening at http://localhost:${port}`) +}) diff --git a/node_modules/connect-mongo/example/package.json b/node_modules/connect-mongo/example/package.json new file mode 100644 index 0000000..8dce1e5 --- /dev/null +++ b/node_modules/connect-mongo/example/package.json @@ -0,0 +1,24 @@ +{ + "name": "connect-mongo-example", + "version": "1.0.0", + "description": "connect-mongo example code", + "main": "index.js", + "license": "MIT", + "scripts": { + "start:js": "node index.js", + "start:mongoose": "node mongoose.js", + "start:ts": "tsc && node build/ts-example.js" + }, + "resolutions": { + "mongodb": "3.6.3" + }, + "dependencies": { + "connect-mongo": "^4.4.0", + "express": "^4.17.1", + "express-session": "^1.17.1", + "mongoose": "5.12.1" + }, + "devDependencies": { + "typescript": "^4.2.3" + } +} diff --git a/node_modules/connect-mongo/example/ts-example.ts b/node_modules/connect-mongo/example/ts-example.ts new file mode 100644 index 0000000..2823b9d --- /dev/null +++ b/node_modules/connect-mongo/example/ts-example.ts @@ -0,0 +1,32 @@ +import express from 'express' +import session from 'express-session' +import MongoStore from 'connect-mongo' + +const app = express() +const port = 3000 + +declare module 'express-session' { + interface SessionData { + foo: string + } +} + +app.use(session({ + secret: 'foo', + resave: false, + saveUninitialized: false, + store: MongoStore.create({ + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + dbName: "example-db", + stringify: false, + }) +})); + +app.get('/', (req, res) => { + req.session.foo = 'test-id' + res.send('Hello World!') +}) + +app.listen(port, () => { + console.log(`Example app listening at http://localhost:${port}`) +}) diff --git a/node_modules/connect-mongo/example/tsconfig.json b/node_modules/connect-mongo/example/tsconfig.json new file mode 100644 index 0000000..70508cb --- /dev/null +++ b/node_modules/connect-mongo/example/tsconfig.json @@ -0,0 +1,71 @@ +{ + "compilerOptions": { + /* Visit https://aka.ms/tsconfig.json to read more about this file */ + + /* Basic Options */ + // "incremental": true, /* Enable incremental compilation */ + "target": "es2018" /* Specify ECMAScript target version: 'ES3' (default), 'ES5', 'ES2015', 'ES2016', 'ES2017', 'ES2018', 'ES2019', 'ES2020', or 'ESNEXT'. */, + "module": "commonjs" /* Specify module code generation: 'none', 'commonjs', 'amd', 'system', 'umd', 'es2015', 'es2020', or 'ESNext'. */, + // "lib": [], /* Specify library files to be included in the compilation. */ + "allowJs": true /* Allow javascript files to be compiled. */, + // "checkJs": true, /* Report errors in .js files. */ + // "jsx": "preserve", /* Specify JSX code generation: 'preserve', 'react-native', 'react', 'react-jsx' or 'react-jsxdev'. */ + // "declaration": true, /* Generates corresponding '.d.ts' file. */ + // "declarationMap": true, /* Generates a sourcemap for each corresponding '.d.ts' file. */ + "sourceMap": true /* Generates corresponding '.map' file. */, + // "outFile": "./", /* Concatenate and emit output to single file. */ + "outDir": "./build" /* Redirect output structure to the directory. */, + // "rootDir": "./", /* Specify the root directory of input files. Use to control the output directory structure with --outDir. */ + // "composite": true, /* Enable project compilation */ + // "tsBuildInfoFile": "./", /* Specify file to store incremental compilation information */ + // "removeComments": true, /* Do not emit comments to output. */ + // "noEmit": true, /* Do not emit outputs. */ + // "importHelpers": true, /* Import emit helpers from 'tslib'. */ + // "downlevelIteration": true, /* Provide full support for iterables in 'for-of', spread, and destructuring when targeting 'ES5' or 'ES3'. */ + // "isolatedModules": true, /* Transpile each file as a separate module (similar to 'ts.transpileModule'). */ + + /* Strict Type-Checking Options */ + "strict": true /* Enable all strict type-checking options. */, + // "noImplicitAny": true, /* Raise error on expressions and declarations with an implied 'any' type. */ + // "strictNullChecks": true, /* Enable strict null checks. */ + // "strictFunctionTypes": true, /* Enable strict checking of function types. */ + // "strictBindCallApply": true, /* Enable strict 'bind', 'call', and 'apply' methods on functions. */ + // "strictPropertyInitialization": true, /* Enable strict checking of property initialization in classes. */ + // "noImplicitThis": true, /* Raise error on 'this' expressions with an implied 'any' type. */ + // "alwaysStrict": true, /* Parse in strict mode and emit "use strict" for each source file. */ + + /* Additional Checks */ + // "noUnusedLocals": true, /* Report errors on unused locals. */ + // "noUnusedParameters": true, /* Report errors on unused parameters. */ + // "noImplicitReturns": true, /* Report error when not all code paths in function return a value. */ + // "noFallthroughCasesInSwitch": true, /* Report errors for fallthrough cases in switch statement. */ + // "noUncheckedIndexedAccess": true, /* Include 'undefined' in index signature results */ + // "noPropertyAccessFromIndexSignature": true, /* Require undeclared properties from index signatures to use element accesses. */ + + /* Module Resolution Options */ + // "moduleResolution": "node", /* Specify module resolution strategy: 'node' (Node.js) or 'classic' (TypeScript pre-1.6). */ + // "baseUrl": "./", /* Base directory to resolve non-absolute module names. */ + // "paths": {}, /* A series of entries which re-map imports to lookup locations relative to the 'baseUrl'. */ + // "rootDirs": [], /* List of root folders whose combined content represents the structure of the project at runtime. */ + // "typeRoots": [], /* List of folders to include type definitions from. */ + // "types": [], /* Type declaration files to be included in compilation. */ + // "allowSyntheticDefaultImports": true, /* Allow default imports from modules with no default export. This does not affect code emit, just typechecking. */ + "esModuleInterop": true /* Enables emit interoperability between CommonJS and ES Modules via creation of namespace objects for all imports. Implies 'allowSyntheticDefaultImports'. */, + // "preserveSymlinks": true, /* Do not resolve the real path of symlinks. */ + // "allowUmdGlobalAccess": true, /* Allow accessing UMD globals from modules. */ + + /* Source Map Options */ + // "sourceRoot": "", /* Specify the location where debugger should locate TypeScript files instead of source locations. */ + // "mapRoot": "", /* Specify the location where debugger should locate map files instead of generated locations. */ + // "inlineSourceMap": true, /* Emit a single file with source maps instead of having a separate file. */ + // "inlineSources": true, /* Emit the source alongside the sourcemaps within a single file; requires '--inlineSourceMap' or '--sourceMap' to be set. */ + + /* Experimental Options */ + // "experimentalDecorators": true, /* Enables experimental support for ES7 decorators. */ + // "emitDecoratorMetadata": true, /* Enables experimental support for emitting type metadata for decorators. */ + + /* Advanced Options */ + "skipLibCheck": true /* Skip type checking of declaration files. */, + "forceConsistentCasingInFileNames": true /* Disallow inconsistently-cased references to the same file. */ + } +} diff --git a/node_modules/connect-mongo/example/yarn.lock b/node_modules/connect-mongo/example/yarn.lock new file mode 100644 index 0000000..7dc0f17 --- /dev/null +++ b/node_modules/connect-mongo/example/yarn.lock @@ -0,0 +1,666 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +"@types/bson@*": + version "4.0.3" + resolved "https://registry.yarnpkg.com/@types/bson/-/bson-4.0.3.tgz#30889d2ffde6262abbe38659364c631454999fbf" + integrity sha512-mVRvYnTOZJz3ccpxhr3wgxVmSeiYinW+zlzQz3SXWaJmD1DuL05Jeq7nKw3SnbKmbleW5qrLG5vdyWe/A9sXhw== + dependencies: + "@types/node" "*" + +"@types/mongodb@^3.5.27": + version "3.6.9" + resolved "https://registry.yarnpkg.com/@types/mongodb/-/mongodb-3.6.9.tgz#55f7e5b04f33904a12d6f0ab4f5d119a5062ade4" + integrity sha512-2XSGr/+IOKeFQ5tU9ATcIiIr7bpHqWyOXNGLOOhp0kg2NnfEvoKZF1SZ25j4zvJRqM2WeSUjfWSvymFJ3HBGJQ== + dependencies: + "@types/bson" "*" + "@types/node" "*" + +"@types/node@*": + version "14.14.33" + resolved "https://registry.yarnpkg.com/@types/node/-/node-14.14.33.tgz#9e4f8c64345522e4e8ce77b334a8aaa64e2b6c78" + integrity sha512-oJqcTrgPUF29oUP8AsUqbXGJNuPutsetaa9kTQAQce5Lx5dTYWV02ScBiT/k1BX/Z7pKeqedmvp39Wu4zR7N7g== + +accepts@~1.3.7: + version "1.3.7" + resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.7.tgz#531bc726517a3b2b41f850021c6cc15eaab507cd" + integrity sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA== + dependencies: + mime-types "~2.1.24" + negotiator "0.6.2" + +array-flatten@1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-1.1.1.tgz#9a5f699051b1e7073328f2a008968b64ea2955d2" + integrity sha1-ml9pkFGx5wczKPKgCJaLZOopVdI= + +asn1.js@^5.4.1: + version "5.4.1" + resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-5.4.1.tgz#11a980b84ebb91781ce35b0fdc2ee294e3783f07" + integrity sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA== + dependencies: + bn.js "^4.0.0" + inherits "^2.0.1" + minimalistic-assert "^1.0.0" + safer-buffer "^2.1.0" + +bl@^2.2.1: + version "2.2.1" + resolved "https://registry.yarnpkg.com/bl/-/bl-2.2.1.tgz#8c11a7b730655c5d56898cdc871224f40fd901d5" + integrity sha512-6Pesp1w0DEX1N550i/uGV/TqucVL4AM/pgThFSN/Qq9si1/DF9aIHs1BxD8V/QU0HoeHO6cQRTAuYnLPKq1e4g== + dependencies: + readable-stream "^2.3.5" + safe-buffer "^5.1.1" + +bluebird@3.5.1: + version "3.5.1" + resolved "https://registry.yarnpkg.com/bluebird/-/bluebird-3.5.1.tgz#d9551f9de98f1fcda1e683d17ee91a0602ee2eb9" + integrity sha512-MKiLiV+I1AA596t9w1sQJ8jkiSr5+ZKi0WKrYGUn6d1Fx+Ij4tIj+m2WMQSGczs5jZVxV339chE8iwk6F64wjA== + +bn.js@^4.0.0: + version "4.12.0" + resolved "https://registry.yarnpkg.com/bn.js/-/bn.js-4.12.0.tgz#775b3f278efbb9718eec7361f483fb36fbbfea88" + integrity sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA== + +body-parser@1.19.0: + version "1.19.0" + resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.19.0.tgz#96b2709e57c9c4e09a6fd66a8fd979844f69f08a" + integrity sha512-dhEPs72UPbDnAQJ9ZKMNTP6ptJaionhP5cBb541nXPlW60Jepo9RV/a4fX4XWW9CuFNK22krhrj1+rgzifNCsw== + dependencies: + bytes "3.1.0" + content-type "~1.0.4" + debug "2.6.9" + depd "~1.1.2" + http-errors "1.7.2" + iconv-lite "0.4.24" + on-finished "~2.3.0" + qs "6.7.0" + raw-body "2.4.0" + type-is "~1.6.17" + +bson@^1.1.4: + version "1.1.5" + resolved "https://registry.yarnpkg.com/bson/-/bson-1.1.5.tgz#2aaae98fcdf6750c0848b0cba1ddec3c73060a34" + integrity sha512-kDuEzldR21lHciPQAIulLs1LZlCXdLziXI6Mb/TDkwXhb//UORJNPXgcRs2CuO4H0DcMkpfT3/ySsP3unoZjBg== + +bytes@3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.1.0.tgz#f6cf7933a360e0588fa9fde85651cdc7f805d1f6" + integrity sha512-zauLjrfCG+xvoyaqLoV8bLVXXNGC4JqlxFCutSDWA6fJrTo2ZuvLYTqZ7aHBLZSMOopbzwv8f+wZcVzfVTI2Dg== + +connect-mongo@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/connect-mongo/-/connect-mongo-4.4.0.tgz#08b3deaadcd2b27c9f154784f8ff697d1ca3681b" + integrity sha512-TTv9SUeLazm7eAvrzDfcIbiRcgeK8Dhif6XLDxnL41S3/1+EtFUgdI+kx6lcZtEdobMY/ehLWtJ6+WTXtsQDvg== + dependencies: + debug "^4.3.1" + kruptein "^3.0.0" + mongodb "3.6.3" + +content-disposition@0.5.3: + version "0.5.3" + resolved "https://registry.yarnpkg.com/content-disposition/-/content-disposition-0.5.3.tgz#e130caf7e7279087c5616c2007d0485698984fbd" + integrity sha512-ExO0774ikEObIAEV9kDo50o+79VCUdEB6n6lzKgGwupcVeRlhrj3qGAfwq8G6uBJjkqLrhT0qEYFcWng8z1z0g== + dependencies: + safe-buffer "5.1.2" + +content-type@~1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/content-type/-/content-type-1.0.4.tgz#e138cc75e040c727b1966fe5e5f8c9aee256fe3b" + integrity sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA== + +cookie-signature@1.0.6: + version "1.0.6" + resolved "https://registry.yarnpkg.com/cookie-signature/-/cookie-signature-1.0.6.tgz#e303a882b342cc3ee8ca513a79999734dab3ae2c" + integrity sha1-4wOogrNCzD7oylE6eZmXNNqzriw= + +cookie@0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.4.0.tgz#beb437e7022b3b6d49019d088665303ebe9c14ba" + integrity sha512-+Hp8fLp57wnUSt0tY0tHEXh4voZRDnoIrZPqlo3DPiI4y9lwg/jqx+1Om94/W6ZaPDOUbnjOt/99w66zk+l1Xg== + +core-util-is@~1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.2.tgz#b5fd54220aa2bc5ab57aab7140c940754503c1a7" + integrity sha1-tf1UIgqivFq1eqtxQMlAdUUDwac= + +debug@2.6.9: + version "2.6.9" + resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f" + integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA== + dependencies: + ms "2.0.0" + +debug@3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/debug/-/debug-3.1.0.tgz#5bb5a0672628b64149566ba16819e61518c67261" + integrity sha512-OX8XqP7/1a9cqkxYw2yXss15f26NKWBpDXQd0/uK/KPqdQhxbPa994hnzjcE2VqQpDslf55723cKPUOGSmMY3g== + dependencies: + ms "2.0.0" + +debug@^4.3.1: + version "4.3.1" + resolved "https://registry.yarnpkg.com/debug/-/debug-4.3.1.tgz#f0d229c505e0c6d8c49ac553d1b13dc183f6b2ee" + integrity sha512-doEwdvm4PCeK4K3RQN2ZC2BYUBaxwLARCqZmMjtF8a51J2Rb0xpVloFRnCODwqjpwnAoao4pelN8l3RJdv3gRQ== + dependencies: + ms "2.1.2" + +denque@^1.4.1: + version "1.5.0" + resolved "https://registry.yarnpkg.com/denque/-/denque-1.5.0.tgz#773de0686ff2d8ec2ff92914316a47b73b1c73de" + integrity sha512-CYiCSgIF1p6EUByQPlGkKnP1M9g0ZV3qMIrqMqZqdwazygIA/YP2vrbcyl1h/WppKJTdl1F85cXIle+394iDAQ== + +depd@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/depd/-/depd-1.1.2.tgz#9bcd52e14c097763e749b274c4346ed2e560b5a9" + integrity sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak= + +depd@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/depd/-/depd-2.0.0.tgz#b696163cc757560d09cf22cc8fad1571b79e76df" + integrity sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw== + +destroy@~1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/destroy/-/destroy-1.0.4.tgz#978857442c44749e4206613e37946205826abd80" + integrity sha1-l4hXRCxEdJ5CBmE+N5RiBYJqvYA= + +ee-first@1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/ee-first/-/ee-first-1.1.1.tgz#590c61156b0ae2f4f0255732a158b266bc56b21d" + integrity sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0= + +encodeurl@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/encodeurl/-/encodeurl-1.0.2.tgz#ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59" + integrity sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k= + +escape-html@~1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/escape-html/-/escape-html-1.0.3.tgz#0258eae4d3d0c0974de1c169188ef0051d1d1988" + integrity sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg= + +etag@~1.8.1: + version "1.8.1" + resolved "https://registry.yarnpkg.com/etag/-/etag-1.8.1.tgz#41ae2eeb65efa62268aebfea83ac7d79299b0887" + integrity sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc= + +express-session@^1.17.1: + version "1.17.1" + resolved "https://registry.yarnpkg.com/express-session/-/express-session-1.17.1.tgz#36ecbc7034566d38c8509885c044d461c11bf357" + integrity sha512-UbHwgqjxQZJiWRTMyhvWGvjBQduGCSBDhhZXYenziMFjxst5rMV+aJZ6hKPHZnPyHGsrqRICxtX8jtEbm/z36Q== + dependencies: + cookie "0.4.0" + cookie-signature "1.0.6" + debug "2.6.9" + depd "~2.0.0" + on-headers "~1.0.2" + parseurl "~1.3.3" + safe-buffer "5.2.0" + uid-safe "~2.1.5" + +express@^4.17.1: + version "4.17.1" + resolved "https://registry.yarnpkg.com/express/-/express-4.17.1.tgz#4491fc38605cf51f8629d39c2b5d026f98a4c134" + integrity sha512-mHJ9O79RqluphRrcw2X/GTh3k9tVv8YcoyY4Kkh4WDMUYKRZUq0h1o0w2rrrxBqM7VoeUVqgb27xlEMXTnYt4g== + dependencies: + accepts "~1.3.7" + array-flatten "1.1.1" + body-parser "1.19.0" + content-disposition "0.5.3" + content-type "~1.0.4" + cookie "0.4.0" + cookie-signature "1.0.6" + debug "2.6.9" + depd "~1.1.2" + encodeurl "~1.0.2" + escape-html "~1.0.3" + etag "~1.8.1" + finalhandler "~1.1.2" + fresh "0.5.2" + merge-descriptors "1.0.1" + methods "~1.1.2" + on-finished "~2.3.0" + parseurl "~1.3.3" + path-to-regexp "0.1.7" + proxy-addr "~2.0.5" + qs "6.7.0" + range-parser "~1.2.1" + safe-buffer "5.1.2" + send "0.17.1" + serve-static "1.14.1" + setprototypeof "1.1.1" + statuses "~1.5.0" + type-is "~1.6.18" + utils-merge "1.0.1" + vary "~1.1.2" + +finalhandler@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/finalhandler/-/finalhandler-1.1.2.tgz#b7e7d000ffd11938d0fdb053506f6ebabe9f587d" + integrity sha512-aAWcW57uxVNrQZqFXjITpW3sIUQmHGG3qSb9mUah9MgMC4NeWhNOlNjXEYq3HjRAvL6arUviZGGJsBg6z0zsWA== + dependencies: + debug "2.6.9" + encodeurl "~1.0.2" + escape-html "~1.0.3" + on-finished "~2.3.0" + parseurl "~1.3.3" + statuses "~1.5.0" + unpipe "~1.0.0" + +forwarded@~0.1.2: + version "0.1.2" + resolved "https://registry.yarnpkg.com/forwarded/-/forwarded-0.1.2.tgz#98c23dab1175657b8c0573e8ceccd91b0ff18c84" + integrity sha1-mMI9qxF1ZXuMBXPozszZGw/xjIQ= + +fresh@0.5.2: + version "0.5.2" + resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.5.2.tgz#3d8cadd90d976569fa835ab1f8e4b23a105605a7" + integrity sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac= + +http-errors@1.7.2: + version "1.7.2" + resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.7.2.tgz#4f5029cf13239f31036e5b2e55292bcfbcc85c8f" + integrity sha512-uUQBt3H/cSIVfch6i1EuPNy/YsRSOUBXTVfZ+yR7Zjez3qjBz6i9+i4zjNaoqcoFVI4lQJ5plg63TvGfRSDCRg== + dependencies: + depd "~1.1.2" + inherits "2.0.3" + setprototypeof "1.1.1" + statuses ">= 1.5.0 < 2" + toidentifier "1.0.0" + +http-errors@~1.7.2: + version "1.7.3" + resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-1.7.3.tgz#6c619e4f9c60308c38519498c14fbb10aacebb06" + integrity sha512-ZTTX0MWrsQ2ZAhA1cejAwDLycFsd7I7nVtnkT3Ol0aqodaKW+0CTZDQ1uBv5whptCnc8e8HeRRJxRs0kmm/Qfw== + dependencies: + depd "~1.1.2" + inherits "2.0.4" + setprototypeof "1.1.1" + statuses ">= 1.5.0 < 2" + toidentifier "1.0.0" + +iconv-lite@0.4.24: + version "0.4.24" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b" + integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA== + dependencies: + safer-buffer ">= 2.1.2 < 3" + +inherits@2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.3.tgz#633c2c83e3da42a502f52466022480f4208261de" + integrity sha1-Yzwsg+PaQqUC9SRmAiSA9CCCYd4= + +inherits@2.0.4, inherits@^2.0.1, inherits@~2.0.3: + version "2.0.4" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c" + integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ== + +ipaddr.js@1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/ipaddr.js/-/ipaddr.js-1.9.1.tgz#bff38543eeb8984825079ff3a2a8e6cbd46781b3" + integrity sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g== + +isarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" + integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE= + +kareem@2.3.2: + version "2.3.2" + resolved "https://registry.yarnpkg.com/kareem/-/kareem-2.3.2.tgz#78c4508894985b8d38a0dc15e1a8e11078f2ca93" + integrity sha512-STHz9P7X2L4Kwn72fA4rGyqyXdmrMSdxqHx9IXon/FXluXieaFA6KJ2upcHAHxQPQ0LeM/OjLrhFxifHewOALQ== + +kruptein@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/kruptein/-/kruptein-3.0.0.tgz#9a7960248c9758f1e75522d2b87b8388bd40874f" + integrity sha512-Fh5sIb+3XI9L12GsgeBQqXVRPLB1HVViKSUkqPPOcqTEX4NwoF8Z3pEfMSl3Psd1j+QlloV8Uxxwp4gk3aFBGA== + dependencies: + asn1.js "^5.4.1" + +media-typer@0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/media-typer/-/media-typer-0.3.0.tgz#8710d7af0aa626f8fffa1ce00168545263255748" + integrity sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g= + +memory-pager@^1.0.2: + version "1.5.0" + resolved "https://registry.yarnpkg.com/memory-pager/-/memory-pager-1.5.0.tgz#d8751655d22d384682741c972f2c3d6dfa3e66b5" + integrity sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg== + +merge-descriptors@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61" + integrity sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E= + +methods@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/methods/-/methods-1.1.2.tgz#5529a4d67654134edcc5266656835b0f851afcee" + integrity sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4= + +mime-db@1.46.0: + version "1.46.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.46.0.tgz#6267748a7f799594de3cbc8cde91def349661cee" + integrity sha512-svXaP8UQRZ5K7or+ZmfNhg2xX3yKDMUzqadsSqi4NCH/KomcH75MAMYAGVlvXn4+b/xOPhS3I2uHKRUzvjY7BQ== + +mime-types@~2.1.24: + version "2.1.29" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.29.tgz#1d4ab77da64b91f5f72489df29236563754bb1b2" + integrity sha512-Y/jMt/S5sR9OaqteJtslsFZKWOIIqMACsJSiHghlCAyhf7jfVYjKBmLiX8OgpWeW+fjJ2b+Az69aPFPkUOY6xQ== + dependencies: + mime-db "1.46.0" + +mime@1.6.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/mime/-/mime-1.6.0.tgz#32cd9e5c64553bd58d19a568af452acff04981b1" + integrity sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg== + +minimalistic-assert@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz#2e194de044626d4a10e7f7fbc00ce73e83e4d5c7" + integrity sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A== + +mongodb@3.6.3, mongodb@3.6.5: + version "3.6.3" + resolved "https://registry.yarnpkg.com/mongodb/-/mongodb-3.6.3.tgz#eddaed0cc3598474d7a15f0f2a5b04848489fd05" + integrity sha512-rOZuR0QkodZiM+UbQE5kDsJykBqWi0CL4Ec2i1nrGrUI3KO11r6Fbxskqmq3JK2NH7aW4dcccBuUujAP0ERl5w== + dependencies: + bl "^2.2.1" + bson "^1.1.4" + denque "^1.4.1" + require_optional "^1.0.1" + safe-buffer "^5.1.2" + optionalDependencies: + saslprep "^1.0.0" + +mongoose-legacy-pluralize@1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/mongoose-legacy-pluralize/-/mongoose-legacy-pluralize-1.0.2.tgz#3ba9f91fa507b5186d399fb40854bff18fb563e4" + integrity sha512-Yo/7qQU4/EyIS8YDFSeenIvXxZN+ld7YdV9LqFVQJzTLye8unujAWPZ4NWKfFA+RNjh+wvTWKY9Z3E5XM6ZZiQ== + +mongoose@5.12.1: + version "5.12.1" + resolved "https://registry.yarnpkg.com/mongoose/-/mongoose-5.12.1.tgz#9aace8ac783b239906253396a98f2a56c0964b8b" + integrity sha512-g/oIEvQQrK1XcICS/PfzU1Gu1s6Uw1rgJP7/SfC3Ru6pTLa1dH2Lb+iJipNWqChbrykE78j/wwBVSsbyCZRl5Q== + dependencies: + "@types/mongodb" "^3.5.27" + bson "^1.1.4" + kareem "2.3.2" + mongodb "3.6.5" + mongoose-legacy-pluralize "1.0.2" + mpath "0.8.3" + mquery "3.2.4" + ms "2.1.2" + regexp-clone "1.0.0" + safe-buffer "5.2.1" + sift "7.0.1" + sliced "1.0.1" + +mpath@0.8.3: + version "0.8.3" + resolved "https://registry.yarnpkg.com/mpath/-/mpath-0.8.3.tgz#828ac0d187f7f42674839d74921970979abbdd8f" + integrity sha512-eb9rRvhDltXVNL6Fxd2zM9D4vKBxjVVQNLNijlj7uoXUy19zNDsIif5zR+pWmPCWNKwAtqyo4JveQm4nfD5+eA== + +mquery@3.2.4: + version "3.2.4" + resolved "https://registry.yarnpkg.com/mquery/-/mquery-3.2.4.tgz#9c5c2e285ea6c6f20673f3528973c99ee1aaa1a0" + integrity sha512-uOLpp7iRX0BV1Uu6YpsqJ5b42LwYnmu0WeF/f8qgD/On3g0XDaQM6pfn0m6UxO6SM8DioZ9Bk6xxbWIGHm2zHg== + dependencies: + bluebird "3.5.1" + debug "3.1.0" + regexp-clone "^1.0.0" + safe-buffer "5.1.2" + sliced "1.0.1" + +ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" + integrity sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g= + +ms@2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.1.tgz#30a5864eb3ebb0a66f2ebe6d727af06a09d86e0a" + integrity sha512-tgp+dl5cGk28utYktBsrFqA7HKgrhgPsg6Z/EfhWI4gl1Hwq8B/GmY/0oXZ6nF8hDVesS/FpnYaD/kOWhYQvyg== + +ms@2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009" + integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w== + +negotiator@0.6.2: + version "0.6.2" + resolved "https://registry.yarnpkg.com/negotiator/-/negotiator-0.6.2.tgz#feacf7ccf525a77ae9634436a64883ffeca346fb" + integrity sha512-hZXc7K2e+PgeI1eDBe/10Ard4ekbfrrqG8Ep+8Jmf4JID2bNg7NvCPOZN+kfF574pFQI7mum2AUqDidoKqcTOw== + +on-finished@~2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/on-finished/-/on-finished-2.3.0.tgz#20f1336481b083cd75337992a16971aa2d906947" + integrity sha1-IPEzZIGwg811M3mSoWlxqi2QaUc= + dependencies: + ee-first "1.1.1" + +on-headers@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/on-headers/-/on-headers-1.0.2.tgz#772b0ae6aaa525c399e489adfad90c403eb3c28f" + integrity sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA== + +parseurl@~1.3.3: + version "1.3.3" + resolved "https://registry.yarnpkg.com/parseurl/-/parseurl-1.3.3.tgz#9da19e7bee8d12dff0513ed5b76957793bc2e8d4" + integrity sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ== + +path-to-regexp@0.1.7: + version "0.1.7" + resolved "https://registry.yarnpkg.com/path-to-regexp/-/path-to-regexp-0.1.7.tgz#df604178005f522f15eb4490e7247a1bfaa67f8c" + integrity sha1-32BBeABfUi8V60SQ5yR6G/qmf4w= + +process-nextick-args@~2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2" + integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag== + +proxy-addr@~2.0.5: + version "2.0.6" + resolved "https://registry.yarnpkg.com/proxy-addr/-/proxy-addr-2.0.6.tgz#fdc2336505447d3f2f2c638ed272caf614bbb2bf" + integrity sha512-dh/frvCBVmSsDYzw6n926jv974gddhkFPfiN8hPOi30Wax25QZyZEGveluCgliBnqmuM+UJmBErbAUFIoDbjOw== + dependencies: + forwarded "~0.1.2" + ipaddr.js "1.9.1" + +qs@6.7.0: + version "6.7.0" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.7.0.tgz#41dc1a015e3d581f1621776be31afb2876a9b1bc" + integrity sha512-VCdBRNFTX1fyE7Nb6FYoURo/SPe62QCaAyzJvUjwRaIsc+NePBEniHlvxFmmX56+HZphIGtV0XeCirBtpDrTyQ== + +random-bytes@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/random-bytes/-/random-bytes-1.0.0.tgz#4f68a1dc0ae58bd3fb95848c30324db75d64360b" + integrity sha1-T2ih3Arli9P7lYSMMDJNt11kNgs= + +range-parser@~1.2.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-1.2.1.tgz#3cf37023d199e1c24d1a55b84800c2f3e6468031" + integrity sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg== + +raw-body@2.4.0: + version "2.4.0" + resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.4.0.tgz#a1ce6fb9c9bc356ca52e89256ab59059e13d0332" + integrity sha512-4Oz8DUIwdvoa5qMJelxipzi/iJIi40O5cGV1wNYp5hvZP8ZN0T+jiNkL0QepXs+EsQ9XJ8ipEDoiH70ySUJP3Q== + dependencies: + bytes "3.1.0" + http-errors "1.7.2" + iconv-lite "0.4.24" + unpipe "1.0.0" + +readable-stream@^2.3.5: + version "2.3.7" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.7.tgz#1eca1cf711aef814c04f62252a36a62f6cb23b57" + integrity sha512-Ebho8K4jIbHAxnuxi7o42OrZgF/ZTNcsZj6nRKyUmkhLFq8CHItp/fy6hQZuZmP/n3yZ9VBUbp4zz/mX8hmYPw== + dependencies: + core-util-is "~1.0.0" + inherits "~2.0.3" + isarray "~1.0.0" + process-nextick-args "~2.0.0" + safe-buffer "~5.1.1" + string_decoder "~1.1.1" + util-deprecate "~1.0.1" + +regexp-clone@1.0.0, regexp-clone@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/regexp-clone/-/regexp-clone-1.0.0.tgz#222db967623277056260b992626354a04ce9bf63" + integrity sha512-TuAasHQNamyyJ2hb97IuBEif4qBHGjPHBS64sZwytpLEqtBQ1gPJTnOaQ6qmpET16cK14kkjbazl6+p0RRv0yw== + +require_optional@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/require_optional/-/require_optional-1.0.1.tgz#4cf35a4247f64ca3df8c2ef208cc494b1ca8fc2e" + integrity sha512-qhM/y57enGWHAe3v/NcwML6a3/vfESLe/sGM2dII+gEO0BpKRUkWZow/tyloNqJyN6kXSl3RyyM8Ll5D/sJP8g== + dependencies: + resolve-from "^2.0.0" + semver "^5.1.0" + +resolve-from@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-2.0.0.tgz#9480ab20e94ffa1d9e80a804c7ea147611966b57" + integrity sha1-lICrIOlP+h2egKgEx+oUdhGWa1c= + +safe-buffer@5.1.2, safe-buffer@~5.1.0, safe-buffer@~5.1.1: + version "5.1.2" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d" + integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g== + +safe-buffer@5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.0.tgz#b74daec49b1148f88c64b68d49b1e815c1f2f519" + integrity sha512-fZEwUGbVl7kouZs1jCdMLdt95hdIv0ZeHg6L7qPeciMZhZ+/gdesW4wgTARkrFWEpspjEATAzUGPG8N2jJiwbg== + +safe-buffer@5.2.1, safe-buffer@^5.1.1, safe-buffer@^5.1.2: + version "5.2.1" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.1.tgz#1eaf9fa9bdb1fdd4ec75f58f9cdb4e6b7827eec6" + integrity sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ== + +"safer-buffer@>= 2.1.2 < 3", safer-buffer@^2.1.0: + version "2.1.2" + resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a" + integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg== + +saslprep@^1.0.0: + version "1.0.3" + resolved "https://registry.yarnpkg.com/saslprep/-/saslprep-1.0.3.tgz#4c02f946b56cf54297e347ba1093e7acac4cf226" + integrity sha512-/MY/PEMbk2SuY5sScONwhUDsV2p77Znkb/q3nSVstq/yQzYJOH/Azh29p9oJLsl3LnQwSvZDKagDGBsBwSooag== + dependencies: + sparse-bitfield "^3.0.3" + +semver@^5.1.0: + version "5.7.1" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.1.tgz#a954f931aeba508d307bbf069eff0c01c96116f7" + integrity sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ== + +send@0.17.1: + version "0.17.1" + resolved "https://registry.yarnpkg.com/send/-/send-0.17.1.tgz#c1d8b059f7900f7466dd4938bdc44e11ddb376c8" + integrity sha512-BsVKsiGcQMFwT8UxypobUKyv7irCNRHk1T0G680vk88yf6LBByGcZJOTJCrTP2xVN6yI+XjPJcNuE3V4fT9sAg== + dependencies: + debug "2.6.9" + depd "~1.1.2" + destroy "~1.0.4" + encodeurl "~1.0.2" + escape-html "~1.0.3" + etag "~1.8.1" + fresh "0.5.2" + http-errors "~1.7.2" + mime "1.6.0" + ms "2.1.1" + on-finished "~2.3.0" + range-parser "~1.2.1" + statuses "~1.5.0" + +serve-static@1.14.1: + version "1.14.1" + resolved "https://registry.yarnpkg.com/serve-static/-/serve-static-1.14.1.tgz#666e636dc4f010f7ef29970a88a674320898b2f9" + integrity sha512-JMrvUwE54emCYWlTI+hGrGv5I8dEwmco/00EvkzIIsR7MqrHonbD9pO2MOfFnpFntl7ecpZs+3mW+XbQZu9QCg== + dependencies: + encodeurl "~1.0.2" + escape-html "~1.0.3" + parseurl "~1.3.3" + send "0.17.1" + +setprototypeof@1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.1.1.tgz#7e95acb24aa92f5885e0abef5ba131330d4ae683" + integrity sha512-JvdAWfbXeIGaZ9cILp38HntZSFSo3mWg6xGcJJsd+d4aRMOqauag1C63dJfDw7OaMYwEbHMOxEZ1lqVRYP2OAw== + +sift@7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/sift/-/sift-7.0.1.tgz#47d62c50b159d316f1372f8b53f9c10cd21a4b08" + integrity sha512-oqD7PMJ+uO6jV9EQCl0LrRw1OwsiPsiFQR5AR30heR+4Dl7jBBbDLnNvWiak20tzZlSE1H7RB30SX/1j/YYT7g== + +sliced@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/sliced/-/sliced-1.0.1.tgz#0b3a662b5d04c3177b1926bea82b03f837a2ef41" + integrity sha1-CzpmK10Ewxd7GSa+qCsD+Dei70E= + +sparse-bitfield@^3.0.3: + version "3.0.3" + resolved "https://registry.yarnpkg.com/sparse-bitfield/-/sparse-bitfield-3.0.3.tgz#ff4ae6e68656056ba4b3e792ab3334d38273ca11" + integrity sha1-/0rm5oZWBWuks+eSqzM004JzyhE= + dependencies: + memory-pager "^1.0.2" + +"statuses@>= 1.5.0 < 2", statuses@~1.5.0: + version "1.5.0" + resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.5.0.tgz#161c7dac177659fd9811f43771fa99381478628c" + integrity sha1-Fhx9rBd2Wf2YEfQ3cfqZOBR4Yow= + +string_decoder@~1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8" + integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg== + dependencies: + safe-buffer "~5.1.0" + +toidentifier@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/toidentifier/-/toidentifier-1.0.0.tgz#7e1be3470f1e77948bc43d94a3c8f4d7752ba553" + integrity sha512-yaOH/Pk/VEhBWWTlhI+qXxDFXlejDGcQipMlyxda9nthulaxLZUNcUqFxokp0vcYnvteJln5FNQDRrxj3YcbVw== + +type-is@~1.6.17, type-is@~1.6.18: + version "1.6.18" + resolved "https://registry.yarnpkg.com/type-is/-/type-is-1.6.18.tgz#4e552cd05df09467dcbc4ef739de89f2cf37c131" + integrity sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g== + dependencies: + media-typer "0.3.0" + mime-types "~2.1.24" + +typescript@^4.2.3: + version "4.2.3" + resolved "https://registry.yarnpkg.com/typescript/-/typescript-4.2.3.tgz#39062d8019912d43726298f09493d598048c1ce3" + integrity sha512-qOcYwxaByStAWrBf4x0fibwZvMRG+r4cQoTjbPtUlrWjBHbmCAww1i448U0GJ+3cNNEtebDteo/cHOR3xJ4wEw== + +uid-safe@~2.1.5: + version "2.1.5" + resolved "https://registry.yarnpkg.com/uid-safe/-/uid-safe-2.1.5.tgz#2b3d5c7240e8fc2e58f8aa269e5ee49c0857bd3a" + integrity sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA== + dependencies: + random-bytes "~1.0.0" + +unpipe@1.0.0, unpipe@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/unpipe/-/unpipe-1.0.0.tgz#b2bf4ee8514aae6165b4817829d21b2ef49904ec" + integrity sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw= + +util-deprecate@~1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" + integrity sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8= + +utils-merge@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/utils-merge/-/utils-merge-1.0.1.tgz#9f95710f50a267947b2ccc124741c1028427e713" + integrity sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM= + +vary@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/vary/-/vary-1.1.2.tgz#2299f02c6ded30d4a5961b0b9f74524a18f634fc" + integrity sha1-IpnwLG3tMNSllhsLn3RSShj2NPw= diff --git a/node_modules/connect-mongo/node_modules/debug/LICENSE b/node_modules/connect-mongo/node_modules/debug/LICENSE new file mode 100644 index 0000000..1a9820e --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/connect-mongo/node_modules/debug/README.md b/node_modules/connect-mongo/node_modules/debug/README.md new file mode 100644 index 0000000..9ebdfbf --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/README.md @@ -0,0 +1,481 @@ +# debug +[](#backers) +[](#sponsors) + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png"> +<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png"> +<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png"> + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + +<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png"> + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + +<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png"> + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png"> + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_. + +<img width="647" src="https://user-images.githubusercontent.com/7143133/152083257-29034707-c42c-4959-8add-3cee850e6fcf.png"> + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + +## Usage in child processes + +Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. +For example: + +```javascript +worker = fork(WORKER_WRAP_PATH, [workerPath], { + stdio: [ + /* stdin: */ 0, + /* stdout: */ 'pipe', + /* stderr: */ 'pipe', + 'ipc', + ], + env: Object.assign({}, process.env, { + DEBUG_COLORS: 1 // without this settings, colors won't be shown + }), +}); + +worker.stderr.pipe(process.stderr, { end: false }); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + - Josh Junon + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/connect-mongo/node_modules/debug/package.json b/node_modules/connect-mongo/node_modules/debug/package.json new file mode 100644 index 0000000..60dfcf5 --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/package.json @@ -0,0 +1,65 @@ +{ + "name": "debug", + "version": "4.4.0", + "repository": { + "type": "git", + "url": "git://github.com/debug-js/debug.git" + }, + "description": "Lightweight debugging utility for Node.js and the browser", + "keywords": [ + "debug", + "log", + "debugger" + ], + "files": [ + "src", + "LICENSE", + "README.md" + ], + "author": "Josh Junon (https://github.com/qix-)", + "contributors": [ + "TJ Holowaychuk <tj@vision-media.ca>", + "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)", + "Andrew Rhyne <rhyneandrew@gmail.com>" + ], + "license": "MIT", + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:node": "istanbul cover _mocha -- test.js test.node.js", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls" + }, + "dependencies": { + "ms": "^2.1.3" + }, + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "sinon": "^14.0.0", + "xo": "^0.23.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "main": "./src/index.js", + "browser": "./src/browser.js", + "engines": { + "node": ">=6.0" + }, + "xo": { + "rules": { + "import/extensions": "off" + } + } +} diff --git a/node_modules/connect-mongo/node_modules/debug/src/browser.js b/node_modules/connect-mongo/node_modules/debug/src/browser.js new file mode 100644 index 0000000..df8e179 --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/src/browser.js @@ -0,0 +1,272 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + let m; + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + // eslint-disable-next-line no-return-assign + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && (m = navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/)) && parseInt(m[1], 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/node_modules/connect-mongo/node_modules/debug/src/common.js b/node_modules/connect-mongo/node_modules/debug/src/common.js new file mode 100644 index 0000000..528c7ec --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/src/common.js @@ -0,0 +1,292 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + let namespacesCache; + let enabledCache; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => { + if (enableOverride !== null) { + return enableOverride; + } + if (namespacesCache !== createDebug.namespaces) { + namespacesCache = createDebug.namespaces; + enabledCache = createDebug.enabled(namespace); + } + + return enabledCache; + }, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.namespaces = namespaces; + + createDebug.names = []; + createDebug.skips = []; + + const split = (typeof namespaces === 'string' ? namespaces : '') + .trim() + .replace(' ', ',') + .split(',') + .filter(Boolean); + + for (const ns of split) { + if (ns[0] === '-') { + createDebug.skips.push(ns.slice(1)); + } else { + createDebug.names.push(ns); + } + } + } + + /** + * Checks if the given string matches a namespace template, honoring + * asterisks as wildcards. + * + * @param {String} search + * @param {String} template + * @return {Boolean} + */ + function matchesTemplate(search, template) { + let searchIndex = 0; + let templateIndex = 0; + let starIndex = -1; + let matchIndex = 0; + + while (searchIndex < search.length) { + if (templateIndex < template.length && (template[templateIndex] === search[searchIndex] || template[templateIndex] === '*')) { + // Match character or proceed with wildcard + if (template[templateIndex] === '*') { + starIndex = templateIndex; + matchIndex = searchIndex; + templateIndex++; // Skip the '*' + } else { + searchIndex++; + templateIndex++; + } + } else if (starIndex !== -1) { // eslint-disable-line no-negated-condition + // Backtrack to the last '*' and try to match more characters + templateIndex = starIndex + 1; + matchIndex++; + searchIndex = matchIndex; + } else { + return false; // No match + } + } + + // Handle trailing '*' in template + while (templateIndex < template.length && template[templateIndex] === '*') { + templateIndex++; + } + + return templateIndex === template.length; + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names, + ...createDebug.skips.map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + for (const skip of createDebug.skips) { + if (matchesTemplate(name, skip)) { + return false; + } + } + + for (const ns of createDebug.names) { + if (matchesTemplate(name, ns)) { + return true; + } + } + + return false; + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/node_modules/connect-mongo/node_modules/debug/src/index.js b/node_modules/connect-mongo/node_modules/debug/src/index.js new file mode 100644 index 0000000..bf4c57f --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/connect-mongo/node_modules/debug/src/node.js b/node_modules/connect-mongo/node_modules/debug/src/node.js new file mode 100644 index 0000000..715560a --- /dev/null +++ b/node_modules/connect-mongo/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.formatWithOptions()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.formatWithOptions(exports.inspectOpts, ...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/node_modules/connect-mongo/node_modules/ms/index.js b/node_modules/connect-mongo/node_modules/ms/index.js new file mode 100644 index 0000000..ea734fb --- /dev/null +++ b/node_modules/connect-mongo/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function (val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/node_modules/connect-mongo/node_modules/ms/license.md b/node_modules/connect-mongo/node_modules/ms/license.md new file mode 100644 index 0000000..fa5d39b --- /dev/null +++ b/node_modules/connect-mongo/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2020 Vercel, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/connect-mongo/node_modules/ms/package.json b/node_modules/connect-mongo/node_modules/ms/package.json new file mode 100644 index 0000000..4997189 --- /dev/null +++ b/node_modules/connect-mongo/node_modules/ms/package.json @@ -0,0 +1,38 @@ +{ + "name": "ms", + "version": "2.1.3", + "description": "Tiny millisecond conversion utility", + "repository": "vercel/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "4.18.2", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1", + "prettier": "2.0.5" + } +} diff --git a/node_modules/connect-mongo/node_modules/ms/readme.md b/node_modules/connect-mongo/node_modules/ms/readme.md new file mode 100644 index 0000000..0fc1abb --- /dev/null +++ b/node_modules/connect-mongo/node_modules/ms/readme.md @@ -0,0 +1,59 @@ +# ms + + + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/connect-mongo/package.json b/node_modules/connect-mongo/package.json new file mode 100644 index 0000000..0fad2c5 --- /dev/null +++ b/node_modules/connect-mongo/package.json @@ -0,0 +1,159 @@ +{ + "name": "connect-mongo", + "version": "5.1.0", + "description": "MongoDB session store for Express and Connect", + "main": "build/main/index.js", + "typings": "build/main/index.d.ts", + "keywords": [ + "connect", + "mongo", + "mongodb", + "session", + "express" + ], + "contributors": [ + "Casey Banner <kcbanner@gmail.com>", + "Jerome Desboeufs <jerome.desboeufs@gmail.com>", + "MC Or <mingchuno@gmail.com>" + ], + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/jdesboeufs/connect-mongo.git" + }, + "bugs": { + "url": "https://github.com/jdesboeufs/connect-mongo/issues" + }, + "scripts": { + "prebuild": "rm -rf build", + "build": "run-p build:*", + "build:main": "tsc -p tsconfig.json", + "fix": "run-s fix:*", + "fix:prettier": "prettier \"src/**/*.ts\" --write", + "fix:lint": "eslint --cache src --ext .ts --fix", + "test": "run-s build test:*", + "test:lint": "eslint --cache src --ext .ts", + "test:prettier": "prettier \"src/**/*.ts\" --list-different", + "test:unit": "nyc ava", + "check-cli": "run-s test diff-integration-tests check-integration-tests", + "check-integration-tests": "run-s check-integration-test:*", + "diff-integration-tests": "mkdir -p diff && rm -rf diff/test && cp -r test diff/test && rm -rf diff/test/test-*/.git && cd diff && git init --quiet && git add -A && git commit --quiet --no-verify --allow-empty -m 'WIP' && echo '\\n\\nCommitted most recent integration test output in the \"diff\" directory. Review the changes with \"cd diff && git diff HEAD\" or your preferred git diff viewer.'", + "watch:build": "tsc -p tsconfig.json -w", + "watch:test": "nyc --silent ava --watch", + "cov": "run-s build test:unit cov:html cov:lcov && open-cli coverage/index.html", + "cov:html": "nyc report --reporter=html", + "cov:lcov": "nyc report --reporter=lcov", + "cov:send": "run-s cov:lcov && codecov", + "cov:check": "nyc report && nyc check-coverage", + "doc": "run-s doc:html && open-cli build/docs/index.html", + "doc:html": "typedoc src/ --exclude **/*.spec.ts --target ES6 --mode file --out build/docs", + "doc:json": "typedoc src/ --exclude **/*.spec.ts --target ES6 --mode file --json build/docs/typedoc.json", + "doc:publish": "gh-pages -m \"[ci skip] Updates\" -d build/docs", + "version": "standard-version", + "reset-hard": "git clean -dfx && git reset --hard && yarn", + "prepare-release": "run-s reset-hard test cov:check doc:html version doc:publish" + }, + "engines": { + "node": ">=12.9.0" + }, + "peerDependencies": { + "express-session": "^1.17.1", + "mongodb": ">= 5.1.0 < 7" + }, + "dependencies": { + "debug": "^4.3.1", + "kruptein": "^3.0.0" + }, + "devDependencies": { + "@ava/typescript": "^1.1.1", + "@commitlint/cli": "^11.0.0", + "@commitlint/config-conventional": "^11.0.0", + "@istanbuljs/nyc-config-typescript": "^1.0.1", + "@types/debug": "^4.1.7", + "@types/express": "^4.17.13", + "@types/express-session": "^1.17.4", + "@types/node": "^14.14.20", + "@types/supertest": "^2.0.10", + "@typescript-eslint/eslint-plugin": "^4.12.0", + "@typescript-eslint/parser": "^4.12.0", + "ava": "^3.12.1", + "codecov": "^3.5.0", + "cspell": "^4.1.0", + "cz-conventional-changelog": "^3.3.0", + "eslint": "^7.17.0", + "eslint-config-prettier": "^7.1.0", + "eslint-config-prettier-standard": "^3.0.1", + "eslint-config-standard": "^16.0.2", + "eslint-plugin-eslint-comments": "^3.2.0", + "eslint-plugin-import": "^2.22.1", + "eslint-plugin-node": "^11.1.0", + "eslint-plugin-prettier": "^3.3.1", + "eslint-plugin-promise": "^4.2.1", + "eslint-plugin-standard": "^5.0.0", + "express": "^4.17.1", + "express-session": "^1.17.1", + "gh-pages": "^3.1.0", + "husky": "4", + "lint-staged": "^10.5.4", + "mongodb": "^5.1.0", + "npm-run-all": "^4.1.5", + "nyc": "^15.1.0", + "open-cli": "^6.0.1", + "prettier": "^2.2.1", + "standard-version": "^9.0.0", + "supertest": "^6.1.3", + "ts-node": "^9.0.0", + "typedoc": "^0.19.0", + "typescript": "^4.0.2" + }, + "files": [ + "build/main", + "build/module", + "!**/*.spec.*", + "!**/*.json", + "!build/*/test/*", + "CHANGELOG.md", + "LICENSE", + "README.md" + ], + "ava": { + "failFast": true, + "timeout": "60s", + "typescript": { + "rewritePaths": { + "src/": "build/main/" + } + }, + "files": [ + "!build/module/**", + "!src/test/testHelper.ts" + ] + }, + "config": { + "commitizen": { + "path": "cz-conventional-changelog" + } + }, + "prettier": { + "singleQuote": true, + "semi": false, + "trailingComma": "es5" + }, + "nyc": { + "extends": "@istanbuljs/nyc-config-typescript", + "exclude": [ + "**/*.spec.js" + ] + }, + "husky": { + "hooks": { + "pre-commit": "lint-staged", + "commit-msg": "commitlint -E HUSKY_GIT_PARAMS" + } + }, + "lint-staged": { + "*.{js,ts}": [ + "eslint --fix" + ] + } +} diff --git a/node_modules/connect-mongo/src/index.ts b/node_modules/connect-mongo/src/index.ts new file mode 100644 index 0000000..d6f60db --- /dev/null +++ b/node_modules/connect-mongo/src/index.ts @@ -0,0 +1,2 @@ +import MongoStore from './lib/MongoStore' +export = MongoStore diff --git a/node_modules/connect-mongo/src/lib/MongoStore.spec.ts b/node_modules/connect-mongo/src/lib/MongoStore.spec.ts new file mode 100644 index 0000000..a8d1393 --- /dev/null +++ b/node_modules/connect-mongo/src/lib/MongoStore.spec.ts @@ -0,0 +1,330 @@ +import test from 'ava' +import { SessionData } from 'express-session' +import { MongoClient } from 'mongodb' + +import MongoStore from './MongoStore' +import { + createStoreHelper, + makeData, + makeDataNoCookie, +} from '../test/testHelper' + +let { store, storePromise } = createStoreHelper() + +test.before(async () => { + await storePromise.clear().catch((err) => { + if (err.message.match(/ns not found/)) { + return null + } else { + throw err + } + }) +}) + +test.afterEach.always(async () => { + await storePromise.close() +}) + +test.serial('create store w/o provide required options', (t) => { + t.throws(() => MongoStore.create({}), { + message: /Cannot init client/, + }) +}) + +test.serial('create store with clientPromise', async (t) => { + const clientP = MongoClient.connect('mongodb://root:example@127.0.0.1:27017') + const store = MongoStore.create({ clientPromise: clientP }) + t.not(store, null) + t.not(store, undefined) + await store.collectionP + store.close() +}) + +test.serial('create store with client', async (t) => { + const client = await MongoClient.connect( + 'mongodb://root:example@127.0.0.1:27017' + ) + const store = MongoStore.create({ client: client }) + t.not(store, null) + t.not(store, undefined) + await store.collectionP + store.close() +}) + +test.serial('length should be 0', async (t) => { + ;({ store, storePromise } = createStoreHelper()) + const length = await storePromise.length() + t.is(length, 0) +}) + +test.serial('get non-exist session should throw error', async (t) => { + ;({ store, storePromise } = createStoreHelper()) + const res = await storePromise.get('fake-sid') + t.is(res, null) +}) + +test.serial('get all session should work for no session', async (t) => { + ;({ store, storePromise } = createStoreHelper()) + const allSessions = await storePromise.all() + t.deepEqual(allSessions, []) +}) + +test.serial('basic operation flow', async (t) => { + ;({ store, storePromise } = createStoreHelper()) + let orgSession = makeData() + const sid = 'test-basic-flow' + const res = await storePromise.set(sid, orgSession) + t.is(res, undefined) + const session = await storePromise.get(sid) + t.is(typeof session, 'object') + orgSession = JSON.parse(JSON.stringify(orgSession)) + t.deepEqual(session, orgSession) + const allSessions = await storePromise.all() + t.deepEqual(allSessions, [orgSession]) + t.is(await storePromise.length(), 1) + const err = await storePromise.destroy(sid) + t.is(err, undefined) + t.is(await storePromise.length(), 0) +}) + +test.serial.cb('set and listen to event', (t) => { + ;({ store, storePromise } = createStoreHelper()) + let orgSession = makeData() + const sid = 'test-set-event' + store.set(sid, orgSession) + orgSession = JSON.parse(JSON.stringify(orgSession)) + store.on('set', (sessionId) => { + t.is(sessionId, sid) + store.get(sid, (err, session) => { + t.is(err, null) + t.is(typeof session, 'object') + t.deepEqual(session, orgSession) + t.end() + }) + }) +}) + +test.serial.cb('set and listen to create event', (t) => { + ;({ store, storePromise } = createStoreHelper()) + const orgSession = makeData() + const sid = 'test-create-event' + store.set(sid, orgSession) + store.on('create', (sessionId) => { + t.is(sessionId, sid) + t.end() + }) +}) + +test.serial.cb('set and listen to update event', (t) => { + ;({ store, storePromise } = createStoreHelper()) + const orgSession = makeData() + const sid = 'test-update-event' + store.set(sid, orgSession) + store.set(sid, { ...orgSession, foo: 'new-bar' } as SessionData) + store.on('update', (sessionId) => { + t.is(sessionId, sid) + t.end() + }) +}) + +test.serial('set with no stringify', async (t) => { + ;({ store, storePromise } = createStoreHelper({ stringify: false })) + const orgSession = makeData() + const cookie = orgSession.cookie + const sid = 'test-no-stringify' + const res = await storePromise.set(sid, orgSession) + t.is(res, undefined) + const session = await storePromise.get(sid) + t.is(typeof session, 'object') + t.deepEqual(orgSession.cookie, cookie) + // @ts-ignore + t.deepEqual(cookie.expires.toJSON(), session.cookie.expires.toJSON()) + // @ts-ignore + t.deepEqual(cookie.secure, session.cookie.secure) + const err = await storePromise.clear() + t.is(err, undefined) + t.is(await storePromise.length(), 0) +}) + +test.serial.cb('test destory event', (t) => { + ;({ store, storePromise } = createStoreHelper()) + const orgSession = makeData() + const sid = 'test-destory-event' + store.on('destroy', (sessionId) => { + t.is(sessionId, sid) + t.end() + }) + storePromise.set(sid, orgSession).then(() => { + store.destroy(sid) + }) +}) + +test.serial('test set default TTL', async (t) => { + const defaultTTL = 10 + ;({ store, storePromise } = createStoreHelper({ + ttl: defaultTTL, + })) + const orgSession = makeDataNoCookie() + const sid = 'test-set-default-ttl' + const timeBeforeSet = new Date().valueOf() + // @ts-ignore + await storePromise.set(sid, orgSession) + const collection = await store.collectionP + const session = await collection.findOne({ _id: sid }) + const timeAfterSet = new Date().valueOf() + const expires = session?.expires?.valueOf() + t.truthy(expires) + if (expires) { + t.truthy(timeBeforeSet + defaultTTL * 1000 <= expires) + t.truthy(expires <= timeAfterSet + defaultTTL * 1000) + } +}) + +test.serial('test default TTL', async (t) => { + const defaultExpirationTime = 1000 * 60 * 60 * 24 * 14 + ;({ store, storePromise } = createStoreHelper()) + const orgSession = makeDataNoCookie() + const sid = 'test-no-set-default-ttl' + const timeBeforeSet = new Date().valueOf() + // @ts-ignore + await storePromise.set(sid, orgSession) + const collection = await store.collectionP + const session = await collection.findOne({ _id: sid }) + const timeAfterSet = new Date().valueOf() + const expires = session?.expires?.valueOf() + t.truthy(expires) + if (expires) { + t.truthy(timeBeforeSet + defaultExpirationTime <= expires) + t.truthy(expires <= timeAfterSet + defaultExpirationTime) + } +}) + +test.serial('test custom serializer', async (t) => { + ;({ store, storePromise } = createStoreHelper({ + serialize: (obj) => { + obj.ice = 'test-ice-serializer' + return JSON.stringify(obj) + }, + })) + const orgSession = makeData() + const sid = 'test-custom-serializer' + await storePromise.set(sid, orgSession) + const session = await storePromise.get(sid) + t.is(typeof session, 'string') + t.not(session, undefined) + // @ts-ignore + orgSession.ice = 'test-ice-serializer' + // @ts-ignore + t.is(session, JSON.stringify(orgSession)) +}) + +test.serial('test custom deserializer', async (t) => { + ;({ store, storePromise } = createStoreHelper({ + unserialize: (obj) => { + obj.ice = 'test-ice-deserializer' + return obj + }, + })) + const orgSession = makeData() + const sid = 'test-custom-deserializer' + await storePromise.set(sid, orgSession) + const session = await storePromise.get(sid) + t.is(typeof session, 'object') + // @ts-ignore + orgSession.cookie = orgSession.cookie.toJSON() + // @ts-ignore + orgSession.ice = 'test-ice-deserializer' + t.not(session, undefined) + t.deepEqual(session, orgSession) +}) + +test.serial('touch ops', async (t) => { + ;({ store, storePromise } = createStoreHelper()) + const orgSession = makeDataNoCookie() + const sid = 'test-touch' + // @ts-ignore + await storePromise.set(sid, orgSession) + const collection = await store.collectionP + const session = await collection.findOne({ _id: sid }) + await new Promise((resolve) => setTimeout(resolve, 500)) + t.not(session, undefined) + await storePromise.touch(sid, session?.session) + const session2 = await collection.findOne({ _id: sid }) + t.not(session2, undefined) + // Check if both expiry date are different + t.truthy(session2?.expires?.getTime()) + t.truthy(session?.expires?.getTime()) + if (session?.expires?.getTime() && session2?.expires?.getTime()) { + t.truthy(session2?.expires.getTime() > session?.expires.getTime()) + } +}) + +test.serial('touch ops with touchAfter', async (t) => { + ;({ store, storePromise } = createStoreHelper({ touchAfter: 1 })) + const orgSession = makeDataNoCookie() + const sid = 'test-touch-with-touchAfter' + // @ts-ignore + await storePromise.set(sid, orgSession) + const collection = await store.collectionP + const session = await collection.findOne({ _id: sid }) + const lastModifiedBeforeTouch = session?.lastModified?.getTime() + t.not(session, undefined) + await storePromise.touch(sid, session as unknown as SessionData) + const session2 = await collection.findOne({ _id: sid }) + t.not(session2, undefined) + const lastModifiedAfterTouch = session2?.lastModified?.getTime() + // Check if both expiry date are different + t.is(lastModifiedBeforeTouch, lastModifiedAfterTouch) +}) + +test.serial('touch ops with touchAfter with touch', async (t) => { + ;({ store, storePromise } = createStoreHelper({ touchAfter: 1 })) + const orgSession = makeDataNoCookie() + const sid = 'test-touch-with-touchAfter-should-touch' + // @ts-ignore + await storePromise.set(sid, orgSession) + const collection = await store.collectionP + const session = await collection.findOne({ _id: sid }) + const lastModifiedBeforeTouch = session?.lastModified?.getTime() + await new Promise((resolve) => setTimeout(resolve, 1200)) + t.not(session, undefined) + await storePromise.touch(sid, session as unknown as SessionData) + const session2 = await collection.findOne({ _id: sid }) + t.not(session2, undefined) + const lastModifiedAfterTouch = session2?.lastModified?.getTime() + // Check if both expiry date are different + t.truthy(lastModifiedAfterTouch) + t.truthy(lastModifiedBeforeTouch) + if (lastModifiedAfterTouch && lastModifiedBeforeTouch) { + t.truthy(lastModifiedAfterTouch > lastModifiedBeforeTouch) + } +}) + +test.serial('basic operation flow with crypto', async (t) => { + ;({ store, storePromise } = createStoreHelper({ + crypto: { secret: 'secret' }, + collectionName: 'crypto-test', + autoRemove: 'disabled', + })) + let orgSession = makeData() + const sid = 'test-basic-flow-with-crypto' + const res = await storePromise.set(sid, orgSession) + t.is(res, undefined) + const session = await storePromise.get(sid) + orgSession = JSON.parse(JSON.stringify(orgSession)) + // @ts-ignore + t.deepEqual(session, orgSession) + const sessions = await storePromise.all() + t.not(sessions, undefined) + t.not(sessions, null) + t.is(sessions?.length, 1) +}) + +test.serial('with touch after and get non-exist session', async (t) => { + ;({ store, storePromise } = createStoreHelper({ + touchAfter: 10, + })) + const sid = 'fake-sid-for-test-touch-after' + const res = await storePromise.get(sid) + t.is(res, null) +}) diff --git a/node_modules/connect-mongo/src/lib/MongoStore.ts b/node_modules/connect-mongo/src/lib/MongoStore.ts new file mode 100644 index 0000000..c40e1af --- /dev/null +++ b/node_modules/connect-mongo/src/lib/MongoStore.ts @@ -0,0 +1,545 @@ +import { assert } from 'console' +import util from 'util' +import * as session from 'express-session' +import { + Collection, + MongoClient, + MongoClientOptions, + WriteConcernSettings, +} from 'mongodb' +import Debug from 'debug' +import Kruptein from 'kruptein' + +const debug = Debug('connect-mongo') + +export type CryptoOptions = { + secret: false | string + algorithm?: string + hashing?: string + encodeas?: string + key_size?: number + iv_size?: number + at_size?: number +} + +export type ConnectMongoOptions = { + mongoUrl?: string + clientPromise?: Promise<MongoClient> + client?: MongoClient + collectionName?: string + mongoOptions?: MongoClientOptions + dbName?: string + ttl?: number + touchAfter?: number + stringify?: boolean + createAutoRemoveIdx?: boolean + autoRemove?: 'native' | 'interval' | 'disabled' + autoRemoveInterval?: number + // FIXME: remove those any + serialize?: (a: any) => any + unserialize?: (a: any) => any + writeOperationOptions?: WriteConcernSettings + transformId?: (a: any) => any + crypto?: CryptoOptions +} + +type ConcretCryptoOptions = Required<CryptoOptions> + +type ConcretConnectMongoOptions = { + mongoUrl?: string + clientPromise?: Promise<MongoClient> + client?: MongoClient + collectionName: string + mongoOptions: MongoClientOptions + dbName?: string + ttl: number + createAutoRemoveIdx?: boolean + autoRemove: 'native' | 'interval' | 'disabled' + autoRemoveInterval: number + touchAfter: number + stringify: boolean + // FIXME: remove those any + serialize?: (a: any) => any + unserialize?: (a: any) => any + writeOperationOptions?: WriteConcernSettings + transformId?: (a: any) => any + // FIXME: remove above any + crypto: ConcretCryptoOptions +} + +type InternalSessionType = { + _id: string + session: any + expires?: Date + lastModified?: Date +} + +// eslint-disable-next-line @typescript-eslint/no-empty-function +const noop = () => {} +const unit: <T>(a: T) => T = (a) => a + +function defaultSerializeFunction( + session: session.SessionData +): session.SessionData { + // Copy each property of the session to a new object + const obj = {} + let prop + for (prop in session) { + if (prop === 'cookie') { + // Convert the cookie instance to an object, if possible + // This gets rid of the duplicate object under session.cookie.data property + // @ts-ignore FIXME: + obj.cookie = session.cookie.toJSON + ? // @ts-ignore FIXME: + session.cookie.toJSON() + : session.cookie + } else { + // @ts-ignore FIXME: + obj[prop] = session[prop] + } + } + + return obj as session.SessionData +} + +function computeTransformFunctions(options: ConcretConnectMongoOptions) { + if (options.serialize || options.unserialize) { + return { + serialize: options.serialize || defaultSerializeFunction, + unserialize: options.unserialize || unit, + } + } + + if (options.stringify === false) { + return { + serialize: defaultSerializeFunction, + unserialize: unit, + } + } + // Default case + return { + serialize: JSON.stringify, + unserialize: JSON.parse, + } +} + +export default class MongoStore extends session.Store { + private clientP: Promise<MongoClient> + private crypto: Kruptein | null = null + private timer?: NodeJS.Timeout + collectionP: Promise<Collection<InternalSessionType>> + private options: ConcretConnectMongoOptions + // FIXME: remvoe any + private transformFunctions: { + serialize: (a: any) => any + unserialize: (a: any) => any + } + + constructor({ + collectionName = 'sessions', + ttl = 1209600, + mongoOptions = {}, + autoRemove = 'native', + autoRemoveInterval = 10, + touchAfter = 0, + stringify = true, + crypto, + ...required + }: ConnectMongoOptions) { + super() + debug('create MongoStore instance') + const options: ConcretConnectMongoOptions = { + collectionName, + ttl, + mongoOptions, + autoRemove, + autoRemoveInterval, + touchAfter, + stringify, + crypto: { + ...{ + secret: false, + algorithm: 'aes-256-gcm', + hashing: 'sha512', + encodeas: 'base64', + key_size: 32, + iv_size: 16, + at_size: 16, + }, + ...crypto, + }, + ...required, + } + // Check params + assert( + options.mongoUrl || options.clientPromise || options.client, + 'You must provide either mongoUrl|clientPromise|client in options' + ) + assert( + options.createAutoRemoveIdx === null || + options.createAutoRemoveIdx === undefined, + 'options.createAutoRemoveIdx has been reverted to autoRemove and autoRemoveInterval' + ) + assert( + !options.autoRemoveInterval || options.autoRemoveInterval <= 71582, + /* (Math.pow(2, 32) - 1) / (1000 * 60) */ 'autoRemoveInterval is too large. options.autoRemoveInterval is in minutes but not seconds nor mills' + ) + this.transformFunctions = computeTransformFunctions(options) + let _clientP: Promise<MongoClient> + if (options.mongoUrl) { + _clientP = MongoClient.connect(options.mongoUrl, options.mongoOptions) + } else if (options.clientPromise) { + _clientP = options.clientPromise + } else if (options.client) { + _clientP = Promise.resolve(options.client) + } else { + throw new Error('Cannot init client. Please provide correct options') + } + assert(!!_clientP, 'Client is null|undefined') + this.clientP = _clientP + this.options = options + this.collectionP = _clientP.then(async (con) => { + const collection = con + .db(options.dbName) + .collection<InternalSessionType>(options.collectionName) + await this.setAutoRemove(collection) + return collection + }) + if (options.crypto.secret) { + this.crypto = require('kruptein')(options.crypto) + } + } + + static create(options: ConnectMongoOptions): MongoStore { + return new MongoStore(options) + } + + private setAutoRemove( + collection: Collection<InternalSessionType> + ): Promise<unknown> { + const removeQuery = () => ({ + expires: { + $lt: new Date(), + }, + }) + switch (this.options.autoRemove) { + case 'native': + debug('Creating MongoDB TTL index') + return collection.createIndex( + { expires: 1 }, + { + background: true, + expireAfterSeconds: 0, + } + ) + case 'interval': + debug('create Timer to remove expired sessions') + this.timer = setInterval( + () => + collection.deleteMany(removeQuery(), { + writeConcern: { + w: 0, + j: false, + }, + }), + this.options.autoRemoveInterval * 1000 * 60 + ) + this.timer.unref() + return Promise.resolve() + case 'disabled': + default: + return Promise.resolve() + } + } + + private computeStorageId(sessionId: string) { + if ( + this.options.transformId && + typeof this.options.transformId === 'function' + ) { + return this.options.transformId(sessionId) + } + return sessionId + } + + /** + * promisify and bind the `this.crypto.get` function. + * Please check !!this.crypto === true before using this getter! + */ + private get cryptoGet() { + if (!this.crypto) { + throw new Error('Check this.crypto before calling this.cryptoGet!') + } + return util.promisify(this.crypto.get).bind(this.crypto) + } + + /** + * Decrypt given session data + * @param session session data to be decrypt. Mutate the input session. + */ + private async decryptSession( + session: session.SessionData | undefined | null + ) { + if (this.crypto && session) { + const plaintext = await this.cryptoGet( + this.options.crypto.secret as string, + session.session + ).catch((err) => { + throw new Error(err) + }) + // @ts-ignore + session.session = JSON.parse(plaintext) + } + } + + /** + * Get a session from the store given a session ID (sid) + * @param sid session ID + */ + get( + sid: string, + callback: (err: any, session?: session.SessionData | null) => void + ): void { + ;(async () => { + try { + debug(`MongoStore#get=${sid}`) + const collection = await this.collectionP + const session = await collection.findOne({ + _id: this.computeStorageId(sid), + $or: [ + { expires: { $exists: false } }, + { expires: { $gt: new Date() } }, + ], + }) + if (this.crypto && session) { + await this.decryptSession( + session as unknown as session.SessionData + ).catch((err) => callback(err)) + } + const s = + session && this.transformFunctions.unserialize(session.session) + if (this.options.touchAfter > 0 && session?.lastModified) { + s.lastModified = session.lastModified + } + this.emit('get', sid) + callback(null, s === undefined ? null : s) + } catch (error) { + callback(error) + } + })() + } + + /** + * Upsert a session into the store given a session ID (sid) and session (session) object. + * @param sid session ID + * @param session session object + */ + set( + sid: string, + session: session.SessionData, + callback: (err: any) => void = noop + ): void { + ;(async () => { + try { + debug(`MongoStore#set=${sid}`) + // Removing the lastModified prop from the session object before update + // @ts-ignore + if (this.options.touchAfter > 0 && session?.lastModified) { + // @ts-ignore + delete session.lastModified + } + const s: InternalSessionType = { + _id: this.computeStorageId(sid), + session: this.transformFunctions.serialize(session), + } + // Expire handling + if (session?.cookie?.expires) { + s.expires = new Date(session.cookie.expires) + } else { + // If there's no expiration date specified, it is + // browser-session cookie or there is no cookie at all, + // as per the connect docs. + // + // So we set the expiration to two-weeks from now + // - as is common practice in the industry (e.g Django) - + // or the default specified in the options. + s.expires = new Date(Date.now() + this.options.ttl * 1000) + } + // Last modify handling + if (this.options.touchAfter > 0) { + s.lastModified = new Date() + } + if (this.crypto) { + const cryptoSet = util.promisify(this.crypto.set).bind(this.crypto) + const data = await cryptoSet( + this.options.crypto.secret as string, + s.session + ).catch((err) => { + throw new Error(err) + }) + s.session = data as unknown as session.SessionData + } + const collection = await this.collectionP + const rawResp = await collection.updateOne( + { _id: s._id }, + { $set: s }, + { + upsert: true, + writeConcern: this.options.writeOperationOptions, + } + ) + if (rawResp.upsertedCount > 0) { + this.emit('create', sid) + } else { + this.emit('update', sid) + } + this.emit('set', sid) + } catch (error) { + return callback(error) + } + return callback(null) + })() + } + + touch( + sid: string, + session: session.SessionData & { lastModified?: Date }, + callback: (err: any) => void = noop + ): void { + ;(async () => { + try { + debug(`MongoStore#touch=${sid}`) + const updateFields: { + lastModified?: Date + expires?: Date + session?: session.SessionData + } = {} + const touchAfter = this.options.touchAfter * 1000 + const lastModified = session.lastModified + ? session.lastModified.getTime() + : 0 + const currentDate = new Date() + + // If the given options has a touchAfter property, check if the + // current timestamp - lastModified timestamp is bigger than + // the specified, if it's not, don't touch the session + if (touchAfter > 0 && lastModified > 0) { + const timeElapsed = currentDate.getTime() - lastModified + if (timeElapsed < touchAfter) { + debug(`Skip touching session=${sid}`) + return callback(null) + } + updateFields.lastModified = currentDate + } + + if (session?.cookie?.expires) { + updateFields.expires = new Date(session.cookie.expires) + } else { + updateFields.expires = new Date(Date.now() + this.options.ttl * 1000) + } + const collection = await this.collectionP + const rawResp = await collection.updateOne( + { _id: this.computeStorageId(sid) }, + { $set: updateFields }, + { writeConcern: this.options.writeOperationOptions } + ) + if (rawResp.matchedCount === 0) { + return callback(new Error('Unable to find the session to touch')) + } else { + this.emit('touch', sid, session) + return callback(null) + } + } catch (error) { + return callback(error) + } + })() + } + + /** + * Get all sessions in the store as an array + */ + all( + callback: ( + err: any, + obj?: + | session.SessionData[] + | { [sid: string]: session.SessionData } + | null + ) => void + ): void { + ;(async () => { + try { + debug('MongoStore#all()') + const collection = await this.collectionP + const sessions = collection.find({ + $or: [ + { expires: { $exists: false } }, + { expires: { $gt: new Date() } }, + ], + }) + const results: session.SessionData[] = [] + for await (const session of sessions) { + if (this.crypto && session) { + await this.decryptSession(session as unknown as session.SessionData) + } + results.push(this.transformFunctions.unserialize(session.session)) + } + this.emit('all', results) + callback(null, results) + } catch (error) { + callback(error) + } + })() + } + + /** + * Destroy/delete a session from the store given a session ID (sid) + * @param sid session ID + */ + destroy(sid: string, callback: (err: any) => void = noop): void { + debug(`MongoStore#destroy=${sid}`) + this.collectionP + .then((colleciton) => + colleciton.deleteOne( + { _id: this.computeStorageId(sid) }, + { writeConcern: this.options.writeOperationOptions } + ) + ) + .then(() => { + this.emit('destroy', sid) + callback(null) + }) + .catch((err) => callback(err)) + } + + /** + * Get the count of all sessions in the store + */ + length(callback: (err: any, length: number) => void): void { + debug('MongoStore#length()') + this.collectionP + .then((collection) => collection.countDocuments()) + .then((c) => callback(null, c)) + // @ts-ignore + .catch((err) => callback(err)) + } + + /** + * Delete all sessions from the store. + */ + clear(callback: (err: any) => void = noop): void { + debug('MongoStore#clear()') + this.collectionP + .then((collection) => collection.drop()) + .then(() => callback(null)) + .catch((err) => callback(err)) + } + + /** + * Close database connection + */ + close(): Promise<void> { + debug('MongoStore#close()') + return this.clientP.then((c) => c.close()) + } +} diff --git a/node_modules/connect-mongo/src/test/integration.spec.ts b/node_modules/connect-mongo/src/test/integration.spec.ts new file mode 100644 index 0000000..8ae7b03 --- /dev/null +++ b/node_modules/connect-mongo/src/test/integration.spec.ts @@ -0,0 +1,105 @@ +import test from 'ava' +import request from 'supertest' +import express from 'express' +import session, { SessionOptions } from 'express-session' +import MongoStore from '../' +import { ConnectMongoOptions } from '../lib/MongoStore' + +declare module 'express-session' { + interface SessionData { + [key: string]: any + } +} + +function createSupertetAgent( + sessionOpts: SessionOptions, + mongoStoreOpts: ConnectMongoOptions +) { + const app = express() + const store = MongoStore.create(mongoStoreOpts) + app.use( + session({ + ...sessionOpts, + store: store, + }) + ) + app.get('/', function (req, res) { + if (typeof req.session.views === 'number') { + req.session.views++ + } else { + req.session.views = 0 + } + res.status(200).send({ views: req.session.views }) + }) + app.get('/ping', function (req, res) { + res.status(200).send({ views: req.session.views }) + }) + const agent = request.agent(app) + return agent +} + +function createSupertetAgentWithDefault( + sessionOpts: Omit<SessionOptions, 'secret'> = {}, + mongoStoreOpts: ConnectMongoOptions = {} +) { + return createSupertetAgent( + { secret: 'foo', ...sessionOpts }, + { + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + dbName: 'itegration-test-db', + stringify: false, + ...mongoStoreOpts, + } + ) +} + +test.serial.cb('simple case', (t) => { + const agent = createSupertetAgentWithDefault() + agent + .get('/') + .expect(200) + .then((response) => response.headers['set-cookie']) + .then((cookie) => { + agent + .get('/') + .expect(200) + .end((err, res) => { + t.is(err, null) + t.deepEqual(res.body, { views: 1 }) + return t.end() + }) + }) +}) + +test.serial.cb('simple case with touch after', (t) => { + const agent = createSupertetAgentWithDefault( + { resave: false, saveUninitialized: false, rolling: true }, + { touchAfter: 1 } + ) + agent + .get('/') + .expect(200) + .then(() => { + agent + .get('/') + .expect(200) + .end((err, res) => { + t.is(err, null) + t.deepEqual(res.body, { views: 1 }) + new Promise<void>((resolve) => { + setTimeout(() => { + resolve() + }, 1200) + }).then(() => { + agent + .get('/ping') + .expect(200) + .end((err, res) => { + t.is(err, null) + t.deepEqual(res.body, { views: 1 }) + return t.end() + }) + }) + }) + }) +}) diff --git a/node_modules/connect-mongo/src/test/testHelper.ts b/node_modules/connect-mongo/src/test/testHelper.ts new file mode 100644 index 0000000..0e0dc27 --- /dev/null +++ b/node_modules/connect-mongo/src/test/testHelper.ts @@ -0,0 +1,64 @@ +// eslint-disable-next-line eslint-comments/disable-enable-pair +/* eslint-disable @typescript-eslint/explicit-module-boundary-types */ +import util from 'util' +import ExpressSession from 'express-session' + +import MongoStore, { ConnectMongoOptions } from '../lib/MongoStore' + +// Create a connect cookie instance +export const makeCookie = () => { + const cookie = new ExpressSession.Cookie() + cookie.maxAge = 10000 // This sets cookie.expire through a setter + cookie.secure = true + cookie.domain = 'cow.com' + cookie.sameSite = false + + return cookie +} + +// Create session data +export const makeData = () => { + return { + foo: 'bar', + baz: { + cow: 'moo', + chicken: 'cluck', + }, + num: 1, + cookie: makeCookie(), + } +} + +export const makeDataNoCookie = () => { + return { + foo: 'bar', + baz: { + cow: 'moo', + fish: 'blub', + fox: 'nobody knows!', + }, + num: 2, + } +} + +export const createStoreHelper = (opt: Partial<ConnectMongoOptions> = {}) => { + const store = MongoStore.create({ + mongoUrl: 'mongodb://root:example@127.0.0.1:27017', + mongoOptions: {}, + dbName: 'testDb', + collectionName: 'test-collection', + ...opt, + }) + + const storePromise = { + length: util.promisify(store.length).bind(store), + clear: util.promisify(store.clear).bind(store), + get: util.promisify(store.get).bind(store), + set: util.promisify(store.set).bind(store), + all: util.promisify(store.all).bind(store), + touch: util.promisify(store.touch).bind(store), + destroy: util.promisify(store.destroy).bind(store), + close: store.close.bind(store), + } + return { store, storePromise } +} diff --git a/node_modules/connect-mongo/src/types/kruptein.d.ts b/node_modules/connect-mongo/src/types/kruptein.d.ts new file mode 100644 index 0000000..8c02fa4 --- /dev/null +++ b/node_modules/connect-mongo/src/types/kruptein.d.ts @@ -0,0 +1,32 @@ +/** + * If you import a dependency which does not include its own type definitions, + * TypeScript will try to find a definition for it by following the `typeRoots` + * compiler option in tsconfig.json. For this project, we've configured it to + * fall back to this folder if nothing is found in node_modules/@types. + * + * Often, you can install the DefinitelyTyped + * (https://github.com/DefinitelyTyped/DefinitelyTyped) type definition for the + * dependency in question. However, if no one has yet contributed definitions + * for the package, you may want to declare your own. (If you're using the + * `noImplicitAny` compiler options, you'll be required to declare it.) + * + * This is an example type definition which allows import from `module-name`, + * e.g.: + * ```ts + * import something from 'module-name'; + * something(); + * ``` + */ +declare module 'kruptein' { + type Callback = (msg?: string, data?: string) => void + class Kruptein { + public set( + secret: string, + plaintext: string | any, + callback: Callback + ): void + + public get(secret: string, ciphertext: string, callback: Callback): void + } + export = Kruptein +} diff --git a/node_modules/connect-mongo/tsconfig.json b/node_modules/connect-mongo/tsconfig.json new file mode 100644 index 0000000..d40a9f5 --- /dev/null +++ b/node_modules/connect-mongo/tsconfig.json @@ -0,0 +1,48 @@ +{ + "compilerOptions": { + "incremental": true, + "target": "es2018", + "outDir": "build/main", + "rootDir": "src", + "moduleResolution": "node", + "module": "commonjs", + "declaration": true, + "inlineSourceMap": true, + "esModuleInterop": true /* Enables emit interoperability between CommonJS and ES Modules via creation of namespace objects for all imports. Implies 'allowSyntheticDefaultImports'. */, + "resolveJsonModule": true /* Include modules imported with .json extension. */, + + "strict": true /* Enable all strict type-checking options. */, + + /* Strict Type-Checking Options */ + // "noImplicitAny": true /* Raise error on expressions and declarations with an implied 'any' type. */, + // "strictNullChecks": true /* Enable strict null checks. */, + "strictFunctionTypes": false /* Enable strict checking of function types. */, + // "strictPropertyInitialization": true /* Enable strict checking of property initialization in classes. */, + // "noImplicitThis": true /* Raise error on 'this' expressions with an implied 'any' type. */, + // "alwaysStrict": true /* Parse in strict mode and emit "use strict" for each source file. */, + + /* Additional Checks */ + // FIXME: turn on these error + "noUnusedLocals": false /* Report errors on unused locals. */, + "noUnusedParameters": false /* Report errors on unused parameters. */, + "noImplicitReturns": true /* Report error when not all code paths in function return a value. */, + "noFallthroughCasesInSwitch": true /* Report errors for fallthrough cases in switch statement. */, + + /* Debugging Options */ + "traceResolution": false /* Report module resolution log messages. */, + "listEmittedFiles": false /* Print names of generated files part of the compilation. */, + "listFiles": false /* Print names of files part of the compilation. */, + "pretty": true /* Stylize errors and messages using color and context. */, + + /* Experimental Options */ + // "experimentalDecorators": true /* Enables experimental support for ES7 decorators. */, + // "emitDecoratorMetadata": true /* Enables experimental support for emitting type metadata for decorators. */, + + "lib": ["es2017"], + "types": ["node"], + "typeRoots": ["node_modules/@types", "src/types"] + }, + "include": ["src/**/*.ts"], + "exclude": ["node_modules/**", "example/**"], + "compileOnSave": false +} diff --git a/node_modules/connect-mongo/yarn.lock b/node_modules/connect-mongo/yarn.lock new file mode 100644 index 0000000..d558f35 --- /dev/null +++ b/node_modules/connect-mongo/yarn.lock @@ -0,0 +1,7281 @@ +# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY. +# yarn lockfile v1 + + +"@ava/typescript@^1.1.1": + version "1.1.1" + resolved "https://registry.yarnpkg.com/@ava/typescript/-/typescript-1.1.1.tgz#3dcaba3aced8026fdb584d927d809752854dc6e6" + integrity sha512-KbLUAe2cWXK63WLK6LnOJonjwEDU/8MNXCOA1ooX/YFZgKRmeAD1kZu+2K0ks5fnOCEcckNQAooyBNGdZUmMQA== + dependencies: + escape-string-regexp "^2.0.0" + +"@babel/code-frame@7.12.11", "@babel/code-frame@^7.10.4", "@babel/code-frame@^7.12.11": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.12.11.tgz#f4ad435aa263db935b8f10f2c552d23fb716a63f" + integrity sha512-Zt1yodBx1UcyiePMSkWnU4hPqhwq7hGi2nFL1LeA3EUl+q2LQx16MISgJ0+z7dnmgvP9QtIleuETGOiOH1RcIw== + dependencies: + "@babel/highlight" "^7.10.4" + +"@babel/code-frame@^7.0.0": + version "7.18.6" + resolved "https://registry.yarnpkg.com/@babel/code-frame/-/code-frame-7.18.6.tgz#3b25d38c89600baa2dcc219edfa88a74eb2c427a" + integrity sha512-TDCmlK5eOvH+eH7cdAFlNXeVJqWIQ7gW9tY1GJIpUtFb6CmjVyq2VM3u71bOyR8CRihcCgMUYoDNyLXao3+70Q== + dependencies: + "@babel/highlight" "^7.18.6" + +"@babel/core@^7.7.5": + version "7.12.10" + resolved "https://registry.yarnpkg.com/@babel/core/-/core-7.12.10.tgz#b79a2e1b9f70ed3d84bbfb6d8c4ef825f606bccd" + integrity sha512-eTAlQKq65zHfkHZV0sIVODCPGVgoo1HdBlbSLi9CqOzuZanMv2ihzY+4paiKr1mH+XmYESMAmJ/dpZ68eN6d8w== + dependencies: + "@babel/code-frame" "^7.10.4" + "@babel/generator" "^7.12.10" + "@babel/helper-module-transforms" "^7.12.1" + "@babel/helpers" "^7.12.5" + "@babel/parser" "^7.12.10" + "@babel/template" "^7.12.7" + "@babel/traverse" "^7.12.10" + "@babel/types" "^7.12.10" + convert-source-map "^1.7.0" + debug "^4.1.0" + gensync "^1.0.0-beta.1" + json5 "^2.1.2" + lodash "^4.17.19" + semver "^5.4.1" + source-map "^0.5.0" + +"@babel/generator@^7.12.10", "@babel/generator@^7.12.11": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/generator/-/generator-7.12.11.tgz#98a7df7b8c358c9a37ab07a24056853016aba3af" + integrity sha512-Ggg6WPOJtSi8yYQvLVjG8F/TlpWDlKx0OpS4Kt+xMQPs5OaGYWy+v1A+1TvxI6sAMGZpKWWoAQ1DaeQbImlItA== + dependencies: + "@babel/types" "^7.12.11" + jsesc "^2.5.1" + source-map "^0.5.0" + +"@babel/helper-function-name@^7.12.11": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/helper-function-name/-/helper-function-name-7.12.11.tgz#1fd7738aee5dcf53c3ecff24f1da9c511ec47b42" + integrity sha512-AtQKjtYNolKNi6nNNVLQ27CP6D9oFR6bq/HPYSizlzbp7uC1M59XJe8L+0uXjbIaZaUJF99ruHqVGiKXU/7ybA== + dependencies: + "@babel/helper-get-function-arity" "^7.12.10" + "@babel/template" "^7.12.7" + "@babel/types" "^7.12.11" + +"@babel/helper-get-function-arity@^7.12.10": + version "7.12.10" + resolved "https://registry.yarnpkg.com/@babel/helper-get-function-arity/-/helper-get-function-arity-7.12.10.tgz#b158817a3165b5faa2047825dfa61970ddcc16cf" + integrity sha512-mm0n5BPjR06wh9mPQaDdXWDoll/j5UpCAPl1x8fS71GHm7HA6Ua2V4ylG1Ju8lvcTOietbPNNPaSilKj+pj+Ag== + dependencies: + "@babel/types" "^7.12.10" + +"@babel/helper-member-expression-to-functions@^7.12.7": + version "7.12.7" + resolved "https://registry.yarnpkg.com/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.12.7.tgz#aa77bd0396ec8114e5e30787efa78599d874a855" + integrity sha512-DCsuPyeWxeHgh1Dus7APn7iza42i/qXqiFPWyBDdOFtvS581JQePsc1F/nD+fHrcswhLlRc2UpYS1NwERxZhHw== + dependencies: + "@babel/types" "^7.12.7" + +"@babel/helper-module-imports@^7.12.1": + version "7.12.5" + resolved "https://registry.yarnpkg.com/@babel/helper-module-imports/-/helper-module-imports-7.12.5.tgz#1bfc0229f794988f76ed0a4d4e90860850b54dfb" + integrity sha512-SR713Ogqg6++uexFRORf/+nPXMmWIn80TALu0uaFb+iQIUoR7bOC7zBWyzBs5b3tBBJXuyD0cRu1F15GyzjOWA== + dependencies: + "@babel/types" "^7.12.5" + +"@babel/helper-module-transforms@^7.12.1": + version "7.12.1" + resolved "https://registry.yarnpkg.com/@babel/helper-module-transforms/-/helper-module-transforms-7.12.1.tgz#7954fec71f5b32c48e4b303b437c34453fd7247c" + integrity sha512-QQzehgFAZ2bbISiCpmVGfiGux8YVFXQ0abBic2Envhej22DVXV9nCFaS5hIQbkyo1AdGb+gNME2TSh3hYJVV/w== + dependencies: + "@babel/helper-module-imports" "^7.12.1" + "@babel/helper-replace-supers" "^7.12.1" + "@babel/helper-simple-access" "^7.12.1" + "@babel/helper-split-export-declaration" "^7.11.0" + "@babel/helper-validator-identifier" "^7.10.4" + "@babel/template" "^7.10.4" + "@babel/traverse" "^7.12.1" + "@babel/types" "^7.12.1" + lodash "^4.17.19" + +"@babel/helper-optimise-call-expression@^7.12.10": + version "7.12.10" + resolved "https://registry.yarnpkg.com/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.12.10.tgz#94ca4e306ee11a7dd6e9f42823e2ac6b49881e2d" + integrity sha512-4tpbU0SrSTjjt65UMWSrUOPZTsgvPgGG4S8QSTNHacKzpS51IVWGDj0yCwyeZND/i+LSN2g/O63jEXEWm49sYQ== + dependencies: + "@babel/types" "^7.12.10" + +"@babel/helper-replace-supers@^7.12.1": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/helper-replace-supers/-/helper-replace-supers-7.12.11.tgz#ea511658fc66c7908f923106dd88e08d1997d60d" + integrity sha512-q+w1cqmhL7R0FNzth/PLLp2N+scXEK/L2AHbXUyydxp828F4FEa5WcVoqui9vFRiHDQErj9Zof8azP32uGVTRA== + dependencies: + "@babel/helper-member-expression-to-functions" "^7.12.7" + "@babel/helper-optimise-call-expression" "^7.12.10" + "@babel/traverse" "^7.12.10" + "@babel/types" "^7.12.11" + +"@babel/helper-simple-access@^7.12.1": + version "7.12.1" + resolved "https://registry.yarnpkg.com/@babel/helper-simple-access/-/helper-simple-access-7.12.1.tgz#32427e5aa61547d38eb1e6eaf5fd1426fdad9136" + integrity sha512-OxBp7pMrjVewSSC8fXDFrHrBcJATOOFssZwv16F3/6Xtc138GHybBfPbm9kfiqQHKhYQrlamWILwlDCeyMFEaA== + dependencies: + "@babel/types" "^7.12.1" + +"@babel/helper-split-export-declaration@^7.11.0", "@babel/helper-split-export-declaration@^7.12.11": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.12.11.tgz#1b4cc424458643c47d37022223da33d76ea4603a" + integrity sha512-LsIVN8j48gHgwzfocYUSkO/hjYAOJqlpJEc7tGXcIm4cubjVUf8LGW6eWRyxEu7gA25q02p0rQUWoCI33HNS5g== + dependencies: + "@babel/types" "^7.12.11" + +"@babel/helper-validator-identifier@^7.10.4", "@babel/helper-validator-identifier@^7.18.6": + version "7.19.1" + resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.19.1.tgz#7eea834cf32901ffdc1a7ee555e2f9c27e249ca2" + integrity sha512-awrNfaMtnHUr653GgGEs++LlAvW6w+DcPrOliSMXWCKo597CwL5Acf/wWdNkf/tfEQE3mjkeD1YOVZOUV/od1w== + +"@babel/helper-validator-identifier@^7.12.11": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/helper-validator-identifier/-/helper-validator-identifier-7.12.11.tgz#c9a1f021917dcb5ccf0d4e453e399022981fc9ed" + integrity sha512-np/lG3uARFybkoHokJUmf1QfEvRVCPbmQeUQpKow5cQ3xWrV9i3rUHodKDJPQfTVX61qKi+UdYk8kik84n7XOw== + +"@babel/helpers@^7.12.5": + version "7.12.5" + resolved "https://registry.yarnpkg.com/@babel/helpers/-/helpers-7.12.5.tgz#1a1ba4a768d9b58310eda516c449913fe647116e" + integrity sha512-lgKGMQlKqA8meJqKsW6rUnc4MdUk35Ln0ATDqdM1a/UpARODdI4j5Y5lVfUScnSNkJcdCRAaWkspykNoFg9sJA== + dependencies: + "@babel/template" "^7.10.4" + "@babel/traverse" "^7.12.5" + "@babel/types" "^7.12.5" + +"@babel/highlight@^7.10.4", "@babel/highlight@^7.18.6": + version "7.18.6" + resolved "https://registry.yarnpkg.com/@babel/highlight/-/highlight-7.18.6.tgz#81158601e93e2563795adcbfbdf5d64be3f2ecdf" + integrity sha512-u7stbOuYjaPezCuLj29hNW1v64M2Md2qupEKP1fHc7WdOA3DgLh37suiSrZYY7haUB7iBeQZ9P1uiRF359do3g== + dependencies: + "@babel/helper-validator-identifier" "^7.18.6" + chalk "^2.0.0" + js-tokens "^4.0.0" + +"@babel/parser@^7.12.10", "@babel/parser@^7.12.11", "@babel/parser@^7.12.7": + version "7.12.11" + resolved "https://registry.yarnpkg.com/@babel/parser/-/parser-7.12.11.tgz#9ce3595bcd74bc5c466905e86c535b8b25011e79" + integrity sha512-N3UxG+uuF4CMYoNj8AhnbAcJF0PiuJ9KHuy1lQmkYsxTer/MAH9UBNHsBoAX/4s6NvlDD047No8mYVGGzLL4hg== + +"@babel/runtime@^7.11.2": + version "7.12.18" + resolved "https://registry.yarnpkg.com/@babel/runtime/-/runtime-7.12.18.tgz#af137bd7e7d9705a412b3caaf991fe6aaa97831b" + integrity sha512-BogPQ7ciE6SYAUPtlm9tWbgI9+2AgqSam6QivMgXgAT+fKbgppaj4ZX15MHeLC1PVF5sNk70huBu20XxWOs8Cg== + dependencies: + regenerator-runtime "^0.13.4" + +"@babel/template@^7.10.4", "@babel/template@^7.12.7": + version "7.12.7" + resolved "https://registry.yarnpkg.com/@babel/template/-/template-7.12.7.tgz#c817233696018e39fbb6c491d2fb684e05ed43bc" + integrity sha512-GkDzmHS6GV7ZeXfJZ0tLRBhZcMcY0/Lnb+eEbXDBfCAcZCjrZKe6p3J4we/D24O9Y8enxWAg1cWwof59yLh2ow== + dependencies: + "@babel/code-frame" "^7.10.4" + "@babel/parser" "^7.12.7" + "@babel/types" "^7.12.7" + +"@babel/traverse@^7.12.1", "@babel/traverse@^7.12.10", "@babel/traverse@^7.12.5": + version "7.12.12" + resolved "https://registry.yarnpkg.com/@babel/traverse/-/traverse-7.12.12.tgz#d0cd87892704edd8da002d674bc811ce64743376" + integrity sha512-s88i0X0lPy45RrLM8b9mz8RPH5FqO9G9p7ti59cToE44xFm1Q+Pjh5Gq4SXBbtb88X7Uy7pexeqRIQDDMNkL0w== + dependencies: + "@babel/code-frame" "^7.12.11" + "@babel/generator" "^7.12.11" + "@babel/helper-function-name" "^7.12.11" + "@babel/helper-split-export-declaration" "^7.12.11" + "@babel/parser" "^7.12.11" + "@babel/types" "^7.12.12" + debug "^4.1.0" + globals "^11.1.0" + lodash "^4.17.19" + +"@babel/types@^7.12.1", "@babel/types@^7.12.10", "@babel/types@^7.12.11", "@babel/types@^7.12.12", "@babel/types@^7.12.5", "@babel/types@^7.12.7": + version "7.12.12" + resolved "https://registry.yarnpkg.com/@babel/types/-/types-7.12.12.tgz#4608a6ec313abbd87afa55004d373ad04a96c299" + integrity sha512-lnIX7piTxOH22xE7fDXDbSHg9MM1/6ORnafpJmov5rs0kX5g4BZxeXNJLXsMRiO0U5Rb8/FvMS6xlTnTHvxonQ== + dependencies: + "@babel/helper-validator-identifier" "^7.12.11" + lodash "^4.17.19" + to-fast-properties "^2.0.0" + +"@commitlint/cli@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/cli/-/cli-11.0.0.tgz#698199bc52afed50aa28169237758fa14a67b5d3" + integrity sha512-YWZWg1DuqqO5Zjh7vUOeSX76vm0FFyz4y0cpGMFhrhvUi5unc4IVfCXZ6337R9zxuBtmveiRuuhQqnRRer+13g== + dependencies: + "@babel/runtime" "^7.11.2" + "@commitlint/format" "^11.0.0" + "@commitlint/lint" "^11.0.0" + "@commitlint/load" "^11.0.0" + "@commitlint/read" "^11.0.0" + chalk "4.1.0" + core-js "^3.6.1" + get-stdin "8.0.0" + lodash "^4.17.19" + resolve-from "5.0.0" + resolve-global "1.0.0" + yargs "^15.1.0" + +"@commitlint/config-conventional@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/config-conventional/-/config-conventional-11.0.0.tgz#3fa300a1b639273946de3c3f15e1cda518333422" + integrity sha512-SNDRsb5gLuDd2PL83yCOQX6pE7gevC79UPFx+GLbLfw6jGnnbO9/tlL76MLD8MOViqGbo7ZicjChO9Gn+7tHhA== + dependencies: + conventional-changelog-conventionalcommits "^4.3.1" + +"@commitlint/ensure@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/ensure/-/ensure-11.0.0.tgz#3e796b968ab5b72bc6f8a6040076406306c987fb" + integrity sha512-/T4tjseSwlirKZdnx4AuICMNNlFvRyPQimbZIOYujp9DSO6XRtOy9NrmvWujwHsq9F5Wb80QWi4WMW6HMaENug== + dependencies: + "@commitlint/types" "^11.0.0" + lodash "^4.17.19" + +"@commitlint/execute-rule@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/execute-rule/-/execute-rule-11.0.0.tgz#3ed60ab7a33019e58d90e2d891b75d7df77b4b4d" + integrity sha512-g01p1g4BmYlZ2+tdotCavrMunnPFPhTzG1ZiLKTCYrooHRbmvqo42ZZn4QMStUEIcn+jfLb6BRZX3JzIwA1ezQ== + +"@commitlint/format@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/format/-/format-11.0.0.tgz#ac47b0b9ca46540c0082c721b290794e67bdc51b" + integrity sha512-bpBLWmG0wfZH/svzqD1hsGTpm79TKJWcf6EXZllh2J/LSSYKxGlv967lpw0hNojme0sZd4a/97R3qA2QHWWSLg== + dependencies: + "@commitlint/types" "^11.0.0" + chalk "^4.0.0" + +"@commitlint/is-ignored@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/is-ignored/-/is-ignored-11.0.0.tgz#7b803eda56276dbe7fec51eb1510676198468f39" + integrity sha512-VLHOUBN+sOlkYC4tGuzE41yNPO2w09sQnOpfS+pSPnBFkNUUHawEuA44PLHtDvQgVuYrMAmSWFQpWabMoP5/Xg== + dependencies: + "@commitlint/types" "^11.0.0" + semver "7.3.2" + +"@commitlint/lint@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/lint/-/lint-11.0.0.tgz#01e062cd1b0e7c3d756aa2c246462e0b6a3348a4" + integrity sha512-Q8IIqGIHfwKr8ecVZyYh6NtXFmKw4YSEWEr2GJTB/fTZXgaOGtGFZDWOesCZllQ63f1s/oWJYtVv5RAEuwN8BQ== + dependencies: + "@commitlint/is-ignored" "^11.0.0" + "@commitlint/parse" "^11.0.0" + "@commitlint/rules" "^11.0.0" + "@commitlint/types" "^11.0.0" + +"@commitlint/load@>6.1.1", "@commitlint/load@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/load/-/load-11.0.0.tgz#f736562f0ffa7e773f8808fea93319042ee18211" + integrity sha512-t5ZBrtgvgCwPfxmG811FCp39/o3SJ7L+SNsxFL92OR4WQxPcu6c8taD0CG2lzOHGuRyuMxZ7ps3EbngT2WpiCg== + dependencies: + "@commitlint/execute-rule" "^11.0.0" + "@commitlint/resolve-extends" "^11.0.0" + "@commitlint/types" "^11.0.0" + chalk "4.1.0" + cosmiconfig "^7.0.0" + lodash "^4.17.19" + resolve-from "^5.0.0" + +"@commitlint/message@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/message/-/message-11.0.0.tgz#83554c3cbbc884fd07b473593bc3e94bcaa3ee05" + integrity sha512-01ObK/18JL7PEIE3dBRtoMmU6S3ecPYDTQWWhcO+ErA3Ai0KDYqV5VWWEijdcVafNpdeUNrEMigRkxXHQLbyJA== + +"@commitlint/parse@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/parse/-/parse-11.0.0.tgz#d18b08cf67c35d02115207d7009306a2e8e7c901" + integrity sha512-DekKQAIYWAXIcyAZ6/PDBJylWJ1BROTfDIzr9PMVxZRxBPc1gW2TG8fLgjZfBP5mc0cuthPkVi91KQQKGri/7A== + dependencies: + conventional-changelog-angular "^5.0.0" + conventional-commits-parser "^3.0.0" + +"@commitlint/read@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/read/-/read-11.0.0.tgz#f24240548c63587bba139fa5a364cab926077016" + integrity sha512-37V0V91GSv0aDzMzJioKpCoZw6l0shk7+tRG8RkW1GfZzUIytdg3XqJmM+IaIYpaop0m6BbZtfq+idzUwJnw7g== + dependencies: + "@commitlint/top-level" "^11.0.0" + fs-extra "^9.0.0" + git-raw-commits "^2.0.0" + +"@commitlint/resolve-extends@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/resolve-extends/-/resolve-extends-11.0.0.tgz#158ecbe27d4a2a51d426111a01478e216fbb1036" + integrity sha512-WinU6Uv6L7HDGLqn/To13KM1CWvZ09VHZqryqxXa1OY+EvJkfU734CwnOEeNlSCK7FVLrB4kmodLJtL1dkEpXw== + dependencies: + import-fresh "^3.0.0" + lodash "^4.17.19" + resolve-from "^5.0.0" + resolve-global "^1.0.0" + +"@commitlint/rules@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/rules/-/rules-11.0.0.tgz#bdb310cc6fc55c9f8d7d917a22b69055c535c375" + integrity sha512-2hD9y9Ep5ZfoNxDDPkQadd2jJeocrwC4vJ98I0g8pNYn/W8hS9+/FuNpolREHN8PhmexXbkjrwyQrWbuC0DVaA== + dependencies: + "@commitlint/ensure" "^11.0.0" + "@commitlint/message" "^11.0.0" + "@commitlint/to-lines" "^11.0.0" + "@commitlint/types" "^11.0.0" + +"@commitlint/to-lines@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/to-lines/-/to-lines-11.0.0.tgz#86dea151c10eea41e39ea96fa4de07839258a7fe" + integrity sha512-TIDTB0Y23jlCNubDROUVokbJk6860idYB5cZkLWcRS9tlb6YSoeLn1NLafPlrhhkkkZzTYnlKYzCVrBNVes1iw== + +"@commitlint/top-level@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/top-level/-/top-level-11.0.0.tgz#bb2d1b6e5ed3be56874633b59e1f7de118c32783" + integrity sha512-O0nFU8o+Ws+py5pfMQIuyxOtfR/kwtr5ybqTvR+C2lUPer2x6lnQU+OnfD7hPM+A+COIUZWx10mYQvkR3MmtAA== + dependencies: + find-up "^5.0.0" + +"@commitlint/types@^11.0.0": + version "11.0.0" + resolved "https://registry.yarnpkg.com/@commitlint/types/-/types-11.0.0.tgz#719cf05fcc1abb6533610a2e0f5dd1e61eac14fe" + integrity sha512-VoNqai1vR5anRF5Tuh/+SWDFk7xi7oMwHrHrbm1BprYXjB2RJsWLhUrStMssDxEl5lW/z3EUdg8RvH/IUBccSQ== + +"@concordance/react@^2.0.0": + version "2.0.0" + resolved "https://registry.yarnpkg.com/@concordance/react/-/react-2.0.0.tgz#aef913f27474c53731f4fd79cc2f54897de90fde" + integrity sha512-huLSkUuM2/P+U0uy2WwlKuixMsTODD8p4JVQBI4VKeopkiN0C7M3N9XYVawb4M+4spN5RrO/eLhk7KoQX6nsfA== + dependencies: + arrify "^1.0.1" + +"@cspell/dict-aws@^1.0.13": + version "1.0.14" + resolved "https://registry.yarnpkg.com/@cspell/dict-aws/-/dict-aws-1.0.14.tgz#beddede1053ce3622400e36c65da9fd2954e939d" + integrity sha512-K21CfB4ZpKYwwDQiPfic2zJA/uxkbsd4IQGejEvDAhE3z8wBs6g6BwwqdVO767M9NgZqc021yAVpr79N5pWe3w== + +"@cspell/dict-bash@^1.0.11": + version "1.0.18" + resolved "https://registry.yarnpkg.com/@cspell/dict-bash/-/dict-bash-1.0.18.tgz#1a2a07075c1ea97923f405e32713bf23d26d67ab" + integrity sha512-kJIqQ+FD2TCSgaaP5XLEDgy222+pVWTc+VhveNO++gnTWU3BCVjkD5LjfW7g/CmGONnz+nwXDueWspProaSdJw== + +"@cspell/dict-companies@^1.0.35": + version "1.0.40" + resolved "https://registry.yarnpkg.com/@cspell/dict-companies/-/dict-companies-1.0.40.tgz#edd7f47fc683dfa1b02cd48fb12ad732d2eece61" + integrity sha512-Aw07qiTroqSST2P5joSrC4uOA05zTXzI2wMb+me3q4Davv1D9sCkzXY0TGoC2vzhNv5ooemRi9KATGaBSdU1sw== + +"@cspell/dict-cpp@^1.1.37": + version "1.1.40" + resolved "https://registry.yarnpkg.com/@cspell/dict-cpp/-/dict-cpp-1.1.40.tgz#f9a859e19d31b83f07a106e4c3c8720a2d93595b" + integrity sha512-sscfB3woNDNj60/yGXAdwNtIRWZ89y35xnIaJVDMk5TPMMpaDvuk0a34iOPIq0g4V+Y8e3RyAg71SH6ADwSjGw== + +"@cspell/dict-cryptocurrencies@^1.0.10": + version "1.0.10" + resolved "https://registry.yarnpkg.com/@cspell/dict-cryptocurrencies/-/dict-cryptocurrencies-1.0.10.tgz#04426fdfee8752818b375686d34a154b2fb40c7d" + integrity sha512-47ABvDJOkaST/rXipNMfNvneHUzASvmL6K/CbOFpYKfsd0x23Jc9k1yaOC7JAm82XSC/8a7+3Yu+Fk2jVJNnsA== + +"@cspell/dict-csharp@^1.0.10": + version "1.0.11" + resolved "https://registry.yarnpkg.com/@cspell/dict-csharp/-/dict-csharp-1.0.11.tgz#cacdf477a31ca8326c2c91bee0b42b9f6b3c4a7c" + integrity sha512-nub+ZCiTgmT87O+swI+FIAzNwaZPWUGckJU4GN402wBq420V+F4ZFqNV7dVALJrGaWH7LvADRtJxi6cZVHJKeA== + +"@cspell/dict-css@^1.0.10": + version "1.0.13" + resolved "https://registry.yarnpkg.com/@cspell/dict-css/-/dict-css-1.0.13.tgz#805a5844dd9739b6cd026b5f1b4ce8e4213d560b" + integrity sha512-HU8RbFRoGanFH85mT01Ot/Ay48ixr/gG25VPLtdq56QTrmPsw79gxYm/5Qay16eQbpoPIxaj5CAWNam+DX4GbA== + +"@cspell/dict-django@^1.0.25": + version "1.0.26" + resolved "https://registry.yarnpkg.com/@cspell/dict-django/-/dict-django-1.0.26.tgz#b97ce0112fbe8c3c3ada0387c68971b5e27483ab" + integrity sha512-mn9bd7Et1L2zuibc08GVHTiD2Go3/hdjyX5KLukXDklBkq06r+tb0OtKtf1zKodtFDTIaYekGADhNhA6AnKLkg== + +"@cspell/dict-dotnet@^1.0.24": + version "1.0.32" + resolved "https://registry.yarnpkg.com/@cspell/dict-dotnet/-/dict-dotnet-1.0.32.tgz#412af0bf1f65c5902c8ef8a4f1decae2892790e2" + integrity sha512-9H9vXrgJB4KF8xsyTToXO53cXD33iyfrpT4mhCds+YLUw3P3x3E9myszgJzshnrxYBvQZ+QMII57Qr6SjZVk4Q== + +"@cspell/dict-elixir@^1.0.23": + version "1.0.26" + resolved "https://registry.yarnpkg.com/@cspell/dict-elixir/-/dict-elixir-1.0.26.tgz#dd86697b351a9c74a7d033b6f2d37a5088587aa6" + integrity sha512-hz1yETUiRJM7yjN3mITSnxcmZaEyaBbyJhpZPpg+cKUil+xhHeZ2wwfbRc83QHGmlqEuDWbdCFqKSpCDJYpYhg== + +"@cspell/dict-en-gb@^1.1.27": + version "1.1.33" + resolved "https://registry.yarnpkg.com/@cspell/dict-en-gb/-/dict-en-gb-1.1.33.tgz#7f1fd90fc364a5cb77111b5438fc9fcf9cc6da0e" + integrity sha512-tKSSUf9BJEV+GJQAYGw5e+ouhEe2ZXE620S7BLKe3ZmpnjlNG9JqlnaBhkIMxKnNFkLY2BP/EARzw31AZnOv4g== + +"@cspell/dict-en_us@^1.2.39": + version "1.2.45" + resolved "https://registry.yarnpkg.com/@cspell/dict-en_us/-/dict-en_us-1.2.45.tgz#1314a9d81a1fd3cc7ed381dc6a0da10e7c2d02f9" + integrity sha512-UPwR4rfiJCxnS+Py+EK9E4AUj3aPZE4p/yBRSHN+5aBQConlI0lLDtMceH5wlupA/sQTU1ERZGPJA9L96jVSyQ== + +"@cspell/dict-filetypes@^1.1.5": + version "1.1.8" + resolved "https://registry.yarnpkg.com/@cspell/dict-filetypes/-/dict-filetypes-1.1.8.tgz#c161ab48667b6539cbc91a70ff0b037fa436a64e" + integrity sha512-EllahNkhzvLWo0ptwu0l3oEeAJOQSUpZnDfnKRIh6mJVehuSovNHwA9vrdZ8jBUjuqcfaN2e7c32zN0D/qvWJQ== + +"@cspell/dict-fonts@^1.0.13": + version "1.0.14" + resolved "https://registry.yarnpkg.com/@cspell/dict-fonts/-/dict-fonts-1.0.14.tgz#7b18129910d30bd23cd9187d0c0009dfc3fef4ba" + integrity sha512-VhIX+FVYAnqQrOuoFEtya6+H72J82cIicz9QddgknsTqZQ3dvgp6lmVnsQXPM3EnzA8n1peTGpLDwHzT7ociLA== + +"@cspell/dict-fullstack@^1.0.36": + version "1.0.39" + resolved "https://registry.yarnpkg.com/@cspell/dict-fullstack/-/dict-fullstack-1.0.39.tgz#65a9031826062a1b9934a87c419fd1c4407ebcb1" + integrity sha512-Mbi+zWdiP9yzL+X4YD9Tgcm5YQ95Ql+Y3vF2LRnOY6g2QWaijTRN1rgksVuxzpFqHi//+bx2uoUb0XEKBYDi8g== + +"@cspell/dict-golang@^1.1.24": + version "1.1.24" + resolved "https://registry.yarnpkg.com/@cspell/dict-golang/-/dict-golang-1.1.24.tgz#3830812aec816eca46a6d793fcc7710c09d4f5b9" + integrity sha512-qq3Cjnx2U1jpeWAGJL1GL0ylEhUMqyaR36Xij6Y6Aq4bViCRp+HRRqk0x5/IHHbOrti45h3yy7ii1itRFo+Xkg== + +"@cspell/dict-haskell@^1.0.12": + version "1.0.13" + resolved "https://registry.yarnpkg.com/@cspell/dict-haskell/-/dict-haskell-1.0.13.tgz#bd159ef474ef427757dd4bc6a66cda977946c927" + integrity sha512-kvl8T84cnYRPpND/P3D86P6WRSqebsbk0FnMfy27zo15L5MLAb3d3MOiT1kW3vEWfQgzUD7uddX/vUiuroQ8TA== + +"@cspell/dict-html-symbol-entities@^1.0.23": + version "1.0.23" + resolved "https://registry.yarnpkg.com/@cspell/dict-html-symbol-entities/-/dict-html-symbol-entities-1.0.23.tgz#0efbdbc7712c9fbe545e14acac637226ac948f2d" + integrity sha512-PV0UBgcBFbBLf/m1wfkVMM8w96kvfHoiCGLWO6BR3Q9v70IXoE4ae0+T+f0CkxcEkacMqEQk/I7vuE9MzrjaNw== + +"@cspell/dict-html@^1.1.5": + version "1.1.9" + resolved "https://registry.yarnpkg.com/@cspell/dict-html/-/dict-html-1.1.9.tgz#e506ca550ffcdad820ba0aa157a48be869f23bf2" + integrity sha512-vvnYia0tyIS5Fdoz+gEQm77MGZZE66kOJjuNpIYyRHCXFAhWdYz3SmkRm6YKJSWSvuO+WBJYTKDvkOxSh3Fx/w== + +"@cspell/dict-java@^1.0.22": + version "1.0.23" + resolved "https://registry.yarnpkg.com/@cspell/dict-java/-/dict-java-1.0.23.tgz#ec95ff2f2c34d5e8e08ba817980b37e387e608cb" + integrity sha512-LcOg9srYLDoNGd8n3kbfDBlZD+LOC9IVcnFCdua1b/luCHNVmlgBx7e677qPu7olpMYOD5TQIVW2OmM1+/6MFA== + +"@cspell/dict-latex@^1.0.23": + version "1.0.25" + resolved "https://registry.yarnpkg.com/@cspell/dict-latex/-/dict-latex-1.0.25.tgz#6ecf5b8b8fdf46cb8a0f070052dd687e25089e59" + integrity sha512-cEgg91Migqcp1SdVV7dUeMxbPDhxdNo6Fgq2eygAXQjIOFK520FFvh/qxyBvW90qdZbIRoU2AJpchyHfGuwZFA== + +"@cspell/dict-lorem-ipsum@^1.0.22": + version "1.0.22" + resolved "https://registry.yarnpkg.com/@cspell/dict-lorem-ipsum/-/dict-lorem-ipsum-1.0.22.tgz#a89f53dadda7d5bfdb978ab61f19d74d2fb69eab" + integrity sha512-yqzspR+2ADeAGUxLTfZ4pXvPl7FmkENMRcGDECmddkOiuEwBCWMZdMP5fng9B0Q6j91hQ8w9CLvJKBz10TqNYg== + +"@cspell/dict-lua@^1.0.16": + version "1.0.16" + resolved "https://registry.yarnpkg.com/@cspell/dict-lua/-/dict-lua-1.0.16.tgz#c0ca43628f8927fc10731fd27cd9ee0af651bf6a" + integrity sha512-YiHDt8kmHJ8nSBy0tHzaxiuitYp+oJ66ffCYuFWTNB3//Y0SI4OGHU3omLsQVeXIfCeVrO4DrVvRDoCls9B5zQ== + +"@cspell/dict-node@^1.0.10": + version "1.0.12" + resolved "https://registry.yarnpkg.com/@cspell/dict-node/-/dict-node-1.0.12.tgz#a7236be30340ff8fe365f62c8d13121fdbe7f51c" + integrity sha512-RPNn/7CSkflAWk0sbSoOkg0ORrgBARUjOW3QjB11KwV1gSu8f5W/ij/S50uIXtlrfoBLqd4OyE04jyON+g/Xfg== + +"@cspell/dict-npm@^1.0.10": + version "1.0.16" + resolved "https://registry.yarnpkg.com/@cspell/dict-npm/-/dict-npm-1.0.16.tgz#86870686cd0af6354a206ab297872db1d84e9c1b" + integrity sha512-RwkuZGcYBxL3Yux3cSG/IOWGlQ1e9HLCpHeyMtTVGYKAIkFAVUnGrz20l16/Q7zUG7IEktBz5O42kAozrEnqMQ== + +"@cspell/dict-php@^1.0.23": + version "1.0.25" + resolved "https://registry.yarnpkg.com/@cspell/dict-php/-/dict-php-1.0.25.tgz#b065314c43b668b982356de59986e10fc26bc390" + integrity sha512-RoBIP5MRdByyPaXcznZMfOY1JdCMYPPLua5E9gkq0TJO7bX5mC9hyAKfYBSWVQunZydd82HZixjb5MPkDFU1uw== + +"@cspell/dict-powershell@^1.0.14": + version "1.0.19" + resolved "https://registry.yarnpkg.com/@cspell/dict-powershell/-/dict-powershell-1.0.19.tgz#b50d14b3b20e33f86b80318ccd7ef986ecba2549" + integrity sha512-zF/raM/lkhXeHf4I43OtK0gP9rBeEJFArscTVwLWOCIvNk21MJcNoTYoaGw+c056+Q+hJL0psGLO7QN+mxYH1A== + +"@cspell/dict-python@^1.0.32": + version "1.0.38" + resolved "https://registry.yarnpkg.com/@cspell/dict-python/-/dict-python-1.0.38.tgz#5212536e00dda94ae001c77f492478c6ce0a348e" + integrity sha512-KuyOQaby9NID/pn7EkXilpUxjVIvvyLzhr7BPsDS6FcvUE8Yhss6bJowEDHSv6pa+W2387phoqbDf2rTicquAA== + +"@cspell/dict-ruby@^1.0.12": + version "1.0.15" + resolved "https://registry.yarnpkg.com/@cspell/dict-ruby/-/dict-ruby-1.0.15.tgz#5da9f54d97deed31cc35772502282b45b20e7aa7" + integrity sha512-I76hJA///lc1pgmDTGUFHN/O8KLIZIU/8TgIYIGI6Ix/YzSEvWNdQYbANn6JbCynS0X+7IbZ2Ft+QqvmGtIWuA== + +"@cspell/dict-rust@^1.0.22": + version "1.0.23" + resolved "https://registry.yarnpkg.com/@cspell/dict-rust/-/dict-rust-1.0.23.tgz#bcef79f74932d90a07f86efa11a8696788079ad8" + integrity sha512-lR4boDzs79YD6+30mmiSGAMMdwh7HTBAPUFSB0obR3Kidibfc3GZ+MHWZXay5dxZ4nBKM06vyjtanF9VJ8q1Iw== + +"@cspell/dict-scala@^1.0.21": + version "1.0.21" + resolved "https://registry.yarnpkg.com/@cspell/dict-scala/-/dict-scala-1.0.21.tgz#bfda392329061e2352fbcd33d228617742c93831" + integrity sha512-5V/R7PRbbminTpPS3ywgdAalI9BHzcEjEj9ug4kWYvBIGwSnS7T6QCFCiu+e9LvEGUqQC+NHgLY4zs1NaBj2vA== + +"@cspell/dict-software-terms@^1.0.24": + version "1.0.48" + resolved "https://registry.yarnpkg.com/@cspell/dict-software-terms/-/dict-software-terms-1.0.48.tgz#dc45a91c64f9f86df3a047879d9f34aa17435bd0" + integrity sha512-pfF3Ys2gRffu5ElqkH7FQMDMi/iZMyOzpGMb3FSH0PJ2AnRQ5rRNWght1h2L36YxvXl0mWVaFrrfwiOyRIc8ZQ== + +"@cspell/dict-typescript@^1.0.16": + version "1.0.20" + resolved "https://registry.yarnpkg.com/@cspell/dict-typescript/-/dict-typescript-1.0.20.tgz#2a28bb94a06490b25bbb9180b875d6f16ebb8400" + integrity sha512-yIuGeeZtQA2gqpGefGjZqBl8iGJpIYWz0QzDqsscNi2qfSnLsbjM0RkRbTehM8y9gGGe7xfgUP5adxceJa5Krg== + +"@eslint/eslintrc@^0.4.3": + version "0.4.3" + resolved "https://registry.yarnpkg.com/@eslint/eslintrc/-/eslintrc-0.4.3.tgz#9e42981ef035beb3dd49add17acb96e8ff6f394c" + integrity sha512-J6KFFz5QCYUJq3pf0mjEcCJVERbzv71PUIDczuh9JkwGEzced6CO5ADLHB1rbf/+oPBtoPfMYNOpGDzCANlbXw== + dependencies: + ajv "^6.12.4" + debug "^4.1.1" + espree "^7.3.0" + globals "^13.9.0" + ignore "^4.0.6" + import-fresh "^3.2.1" + js-yaml "^3.13.1" + minimatch "^3.0.4" + strip-json-comments "^3.1.1" + +"@humanwhocodes/config-array@^0.5.0": + version "0.5.0" + resolved "https://registry.yarnpkg.com/@humanwhocodes/config-array/-/config-array-0.5.0.tgz#1407967d4c6eecd7388f83acf1eaf4d0c6e58ef9" + integrity sha512-FagtKFz74XrTl7y6HCzQpwDfXP0yhxe9lHLD1UZxjvZIcbyRz8zTFF/yYNfSfzU414eDwZ1SrO0Qvtyf+wFMQg== + dependencies: + "@humanwhocodes/object-schema" "^1.2.0" + debug "^4.1.1" + minimatch "^3.0.4" + +"@humanwhocodes/object-schema@^1.2.0": + version "1.2.1" + resolved "https://registry.yarnpkg.com/@humanwhocodes/object-schema/-/object-schema-1.2.1.tgz#b520529ec21d8e5945a1851dfd1c32e94e39ff45" + integrity sha512-ZnQMnLV4e7hDlUvw8H+U8ASL02SS2Gn6+9Ac3wGGLIe7+je2AeAOxPY+izIPJDfFDb7eDjev0Us8MO1iFRN8hA== + +"@hutson/parse-repository-url@^3.0.0": + version "3.0.2" + resolved "https://registry.yarnpkg.com/@hutson/parse-repository-url/-/parse-repository-url-3.0.2.tgz#98c23c950a3d9b6c8f0daed06da6c3af06981340" + integrity sha512-H9XAx3hc0BQHY6l+IFSWHDySypcXsvsuLhgYLUGywmJ5pswRVQJUHpOsobnLYp2ZUaUlKiKDrgWWhosOwAEM8Q== + +"@istanbuljs/load-nyc-config@^1.0.0": + version "1.1.0" + resolved "https://registry.yarnpkg.com/@istanbuljs/load-nyc-config/-/load-nyc-config-1.1.0.tgz#fd3db1d59ecf7cf121e80650bb86712f9b55eced" + integrity sha512-VjeHSlIzpv/NyD3N0YuHfXOPDIixcA1q2ZV98wsMqcYlPmv2n3Yb2lYP9XMElnaFVXg5A7YLTeLu6V84uQDjmQ== + dependencies: + camelcase "^5.3.1" + find-up "^4.1.0" + get-package-type "^0.1.0" + js-yaml "^3.13.1" + resolve-from "^5.0.0" + +"@istanbuljs/nyc-config-typescript@^1.0.1": + version "1.0.2" + resolved "https://registry.yarnpkg.com/@istanbuljs/nyc-config-typescript/-/nyc-config-typescript-1.0.2.tgz#1f5235b28540a07219ae0dd42014912a0b19cf89" + integrity sha512-iKGIyMoyJuFnJRSVTZ78POIRvNnwZaWIf8vG4ZS3rQq58MMDrqEX2nnzx0R28V2X8JvmKYiqY9FP2hlJsm8A0w== + dependencies: + "@istanbuljs/schema" "^0.1.2" + +"@istanbuljs/schema@^0.1.2": + version "0.1.3" + resolved "https://registry.yarnpkg.com/@istanbuljs/schema/-/schema-0.1.3.tgz#e45e384e4b8ec16bce2fd903af78450f6bf7ec98" + integrity sha512-ZXRY4jNvVgSVQ8DL3LTcakaAtXwTVUxE81hslsyD2AtoXW/wVob10HkOJ1X/pAlcI7D+2YoZKg5do8G/w6RYgA== + +"@mongodb-js/saslprep@^1.1.0": + version "1.1.0" + resolved "https://registry.yarnpkg.com/@mongodb-js/saslprep/-/saslprep-1.1.0.tgz#022fa36620a7287d17acd05c4aae1e5f390d250d" + integrity sha512-Xfijy7HvfzzqiOAhAepF4SGN5e9leLkMvg/OPOF97XemjfVCYN/oWa75wnkc6mltMSTwY+XlbhWgUOJmkFspSw== + dependencies: + sparse-bitfield "^3.0.3" + +"@nodelib/fs.scandir@2.1.5": + version "2.1.5" + resolved "https://registry.yarnpkg.com/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz#7619c2eb21b25483f6d167548b4cfd5a7488c3d5" + integrity sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g== + dependencies: + "@nodelib/fs.stat" "2.0.5" + run-parallel "^1.1.9" + +"@nodelib/fs.stat@2.0.5", "@nodelib/fs.stat@^2.0.2": + version "2.0.5" + resolved "https://registry.yarnpkg.com/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz#5bd262af94e9d25bd1e71b05deed44876a222e8b" + integrity sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A== + +"@nodelib/fs.walk@^1.2.3": + version "1.2.8" + resolved "https://registry.yarnpkg.com/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz#e95737e8bb6746ddedf69c556953494f196fe69a" + integrity sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg== + dependencies: + "@nodelib/fs.scandir" "2.1.5" + fastq "^1.6.0" + +"@sindresorhus/is@^0.14.0": + version "0.14.0" + resolved "https://registry.yarnpkg.com/@sindresorhus/is/-/is-0.14.0.tgz#9fb3a3cf3132328151f353de4632e01e52102bea" + integrity sha512-9NET910DNaIPngYnLLPeg+Ogzqsi9uM4mSboU5y6p8S5DzMTVEsJZrawi+BoDNUVBa2DhJqQYUFvMDfgU062LQ== + +"@szmarczak/http-timer@^1.1.2": + version "1.1.2" + resolved "https://registry.yarnpkg.com/@szmarczak/http-timer/-/http-timer-1.1.2.tgz#b1665e2c461a2cd92f4c1bbf50d5454de0d4b421" + integrity sha512-XIB2XbzHTN6ieIjfIMV9hlVcfPU26s2vafYWQcZHWXHOxiaRZYEDKEwdl129Zyg50+foYV2jCgtrqSA6qNuNSA== + dependencies: + defer-to-connect "^1.0.1" + +"@tokenizer/token@^0.1.0", "@tokenizer/token@^0.1.1": + version "0.1.1" + resolved "https://registry.yarnpkg.com/@tokenizer/token/-/token-0.1.1.tgz#f0d92c12f87079ddfd1b29f614758b9696bc29e3" + integrity sha512-XO6INPbZCxdprl+9qa/AAbFFOMzzwqYxpjPgLICrMD6C2FCw6qfJOPcBk6JqqPLSaZ/Qx87qn4rpPmPMwaAK6w== + +"@tootallnate/once@1": + version "1.1.2" + resolved "https://registry.yarnpkg.com/@tootallnate/once/-/once-1.1.2.tgz#ccb91445360179a04e7fe6aff78c00ffc1eeaf82" + integrity sha512-RbzJvlNzmRq5c3O09UipeuXno4tA1FE6ikOjxZK0tuxVv3412l64l5t1W5pj4+rJq9vpkm/kwiR07aZXnsKPxw== + +"@types/body-parser@*": + version "1.19.2" + resolved "https://registry.yarnpkg.com/@types/body-parser/-/body-parser-1.19.2.tgz#aea2059e28b7658639081347ac4fab3de166e6f0" + integrity sha512-ALYone6pm6QmwZoAgeyNksccT9Q4AWZQ6PvfwR37GT6r6FWUPguq6sUmNGSMV2Wr761oQoBxwGGa6DR5o1DC9g== + dependencies: + "@types/connect" "*" + "@types/node" "*" + +"@types/connect@*": + version "3.4.35" + resolved "https://registry.yarnpkg.com/@types/connect/-/connect-3.4.35.tgz#5fcf6ae445e4021d1fc2219a4873cc73a3bb2ad1" + integrity sha512-cdeYyv4KWoEgpBISTxWvqYsVy444DOqehiF3fM3ne10AmJ62RSyNkUnxMJXHQWRQQX2eR94m5y1IZyDwBjV9FQ== + dependencies: + "@types/node" "*" + +"@types/cookiejar@*": + version "2.1.2" + resolved "https://registry.yarnpkg.com/@types/cookiejar/-/cookiejar-2.1.2.tgz#66ad9331f63fe8a3d3d9d8c6e3906dd10f6446e8" + integrity sha512-t73xJJrvdTjXrn4jLS9VSGRbz0nUY3cl2DMGDU48lKl+HR9dbbjW2A9r3g40VA++mQpy6uuHg33gy7du2BKpog== + +"@types/debug@^4.1.5": + version "4.1.5" + resolved "https://registry.yarnpkg.com/@types/debug/-/debug-4.1.5.tgz#b14efa8852b7768d898906613c23f688713e02cd" + integrity sha512-Q1y515GcOdTHgagaVFhHnIFQ38ygs/kmxdNpvpou+raI9UO3YZcHDngBSYKQklcKlvA7iuQlmIKbzvmxcOE9CQ== + +"@types/debug@^4.1.7": + version "4.1.7" + resolved "https://registry.yarnpkg.com/@types/debug/-/debug-4.1.7.tgz#7cc0ea761509124709b8b2d1090d8f6c17aadb82" + integrity sha512-9AonUzyTjXXhEOa0DnqpzZi6VHlqKMswga9EXjpXnnqxwLtdvPPtlO8evrI5D9S6asFRCQ6v+wpiUKbw+vKqyg== + dependencies: + "@types/ms" "*" + +"@types/express-serve-static-core@^4.17.33": + version "4.17.33" + resolved "https://registry.yarnpkg.com/@types/express-serve-static-core/-/express-serve-static-core-4.17.33.tgz#de35d30a9d637dc1450ad18dd583d75d5733d543" + integrity sha512-TPBqmR/HRYI3eC2E5hmiivIzv+bidAfXofM+sbonAGvyDhySGw9/PQZFt2BLOrjUUR++4eJVpx6KnLQK1Fk9tA== + dependencies: + "@types/node" "*" + "@types/qs" "*" + "@types/range-parser" "*" + +"@types/express-session@^1.17.4": + version "1.17.6" + resolved "https://registry.yarnpkg.com/@types/express-session/-/express-session-1.17.6.tgz#1c8881ba0dc836ffbf1071b2f020d60fcca0f08c" + integrity sha512-L6sB04HVA4HEZo1hDL65JXdZdBJtzZnCiw/P7MnO4w6746tJCNtXlHtzEASyI9ccn9zyOw6IbqQuhVa03VpO4w== + dependencies: + "@types/express" "*" + +"@types/express@*", "@types/express@^4.17.13": + version "4.17.17" + resolved "https://registry.yarnpkg.com/@types/express/-/express-4.17.17.tgz#01d5437f6ef9cfa8668e616e13c2f2ac9a491ae4" + integrity sha512-Q4FmmuLGBG58btUnfS1c1r/NQdlp3DMfGDGig8WhfpA2YRUtEkxAjkZb0yvplJGYdF1fsQ81iMDcH24sSCNC/Q== + dependencies: + "@types/body-parser" "*" + "@types/express-serve-static-core" "^4.17.33" + "@types/qs" "*" + "@types/serve-static" "*" + +"@types/json-schema@^7.0.7": + version "7.0.11" + resolved "https://registry.yarnpkg.com/@types/json-schema/-/json-schema-7.0.11.tgz#d421b6c527a3037f7c84433fd2c4229e016863d3" + integrity sha512-wOuvG1SN4Us4rez+tylwwwCV1psiNVOkJeM3AUWUNWg/jDQY2+HE/444y5gc+jBmRqASOm2Oeh5c1axHobwRKQ== + +"@types/json5@^0.0.29": + version "0.0.29" + resolved "https://registry.yarnpkg.com/@types/json5/-/json5-0.0.29.tgz#ee28707ae94e11d2b827bcbe5270bcea7f3e71ee" + integrity sha512-dRLjCWHYg4oaA77cxO64oO+7JwCwnIzkZPdrrC71jQmQtlhM556pwKo5bUzqvZndkVbeFLIIi+9TC40JNF5hNQ== + +"@types/mime@*": + version "3.0.1" + resolved "https://registry.yarnpkg.com/@types/mime/-/mime-3.0.1.tgz#5f8f2bca0a5863cb69bc0b0acd88c96cb1d4ae10" + integrity sha512-Y4XFY5VJAuw0FgAqPNd6NNoV44jbq9Bz2L7Rh/J6jLTiHBSBJa9fxqQIvkIld4GsoDOcCbvzOUAbLPsSKKg+uA== + +"@types/minimist@^1.2.0": + version "1.2.2" + resolved "https://registry.yarnpkg.com/@types/minimist/-/minimist-1.2.2.tgz#ee771e2ba4b3dc5b372935d549fd9617bf345b8c" + integrity sha512-jhuKLIRrhvCPLqwPcx6INqmKeiA5EWrsCOPhrlFSrbrmU4ZMPjj5Ul/oLCMDO98XRUIwVm78xICz4EPCektzeQ== + +"@types/ms@*": + version "0.7.31" + resolved "https://registry.yarnpkg.com/@types/ms/-/ms-0.7.31.tgz#31b7ca6407128a3d2bbc27fe2d21b345397f6197" + integrity sha512-iiUgKzV9AuaEkZqkOLDIvlQiL6ltuZd9tGcW3gwpnX8JbuiuhFlEGmmFXEXkN50Cvq7Os88IY2v0dkDqXYWVgA== + +"@types/node@*": + version "18.15.2" + resolved "https://registry.yarnpkg.com/@types/node/-/node-18.15.2.tgz#0407ceb15647f186318101546d5ae40725b73810" + integrity sha512-sDPHm2wfx2QhrMDK0pOt2J4KLJMAcerqWNvnED0itPRJWvI+bK+uNHzcH1dFsBlf7G3u8tqXmRF3wkvL9yUwMw== + +"@types/node@^14.14.20": + version "14.18.37" + resolved "https://registry.yarnpkg.com/@types/node/-/node-14.18.37.tgz#0bfcd173e8e1e328337473a8317e37b3b14fd30d" + integrity sha512-7GgtHCs/QZrBrDzgIJnQtuSvhFSwhyYSI2uafSwZoNt1iOGhEN5fwNrQMjtONyHm9+/LoA4453jH0CMYcr06Pg== + +"@types/normalize-package-data@^2.4.0": + version "2.4.1" + resolved "https://registry.yarnpkg.com/@types/normalize-package-data/-/normalize-package-data-2.4.1.tgz#d3357479a0fdfdd5907fe67e17e0a85c906e1301" + integrity sha512-Gj7cI7z+98M282Tqmp2K5EIsoouUEzbBJhQQzDE3jSIRk6r9gsz0oUokqIUR4u1R3dMHo0pDHM7sNOHyhulypw== + +"@types/parse-json@^4.0.0": + version "4.0.0" + resolved "https://registry.yarnpkg.com/@types/parse-json/-/parse-json-4.0.0.tgz#2f8bb441434d163b35fb8ffdccd7138927ffb8c0" + integrity sha512-//oorEZjL6sbPcKUaCdIGlIUeH26mgzimjBB77G6XRgnDl/L5wOnpyBGRe/Mmf5CVW3PwEBE1NjiMZ/ssFh4wA== + +"@types/qs@*": + version "6.9.7" + resolved "https://registry.yarnpkg.com/@types/qs/-/qs-6.9.7.tgz#63bb7d067db107cc1e457c303bc25d511febf6cb" + integrity sha512-FGa1F62FT09qcrueBA6qYTrJPVDzah9a+493+o2PCXsesWHIn27G98TsSMs3WPNbZIEj4+VJf6saSFpvD+3Zsw== + +"@types/range-parser@*": + version "1.2.4" + resolved "https://registry.yarnpkg.com/@types/range-parser/-/range-parser-1.2.4.tgz#cd667bcfdd025213aafb7ca5915a932590acdcdc" + integrity sha512-EEhsLsD6UsDM1yFhAvy0Cjr6VwmpMWqFBCb9w07wVugF7w9nfajxLuVmngTIpgS6svCnm6Vaw+MZhoDCKnOfsw== + +"@types/serve-static@*": + version "1.15.1" + resolved "https://registry.yarnpkg.com/@types/serve-static/-/serve-static-1.15.1.tgz#86b1753f0be4f9a1bee68d459fcda5be4ea52b5d" + integrity sha512-NUo5XNiAdULrJENtJXZZ3fHtfMolzZwczzBbnAeBbqBwG+LaG6YaJtuwzwGSQZ2wsCrxjEhNNjAkKigy3n8teQ== + dependencies: + "@types/mime" "*" + "@types/node" "*" + +"@types/superagent@*": + version "4.1.16" + resolved "https://registry.yarnpkg.com/@types/superagent/-/superagent-4.1.16.tgz#12c9c16f232f9d89beab91d69368f96ce8e2d881" + integrity sha512-tLfnlJf6A5mB6ddqF159GqcDizfzbMUB1/DeT59/wBNqzRTNNKsaw79A/1TZ84X+f/EwWH8FeuSkjlCLyqS/zQ== + dependencies: + "@types/cookiejar" "*" + "@types/node" "*" + +"@types/supertest@^2.0.10": + version "2.0.12" + resolved "https://registry.yarnpkg.com/@types/supertest/-/supertest-2.0.12.tgz#ddb4a0568597c9aadff8dbec5b2e8fddbe8692fc" + integrity sha512-X3HPWTwXRerBZS7Mo1k6vMVR1Z6zmJcDVn5O/31whe0tnjE4te6ZJSJGq1RiqHPjzPdMTfjCFogDJmwng9xHaQ== + dependencies: + "@types/superagent" "*" + +"@types/webidl-conversions@*": + version "6.1.1" + resolved "https://registry.yarnpkg.com/@types/webidl-conversions/-/webidl-conversions-6.1.1.tgz#e33bc8ea812a01f63f90481c666334844b12a09e" + integrity sha512-XAahCdThVuCFDQLT7R7Pk/vqeObFNL3YqRyFZg+AqAP/W1/w3xHaIxuW7WszQqTbIBOPRcItYJIou3i/mppu3Q== + +"@types/whatwg-url@^8.2.1": + version "8.2.1" + resolved "https://registry.yarnpkg.com/@types/whatwg-url/-/whatwg-url-8.2.1.tgz#f1aac222dab7c59e011663a0cb0a3117b2ef05d4" + integrity sha512-2YubE1sjj5ifxievI5Ge1sckb9k/Er66HyR2c+3+I6VDUUg1TLPdYYTEbQ+DjRkS4nTxMJhgWfSfMRD2sl2EYQ== + dependencies: + "@types/node" "*" + "@types/webidl-conversions" "*" + +"@typescript-eslint/eslint-plugin@^4.12.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/eslint-plugin/-/eslint-plugin-4.33.0.tgz#c24dc7c8069c7706bc40d99f6fa87edcb2005276" + integrity sha512-aINiAxGVdOl1eJyVjaWn/YcVAq4Gi/Yo35qHGCnqbWVz61g39D0h23veY/MA0rFFGfxK7TySg2uwDeNv+JgVpg== + dependencies: + "@typescript-eslint/experimental-utils" "4.33.0" + "@typescript-eslint/scope-manager" "4.33.0" + debug "^4.3.1" + functional-red-black-tree "^1.0.1" + ignore "^5.1.8" + regexpp "^3.1.0" + semver "^7.3.5" + tsutils "^3.21.0" + +"@typescript-eslint/experimental-utils@4.33.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/experimental-utils/-/experimental-utils-4.33.0.tgz#6f2a786a4209fa2222989e9380b5331b2810f7fd" + integrity sha512-zeQjOoES5JFjTnAhI5QY7ZviczMzDptls15GFsI6jyUOq0kOf9+WonkhtlIhh0RgHRnqj5gdNxW5j1EvAyYg6Q== + dependencies: + "@types/json-schema" "^7.0.7" + "@typescript-eslint/scope-manager" "4.33.0" + "@typescript-eslint/types" "4.33.0" + "@typescript-eslint/typescript-estree" "4.33.0" + eslint-scope "^5.1.1" + eslint-utils "^3.0.0" + +"@typescript-eslint/parser@^4.12.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/parser/-/parser-4.33.0.tgz#dfe797570d9694e560528d18eecad86c8c744899" + integrity sha512-ZohdsbXadjGBSK0/r+d87X0SBmKzOq4/S5nzK6SBgJspFo9/CUDJ7hjayuze+JK7CZQLDMroqytp7pOcFKTxZA== + dependencies: + "@typescript-eslint/scope-manager" "4.33.0" + "@typescript-eslint/types" "4.33.0" + "@typescript-eslint/typescript-estree" "4.33.0" + debug "^4.3.1" + +"@typescript-eslint/scope-manager@4.33.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/scope-manager/-/scope-manager-4.33.0.tgz#d38e49280d983e8772e29121cf8c6e9221f280a3" + integrity sha512-5IfJHpgTsTZuONKbODctL4kKuQje/bzBRkwHE8UOZ4f89Zeddg+EGZs8PD8NcN4LdM3ygHWYB3ukPAYjvl/qbQ== + dependencies: + "@typescript-eslint/types" "4.33.0" + "@typescript-eslint/visitor-keys" "4.33.0" + +"@typescript-eslint/types@4.33.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/types/-/types-4.33.0.tgz#a1e59036a3b53ae8430ceebf2a919dc7f9af6d72" + integrity sha512-zKp7CjQzLQImXEpLt2BUw1tvOMPfNoTAfb8l51evhYbOEEzdWyQNmHWWGPR6hwKJDAi+1VXSBmnhL9kyVTTOuQ== + +"@typescript-eslint/typescript-estree@4.33.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/typescript-estree/-/typescript-estree-4.33.0.tgz#0dfb51c2908f68c5c08d82aefeaf166a17c24609" + integrity sha512-rkWRY1MPFzjwnEVHsxGemDzqqddw2QbTJlICPD9p9I9LfsO8fdmfQPOX3uKfUaGRDFJbfrtm/sXhVXN4E+bzCA== + dependencies: + "@typescript-eslint/types" "4.33.0" + "@typescript-eslint/visitor-keys" "4.33.0" + debug "^4.3.1" + globby "^11.0.3" + is-glob "^4.0.1" + semver "^7.3.5" + tsutils "^3.21.0" + +"@typescript-eslint/visitor-keys@4.33.0": + version "4.33.0" + resolved "https://registry.yarnpkg.com/@typescript-eslint/visitor-keys/-/visitor-keys-4.33.0.tgz#2a22f77a41604289b7a186586e9ec48ca92ef1dd" + integrity sha512-uqi/2aSz9g2ftcHWf8uLPJA70rUv6yuMW5Bohw+bwcuzaxQIHaKFZCKGoGXIrc9vkTJ3+0txM73K0Hq3d5wgIg== + dependencies: + "@typescript-eslint/types" "4.33.0" + eslint-visitor-keys "^2.0.0" + +JSONStream@^1.0.4: + version "1.3.5" + resolved "https://registry.yarnpkg.com/JSONStream/-/JSONStream-1.3.5.tgz#3208c1f08d3a4d99261ab64f92302bc15e111ca0" + integrity sha512-E+iruNOY8VV9s4JEbe1aNEm6MiszPRr/UfcHMz0TQh1BXSxHK+ASV1R6W4HpjBhSeS+54PIsAMCBmwD06LLsqQ== + dependencies: + jsonparse "^1.2.0" + through ">=2.2.7 <3" + +accepts@~1.3.8: + version "1.3.8" + resolved "https://registry.yarnpkg.com/accepts/-/accepts-1.3.8.tgz#0bf0be125b67014adcb0b0921e62db7bffe16b2e" + integrity sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw== + dependencies: + mime-types "~2.1.34" + negotiator "0.6.3" + +acorn-jsx@^5.3.1: + version "5.3.2" + resolved "https://registry.yarnpkg.com/acorn-jsx/-/acorn-jsx-5.3.2.tgz#7ed5bb55908b3b2f1bc55c6af1653bada7f07937" + integrity sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ== + +acorn-walk@^8.0.0: + version "8.0.1" + resolved "https://registry.yarnpkg.com/acorn-walk/-/acorn-walk-8.0.1.tgz#d265d35db6940a656c715806a448456ee4fa3b7f" + integrity sha512-zn/7dYtoTVkG4EoMU55QlQU4F+m+T7Kren6Vj3C2DapWPnakG/DL9Ns5aPAPW5Ixd3uxXrV/BoMKKVFIazPcdg== + +acorn@^7.4.0: + version "7.4.1" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-7.4.1.tgz#feaed255973d2e77555b83dbc08851a6c63520fa" + integrity sha512-nQyp0o1/mNdbTO1PO6kHkwSrmgZ0MT/jCCpNiwbUjGoRN4dlBhqJtoQuCnEOKzgTVwg0ZWiCoQy6SxMebQVh8A== + +acorn@^8.0.4: + version "8.0.4" + resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.0.4.tgz#7a3ae4191466a6984eee0fe3407a4f3aa9db8354" + integrity sha512-XNP0PqF1XD19ZlLKvB7cMmnZswW4C/03pRHgirB30uSJTaS3A3V1/P4sS3HPvFmjoriPCJQs+JDSbm4bL1TxGQ== + +add-stream@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/add-stream/-/add-stream-1.0.0.tgz#6a7990437ca736d5e1288db92bd3266d5f5cb2aa" + integrity sha512-qQLMr+8o0WC4FZGQTcJiKBVC59JylcPSrTtk6usvmIDFUOCKegapy1VHQwRbFMOFyb/inzUVqHs+eMYKDM1YeQ== + +agent-base@6: + version "6.0.2" + resolved "https://registry.yarnpkg.com/agent-base/-/agent-base-6.0.2.tgz#49fff58577cfee3f37176feab4c22e00f86d7f77" + integrity sha512-RZNwNclF7+MS/8bDg70amg32dyeZGZxiDuQmZxKLAlQjr3jGyLx+4Kkk58UO7D2QdgFIQCovuSuZESne6RG6XQ== + dependencies: + debug "4" + +aggregate-error@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/aggregate-error/-/aggregate-error-3.1.0.tgz#92670ff50f5359bdb7a3e0d40d0ec30c5737687a" + integrity sha512-4I7Td01quW/RpocfNayFdFVk1qSuoh0E7JrbRJ16nH01HhKFQ88INq9Sd+nd72zqRySlr9BmDA8xlEJ6vJMrYA== + dependencies: + clean-stack "^2.0.0" + indent-string "^4.0.0" + +ajv@^6.10.0, ajv@^6.12.4: + version "6.12.6" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-6.12.6.tgz#baf5a62e802b07d977034586f8c3baf5adf26df4" + integrity sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g== + dependencies: + fast-deep-equal "^3.1.1" + fast-json-stable-stringify "^2.0.0" + json-schema-traverse "^0.4.1" + uri-js "^4.2.2" + +ajv@^8.0.1: + version "8.12.0" + resolved "https://registry.yarnpkg.com/ajv/-/ajv-8.12.0.tgz#d1a0527323e22f53562c567c00991577dfbe19d1" + integrity sha512-sRu1kpcO9yLtYxBKvqfTeh9KzZEwO3STyX1HT+4CaDzC6HpTGYhIhPIzj9XuKU7KYDwnaeh5hcOwjy1QuJzBPA== + dependencies: + fast-deep-equal "^3.1.1" + json-schema-traverse "^1.0.0" + require-from-string "^2.0.2" + uri-js "^4.2.2" + +ansi-align@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/ansi-align/-/ansi-align-3.0.0.tgz#b536b371cf687caaef236c18d3e21fe3797467cb" + integrity sha512-ZpClVKqXN3RGBmKibdfWzqCY4lnjEuoNzU5T0oEFpfd/z5qJHVarukridD4juLO2FXMiwUQxr9WqQtaYa8XRYw== + dependencies: + string-width "^3.0.0" + +ansi-colors@^4.1.1: + version "4.1.3" + resolved "https://registry.yarnpkg.com/ansi-colors/-/ansi-colors-4.1.3.tgz#37611340eb2243e70cc604cad35d63270d48781b" + integrity sha512-/6w/C21Pm1A7aZitlI5Ni/2J6FFQN8i1Cvz3kHABAAbw93v/NlvKdVOqz7CCWz/3iv/JplRSEEZ83XION15ovw== + +ansi-escapes@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-3.2.0.tgz#8780b98ff9dbf5638152d1f1fe5c1d7b4442976b" + integrity sha512-cBhpre4ma+U0T1oM5fXg7Dy1Jw7zzwv7lt/GoCpr+hDQJoYnKVPLL4dCvSEFMmQurOQvSrwT7SL/DAlhBI97RQ== + +ansi-escapes@^4.3.0: + version "4.3.1" + resolved "https://registry.yarnpkg.com/ansi-escapes/-/ansi-escapes-4.3.1.tgz#a5c47cc43181f1f38ffd7076837700d395522a61" + integrity sha512-JWF7ocqNrp8u9oqpgV+wH5ftbt+cfvv+PTjOvKLT3AdYly/LmORARfEVT1iyjwN+4MqE5UmVKoAdIBqeoCHgLA== + dependencies: + type-fest "^0.11.0" + +ansi-regex@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-3.0.0.tgz#ed0317c322064f79466c02966bddb605ab37d998" + integrity sha1-7QMXwyIGT3lGbAKWa922Bas32Zg= + +ansi-regex@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-4.1.0.tgz#8b9f8f08cf1acb843756a839ca8c7e3168c51997" + integrity sha512-1apePfXM1UOSqw0o9IiFAovVz9M5S1Dg+4TrDwfMewQ6p/rmMueb7tWZjQ1rx4Loy1ArBggoqGpfqqdI4rondg== + +ansi-regex@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/ansi-regex/-/ansi-regex-5.0.1.tgz#082cb2c89c9fe8659a311a53bd6a4dc5301db304" + integrity sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ== + +ansi-styles@^3.2.1: + version "3.2.1" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-3.2.1.tgz#41fbb20243e50b12be0f04b8dedbf07520ce841d" + integrity sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA== + dependencies: + color-convert "^1.9.0" + +ansi-styles@^4.0.0, ansi-styles@^4.1.0: + version "4.3.0" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937" + integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg== + dependencies: + color-convert "^2.0.1" + +ansi-styles@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-5.0.0.tgz#675dbbb5ca1908fa90abe4e5b1c2e9b1f4080d99" + integrity sha512-6564t0m0fuQMnockqBv7wJxo9T5C2V9JpYXyNScfRDPVLusOQQhkpMGrFC17QbiolraQ1sMXX+Y5nJpjqozL4g== + +anymatch@~3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/anymatch/-/anymatch-3.1.1.tgz#c55ecf02185e2469259399310c173ce31233b142" + integrity sha512-mM8522psRCqzV+6LhomX5wgp25YVibjh8Wj23I5RPkPppSVSjyKD2A2mBJmWGa+KN7f2D6LNh9jkBCeyLktzjg== + dependencies: + normalize-path "^3.0.0" + picomatch "^2.0.4" + +append-transform@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/append-transform/-/append-transform-2.0.0.tgz#99d9d29c7b38391e6f428d28ce136551f0b77e12" + integrity sha512-7yeyCEurROLQJFv5Xj4lEGTy0borxepjFv1g22oAdqFu//SrAlDl1O1Nxx15SH1RoliUml6p8dwJW9jvZughhg== + dependencies: + default-require-extensions "^3.0.0" + +archy@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/archy/-/archy-1.0.0.tgz#f9c8c13757cc1dd7bc379ac77b2c62a5c2868c40" + integrity sha1-+cjBN1fMHde8N5rHeyxipcKGjEA= + +arg@^4.1.0: + version "4.1.3" + resolved "https://registry.yarnpkg.com/arg/-/arg-4.1.3.tgz#269fc7ad5b8e42cb63c896d5666017261c144089" + integrity sha512-58S9QDqG0Xx27YwPSt9fJxivjYl432YCwfDMfZ+71RAqUrZef7LrKQZ3LHLOwCS4FLNBplP533Zx895SeOCHvA== + +argparse@^1.0.7: + version "1.0.10" + resolved "https://registry.yarnpkg.com/argparse/-/argparse-1.0.10.tgz#bcd6791ea5ae09725e17e5ad988134cd40b3d911" + integrity sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg== + dependencies: + sprintf-js "~1.0.2" + +argv@0.0.2: + version "0.0.2" + resolved "https://registry.yarnpkg.com/argv/-/argv-0.0.2.tgz#ecbd16f8949b157183711b1bda334f37840185ab" + integrity sha512-dEamhpPEwRUBpLNHeuCm/v+g0anFByHahxodVO/BbAarHVBBg2MccCwf9K+o1Pof+2btdnkJelYVUWjW/VrATw== + +arr-diff@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/arr-diff/-/arr-diff-4.0.0.tgz#d6461074febfec71e7e15235761a329a5dc7c520" + integrity sha1-1kYQdP6/7HHn4VI1dhoyml3HxSA= + +arr-flatten@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.1.0.tgz#36048bbff4e7b47e136644316c99669ea5ae91f1" + integrity sha512-L3hKV5R/p5o81R7O02IGnwpDmkp6E982XhtbuwSe3O4qOtMMMtodicASA1Cny2U+aCXcNpml+m4dPsvsJ3jatg== + +arr-union@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/arr-union/-/arr-union-3.1.0.tgz#e39b09aea9def866a8f206e288af63919bae39c4" + integrity sha1-45sJrqne+Gao8gbiiK9jkZuuOcQ= + +array-buffer-byte-length@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/array-buffer-byte-length/-/array-buffer-byte-length-1.0.0.tgz#fabe8bc193fea865f317fe7807085ee0dee5aead" + integrity sha512-LPuwb2P+NrQw3XhxGc36+XSvuBPopovXYTR9Ew++Du9Yb/bx5AzBfrIsBoj0EZUifjQU+sHL21sseZ3jerWO/A== + dependencies: + call-bind "^1.0.2" + is-array-buffer "^3.0.1" + +array-find-index@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1" + integrity sha512-M1HQyIXcBGtVywBt8WVdim+lrNaK7VHp99Qt5pSNziXznKHViIBbXWtfRTpEFpF/c4FdfxNAsCCwPp5phBYJtw== + +array-flatten@1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-1.1.1.tgz#9a5f699051b1e7073328f2a008968b64ea2955d2" + integrity sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg== + +array-ify@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/array-ify/-/array-ify-1.0.0.tgz#9e528762b4a9066ad163a6962a364418e9626ece" + integrity sha512-c5AMf34bKdvPhQ7tBGhqkgKNUzMr4WUs+WDtC2ZUGOUncbxKMTvqxYctiseW3+L4bA8ec+GcZ6/A/FW4m8ukng== + +array-includes@^3.1.6: + version "3.1.6" + resolved "https://registry.yarnpkg.com/array-includes/-/array-includes-3.1.6.tgz#9e9e720e194f198266ba9e18c29e6a9b0e4b225f" + integrity sha512-sgTbLvL6cNnw24FnbaDyjmvddQ2ML8arZsgaJhoABMoplz/4QRhtrYS+alr1BUM1Bwp6dhx8vVCBSLG+StwOFw== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + get-intrinsic "^1.1.3" + is-string "^1.0.7" + +array-timsort@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/array-timsort/-/array-timsort-1.0.3.tgz#3c9e4199e54fb2b9c3fe5976396a21614ef0d926" + integrity sha512-/+3GRL7dDAGEfM6TseQk/U+mi18TU2Ms9I3UlLdUMhz2hbvGNTKdj9xniwXfUqgYhHxRx0+8UnKkvlNwVU+cWQ== + +array-union@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/array-union/-/array-union-1.0.2.tgz#9a34410e4f4e3da23dea375be5be70f24778ec39" + integrity sha512-Dxr6QJj/RdU/hCaBjOfxW+q6lyuVE6JFWIrAUpuOOhoJJoQ99cUn3igRaHVB5P9WrgFVN0FfArM3x0cueOU8ng== + dependencies: + array-uniq "^1.0.1" + +array-union@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/array-union/-/array-union-2.1.0.tgz#b798420adbeb1de828d84acd8a2e23d3efe85e8d" + integrity sha512-HGyxoOTYUyCM6stUe6EJgnd4EoewAI7zMdfqO+kGjnlZmBDz/cR5pf8r/cR4Wq60sL/p0IkcjUEEPwS3GFrIyw== + +array-uniq@^1.0.1: + version "1.0.3" + resolved "https://registry.yarnpkg.com/array-uniq/-/array-uniq-1.0.3.tgz#af6ac877a25cc7f74e058894753858dfdb24fdb6" + integrity sha512-MNha4BWQ6JbwhFhj03YK552f7cb3AzoE8SzeljgChvL1dl3IcvggXVz1DilzySZkCja+CXuZbdW7yATchWn8/Q== + +array-unique@^0.3.2: + version "0.3.2" + resolved "https://registry.yarnpkg.com/array-unique/-/array-unique-0.3.2.tgz#a894b75d4bc4f6cd679ef3244a9fd8f46ae2d428" + integrity sha1-qJS3XUvE9s1nnvMkSp/Y9Gri1Cg= + +array.prototype.flat@^1.3.1: + version "1.3.1" + resolved "https://registry.yarnpkg.com/array.prototype.flat/-/array.prototype.flat-1.3.1.tgz#ffc6576a7ca3efc2f46a143b9d1dda9b4b3cf5e2" + integrity sha512-roTU0KWIOmJ4DRLmwKd19Otg0/mT3qPNt0Qb3GWW8iObuZXxrjB/pzn0R3hqpRSWg4HCwqx+0vwOnWnvlOyeIA== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + es-shim-unscopables "^1.0.0" + +array.prototype.flatmap@^1.3.1: + version "1.3.1" + resolved "https://registry.yarnpkg.com/array.prototype.flatmap/-/array.prototype.flatmap-1.3.1.tgz#1aae7903c2100433cb8261cd4ed310aab5c4a183" + integrity sha512-8UGn9O1FDVvMNB0UlLv4voxRMze7+FpHyF5mSMRjWHUMlpoDViniy05870VlxhfgTnLbpuwTzvD76MTtWxB/mQ== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + es-shim-unscopables "^1.0.0" + +arrgv@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/arrgv/-/arrgv-1.0.2.tgz#025ed55a6a433cad9b604f8112fc4292715a6ec0" + integrity sha512-a4eg4yhp7mmruZDQFqVMlxNRFGi/i1r87pt8SDHy0/I8PqSXoUTlWZRdAZo0VXgvEARcujbtTk8kiZRi1uDGRw== + +arrify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/arrify/-/arrify-1.0.1.tgz#898508da2226f380df904728456849c1501a4b0d" + integrity sha512-3CYzex9M9FGQjCGMGyi6/31c8GJbgb0qGyrx5HWxPd0aCwh4cB2YjMb2Xf9UuoogrMrlO9cTqnB5rI5GHZTcUA== + +arrify@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/arrify/-/arrify-2.0.1.tgz#c9655e9331e0abcd588d2a7cad7e9956f66701fa" + integrity sha512-3duEwti880xqi4eAMN8AyR4a0ByT90zoYdLlevfrvU43vb0YZwZVfxOgxWrLXXXpyugL0hNZc9G6BiB5B3nUug== + +asap@^2.0.0: + version "2.0.6" + resolved "https://registry.yarnpkg.com/asap/-/asap-2.0.6.tgz#e50347611d7e690943208bbdafebcbc2fb866d46" + integrity sha512-BSHWgDSAiKs50o2Re8ppvp3seVHXSRM44cdSsT9FfNEUUZLOGWVCsiWaRPWM1Znn+mqZ1OfVZ3z3DWEzSp7hRA== + +asn1.js@^5.4.1: + version "5.4.1" + resolved "https://registry.yarnpkg.com/asn1.js/-/asn1.js-5.4.1.tgz#11a980b84ebb91781ce35b0fdc2ee294e3783f07" + integrity sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA== + dependencies: + bn.js "^4.0.0" + inherits "^2.0.1" + minimalistic-assert "^1.0.0" + safer-buffer "^2.1.0" + +assign-symbols@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/assign-symbols/-/assign-symbols-1.0.0.tgz#59667f41fadd4f20ccbc2bb96b8d4f7f78ec0367" + integrity sha1-WWZ/QfrdTyDMvCu5a41Pf3jsA2c= + +astral-regex@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/astral-regex/-/astral-regex-2.0.0.tgz#483143c567aeed4785759c0865786dc77d7d2e31" + integrity sha512-Z7tMw1ytTXt5jqMcOP+OQteU1VuNK9Y02uuJtKQ1Sv69jXQKKg5cibLwGJow8yzZP+eAc18EmLGPal0bp36rvQ== + +async@^2.6.1: + version "2.6.4" + resolved "https://registry.yarnpkg.com/async/-/async-2.6.4.tgz#706b7ff6084664cd7eae713f6f965433b5504221" + integrity sha512-mzo5dfJYwAn29PeiJ0zvwTo04zj8HDJj0Mn8TD7sno7q12prdbnasKJHhkm2c1LgrhlJ0teaea8860oxi51mGA== + dependencies: + lodash "^4.17.14" + +asynckit@^0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/asynckit/-/asynckit-0.4.0.tgz#c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79" + integrity sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q== + +at-least-node@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/at-least-node/-/at-least-node-1.0.0.tgz#602cd4b46e844ad4effc92a8011a3c46e0238dc2" + integrity sha512-+q/t7Ekv1EDY2l6Gda6LLiX14rU9TV20Wa3ofeQmwPFZbOMo9DXrLbOjFaaclkXKWidIaopwAObQDqwWtGUjqg== + +atob@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/atob/-/atob-2.1.2.tgz#6d9517eb9e030d2436666651e86bd9f6f13533c9" + integrity sha512-Wm6ukoaOGJi/73p/cl2GvLjTI5JM1k/O14isD73YML8StrH/7/lRFgmg8nICZgD3bZZvjwCGxtMOD3wWNAu8cg== + +ava@^3.12.1: + version "3.15.0" + resolved "https://registry.yarnpkg.com/ava/-/ava-3.15.0.tgz#a239658ab1de8a29a243cc902e6b42e4574de2f0" + integrity sha512-HGAnk1SHPk4Sx6plFAUkzV/XC1j9+iQhOzt4vBly18/yo0AV8Oytx7mtJd/CR8igCJ5p160N/Oo/cNJi2uSeWA== + dependencies: + "@concordance/react" "^2.0.0" + acorn "^8.0.4" + acorn-walk "^8.0.0" + ansi-styles "^5.0.0" + arrgv "^1.0.2" + arrify "^2.0.1" + callsites "^3.1.0" + chalk "^4.1.0" + chokidar "^3.4.3" + chunkd "^2.0.1" + ci-info "^2.0.0" + ci-parallel-vars "^1.0.1" + clean-yaml-object "^0.1.0" + cli-cursor "^3.1.0" + cli-truncate "^2.1.0" + code-excerpt "^3.0.0" + common-path-prefix "^3.0.0" + concordance "^5.0.1" + convert-source-map "^1.7.0" + currently-unhandled "^0.4.1" + debug "^4.3.1" + del "^6.0.0" + emittery "^0.8.0" + equal-length "^1.0.0" + figures "^3.2.0" + globby "^11.0.1" + ignore-by-default "^2.0.0" + import-local "^3.0.2" + indent-string "^4.0.0" + is-error "^2.2.2" + is-plain-object "^5.0.0" + is-promise "^4.0.0" + lodash "^4.17.20" + matcher "^3.0.0" + md5-hex "^3.0.1" + mem "^8.0.0" + ms "^2.1.3" + ora "^5.2.0" + p-event "^4.2.0" + p-map "^4.0.0" + picomatch "^2.2.2" + pkg-conf "^3.1.0" + plur "^4.0.0" + pretty-ms "^7.0.1" + read-pkg "^5.2.0" + resolve-cwd "^3.0.0" + slash "^3.0.0" + source-map-support "^0.5.19" + stack-utils "^2.0.3" + strip-ansi "^6.0.0" + supertap "^2.0.0" + temp-dir "^2.0.0" + trim-off-newlines "^1.0.1" + update-notifier "^5.0.1" + write-file-atomic "^3.0.3" + yargs "^16.2.0" + +available-typed-arrays@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/available-typed-arrays/-/available-typed-arrays-1.0.5.tgz#92f95616501069d07d10edb2fc37d3e1c65123b7" + integrity sha512-DMD0KiN46eipeziST1LPP/STfDU0sufISXmjSgvVsoU2tqxctQeASejWcfNtxYKqETM1UxQ8sp2OrSBWpHY6sw== + +balanced-match@^1.0.0: + version "1.0.2" + resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.2.tgz#e83e3a7e3f300b34cb9d87f615fa0cbf357690ee" + integrity sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw== + +base64-js@^1.3.1: + version "1.5.1" + resolved "https://registry.yarnpkg.com/base64-js/-/base64-js-1.5.1.tgz#1b1b440160a5bf7ad40b650f095963481903930a" + integrity sha512-AKpaYlHn8t4SVbOHCy+b5+KKgvR4vrsD8vbvrbiQJps7fKDTkjkDry6ji0rUJjC0kzbNePLwzxq8iypo41qeWA== + +base@^0.11.1: + version "0.11.2" + resolved "https://registry.yarnpkg.com/base/-/base-0.11.2.tgz#7bde5ced145b6d551a90db87f83c558b4eb48a8f" + integrity sha512-5T6P4xPgpp0YDFvSWwEZ4NoE3aM4QBQXDzmVbraCkFj8zHM+mba8SyqB5DbZWyR7mYHo6Y7BdQo3MoA4m0TeQg== + dependencies: + cache-base "^1.0.1" + class-utils "^0.3.5" + component-emitter "^1.2.1" + define-property "^1.0.0" + isobject "^3.0.1" + mixin-deep "^1.2.0" + pascalcase "^0.1.1" + +binary-extensions@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/binary-extensions/-/binary-extensions-2.1.0.tgz#30fa40c9e7fe07dbc895678cd287024dea241dd9" + integrity sha512-1Yj8h9Q+QDF5FzhMs/c9+6UntbD5MkRfRwac8DoEm9ZfUBZ7tZ55YcGVAzEe4bXsdQHEk+s9S5wsOKVdZrw0tQ== + +bl@^4.0.3: + version "4.0.3" + resolved "https://registry.yarnpkg.com/bl/-/bl-4.0.3.tgz#12d6287adc29080e22a705e5764b2a9522cdc489" + integrity sha512-fs4G6/Hu4/EE+F75J8DuN/0IpQqNjAdC7aEQv7Qt8MHGUH7Ckv2MwTEEeN9QehD0pfIDkMI1bkHYkKy7xHyKIg== + dependencies: + buffer "^5.5.0" + inherits "^2.0.4" + readable-stream "^3.4.0" + +blueimp-md5@^2.10.0: + version "2.18.0" + resolved "https://registry.yarnpkg.com/blueimp-md5/-/blueimp-md5-2.18.0.tgz#1152be1335f0c6b3911ed9e36db54f3e6ac52935" + integrity sha512-vE52okJvzsVWhcgUHOv+69OG3Mdg151xyn41aVQN/5W5S+S43qZhxECtYLAEHMSFWX6Mv5IZrzj3T5+JqXfj5Q== + +bn.js@^4.0.0: + version "4.12.0" + resolved "https://registry.yarnpkg.com/bn.js/-/bn.js-4.12.0.tgz#775b3f278efbb9718eec7361f483fb36fbbfea88" + integrity sha512-c98Bf3tPniI+scsdk237ku1Dc3ujXQTSgyiPUDEOe7tRkhrqridvh8klBv0HCEso1OLOYcHuCv/cS6DNxKH+ZA== + +body-parser@1.20.1: + version "1.20.1" + resolved "https://registry.yarnpkg.com/body-parser/-/body-parser-1.20.1.tgz#b1812a8912c195cd371a3ee5e66faa2338a5c668" + integrity sha512-jWi7abTbYwajOytWCQc37VulmWiRae5RyTpaCyDcS5/lMdtwSz5lOpDE67srw/HYe35f1z3fDQw+3txg7gNtWw== + dependencies: + bytes "3.1.2" + content-type "~1.0.4" + debug "2.6.9" + depd "2.0.0" + destroy "1.2.0" + http-errors "2.0.0" + iconv-lite "0.4.24" + on-finished "2.4.1" + qs "6.11.0" + raw-body "2.5.1" + type-is "~1.6.18" + unpipe "1.0.0" + +boxen@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/boxen/-/boxen-4.2.0.tgz#e411b62357d6d6d36587c8ac3d5d974daa070e64" + integrity sha512-eB4uT9RGzg2odpER62bBwSLvUeGC+WbRjjyyFhGsKnc8wp/m0+hQsMUvUe3H2V0D5vw0nBdO1hCJoZo5mKeuIQ== + dependencies: + ansi-align "^3.0.0" + camelcase "^5.3.1" + chalk "^3.0.0" + cli-boxes "^2.2.0" + string-width "^4.1.0" + term-size "^2.1.0" + type-fest "^0.8.1" + widest-line "^3.1.0" + +brace-expansion@^1.1.7: + version "1.1.11" + resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" + integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA== + dependencies: + balanced-match "^1.0.0" + concat-map "0.0.1" + +braces@^2.3.1: + version "2.3.2" + resolved "https://registry.yarnpkg.com/braces/-/braces-2.3.2.tgz#5979fd3f14cd531565e5fa2df1abfff1dfaee729" + integrity sha512-aNdbnj9P8PjdXU4ybaWLK2IF3jc/EoDYbC7AazW6to3TRsfXxscC9UXOB5iDiEQrkyIbWp2SLQda4+QAa7nc3w== + dependencies: + arr-flatten "^1.1.0" + array-unique "^0.3.2" + extend-shallow "^2.0.1" + fill-range "^4.0.0" + isobject "^3.0.1" + repeat-element "^1.1.2" + snapdragon "^0.8.1" + snapdragon-node "^2.0.1" + split-string "^3.0.2" + to-regex "^3.0.1" + +braces@^3.0.2, braces@~3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/braces/-/braces-3.0.2.tgz#3454e1a462ee8d599e236df336cd9ea4f8afe107" + integrity sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A== + dependencies: + fill-range "^7.0.1" + +bson@^5.5.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/bson/-/bson-5.5.0.tgz#a419cc69f368d2def3b8b22ea03ed1c9be40e53f" + integrity sha512-B+QB4YmDx9RStKv8LLSl/aVIEV3nYJc3cJNNTK2Cd1TL+7P+cNpw9mAPeCgc5K+j01Dv6sxUzcITXDx7ZU3F0w== + +buffer-from@^1.0.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/buffer-from/-/buffer-from-1.1.2.tgz#2b146a6fd72e80b4f55d255f35ed59a3a9a41bd5" + integrity sha512-E+XQCRwSbaaiChtv6k6Dwgc+bx+Bs6vuKJHHl5kox/BaKbhiXzqQOwK4cO22yElGp2OCmjwVhT3HmxgyPGnJfQ== + +buffer@^5.5.0: + version "5.7.1" + resolved "https://registry.yarnpkg.com/buffer/-/buffer-5.7.1.tgz#ba62e7c13133053582197160851a8f648e99eed0" + integrity sha512-EHcyIPBQ4BSGlvjB16k5KgAJ27CIsHY/2JBmCRReo48y9rQ3MaUzWX3KVlBa4U7MyX02HdVj0K7C3WaB3ju7FQ== + dependencies: + base64-js "^1.3.1" + ieee754 "^1.1.13" + +bytes@3.1.2: + version "3.1.2" + resolved "https://registry.yarnpkg.com/bytes/-/bytes-3.1.2.tgz#8b0beeb98605adf1b128fa4386403c009e0221a5" + integrity sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg== + +cache-base@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/cache-base/-/cache-base-1.0.1.tgz#0a7f46416831c8b662ee36fe4e7c59d76f666ab2" + integrity sha512-AKcdTnFSWATd5/GCPRxr2ChwIJ85CeyrEyjRHlKxQ56d4XJMGym0uAiKn0xbLOGOl3+yRpOTi484dVCEc5AUzQ== + dependencies: + collection-visit "^1.0.0" + component-emitter "^1.2.1" + get-value "^2.0.6" + has-value "^1.0.0" + isobject "^3.0.1" + set-value "^2.0.0" + to-object-path "^0.3.0" + union-value "^1.0.0" + unset-value "^1.0.0" + +cacheable-request@^6.0.0: + version "6.1.0" + resolved "https://registry.yarnpkg.com/cacheable-request/-/cacheable-request-6.1.0.tgz#20ffb8bd162ba4be11e9567d823db651052ca912" + integrity sha512-Oj3cAGPCqOZX7Rz64Uny2GYAZNliQSqfbePrgAQ1wKAihYmCUnraBtJtKcGR4xz7wF+LoJC+ssFZvv5BgF9Igg== + dependencies: + clone-response "^1.0.2" + get-stream "^5.1.0" + http-cache-semantics "^4.0.0" + keyv "^3.0.0" + lowercase-keys "^2.0.0" + normalize-url "^4.1.0" + responselike "^1.0.2" + +cachedir@2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/cachedir/-/cachedir-2.2.0.tgz#19afa4305e05d79e417566882e0c8f960f62ff0e" + integrity sha512-VvxA0xhNqIIfg0V9AmJkDg91DaJwryutH5rVEZAhcNi4iJFj9f+QxmAjgK1LT9I8OgToX27fypX6/MeCXVbBjQ== + +caching-transform@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/caching-transform/-/caching-transform-4.0.0.tgz#00d297a4206d71e2163c39eaffa8157ac0651f0f" + integrity sha512-kpqOvwXnjjN44D89K5ccQC+RUrsy7jB/XLlRrx0D7/2HNcTPqzsb6XgYoErwko6QsV184CA2YgS1fxDiiDZMWA== + dependencies: + hasha "^5.0.0" + make-dir "^3.0.0" + package-hash "^4.0.0" + write-file-atomic "^3.0.0" + +call-bind@^1.0.0, call-bind@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/call-bind/-/call-bind-1.0.2.tgz#b1d4e89e688119c3c9a903ad30abb2f6a919be3c" + integrity sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA== + dependencies: + function-bind "^1.1.1" + get-intrinsic "^1.0.2" + +callsites@^3.0.0, callsites@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/callsites/-/callsites-3.1.0.tgz#b3630abd8943432f54b3f0519238e33cd7df2f73" + integrity sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ== + +camelcase-keys@^6.2.2: + version "6.2.2" + resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-6.2.2.tgz#5e755d6ba51aa223ec7d3d52f25778210f9dc3c0" + integrity sha512-YrwaA0vEKazPBkn0ipTiMpSajYDSe+KjQfrjhcBMxJt/znbvlHd8Pw/Vamaz5EB4Wfhs3SUR3Z9mwRu/P3s3Yg== + dependencies: + camelcase "^5.3.1" + map-obj "^4.0.0" + quick-lru "^4.0.1" + +camelcase@^5.0.0, camelcase@^5.3.1: + version "5.3.1" + resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-5.3.1.tgz#e3c9b31569e106811df242f715725a1f4c494320" + integrity sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg== + +chalk@4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.0.tgz#4e14870a618d9e2edd97dd8345fd9d9dc315646a" + integrity sha512-qwx12AxXe2Q5xQ43Ac//I6v5aXTipYrSESdOgzrN+9XjgEpyjpKuvSGaN4qE93f7TQTlerQQ8S+EQ0EyDoVL1A== + dependencies: + ansi-styles "^4.1.0" + supports-color "^7.1.0" + +chalk@^2.0.0, chalk@^2.4.1, chalk@^2.4.2: + version "2.4.2" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-2.4.2.tgz#cd42541677a54333cf541a49108c1432b44c9424" + integrity sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ== + dependencies: + ansi-styles "^3.2.1" + escape-string-regexp "^1.0.5" + supports-color "^5.3.0" + +chalk@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-3.0.0.tgz#3f73c2bf526591f574cc492c51e2456349f844e4" + integrity sha512-4D3B6Wf41KOYRFdszmDqMCGq5VV/uMAB273JILmO+3jAlh8X4qDtdtgCR3fxtbLEMzSx22QdhnDcJvu2u1fVwg== + dependencies: + ansi-styles "^4.1.0" + supports-color "^7.1.0" + +chalk@^4.0.0, chalk@^4.1.0: + version "4.1.2" + resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01" + integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA== + dependencies: + ansi-styles "^4.1.0" + supports-color "^7.1.0" + +chardet@^0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/chardet/-/chardet-0.7.0.tgz#90094849f0937f2eedc2425d0d28a9e5f0cbad9e" + integrity sha512-mT8iDcrh03qDGRRmoA2hmBJnxpllMR+0/0qlzjqZES6NdiWDcZkCNAk4rPFZ9Q85r27unkiNNg8ZOiwZXBHwcA== + +chokidar@^3.4.3: + version "3.5.0" + resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-3.5.0.tgz#458a4816a415e9d3b3caa4faec2b96a6935a9e65" + integrity sha512-JgQM9JS92ZbFR4P90EvmzNpSGhpPBGBSj10PILeDyYFwp4h2/D9OM03wsJ4zW1fEp4ka2DGrnUeD7FuvQ2aZ2Q== + dependencies: + anymatch "~3.1.1" + braces "~3.0.2" + glob-parent "~5.1.0" + is-binary-path "~2.1.0" + is-glob "~4.0.1" + normalize-path "~3.0.0" + readdirp "~3.5.0" + optionalDependencies: + fsevents "~2.3.1" + +chunkd@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/chunkd/-/chunkd-2.0.1.tgz#49cd1d7b06992dc4f7fccd962fe2a101ee7da920" + integrity sha512-7d58XsFmOq0j6el67Ug9mHf9ELUXsQXYJBkyxhH/k+6Ke0qXRnv0kbemx+Twc6fRJ07C49lcbdgm9FL1Ei/6SQ== + +ci-info@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ci-info/-/ci-info-2.0.0.tgz#67a9e964be31a51e15e5010d58e6f12834002f46" + integrity sha512-5tK7EtrZ0N+OLFMthtqOj4fI2Jeb88C4CAZPu25LDVUgXJ0A3Js4PMGqrn0JU1W0Mh1/Z8wZzYPxqUrXeBboCQ== + +ci-parallel-vars@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/ci-parallel-vars/-/ci-parallel-vars-1.0.1.tgz#e87ff0625ccf9d286985b29b4ada8485ca9ffbc2" + integrity sha512-uvzpYrpmidaoxvIQHM+rKSrigjOe9feHYbw4uOI2gdfe1C3xIlxO+kVXq83WQWNniTf8bAxVpy+cQeFQsMERKg== + +class-utils@^0.3.5: + version "0.3.6" + resolved "https://registry.yarnpkg.com/class-utils/-/class-utils-0.3.6.tgz#f93369ae8b9a7ce02fd41faad0ca83033190c463" + integrity sha512-qOhPa/Fj7s6TY8H8esGu5QNpMMQxz79h+urzrNYN6mn+9BnxlDGf5QZ+XeCDsxSjPqsSR56XOZOJmpeurnLMeg== + dependencies: + arr-union "^3.1.0" + define-property "^0.2.5" + isobject "^3.0.0" + static-extend "^0.1.1" + +clean-stack@^2.0.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/clean-stack/-/clean-stack-2.2.0.tgz#ee8472dbb129e727b31e8a10a427dee9dfe4008b" + integrity sha512-4diC9HaTE+KRAMWhDhrGOECgWZxoevMc5TlkObMqNSsVU62PYzXZ/SMTjzyGAFF1YusgxGcSWTEXBhp0CPwQ1A== + +clean-yaml-object@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/clean-yaml-object/-/clean-yaml-object-0.1.0.tgz#63fb110dc2ce1a84dc21f6d9334876d010ae8b68" + integrity sha1-Y/sRDcLOGoTcIfbZM0h20BCui2g= + +cli-boxes@^2.2.0: + version "2.2.1" + resolved "https://registry.yarnpkg.com/cli-boxes/-/cli-boxes-2.2.1.tgz#ddd5035d25094fce220e9cab40a45840a440318f" + integrity sha512-y4coMcylgSCdVinjiDBuR8PCC2bLjyGTwEmPb9NHR/QaNU6EUOXcTY/s6VjGMD6ENSEaeQYHCY0GNGS5jfMwPw== + +cli-cursor@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-2.1.0.tgz#b35dac376479facc3e94747d41d0d0f5238ffcb5" + integrity sha1-s12sN2R5+sw+lHR9QdDQ9SOP/LU= + dependencies: + restore-cursor "^2.0.0" + +cli-cursor@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/cli-cursor/-/cli-cursor-3.1.0.tgz#264305a7ae490d1d03bf0c9ba7c925d1753af307" + integrity sha512-I/zHAwsKf9FqGoXM4WWRACob9+SNukZTd94DWF57E4toouRulbCxcUh6RKUEOQlYTHJnzkPMySvPNaaSLNfLZw== + dependencies: + restore-cursor "^3.1.0" + +cli-spinners@^2.5.0: + version "2.5.0" + resolved "https://registry.yarnpkg.com/cli-spinners/-/cli-spinners-2.5.0.tgz#12763e47251bf951cb75c201dfa58ff1bcb2d047" + integrity sha512-PC+AmIuK04E6aeSs/pUccSujsTzBhu4HzC2dL+CfJB/Jcc2qTRbEwZQDfIUpt2Xl8BodYBEq8w4fc0kU2I9DjQ== + +cli-truncate@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/cli-truncate/-/cli-truncate-2.1.0.tgz#c39e28bf05edcde5be3b98992a22deed5a2b93c7" + integrity sha512-n8fOixwDD6b/ObinzTrp1ZKFzbgvKZvuz/TvejnLn1aQfC6r52XEx85FmuC+3HI+JM7coBRXUvNqEU2PHVrHpg== + dependencies: + slice-ansi "^3.0.0" + string-width "^4.2.0" + +cli-width@^2.0.0: + version "2.2.1" + resolved "https://registry.yarnpkg.com/cli-width/-/cli-width-2.2.1.tgz#b0433d0b4e9c847ef18868a4ef16fd5fc8271c48" + integrity sha512-GRMWDxpOB6Dgk2E5Uo+3eEBvtOOlimMmpbFiKuLFnQzYDavtLFY3K5ona41jgN/WdRZtG7utuVSVTL4HbZHGkw== + +cliui@^6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-6.0.0.tgz#511d702c0c4e41ca156d7d0e96021f23e13225b1" + integrity sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ== + dependencies: + string-width "^4.2.0" + strip-ansi "^6.0.0" + wrap-ansi "^6.2.0" + +cliui@^7.0.2: + version "7.0.4" + resolved "https://registry.yarnpkg.com/cliui/-/cliui-7.0.4.tgz#a0265ee655476fc807aea9df3df8df7783808b4f" + integrity sha512-OcRE68cOsVMXp1Yvonl/fzkQOyjLSu/8bhPDfQt0e0/Eb283TKP20Fs2MqoPsr9SwA595rRCA+QMzYc9nBP+JQ== + dependencies: + string-width "^4.2.0" + strip-ansi "^6.0.0" + wrap-ansi "^7.0.0" + +clone-response@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/clone-response/-/clone-response-1.0.2.tgz#d1dc973920314df67fbeb94223b4ee350239e96b" + integrity sha1-0dyXOSAxTfZ/vrlCI7TuNQI56Ws= + dependencies: + mimic-response "^1.0.0" + +clone@^1.0.2: + version "1.0.4" + resolved "https://registry.yarnpkg.com/clone/-/clone-1.0.4.tgz#da309cc263df15994c688ca902179ca3c7cd7c7e" + integrity sha1-2jCcwmPfFZlMaIypAheco8fNfH4= + +code-excerpt@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/code-excerpt/-/code-excerpt-3.0.0.tgz#fcfb6748c03dba8431c19f5474747fad3f250f10" + integrity sha512-VHNTVhd7KsLGOqfX3SyeO8RyYPMp1GJOg194VITk04WMYCv4plV68YWe6TJZxd9MhobjtpMRnVky01gqZsalaw== + dependencies: + convert-to-spaces "^1.0.1" + +codecov@^3.5.0: + version "3.8.3" + resolved "https://registry.yarnpkg.com/codecov/-/codecov-3.8.3.tgz#9c3e364b8a700c597346ae98418d09880a3fdbe7" + integrity sha512-Y8Hw+V3HgR7V71xWH2vQ9lyS358CbGCldWlJFR0JirqoGtOoas3R3/OclRTvgUYFK29mmJICDPauVKmpqbwhOA== + dependencies: + argv "0.0.2" + ignore-walk "3.0.4" + js-yaml "3.14.1" + teeny-request "7.1.1" + urlgrey "1.0.0" + +collection-visit@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/collection-visit/-/collection-visit-1.0.0.tgz#4bc0373c164bc3291b4d368c829cf1a80a59dca0" + integrity sha1-S8A3PBZLwykbTTaMgpzxqApZ3KA= + dependencies: + map-visit "^1.0.0" + object-visit "^1.0.0" + +color-convert@^1.9.0: + version "1.9.3" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-1.9.3.tgz#bb71850690e1f136567de629d2d5471deda4c1e8" + integrity sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg== + dependencies: + color-name "1.1.3" + +color-convert@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3" + integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ== + dependencies: + color-name "~1.1.4" + +color-name@1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.3.tgz#a7d0558bd89c42f795dd42328f740831ca53bc25" + integrity sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw== + +color-name@~1.1.4: + version "1.1.4" + resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2" + integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA== + +combined-stream@^1.0.8: + version "1.0.8" + resolved "https://registry.yarnpkg.com/combined-stream/-/combined-stream-1.0.8.tgz#c3d45a8b34fd730631a110a8a2520682b31d5a7f" + integrity sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg== + dependencies: + delayed-stream "~1.0.0" + +commander@^2.18.0: + version "2.20.3" + resolved "https://registry.yarnpkg.com/commander/-/commander-2.20.3.tgz#fd485e84c03eb4881c20722ba48035e8531aeb33" + integrity sha512-GpVkmM8vF2vQUkj2LvZmD35JxeJOLCwJ9cUkugyk2nuhbv3+mJvpLYYt+0+USMxE+oj+ey/lJEnhZw75x/OMcQ== + +commander@^6.2.0: + version "6.2.1" + resolved "https://registry.yarnpkg.com/commander/-/commander-6.2.1.tgz#0792eb682dfbc325999bb2b84fddddba110ac73c" + integrity sha512-U7VdrJFnJgo4xjrHpTzu0yrHPGImdsmD95ZlgYSEajAn2JKzDhDTPG9kBTefmObL2w/ngeZnilk+OV9CG3d7UA== + +commander@^7.0.0: + version "7.2.0" + resolved "https://registry.yarnpkg.com/commander/-/commander-7.2.0.tgz#a36cb57d0b501ce108e4d20559a150a391d97ab7" + integrity sha512-QrWXB+ZQSVPmIWIhtEO9H+gwHaMGYiF5ChvoJ+K9ZGHG/sVsa6yiesAD1GC/x46sET00Xlwo1u49RVVVzvcSkw== + +comment-json@^4.0.6, comment-json@^4.1.0: + version "4.2.3" + resolved "https://registry.yarnpkg.com/comment-json/-/comment-json-4.2.3.tgz#50b487ebbf43abe44431f575ebda07d30d015365" + integrity sha512-SsxdiOf064DWoZLH799Ata6u7iV658A11PlWtZATDlXPpKGJnbJZ5Z24ybixAi+LUUqJ/GKowAejtC5GFUG7Tw== + dependencies: + array-timsort "^1.0.3" + core-util-is "^1.0.3" + esprima "^4.0.1" + has-own-prop "^2.0.0" + repeat-string "^1.6.1" + +commitizen@^4.0.3: + version "4.2.2" + resolved "https://registry.yarnpkg.com/commitizen/-/commitizen-4.2.2.tgz#1a93dd07208521ea1ebbf832593542dac714cc79" + integrity sha512-uz+E6lGsDBDI2mYA4QfOxFeqdWUYwR1ky11YmLgg2BnEEP3YbeejpT4lxzGjkYqumnXr062qTOGavR9NtX/iwQ== + dependencies: + cachedir "2.2.0" + cz-conventional-changelog "3.3.0" + dedent "0.7.0" + detect-indent "6.0.0" + find-node-modules "2.0.0" + find-root "1.1.0" + fs-extra "8.1.0" + glob "7.1.4" + inquirer "6.5.2" + is-utf8 "^0.2.1" + lodash "^4.17.20" + minimist "1.2.5" + strip-bom "4.0.0" + strip-json-comments "3.0.1" + +common-path-prefix@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/common-path-prefix/-/common-path-prefix-3.0.0.tgz#7d007a7e07c58c4b4d5f433131a19141b29f11e0" + integrity sha512-QE33hToZseCH3jS0qN96O/bSh3kaw/h+Tq7ngyY9eWDUnTlTNUyqfqvCXioLe5Na5jFsL78ra/wuBU4iuEgd4w== + +commondir@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/commondir/-/commondir-1.0.1.tgz#ddd800da0c66127393cca5950ea968a3aaf1253b" + integrity sha512-W9pAhw0ja1Edb5GVdIF1mjZw/ASI0AlShXM83UUGe2DVr5TdAPEA1OA8m/g8zWp9x6On7gqufY+FatDbC3MDQg== + +compare-func@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/compare-func/-/compare-func-2.0.0.tgz#fb65e75edbddfd2e568554e8b5b05fff7a51fcb3" + integrity sha512-zHig5N+tPWARooBnb0Zx1MFcdfpyJrfTJ3Y5L+IFvUm8rM74hHz66z0gw0x4tijh5CorKkKUCnW82R2vmpeCRA== + dependencies: + array-ify "^1.0.0" + dot-prop "^5.1.0" + +compare-versions@^3.6.0: + version "3.6.0" + resolved "https://registry.yarnpkg.com/compare-versions/-/compare-versions-3.6.0.tgz#1a5689913685e5a87637b8d3ffca75514ec41d62" + integrity sha512-W6Af2Iw1z4CB7q4uU4hv646dW9GQuBM+YpC0UvUCWSD8w90SJjp+ujJuXaEMtAXBtSqGfMPuFOVn4/+FlaqfBA== + +component-emitter@^1.2.1, component-emitter@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/component-emitter/-/component-emitter-1.3.0.tgz#16e4070fba8ae29b679f2215853ee181ab2eabc0" + integrity sha512-Rd3se6QB+sO1TwqZjscQrurpEPIfO0/yYnSin6Q/rD3mOutHvUrCAhJub3r90uNb+SESBuE0QYoB90YdfatsRg== + +concat-map@0.0.1: + version "0.0.1" + resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" + integrity sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg== + +concat-stream@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/concat-stream/-/concat-stream-2.0.0.tgz#414cf5af790a48c60ab9be4527d56d5e41133cb1" + integrity sha512-MWufYdFw53ccGjCA+Ol7XJYpAlW6/prSMzuPOTRnJGcGzuhLn4Scrz7qf6o8bROZ514ltazcIFJZevcfbo0x7A== + dependencies: + buffer-from "^1.0.0" + inherits "^2.0.3" + readable-stream "^3.0.2" + typedarray "^0.0.6" + +concordance@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/concordance/-/concordance-5.0.1.tgz#7a248aca8b286125d1d76f77b03320acf3f4ac63" + integrity sha512-TbNtInKVElgEBnJ1v2Xg+MFX2lvFLbmlv3EuSC5wTfCwpB8kC3w3mffF6cKuUhkn475Ym1f1I4qmuXzx2+uXpw== + dependencies: + date-time "^3.1.0" + esutils "^2.0.3" + fast-diff "^1.2.0" + js-string-escape "^1.0.1" + lodash "^4.17.15" + md5-hex "^3.0.1" + semver "^7.3.2" + well-known-symbols "^2.0.0" + +configstore@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/configstore/-/configstore-5.0.1.tgz#d365021b5df4b98cdd187d6a3b0e3f6a7cc5ed96" + integrity sha512-aMKprgk5YhBNyH25hj8wGt2+D52Sw1DRRIzqBwLp2Ya9mFmY8KPvvtvmna8SxVR9JMZ4kzMD68N22vlaRpkeFA== + dependencies: + dot-prop "^5.2.0" + graceful-fs "^4.1.2" + make-dir "^3.0.0" + unique-string "^2.0.0" + write-file-atomic "^3.0.0" + xdg-basedir "^4.0.0" + +content-disposition@0.5.4: + version "0.5.4" + resolved "https://registry.yarnpkg.com/content-disposition/-/content-disposition-0.5.4.tgz#8b82b4efac82512a02bb0b1dcec9d2c5e8eb5bfe" + integrity sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ== + dependencies: + safe-buffer "5.2.1" + +content-type@~1.0.4: + version "1.0.5" + resolved "https://registry.yarnpkg.com/content-type/-/content-type-1.0.5.tgz#8b773162656d1d1086784c8f23a54ce6d73d7918" + integrity sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA== + +conventional-changelog-angular@^5.0.0: + version "5.0.12" + resolved "https://registry.yarnpkg.com/conventional-changelog-angular/-/conventional-changelog-angular-5.0.12.tgz#c979b8b921cbfe26402eb3da5bbfda02d865a2b9" + integrity sha512-5GLsbnkR/7A89RyHLvvoExbiGbd9xKdKqDTrArnPbOqBqG/2wIosu0fHwpeIRI8Tl94MhVNBXcLJZl92ZQ5USw== + dependencies: + compare-func "^2.0.0" + q "^1.5.1" + +conventional-changelog-angular@^5.0.12: + version "5.0.13" + resolved "https://registry.yarnpkg.com/conventional-changelog-angular/-/conventional-changelog-angular-5.0.13.tgz#896885d63b914a70d4934b59d2fe7bde1832b28c" + integrity sha512-i/gipMxs7s8L/QeuavPF2hLnJgH6pEZAttySB6aiQLWcX3puWDL3ACVmvBhJGxnAy52Qc15ua26BufY6KpmrVA== + dependencies: + compare-func "^2.0.0" + q "^1.5.1" + +conventional-changelog-atom@^2.0.8: + version "2.0.8" + resolved "https://registry.yarnpkg.com/conventional-changelog-atom/-/conventional-changelog-atom-2.0.8.tgz#a759ec61c22d1c1196925fca88fe3ae89fd7d8de" + integrity sha512-xo6v46icsFTK3bb7dY/8m2qvc8sZemRgdqLb/bjpBsH2UyOS8rKNTgcb5025Hri6IpANPApbXMg15QLb1LJpBw== + dependencies: + q "^1.5.1" + +conventional-changelog-codemirror@^2.0.8: + version "2.0.8" + resolved "https://registry.yarnpkg.com/conventional-changelog-codemirror/-/conventional-changelog-codemirror-2.0.8.tgz#398e9530f08ce34ec4640af98eeaf3022eb1f7dc" + integrity sha512-z5DAsn3uj1Vfp7po3gpt2Boc+Bdwmw2++ZHa5Ak9k0UKsYAO5mH1UBTN0qSCuJZREIhX6WU4E1p3IW2oRCNzQw== + dependencies: + q "^1.5.1" + +conventional-changelog-config-spec@2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/conventional-changelog-config-spec/-/conventional-changelog-config-spec-2.1.0.tgz#874a635287ef8b581fd8558532bf655d4fb59f2d" + integrity sha512-IpVePh16EbbB02V+UA+HQnnPIohgXvJRxHcS5+Uwk4AT5LjzCZJm5sp/yqs5C6KZJ1jMsV4paEV13BN1pvDuxQ== + +conventional-changelog-conventionalcommits@4.6.3, conventional-changelog-conventionalcommits@^4.5.0: + version "4.6.3" + resolved "https://registry.yarnpkg.com/conventional-changelog-conventionalcommits/-/conventional-changelog-conventionalcommits-4.6.3.tgz#0765490f56424b46f6cb4db9135902d6e5a36dc2" + integrity sha512-LTTQV4fwOM4oLPad317V/QNQ1FY4Hju5qeBIM1uTHbrnCE+Eg4CdRZ3gO2pUeR+tzWdp80M2j3qFFEDWVqOV4g== + dependencies: + compare-func "^2.0.0" + lodash "^4.17.15" + q "^1.5.1" + +conventional-changelog-conventionalcommits@^4.3.1: + version "4.5.0" + resolved "https://registry.yarnpkg.com/conventional-changelog-conventionalcommits/-/conventional-changelog-conventionalcommits-4.5.0.tgz#a02e0b06d11d342fdc0f00c91d78265ed0bc0a62" + integrity sha512-buge9xDvjjOxJlyxUnar/+6i/aVEVGA7EEh4OafBCXPlLUQPGbRUBhBUveWRxzvR8TEjhKEP4BdepnpG2FSZXw== + dependencies: + compare-func "^2.0.0" + lodash "^4.17.15" + q "^1.5.1" + +conventional-changelog-core@^4.2.1: + version "4.2.4" + resolved "https://registry.yarnpkg.com/conventional-changelog-core/-/conventional-changelog-core-4.2.4.tgz#e50d047e8ebacf63fac3dc67bf918177001e1e9f" + integrity sha512-gDVS+zVJHE2v4SLc6B0sLsPiloR0ygU7HaDW14aNJE1v4SlqJPILPl/aJC7YdtRE4CybBf8gDwObBvKha8Xlyg== + dependencies: + add-stream "^1.0.0" + conventional-changelog-writer "^5.0.0" + conventional-commits-parser "^3.2.0" + dateformat "^3.0.0" + get-pkg-repo "^4.0.0" + git-raw-commits "^2.0.8" + git-remote-origin-url "^2.0.0" + git-semver-tags "^4.1.1" + lodash "^4.17.15" + normalize-package-data "^3.0.0" + q "^1.5.1" + read-pkg "^3.0.0" + read-pkg-up "^3.0.0" + through2 "^4.0.0" + +conventional-changelog-ember@^2.0.9: + version "2.0.9" + resolved "https://registry.yarnpkg.com/conventional-changelog-ember/-/conventional-changelog-ember-2.0.9.tgz#619b37ec708be9e74a220f4dcf79212ae1c92962" + integrity sha512-ulzIReoZEvZCBDhcNYfDIsLTHzYHc7awh+eI44ZtV5cx6LVxLlVtEmcO+2/kGIHGtw+qVabJYjdI5cJOQgXh1A== + dependencies: + q "^1.5.1" + +conventional-changelog-eslint@^3.0.9: + version "3.0.9" + resolved "https://registry.yarnpkg.com/conventional-changelog-eslint/-/conventional-changelog-eslint-3.0.9.tgz#689bd0a470e02f7baafe21a495880deea18b7cdb" + integrity sha512-6NpUCMgU8qmWmyAMSZO5NrRd7rTgErjrm4VASam2u5jrZS0n38V7Y9CzTtLT2qwz5xEChDR4BduoWIr8TfwvXA== + dependencies: + q "^1.5.1" + +conventional-changelog-express@^2.0.6: + version "2.0.6" + resolved "https://registry.yarnpkg.com/conventional-changelog-express/-/conventional-changelog-express-2.0.6.tgz#420c9d92a347b72a91544750bffa9387665a6ee8" + integrity sha512-SDez2f3iVJw6V563O3pRtNwXtQaSmEfTCaTBPCqn0oG0mfkq0rX4hHBq5P7De2MncoRixrALj3u3oQsNK+Q0pQ== + dependencies: + q "^1.5.1" + +conventional-changelog-jquery@^3.0.11: + version "3.0.11" + resolved "https://registry.yarnpkg.com/conventional-changelog-jquery/-/conventional-changelog-jquery-3.0.11.tgz#d142207400f51c9e5bb588596598e24bba8994bf" + integrity sha512-x8AWz5/Td55F7+o/9LQ6cQIPwrCjfJQ5Zmfqi8thwUEKHstEn4kTIofXub7plf1xvFA2TqhZlq7fy5OmV6BOMw== + dependencies: + q "^1.5.1" + +conventional-changelog-jshint@^2.0.9: + version "2.0.9" + resolved "https://registry.yarnpkg.com/conventional-changelog-jshint/-/conventional-changelog-jshint-2.0.9.tgz#f2d7f23e6acd4927a238555d92c09b50fe3852ff" + integrity sha512-wMLdaIzq6TNnMHMy31hql02OEQ8nCQfExw1SE0hYL5KvU+JCTuPaDO+7JiogGT2gJAxiUGATdtYYfh+nT+6riA== + dependencies: + compare-func "^2.0.0" + q "^1.5.1" + +conventional-changelog-preset-loader@^2.3.4: + version "2.3.4" + resolved "https://registry.yarnpkg.com/conventional-changelog-preset-loader/-/conventional-changelog-preset-loader-2.3.4.tgz#14a855abbffd59027fd602581f1f34d9862ea44c" + integrity sha512-GEKRWkrSAZeTq5+YjUZOYxdHq+ci4dNwHvpaBC3+ENalzFWuCWa9EZXSuZBpkr72sMdKB+1fyDV4takK1Lf58g== + +conventional-changelog-writer@^5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/conventional-changelog-writer/-/conventional-changelog-writer-5.0.1.tgz#e0757072f045fe03d91da6343c843029e702f359" + integrity sha512-5WsuKUfxW7suLblAbFnxAcrvf6r+0b7GvNaWUwUIk0bXMnENP/PEieGKVUQrjPqwPT4o3EPAASBXiY6iHooLOQ== + dependencies: + conventional-commits-filter "^2.0.7" + dateformat "^3.0.0" + handlebars "^4.7.7" + json-stringify-safe "^5.0.1" + lodash "^4.17.15" + meow "^8.0.0" + semver "^6.0.0" + split "^1.0.0" + through2 "^4.0.0" + +conventional-changelog@3.1.25: + version "3.1.25" + resolved "https://registry.yarnpkg.com/conventional-changelog/-/conventional-changelog-3.1.25.tgz#3e227a37d15684f5aa1fb52222a6e9e2536ccaff" + integrity sha512-ryhi3fd1mKf3fSjbLXOfK2D06YwKNic1nC9mWqybBHdObPd8KJ2vjaXZfYj1U23t+V8T8n0d7gwnc9XbIdFbyQ== + dependencies: + conventional-changelog-angular "^5.0.12" + conventional-changelog-atom "^2.0.8" + conventional-changelog-codemirror "^2.0.8" + conventional-changelog-conventionalcommits "^4.5.0" + conventional-changelog-core "^4.2.1" + conventional-changelog-ember "^2.0.9" + conventional-changelog-eslint "^3.0.9" + conventional-changelog-express "^2.0.6" + conventional-changelog-jquery "^3.0.11" + conventional-changelog-jshint "^2.0.9" + conventional-changelog-preset-loader "^2.3.4" + +conventional-commit-types@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/conventional-commit-types/-/conventional-commit-types-3.0.0.tgz#7c9214e58eae93e85dd66dbfbafe7e4fffa2365b" + integrity sha512-SmmCYnOniSsAa9GqWOeLqc179lfr5TRu5b4QFDkbsrJ5TZjPJx85wtOr3zn+1dbeNiXDKGPbZ72IKbPhLXh/Lg== + +conventional-commits-filter@^2.0.7: + version "2.0.7" + resolved "https://registry.yarnpkg.com/conventional-commits-filter/-/conventional-commits-filter-2.0.7.tgz#f8d9b4f182fce00c9af7139da49365b136c8a0b3" + integrity sha512-ASS9SamOP4TbCClsRHxIHXRfcGCnIoQqkvAzCSbZzTFLfcTqJVugB0agRgsEELsqaeWgsXv513eS116wnlSSPA== + dependencies: + lodash.ismatch "^4.4.0" + modify-values "^1.0.0" + +conventional-commits-parser@^3.0.0: + version "3.2.1" + resolved "https://registry.yarnpkg.com/conventional-commits-parser/-/conventional-commits-parser-3.2.1.tgz#ba44f0b3b6588da2ee9fd8da508ebff50d116ce2" + integrity sha512-OG9kQtmMZBJD/32NEw5IhN5+HnBqVjy03eC+I71I0oQRFA5rOgA4OtPOYG7mz1GkCfCNxn3gKIX8EiHJYuf1cA== + dependencies: + JSONStream "^1.0.4" + is-text-path "^1.0.1" + lodash "^4.17.15" + meow "^8.0.0" + split2 "^3.0.0" + through2 "^4.0.0" + trim-off-newlines "^1.0.0" + +conventional-commits-parser@^3.2.0: + version "3.2.4" + resolved "https://registry.yarnpkg.com/conventional-commits-parser/-/conventional-commits-parser-3.2.4.tgz#a7d3b77758a202a9b2293d2112a8d8052c740972" + integrity sha512-nK7sAtfi+QXbxHCYfhpZsfRtaitZLIA6889kFIouLvz6repszQDgxBu7wf2WbU+Dco7sAnNCJYERCwt54WPC2Q== + dependencies: + JSONStream "^1.0.4" + is-text-path "^1.0.1" + lodash "^4.17.15" + meow "^8.0.0" + split2 "^3.0.0" + through2 "^4.0.0" + +conventional-recommended-bump@6.1.0: + version "6.1.0" + resolved "https://registry.yarnpkg.com/conventional-recommended-bump/-/conventional-recommended-bump-6.1.0.tgz#cfa623285d1de554012f2ffde70d9c8a22231f55" + integrity sha512-uiApbSiNGM/kkdL9GTOLAqC4hbptObFo4wW2QRyHsKciGAfQuLU1ShZ1BIVI/+K2BE/W1AWYQMCXAsv4dyKPaw== + dependencies: + concat-stream "^2.0.0" + conventional-changelog-preset-loader "^2.3.4" + conventional-commits-filter "^2.0.7" + conventional-commits-parser "^3.2.0" + git-raw-commits "^2.0.8" + git-semver-tags "^4.1.1" + meow "^8.0.0" + q "^1.5.1" + +convert-source-map@^1.7.0: + version "1.7.0" + resolved "https://registry.yarnpkg.com/convert-source-map/-/convert-source-map-1.7.0.tgz#17a2cb882d7f77d3490585e2ce6c524424a3a442" + integrity sha512-4FJkXzKXEDB1snCFZlLP4gpC3JILicCpGbzG9f9G7tGqGCzETQ2hWPrcinA9oU4wtf2biUaEH5065UnMeR33oA== + dependencies: + safe-buffer "~5.1.1" + +convert-to-spaces@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/convert-to-spaces/-/convert-to-spaces-1.0.2.tgz#7e3e48bbe6d997b1417ddca2868204b4d3d85715" + integrity sha1-fj5Iu+bZl7FBfdyihoIEtNPYVxU= + +cookie-signature@1.0.6: + version "1.0.6" + resolved "https://registry.yarnpkg.com/cookie-signature/-/cookie-signature-1.0.6.tgz#e303a882b342cc3ee8ca513a79999734dab3ae2c" + integrity sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ== + +cookie@0.4.2: + version "0.4.2" + resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.4.2.tgz#0e41f24de5ecf317947c82fc789e06a884824432" + integrity sha512-aSWTXFzaKWkvHO1Ny/s+ePFpvKsPnjc551iI41v3ny/ow6tBG5Vd+FuqGNhh1LxOmVzOlGUriIlOaokOvhaStA== + +cookie@0.5.0: + version "0.5.0" + resolved "https://registry.yarnpkg.com/cookie/-/cookie-0.5.0.tgz#d1f5d71adec6558c58f389987c366aa47e994f8b" + integrity sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw== + +cookiejar@^2.1.4: + version "2.1.4" + resolved "https://registry.yarnpkg.com/cookiejar/-/cookiejar-2.1.4.tgz#ee669c1fea2cf42dc31585469d193fef0d65771b" + integrity sha512-LDx6oHrK+PhzLKJU9j5S7/Y3jM/mUHvD/DeI1WQmJn652iPC5Y4TBzC9l+5OMOXlyTTA+SmVUPm0HQUwpD5Jqw== + +copy-descriptor@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/copy-descriptor/-/copy-descriptor-0.1.1.tgz#676f6eb3c39997c2ee1ac3a924fd6124748f578d" + integrity sha1-Z29us8OZl8LuGsOpJP1hJHSPV40= + +core-js@^3.6.1: + version "3.9.0" + resolved "https://registry.yarnpkg.com/core-js/-/core-js-3.9.0.tgz#790b1bb11553a2272b36e2625c7179db345492f8" + integrity sha512-PyFBJaLq93FlyYdsndE5VaueA9K5cNB7CGzeCj191YYLhkQM0gdZR2SKihM70oF0wdqKSKClv/tEBOpoRmdOVQ== + +core-util-is@^1.0.3, core-util-is@~1.0.0: + version "1.0.3" + resolved "https://registry.yarnpkg.com/core-util-is/-/core-util-is-1.0.3.tgz#a6042d3634c2b27e9328f837b965fac83808db85" + integrity sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ== + +cosmiconfig@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/cosmiconfig/-/cosmiconfig-7.0.0.tgz#ef9b44d773959cae63ddecd122de23853b60f8d3" + integrity sha512-pondGvTuVYDk++upghXJabWzL6Kxu6f26ljFw64Swq9v6sQPUL3EUlVDV56diOjpCayKihL6hVe8exIACU4XcA== + dependencies: + "@types/parse-json" "^4.0.0" + import-fresh "^3.2.1" + parse-json "^5.0.0" + path-type "^4.0.0" + yaml "^1.10.0" + +create-require@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/create-require/-/create-require-1.1.1.tgz#c1d7e8f1e5f6cfc9ff65f9cd352d37348756c333" + integrity sha512-dcKFX3jn0MpIaXjisoRvexIJVEKzaq7z2rZKxf+MSr9TkdmHmsU4m2lcLojrj/FHl8mk5VxMmYA+ftRkP/3oKQ== + +cross-spawn@^6.0.5: + version "6.0.5" + resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-6.0.5.tgz#4a5ec7c64dfae22c3a14124dbacdee846d80cbc4" + integrity sha512-eTVLrBSt7fjbDygz805pMnstIs2VTBNkRm0qxZd+M7A5XDdxVRWO5MxGBXZhjY4cqLYLdtrGqRf8mBPmzwSpWQ== + dependencies: + nice-try "^1.0.4" + path-key "^2.0.1" + semver "^5.5.0" + shebang-command "^1.2.0" + which "^1.2.9" + +cross-spawn@^7.0.0, cross-spawn@^7.0.2: + version "7.0.3" + resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-7.0.3.tgz#f73a85b9d5d41d045551c177e2882d4ac85728a6" + integrity sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w== + dependencies: + path-key "^3.1.0" + shebang-command "^2.0.0" + which "^2.0.1" + +crypto-random-string@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/crypto-random-string/-/crypto-random-string-2.0.0.tgz#ef2a7a966ec11083388369baa02ebead229b30d5" + integrity sha512-v1plID3y9r/lPhviJ1wrXpLeyUIGAZ2SHNYTEapm7/8A9nLPoyvVp3RK/EPFqn5kEznyWgYZNsRtYYIWbuG8KA== + +cspell-glob@^0.1.25: + version "0.1.25" + resolved "https://registry.yarnpkg.com/cspell-glob/-/cspell-glob-0.1.25.tgz#5d55b03ac5e7a379d435ebd5685178806b0c372f" + integrity sha512-/XaSHrGBpMJa+duFz3GKOWfrijrfdHT7a/XGgIcq3cymCSpOH+DPho42sl0jLI/hjM+8yv2m8aEoxRT8yVSnlg== + dependencies: + micromatch "^4.0.2" + +cspell-io@^4.1.7: + version "4.1.7" + resolved "https://registry.yarnpkg.com/cspell-io/-/cspell-io-4.1.7.tgz#ff2c0d44560fe26fa8c5714d2b973a940a66bffe" + integrity sha512-V0/tUu9FnIS3v+vAvDT6NNa14Nc/zUNX8+YUUOfFAiDJJTdqefmvcWjOJBIMYBf3wIk9iWLmLbMM+bNHqr7DSQ== + dependencies: + iconv-lite "^0.6.2" + iterable-to-stream "^1.0.1" + +cspell-lib@^4.3.12: + version "4.3.12" + resolved "https://registry.yarnpkg.com/cspell-lib/-/cspell-lib-4.3.12.tgz#9ba30591079562534ef47e5552b86cadaf7383d8" + integrity sha512-yCCb6MoW1K8Tsr/WVEQoO4dfYhH9bCsjQayccb8MlyDaNNuWJHuX+gUGHsZSXSuChSh8PrTWKXJzs13/uM977g== + dependencies: + "@cspell/dict-aws" "^1.0.13" + "@cspell/dict-bash" "^1.0.11" + "@cspell/dict-companies" "^1.0.35" + "@cspell/dict-cpp" "^1.1.37" + "@cspell/dict-cryptocurrencies" "^1.0.10" + "@cspell/dict-csharp" "^1.0.10" + "@cspell/dict-css" "^1.0.10" + "@cspell/dict-django" "^1.0.25" + "@cspell/dict-dotnet" "^1.0.24" + "@cspell/dict-elixir" "^1.0.23" + "@cspell/dict-en-gb" "^1.1.27" + "@cspell/dict-en_us" "^1.2.39" + "@cspell/dict-filetypes" "^1.1.5" + "@cspell/dict-fonts" "^1.0.13" + "@cspell/dict-fullstack" "^1.0.36" + "@cspell/dict-golang" "^1.1.24" + "@cspell/dict-haskell" "^1.0.12" + "@cspell/dict-html" "^1.1.5" + "@cspell/dict-html-symbol-entities" "^1.0.23" + "@cspell/dict-java" "^1.0.22" + "@cspell/dict-latex" "^1.0.23" + "@cspell/dict-lorem-ipsum" "^1.0.22" + "@cspell/dict-lua" "^1.0.16" + "@cspell/dict-node" "^1.0.10" + "@cspell/dict-npm" "^1.0.10" + "@cspell/dict-php" "^1.0.23" + "@cspell/dict-powershell" "^1.0.14" + "@cspell/dict-python" "^1.0.32" + "@cspell/dict-ruby" "^1.0.12" + "@cspell/dict-rust" "^1.0.22" + "@cspell/dict-scala" "^1.0.21" + "@cspell/dict-software-terms" "^1.0.24" + "@cspell/dict-typescript" "^1.0.16" + comment-json "^4.1.0" + configstore "^5.0.1" + cspell-io "^4.1.7" + cspell-trie-lib "^4.2.8" + cspell-util-bundle "^4.1.11" + fs-extra "^9.1.0" + gensequence "^3.1.1" + minimatch "^3.0.4" + resolve-from "^5.0.0" + resolve-global "^1.0.0" + vscode-uri "^3.0.2" + +cspell-trie-lib@^4.2.8: + version "4.2.8" + resolved "https://registry.yarnpkg.com/cspell-trie-lib/-/cspell-trie-lib-4.2.8.tgz#50d9841945274b7c879e2ebe3caa360828355bda" + integrity sha512-Nt3c0gxOYXIc3/yhALDukpje1BgR6guvlUKWQO2zb0r7qRWpwUw2j2YM4dWbHQeH/3Hx5ei4Braa6cMaiJ5YBw== + dependencies: + gensequence "^3.1.1" + +cspell-util-bundle@^4.1.11: + version "4.1.11" + resolved "https://registry.yarnpkg.com/cspell-util-bundle/-/cspell-util-bundle-4.1.11.tgz#96840af030dcac5baeb3480e249e7402413015d0" + integrity sha512-or3OGKydZs1NwweMIgnA48k8H3F5zK4e5lonjUhpEzLYQZ2nB23decdoqZ8ogFC8pFTA40tZKDsMJ0b+65gX4Q== + +cspell@^4.1.0: + version "4.2.8" + resolved "https://registry.yarnpkg.com/cspell/-/cspell-4.2.8.tgz#69b4c6f4c1b628f0b51d8618738d061e497d76d3" + integrity sha512-eqan8+lCU9bSp8Tl4+SR/ccBnuPyMmp7evck/RlMdFTjLh/s+3vQ5hQyBzbzK8w2MMqL84CymW7BwIOKjpylSg== + dependencies: + chalk "^4.1.0" + commander "^7.0.0" + comment-json "^4.0.6" + cspell-glob "^0.1.25" + cspell-lib "^4.3.12" + fs-extra "^9.1.0" + gensequence "^3.1.1" + get-stdin "^8.0.0" + glob "^7.1.6" + minimatch "^3.0.4" + +currently-unhandled@^0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea" + integrity sha512-/fITjgjGU50vjQ4FH6eUoYu+iUoUKIXws2hL15JJpIR+BbTxaXQsMuuyjtNh2WqsSBS5nsaZHFsFecyw5CCAng== + dependencies: + array-find-index "^1.0.1" + +cz-conventional-changelog@3.3.0, cz-conventional-changelog@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/cz-conventional-changelog/-/cz-conventional-changelog-3.3.0.tgz#9246947c90404149b3fe2cf7ee91acad3b7d22d2" + integrity sha512-U466fIzU5U22eES5lTNiNbZ+d8dfcHcssH4o7QsdWaCcRs/feIPCxKYSWkYBNs5mny7MvEfwpTLWjvbm94hecw== + dependencies: + chalk "^2.4.1" + commitizen "^4.0.3" + conventional-commit-types "^3.0.0" + lodash.map "^4.5.1" + longest "^2.0.1" + word-wrap "^1.0.3" + optionalDependencies: + "@commitlint/load" ">6.1.1" + +dargs@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/dargs/-/dargs-7.0.0.tgz#04015c41de0bcb69ec84050f3d9be0caf8d6d5cc" + integrity sha512-2iy1EkLdlBzQGvbweYRFxmFath8+K7+AKB0TlhHWkNuH+TmovaMH/Wp7V7R4u7f4SnX3OgLsU9t1NI9ioDnUpg== + +date-time@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/date-time/-/date-time-3.1.0.tgz#0d1e934d170579f481ed8df1e2b8ff70ee845e1e" + integrity sha512-uqCUKXE5q1PNBXjPqvwhwJf9SwMoAHBgWJ6DcrnS5o+W2JOiIILl0JEdVD8SGujrNS02GGxgwAg2PN2zONgtjg== + dependencies: + time-zone "^1.0.0" + +dateformat@^3.0.0: + version "3.0.3" + resolved "https://registry.yarnpkg.com/dateformat/-/dateformat-3.0.3.tgz#a6e37499a4d9a9cf85ef5872044d62901c9889ae" + integrity sha512-jyCETtSl3VMZMWeRo7iY1FL19ges1t55hMo5yaam4Jrsm5EPL89UQkoQRyiI+Yf4k8r2ZpdngkV8hr1lIdjb3Q== + +debug@2.6.9, debug@^2.2.0, debug@^2.3.3: + version "2.6.9" + resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.9.tgz#5d128515df134ff327e90a4c93f4e077a536341f" + integrity sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA== + dependencies: + ms "2.0.0" + +debug@4, debug@^4.0.1, debug@^4.1.1, debug@^4.3.1, debug@^4.3.4: + version "4.3.4" + resolved "https://registry.yarnpkg.com/debug/-/debug-4.3.4.tgz#1319f6579357f2338d3337d2cdd4914bb5dcc865" + integrity sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ== + dependencies: + ms "2.1.2" + +debug@^3.2.7: + version "3.2.7" + resolved "https://registry.yarnpkg.com/debug/-/debug-3.2.7.tgz#72580b7e9145fb39b6676f9c5e5fb100b934179a" + integrity sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ== + dependencies: + ms "^2.1.1" + +debug@^4.1.0, debug@^4.2.0: + version "4.3.1" + resolved "https://registry.yarnpkg.com/debug/-/debug-4.3.1.tgz#f0d229c505e0c6d8c49ac553d1b13dc183f6b2ee" + integrity sha512-doEwdvm4PCeK4K3RQN2ZC2BYUBaxwLARCqZmMjtF8a51J2Rb0xpVloFRnCODwqjpwnAoao4pelN8l3RJdv3gRQ== + dependencies: + ms "2.1.2" + +decamelize-keys@^1.1.0: + version "1.1.1" + resolved "https://registry.yarnpkg.com/decamelize-keys/-/decamelize-keys-1.1.1.tgz#04a2d523b2f18d80d0158a43b895d56dff8d19d8" + integrity sha512-WiPxgEirIV0/eIOMcnFBA3/IJZAZqKnwAwWyvvdi4lsr1WCN22nhdf/3db3DoZcUjTV2SqfzIwNyp6y2xs3nmg== + dependencies: + decamelize "^1.1.0" + map-obj "^1.0.0" + +decamelize@^1.1.0, decamelize@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/decamelize/-/decamelize-1.2.0.tgz#f6534d15148269b20352e7bee26f501f9a191290" + integrity sha512-z2S+W9X73hAUUki+N+9Za2lBlun89zigOyGrsax+KUQ6wKW4ZoWpEYBkGhQjwAjjDCkWxhY0VKEhk8wzY7F5cA== + +decode-uri-component@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/decode-uri-component/-/decode-uri-component-0.2.0.tgz#eb3913333458775cb84cd1a1fae062106bb87545" + integrity sha1-6zkTMzRYd1y4TNGh+uBiEGu4dUU= + +decompress-response@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/decompress-response/-/decompress-response-3.3.0.tgz#80a4dd323748384bfa248083622aedec982adff3" + integrity sha1-gKTdMjdIOEv6JICDYirt7Jgq3/M= + dependencies: + mimic-response "^1.0.0" + +dedent@0.7.0, dedent@^0.7.0: + version "0.7.0" + resolved "https://registry.yarnpkg.com/dedent/-/dedent-0.7.0.tgz#2495ddbaf6eb874abb0e1be9df22d2e5a544326c" + integrity sha1-JJXduvbrh0q7Dhvp3yLS5aVEMmw= + +deep-extend@^0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.6.0.tgz#c4fa7c95404a17a9c3e8ca7e1537312b736330ac" + integrity sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA== + +deep-is@^0.1.3: + version "0.1.4" + resolved "https://registry.yarnpkg.com/deep-is/-/deep-is-0.1.4.tgz#a6f2dce612fadd2ef1f519b73551f17e85199831" + integrity sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ== + +default-require-extensions@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/default-require-extensions/-/default-require-extensions-3.0.0.tgz#e03f93aac9b2b6443fc52e5e4a37b3ad9ad8df96" + integrity sha512-ek6DpXq/SCpvjhpFsLFRVtIxJCRw6fUR42lYMVZuUMK7n8eMz4Uh5clckdBjEpLhn/gEBZo7hDJnJcwdKLKQjg== + dependencies: + strip-bom "^4.0.0" + +defaults@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/defaults/-/defaults-1.0.3.tgz#c656051e9817d9ff08ed881477f3fe4019f3ef7d" + integrity sha1-xlYFHpgX2f8I7YgUd/P+QBnz730= + dependencies: + clone "^1.0.2" + +defer-to-connect@^1.0.1: + version "1.1.3" + resolved "https://registry.yarnpkg.com/defer-to-connect/-/defer-to-connect-1.1.3.tgz#331ae050c08dcf789f8c83a7b81f0ed94f4ac591" + integrity sha512-0ISdNousHvZT2EiFlZeZAHBUvSxmKswVCEf8hW7KWgG4a8MVEu/3Vb6uWYozkjylyCxe0JBIiRB1jV45S70WVQ== + +define-properties@^1.1.3, define-properties@^1.1.4: + version "1.2.0" + resolved "https://registry.yarnpkg.com/define-properties/-/define-properties-1.2.0.tgz#52988570670c9eacedd8064f4a990f2405849bd5" + integrity sha512-xvqAVKGfT1+UAvPwKTVw/njhdQ8ZhXK4lI0bCIuCMrp2up9nPnaDftrLtmpTazqd1o+UY4zgzU+avtMbDP+ldA== + dependencies: + has-property-descriptors "^1.0.0" + object-keys "^1.1.1" + +define-property@^0.2.5: + version "0.2.5" + resolved "https://registry.yarnpkg.com/define-property/-/define-property-0.2.5.tgz#c35b1ef918ec3c990f9a5bc57be04aacec5c8116" + integrity sha1-w1se+RjsPJkPmlvFe+BKrOxcgRY= + dependencies: + is-descriptor "^0.1.0" + +define-property@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/define-property/-/define-property-1.0.0.tgz#769ebaaf3f4a63aad3af9e8d304c9bbe79bfb0e6" + integrity sha1-dp66rz9KY6rTr56NMEybvnm/sOY= + dependencies: + is-descriptor "^1.0.0" + +define-property@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/define-property/-/define-property-2.0.2.tgz#d459689e8d654ba77e02a817f8710d702cb16e9d" + integrity sha512-jwK2UV4cnPpbcG7+VRARKTZPUWowwXA8bzH5NP6ud0oeAxyYPuGZUAC7hMugpCdz4BeSZl2Dl9k66CHJ/46ZYQ== + dependencies: + is-descriptor "^1.0.2" + isobject "^3.0.1" + +del@^6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/del/-/del-6.0.0.tgz#0b40d0332cea743f1614f818be4feb717714c952" + integrity sha512-1shh9DQ23L16oXSZKB2JxpL7iMy2E0S9d517ptA1P8iw0alkPtQcrKH7ru31rYtKwF499HkTu+DRzq3TCKDFRQ== + dependencies: + globby "^11.0.1" + graceful-fs "^4.2.4" + is-glob "^4.0.1" + is-path-cwd "^2.2.0" + is-path-inside "^3.0.2" + p-map "^4.0.0" + rimraf "^3.0.2" + slash "^3.0.0" + +delayed-stream@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619" + integrity sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ== + +depd@2.0.0, depd@~2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/depd/-/depd-2.0.0.tgz#b696163cc757560d09cf22cc8fad1571b79e76df" + integrity sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw== + +destroy@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/destroy/-/destroy-1.2.0.tgz#4803735509ad8be552934c67df614f94e66fa015" + integrity sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg== + +detect-file@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/detect-file/-/detect-file-1.0.0.tgz#f0d66d03672a825cb1b73bdb3fe62310c8e552b7" + integrity sha1-8NZtA2cqglyxtzvbP+YjEMjlUrc= + +detect-indent@6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-6.0.0.tgz#0abd0f549f69fc6659a254fe96786186b6f528fd" + integrity sha512-oSyFlqaTHCItVRGK5RmrmjB+CmaMOW7IaNA/kdxqhoa6d17j/5ce9O9eWXmV/KEdRwqpQA+Vqe8a8Bsybu4YnA== + +detect-indent@^6.0.0: + version "6.1.0" + resolved "https://registry.yarnpkg.com/detect-indent/-/detect-indent-6.1.0.tgz#592485ebbbf6b3b1ab2be175c8393d04ca0d57e6" + integrity sha512-reYkTUJAZb9gUuZ2RvVCNhVHdg62RHnJ7WJl8ftMi4diZ6NWlciOzQN88pUhSELEwflJht4oQDv0F0BMlwaYtA== + +detect-newline@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/detect-newline/-/detect-newline-3.1.0.tgz#576f5dfc63ae1a192ff192d8ad3af6308991b651" + integrity sha512-TLz+x/vEXm/Y7P7wn1EJFNLxYpUD4TgMosxY6fAVJUnJMbupHBOncxyWUG9OpTaH9EBD7uFI5LfEgmMOc54DsA== + +dezalgo@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/dezalgo/-/dezalgo-1.0.4.tgz#751235260469084c132157dfa857f386d4c33d81" + integrity sha512-rXSP0bf+5n0Qonsb+SVVfNfIsimO4HEtmnIpPHY8Q1UCzKlQrDMfdobr8nJOOsRgWCyMRqeSBQzmWUMq7zvVig== + dependencies: + asap "^2.0.0" + wrappy "1" + +diff@^4.0.1: + version "4.0.2" + resolved "https://registry.yarnpkg.com/diff/-/diff-4.0.2.tgz#60f3aecb89d5fae520c11aa19efc2bb982aade7d" + integrity sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A== + +dir-glob@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/dir-glob/-/dir-glob-3.0.1.tgz#56dbf73d992a4a93ba1584f4534063fd2e41717f" + integrity sha512-WkrWp9GR4KXfKGYzOLmTuGVi1UWFfws377n9cc55/tb6DuqyF6pcQ5AbiHEshaDpY9v6oaSr2XCDidGmMwdzIA== + dependencies: + path-type "^4.0.0" + +doctrine@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-2.1.0.tgz#5cd01fc101621b42c4cd7f5d1a66243716d3f39d" + integrity sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw== + dependencies: + esutils "^2.0.2" + +doctrine@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-3.0.0.tgz#addebead72a6574db783639dc87a121773973961" + integrity sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w== + dependencies: + esutils "^2.0.2" + +dot-prop@^5.1.0, dot-prop@^5.2.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/dot-prop/-/dot-prop-5.3.0.tgz#90ccce708cd9cd82cc4dc8c3ddd9abdd55b20e88" + integrity sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q== + dependencies: + is-obj "^2.0.0" + +dotgitignore@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/dotgitignore/-/dotgitignore-2.1.0.tgz#a4b15a4e4ef3cf383598aaf1dfa4a04bcc089b7b" + integrity sha512-sCm11ak2oY6DglEPpCB8TixLjWAxd3kJTs6UIcSasNYxXdFPV+YKlye92c8H4kKFqV5qYMIh7d+cYecEg0dIkA== + dependencies: + find-up "^3.0.0" + minimatch "^3.0.4" + +duplexer3@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/duplexer3/-/duplexer3-0.1.4.tgz#ee01dd1cac0ed3cbc7fdbea37dc0a8f1ce002ce2" + integrity sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI= + +ee-first@1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/ee-first/-/ee-first-1.1.1.tgz#590c61156b0ae2f4f0255732a158b266bc56b21d" + integrity sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow== + +email-addresses@^3.0.1: + version "3.1.0" + resolved "https://registry.yarnpkg.com/email-addresses/-/email-addresses-3.1.0.tgz#cabf7e085cbdb63008a70319a74e6136188812fb" + integrity sha512-k0/r7GrWVL32kZlGwfPNgB2Y/mMXVTq/decgLczm/j34whdaspNrZO8CnXPf1laaHxI6ptUlsnAxN+UAPw+fzg== + +emittery@^0.8.0: + version "0.8.1" + resolved "https://registry.yarnpkg.com/emittery/-/emittery-0.8.1.tgz#bb23cc86d03b30aa75a7f734819dee2e1ba70860" + integrity sha512-uDfvUjVrfGJJhymx/kz6prltenw1u7WrCg1oa94zYY8xxVpLLUu045LAT0dhDZdXG58/EpPL/5kA180fQ/qudg== + +emoji-regex@^7.0.1: + version "7.0.3" + resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-7.0.3.tgz#933a04052860c85e83c122479c4748a8e4c72156" + integrity sha512-CwBLREIQ7LvYFB0WyRvwhq5N5qPhc6PMjD6bYggFlI5YyDgl+0vxq5VHbMOFqLg7hfWzmu8T5Z1QofhmTIhItA== + +emoji-regex@^8.0.0: + version "8.0.0" + resolved "https://registry.yarnpkg.com/emoji-regex/-/emoji-regex-8.0.0.tgz#e818fd69ce5ccfcb404594f842963bf53164cc37" + integrity sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A== + +encodeurl@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/encodeurl/-/encodeurl-1.0.2.tgz#ad3ff4c86ec2d029322f5a02c3a9a606c95b3f59" + integrity sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w== + +end-of-stream@^1.1.0: + version "1.4.4" + resolved "https://registry.yarnpkg.com/end-of-stream/-/end-of-stream-1.4.4.tgz#5ae64a5f45057baf3626ec14da0ca5e4b2431eb0" + integrity sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q== + dependencies: + once "^1.4.0" + +enquirer@^2.3.5, enquirer@^2.3.6: + version "2.3.6" + resolved "https://registry.yarnpkg.com/enquirer/-/enquirer-2.3.6.tgz#2a7fe5dd634a1e4125a975ec994ff5456dc3734d" + integrity sha512-yjNnPr315/FjS4zIsUxYguYUPP2e1NK4d7E7ZOLiyYCcbFBiTMyID+2wvm2w6+pZ/odMA7cRkjhsPbltwBOrLg== + dependencies: + ansi-colors "^4.1.1" + +equal-length@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/equal-length/-/equal-length-1.0.1.tgz#21ca112d48ab24b4e1e7ffc0e5339d31fdfc274c" + integrity sha1-IcoRLUirJLTh5//A5TOdMf38J0w= + +error-ex@^1.3.1: + version "1.3.2" + resolved "https://registry.yarnpkg.com/error-ex/-/error-ex-1.3.2.tgz#b4ac40648107fdcdcfae242f428bea8a14d4f1bf" + integrity sha512-7dFHNmqeFSEt2ZBsCriorKnn3Z2pj+fd9kmI6QoWw4//DL+icEBfc0U7qJCisqrTsKTjw4fNFy2pW9OqStD84g== + dependencies: + is-arrayish "^0.2.1" + +es-abstract@^1.18.0-next.1, es-abstract@^1.19.0, es-abstract@^1.20.4: + version "1.21.2" + resolved "https://registry.yarnpkg.com/es-abstract/-/es-abstract-1.21.2.tgz#a56b9695322c8a185dc25975aa3b8ec31d0e7eff" + integrity sha512-y/B5POM2iBnIxCiernH1G7rC9qQoM77lLIMQLuob0zhp8C56Po81+2Nj0WFKnd0pNReDTnkYryc+zhOzpEIROg== + dependencies: + array-buffer-byte-length "^1.0.0" + available-typed-arrays "^1.0.5" + call-bind "^1.0.2" + es-set-tostringtag "^2.0.1" + es-to-primitive "^1.2.1" + function.prototype.name "^1.1.5" + get-intrinsic "^1.2.0" + get-symbol-description "^1.0.0" + globalthis "^1.0.3" + gopd "^1.0.1" + has "^1.0.3" + has-property-descriptors "^1.0.0" + has-proto "^1.0.1" + has-symbols "^1.0.3" + internal-slot "^1.0.5" + is-array-buffer "^3.0.2" + is-callable "^1.2.7" + is-negative-zero "^2.0.2" + is-regex "^1.1.4" + is-shared-array-buffer "^1.0.2" + is-string "^1.0.7" + is-typed-array "^1.1.10" + is-weakref "^1.0.2" + object-inspect "^1.12.3" + object-keys "^1.1.1" + object.assign "^4.1.4" + regexp.prototype.flags "^1.4.3" + safe-regex-test "^1.0.0" + string.prototype.trim "^1.2.7" + string.prototype.trimend "^1.0.6" + string.prototype.trimstart "^1.0.6" + typed-array-length "^1.0.4" + unbox-primitive "^1.0.2" + which-typed-array "^1.1.9" + +es-set-tostringtag@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/es-set-tostringtag/-/es-set-tostringtag-2.0.1.tgz#338d502f6f674301d710b80c8592de8a15f09cd8" + integrity sha512-g3OMbtlwY3QewlqAiMLI47KywjWZoEytKr8pf6iTC8uJq5bIAH52Z9pnQ8pVL6whrCto53JZDuUIsifGeLorTg== + dependencies: + get-intrinsic "^1.1.3" + has "^1.0.3" + has-tostringtag "^1.0.0" + +es-shim-unscopables@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/es-shim-unscopables/-/es-shim-unscopables-1.0.0.tgz#702e632193201e3edf8713635d083d378e510241" + integrity sha512-Jm6GPcCdC30eMLbZ2x8z2WuRwAws3zTBBKuusffYVUrNj/GVSUAZ+xKMaUpfNDR5IbyNA5LJbaecoUVbmUcB1w== + dependencies: + has "^1.0.3" + +es-to-primitive@^1.2.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/es-to-primitive/-/es-to-primitive-1.2.1.tgz#e55cd4c9cdc188bcefb03b366c736323fc5c898a" + integrity sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA== + dependencies: + is-callable "^1.1.4" + is-date-object "^1.0.1" + is-symbol "^1.0.2" + +es6-error@^4.0.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/es6-error/-/es6-error-4.1.1.tgz#9e3af407459deed47e9a91f9b885a84eb05c561d" + integrity sha512-Um/+FxMr9CISWh0bi5Zv0iOD+4cFh5qLeks1qhAopKVAJw3drgKbKySikp7wGhDL0HPeaja0P5ULZrxLkniUVg== + +escalade@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/escalade/-/escalade-3.1.1.tgz#d8cfdc7000965c5a0174b4a82eaa5c0552742e40" + integrity sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw== + +escape-goat@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/escape-goat/-/escape-goat-2.1.1.tgz#1b2dc77003676c457ec760b2dc68edb648188675" + integrity sha512-8/uIhbG12Csjy2JEW7D9pHbreaVaS/OpN3ycnyvElTdwM5n6GY6W6e2IPemfvGZeUMqZ9A/3GqIZMgKnBhAw/Q== + +escape-html@~1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/escape-html/-/escape-html-1.0.3.tgz#0258eae4d3d0c0974de1c169188ef0051d1d1988" + integrity sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow== + +escape-string-regexp@^1.0.2, escape-string-regexp@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz#1b61c0562190a8dff6ae3bb2cf0200ca130b86d4" + integrity sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg== + +escape-string-regexp@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-2.0.0.tgz#a30304e99daa32e23b2fd20f51babd07cffca344" + integrity sha512-UpzcLCXolUWcNu5HtVMHYdXJjArjsF9C0aNnquZYY4uW/Vu0miy5YoWvbV345HauVvcAUnpRuhMMcqTcGOY2+w== + +escape-string-regexp@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz#14ba83a5d373e3d311e5afca29cf5bfad965bf34" + integrity sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA== + +eslint-config-prettier-standard@^3.0.1: + version "3.0.2" + resolved "https://registry.yarnpkg.com/eslint-config-prettier-standard/-/eslint-config-prettier-standard-3.0.2.tgz#43e9a161ee6d409c404e8652ac28b4db71fc75bb" + integrity sha512-GUfjNOwkYmZPxZ0orDl5YjRJOLf6rzXWR8pHGixNaxI5CORAQvnJ5jkRudYFUhDcxTCALuXXwK+uIlR56Dbpvg== + +eslint-config-prettier@^7.1.0: + version "7.2.0" + resolved "https://registry.yarnpkg.com/eslint-config-prettier/-/eslint-config-prettier-7.2.0.tgz#f4a4bd2832e810e8cc7c1411ec85b3e85c0c53f9" + integrity sha512-rV4Qu0C3nfJKPOAhFujFxB7RMP+URFyQqqOZW9DMRD7ZDTFyjaIlETU3xzHELt++4ugC0+Jm084HQYkkJe+Ivg== + +eslint-config-standard@^16.0.2: + version "16.0.3" + resolved "https://registry.yarnpkg.com/eslint-config-standard/-/eslint-config-standard-16.0.3.tgz#6c8761e544e96c531ff92642eeb87842b8488516" + integrity sha512-x4fmJL5hGqNJKGHSjnLdgA6U6h1YW/G2dW9fA+cyVur4SK6lyue8+UgNKWlZtUDTXvgKDD/Oa3GQjmB5kjtVvg== + +eslint-import-resolver-node@^0.3.7: + version "0.3.7" + resolved "https://registry.yarnpkg.com/eslint-import-resolver-node/-/eslint-import-resolver-node-0.3.7.tgz#83b375187d412324a1963d84fa664377a23eb4d7" + integrity sha512-gozW2blMLJCeFpBwugLTGyvVjNoeo1knonXAcatC6bjPBZitotxdWf7Gimr25N4c0AAOo4eOUfaG82IJPDpqCA== + dependencies: + debug "^3.2.7" + is-core-module "^2.11.0" + resolve "^1.22.1" + +eslint-module-utils@^2.7.4: + version "2.7.4" + resolved "https://registry.yarnpkg.com/eslint-module-utils/-/eslint-module-utils-2.7.4.tgz#4f3e41116aaf13a20792261e61d3a2e7e0583974" + integrity sha512-j4GT+rqzCoRKHwURX7pddtIPGySnX9Si/cgMI5ztrcqOPtk5dDEeZ34CQVPphnqkJytlc97Vuk05Um2mJ3gEQA== + dependencies: + debug "^3.2.7" + +eslint-plugin-es@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-es/-/eslint-plugin-es-3.0.1.tgz#75a7cdfdccddc0589934aeeb384175f221c57893" + integrity sha512-GUmAsJaN4Fc7Gbtl8uOBlayo2DqhwWvEzykMHSCZHU3XdJ+NSzzZcVhXh3VxX5icqQ+oQdIEawXX8xkR3mIFmQ== + dependencies: + eslint-utils "^2.0.0" + regexpp "^3.0.0" + +eslint-plugin-eslint-comments@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/eslint-plugin-eslint-comments/-/eslint-plugin-eslint-comments-3.2.0.tgz#9e1cd7b4413526abb313933071d7aba05ca12ffa" + integrity sha512-0jkOl0hfojIHHmEHgmNdqv4fmh7300NdpA9FFpF7zaoLvB/QeXOGNLIo86oAveJFrfB1p05kC8hpEMHM8DwWVQ== + dependencies: + escape-string-regexp "^1.0.5" + ignore "^5.0.5" + +eslint-plugin-import@^2.22.1: + version "2.27.5" + resolved "https://registry.yarnpkg.com/eslint-plugin-import/-/eslint-plugin-import-2.27.5.tgz#876a6d03f52608a3e5bb439c2550588e51dd6c65" + integrity sha512-LmEt3GVofgiGuiE+ORpnvP+kAm3h6MLZJ4Q5HCyHADofsb4VzXFsRiWj3c0OFiV+3DWFh0qg3v9gcPlfc3zRow== + dependencies: + array-includes "^3.1.6" + array.prototype.flat "^1.3.1" + array.prototype.flatmap "^1.3.1" + debug "^3.2.7" + doctrine "^2.1.0" + eslint-import-resolver-node "^0.3.7" + eslint-module-utils "^2.7.4" + has "^1.0.3" + is-core-module "^2.11.0" + is-glob "^4.0.3" + minimatch "^3.1.2" + object.values "^1.1.6" + resolve "^1.22.1" + semver "^6.3.0" + tsconfig-paths "^3.14.1" + +eslint-plugin-node@^11.1.0: + version "11.1.0" + resolved "https://registry.yarnpkg.com/eslint-plugin-node/-/eslint-plugin-node-11.1.0.tgz#c95544416ee4ada26740a30474eefc5402dc671d" + integrity sha512-oUwtPJ1W0SKD0Tr+wqu92c5xuCeQqB3hSCHasn/ZgjFdA9iDGNkNf2Zi9ztY7X+hNuMib23LNGRm6+uN+KLE3g== + dependencies: + eslint-plugin-es "^3.0.0" + eslint-utils "^2.0.0" + ignore "^5.1.1" + minimatch "^3.0.4" + resolve "^1.10.1" + semver "^6.1.0" + +eslint-plugin-prettier@^3.3.1: + version "3.4.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-prettier/-/eslint-plugin-prettier-3.4.1.tgz#e9ddb200efb6f3d05ffe83b1665a716af4a387e5" + integrity sha512-htg25EUYUeIhKHXjOinK4BgCcDwtLHjqaxCDsMy5nbnUMkKFvIhMVCp+5GFUXQ4Nr8lBsPqtGAqBenbpFqAA2g== + dependencies: + prettier-linter-helpers "^1.0.0" + +eslint-plugin-promise@^4.2.1: + version "4.3.1" + resolved "https://registry.yarnpkg.com/eslint-plugin-promise/-/eslint-plugin-promise-4.3.1.tgz#61485df2a359e03149fdafc0a68b0e030ad2ac45" + integrity sha512-bY2sGqyptzFBDLh/GMbAxfdJC+b0f23ME63FOE4+Jao0oZ3E1LEwFtWJX/1pGMJLiTtrSSern2CRM/g+dfc0eQ== + +eslint-plugin-standard@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/eslint-plugin-standard/-/eslint-plugin-standard-5.0.0.tgz#c43f6925d669f177db46f095ea30be95476b1ee4" + integrity sha512-eSIXPc9wBM4BrniMzJRBm2uoVuXz2EPa+NXPk2+itrVt+r5SbKFERx/IgrK/HmfjddyKVz2f+j+7gBRvu19xLg== + +eslint-scope@^5.1.1: + version "5.1.1" + resolved "https://registry.yarnpkg.com/eslint-scope/-/eslint-scope-5.1.1.tgz#e786e59a66cb92b3f6c1fb0d508aab174848f48c" + integrity sha512-2NxwbF/hZ0KpepYN0cNbo+FN6XoK7GaHlQhgx/hIZl6Va0bF45RQOOwhLIy8lQDbuCiadSLCBnH2CFYquit5bw== + dependencies: + esrecurse "^4.3.0" + estraverse "^4.1.1" + +eslint-utils@^2.0.0, eslint-utils@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-2.1.0.tgz#d2de5e03424e707dc10c74068ddedae708741b27" + integrity sha512-w94dQYoauyvlDc43XnGB8lU3Zt713vNChgt4EWwhXAP2XkBvndfxF0AgIqKOOasjPIPzj9JqgwkwbCYD0/V3Zg== + dependencies: + eslint-visitor-keys "^1.1.0" + +eslint-utils@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/eslint-utils/-/eslint-utils-3.0.0.tgz#8aebaface7345bb33559db0a1f13a1d2d48c3672" + integrity sha512-uuQC43IGctw68pJA1RgbQS8/NP7rch6Cwd4j3ZBtgo4/8Flj4eGE7ZYSZRN3iq5pVUv6GPdW5Z1RFleo84uLDA== + dependencies: + eslint-visitor-keys "^2.0.0" + +eslint-visitor-keys@^1.1.0, eslint-visitor-keys@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-1.3.0.tgz#30ebd1ef7c2fdff01c3a4f151044af25fab0523e" + integrity sha512-6J72N8UNa462wa/KFODt/PJ3IU60SDpC3QXC1Hjc1BXXpfL2C9R5+AU7jhe0F6GREqVMh4Juu+NY7xn+6dipUQ== + +eslint-visitor-keys@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/eslint-visitor-keys/-/eslint-visitor-keys-2.1.0.tgz#f65328259305927392c938ed44eb0a5c9b2bd303" + integrity sha512-0rSmRBzXgDzIsD6mGdJgevzgezI534Cer5L/vyMX0kHzT/jiB43jRhd9YUlMGYLQy2zprNmoT8qasCGtY+QaKw== + +eslint@^7.17.0: + version "7.32.0" + resolved "https://registry.yarnpkg.com/eslint/-/eslint-7.32.0.tgz#c6d328a14be3fb08c8d1d21e12c02fdb7a2a812d" + integrity sha512-VHZ8gX+EDfz+97jGcgyGCyRia/dPOd6Xh9yPv8Bl1+SoaIwD+a/vlrOmGRUyOYu7MwUhc7CxqeaDZU13S4+EpA== + dependencies: + "@babel/code-frame" "7.12.11" + "@eslint/eslintrc" "^0.4.3" + "@humanwhocodes/config-array" "^0.5.0" + ajv "^6.10.0" + chalk "^4.0.0" + cross-spawn "^7.0.2" + debug "^4.0.1" + doctrine "^3.0.0" + enquirer "^2.3.5" + escape-string-regexp "^4.0.0" + eslint-scope "^5.1.1" + eslint-utils "^2.1.0" + eslint-visitor-keys "^2.0.0" + espree "^7.3.1" + esquery "^1.4.0" + esutils "^2.0.2" + fast-deep-equal "^3.1.3" + file-entry-cache "^6.0.1" + functional-red-black-tree "^1.0.1" + glob-parent "^5.1.2" + globals "^13.6.0" + ignore "^4.0.6" + import-fresh "^3.0.0" + imurmurhash "^0.1.4" + is-glob "^4.0.0" + js-yaml "^3.13.1" + json-stable-stringify-without-jsonify "^1.0.1" + levn "^0.4.1" + lodash.merge "^4.6.2" + minimatch "^3.0.4" + natural-compare "^1.4.0" + optionator "^0.9.1" + progress "^2.0.0" + regexpp "^3.1.0" + semver "^7.2.1" + strip-ansi "^6.0.0" + strip-json-comments "^3.1.0" + table "^6.0.9" + text-table "^0.2.0" + v8-compile-cache "^2.0.3" + +espree@^7.3.0, espree@^7.3.1: + version "7.3.1" + resolved "https://registry.yarnpkg.com/espree/-/espree-7.3.1.tgz#f2df330b752c6f55019f8bd89b7660039c1bbbb6" + integrity sha512-v3JCNCE64umkFpmkFGqzVKsOT0tN1Zr+ueqLZfpV1Ob8e+CEgPWa+OxCoGH3tnhimMKIaBm4m/vaRpJ/krRz2g== + dependencies: + acorn "^7.4.0" + acorn-jsx "^5.3.1" + eslint-visitor-keys "^1.3.0" + +esprima@^4.0.0, esprima@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/esprima/-/esprima-4.0.1.tgz#13b04cdb3e6c5d19df91ab6987a8695619b0aa71" + integrity sha512-eGuFFw7Upda+g4p+QHvnW0RyTX/SVeJBDM/gCtMARO0cLuT2HcEKnTPvhjV6aGeqrCB/sbNop0Kszm0jsaWU4A== + +esquery@^1.4.0: + version "1.5.0" + resolved "https://registry.yarnpkg.com/esquery/-/esquery-1.5.0.tgz#6ce17738de8577694edd7361c57182ac8cb0db0b" + integrity sha512-YQLXUplAwJgCydQ78IMJywZCceoqk1oH01OERdSAJc/7U2AylwjhSCLDEtqwg811idIS/9fIU5GjG73IgjKMVg== + dependencies: + estraverse "^5.1.0" + +esrecurse@^4.3.0: + version "4.3.0" + resolved "https://registry.yarnpkg.com/esrecurse/-/esrecurse-4.3.0.tgz#7ad7964d679abb28bee72cec63758b1c5d2c9921" + integrity sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag== + dependencies: + estraverse "^5.2.0" + +estraverse@^4.1.1: + version "4.3.0" + resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-4.3.0.tgz#398ad3f3c5a24948be7725e83d11a7de28cdbd1d" + integrity sha512-39nnKffWz8xN1BU/2c79n9nB9HDzo0niYUqx6xyqUnyoAnQyyWpOTdZEeiCch8BBu515t4wp9ZmgVfVhn9EBpw== + +estraverse@^5.1.0, estraverse@^5.2.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/estraverse/-/estraverse-5.3.0.tgz#2eea5290702f26ab8fe5370370ff86c965d21123" + integrity sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA== + +esutils@^2.0.2, esutils@^2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/esutils/-/esutils-2.0.3.tgz#74d2eb4de0b8da1293711910d50775b9b710ef64" + integrity sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g== + +etag@~1.8.1: + version "1.8.1" + resolved "https://registry.yarnpkg.com/etag/-/etag-1.8.1.tgz#41ae2eeb65efa62268aebfea83ac7d79299b0887" + integrity sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg== + +execa@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/execa/-/execa-4.1.0.tgz#4e5491ad1572f2f17a77d388c6c857135b22847a" + integrity sha512-j5W0//W7f8UxAn8hXVnwG8tLwdiUy4FJLcSupCg6maBYZDpyBvTApK7KyuI4bKj8KOh1r2YH+6ucuYtJv1bTZA== + dependencies: + cross-spawn "^7.0.0" + get-stream "^5.0.0" + human-signals "^1.1.1" + is-stream "^2.0.0" + merge-stream "^2.0.0" + npm-run-path "^4.0.0" + onetime "^5.1.0" + signal-exit "^3.0.2" + strip-final-newline "^2.0.0" + +expand-brackets@^2.1.4: + version "2.1.4" + resolved "https://registry.yarnpkg.com/expand-brackets/-/expand-brackets-2.1.4.tgz#b77735e315ce30f6b6eff0f83b04151a22449622" + integrity sha1-t3c14xXOMPa27/D4OwQVGiJEliI= + dependencies: + debug "^2.3.3" + define-property "^0.2.5" + extend-shallow "^2.0.1" + posix-character-classes "^0.1.0" + regex-not "^1.0.0" + snapdragon "^0.8.1" + to-regex "^3.0.1" + +expand-tilde@^2.0.0, expand-tilde@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/expand-tilde/-/expand-tilde-2.0.2.tgz#97e801aa052df02454de46b02bf621642cdc8502" + integrity sha1-l+gBqgUt8CRU3kawK/YhZCzchQI= + dependencies: + homedir-polyfill "^1.0.1" + +express-session@^1.17.1: + version "1.17.3" + resolved "https://registry.yarnpkg.com/express-session/-/express-session-1.17.3.tgz#14b997a15ed43e5949cb1d073725675dd2777f36" + integrity sha512-4+otWXlShYlG1Ma+2Jnn+xgKUZTMJ5QD3YvfilX3AcocOAbIkVylSWEklzALe/+Pu4qV6TYBj5GwOBFfdKqLBw== + dependencies: + cookie "0.4.2" + cookie-signature "1.0.6" + debug "2.6.9" + depd "~2.0.0" + on-headers "~1.0.2" + parseurl "~1.3.3" + safe-buffer "5.2.1" + uid-safe "~2.1.5" + +express@^4.17.1: + version "4.18.2" + resolved "https://registry.yarnpkg.com/express/-/express-4.18.2.tgz#3fabe08296e930c796c19e3c516979386ba9fd59" + integrity sha512-5/PsL6iGPdfQ/lKM1UuielYgv3BUoJfz1aUwU9vHZ+J7gyvwdQXFEBIEIaxeGf0GIcreATNyBExtalisDbuMqQ== + dependencies: + accepts "~1.3.8" + array-flatten "1.1.1" + body-parser "1.20.1" + content-disposition "0.5.4" + content-type "~1.0.4" + cookie "0.5.0" + cookie-signature "1.0.6" + debug "2.6.9" + depd "2.0.0" + encodeurl "~1.0.2" + escape-html "~1.0.3" + etag "~1.8.1" + finalhandler "1.2.0" + fresh "0.5.2" + http-errors "2.0.0" + merge-descriptors "1.0.1" + methods "~1.1.2" + on-finished "2.4.1" + parseurl "~1.3.3" + path-to-regexp "0.1.7" + proxy-addr "~2.0.7" + qs "6.11.0" + range-parser "~1.2.1" + safe-buffer "5.2.1" + send "0.18.0" + serve-static "1.15.0" + setprototypeof "1.2.0" + statuses "2.0.1" + type-is "~1.6.18" + utils-merge "1.0.1" + vary "~1.1.2" + +extend-shallow@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-2.0.1.tgz#51af7d614ad9a9f610ea1bafbb989d6b1c56890f" + integrity sha1-Ua99YUrZqfYQ6huvu5idaxxWiQ8= + dependencies: + is-extendable "^0.1.0" + +extend-shallow@^3.0.0, extend-shallow@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/extend-shallow/-/extend-shallow-3.0.2.tgz#26a71aaf073b39fb2127172746131c2704028db8" + integrity sha1-Jqcarwc7OfshJxcnRhMcJwQCjbg= + dependencies: + assign-symbols "^1.0.0" + is-extendable "^1.0.1" + +external-editor@^3.0.3: + version "3.1.0" + resolved "https://registry.yarnpkg.com/external-editor/-/external-editor-3.1.0.tgz#cb03f740befae03ea4d283caed2741a83f335495" + integrity sha512-hMQ4CX1p1izmuLYyZqLMO/qGNw10wSv9QDCPfzXfyFrOaCSSoRfqE1Kf1s5an66J5JZC62NewG+mK49jOCtQew== + dependencies: + chardet "^0.7.0" + iconv-lite "^0.4.24" + tmp "^0.0.33" + +extglob@^2.0.4: + version "2.0.4" + resolved "https://registry.yarnpkg.com/extglob/-/extglob-2.0.4.tgz#ad00fe4dc612a9232e8718711dc5cb5ab0285543" + integrity sha512-Nmb6QXkELsuBr24CJSkilo6UHHgbekK5UiZgfE6UHD3Eb27YC6oD+bhcT+tJ6cl8dmsgdQxnWlcry8ksBIBLpw== + dependencies: + array-unique "^0.3.2" + define-property "^1.0.0" + expand-brackets "^2.1.4" + extend-shallow "^2.0.1" + fragment-cache "^0.2.1" + regex-not "^1.0.0" + snapdragon "^0.8.1" + to-regex "^3.0.1" + +fast-deep-equal@^3.1.1, fast-deep-equal@^3.1.3: + version "3.1.3" + resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz#3a7d56b559d6cbc3eb512325244e619a65c6c525" + integrity sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q== + +fast-diff@^1.1.2, fast-diff@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/fast-diff/-/fast-diff-1.2.0.tgz#73ee11982d86caaf7959828d519cfe927fac5f03" + integrity sha512-xJuoT5+L99XlZ8twedaRf6Ax2TgQVxvgZOYoPKqZufmJib0tL2tegPBOZb1pVNgIhlqDlA0eO0c3wBvQcmzx4w== + +fast-glob@^3.2.9: + version "3.2.12" + resolved "https://registry.yarnpkg.com/fast-glob/-/fast-glob-3.2.12.tgz#7f39ec99c2e6ab030337142da9e0c18f37afae80" + integrity sha512-DVj4CQIYYow0BlaelwK1pHl5n5cRSJfM60UA0zK891sVInoPri2Ekj7+e1CT3/3qxXenpI+nBBmQAcJPJgaj4w== + dependencies: + "@nodelib/fs.stat" "^2.0.2" + "@nodelib/fs.walk" "^1.2.3" + glob-parent "^5.1.2" + merge2 "^1.3.0" + micromatch "^4.0.4" + +fast-json-stable-stringify@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz#874bf69c6f404c2b5d99c481341399fd55892633" + integrity sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw== + +fast-levenshtein@^2.0.6: + version "2.0.6" + resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917" + integrity sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw== + +fast-safe-stringify@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/fast-safe-stringify/-/fast-safe-stringify-2.1.1.tgz#c406a83b6e70d9e35ce3b30a81141df30aeba884" + integrity sha512-W+KJc2dmILlPplD/H4K9l9LcAHAfPtP6BY84uVLXQ6Evcz9Lcg33Y2z1IVblT6xdY54PXYVHEv+0Wpq8Io6zkA== + +fast-url-parser@^1.1.3: + version "1.1.3" + resolved "https://registry.yarnpkg.com/fast-url-parser/-/fast-url-parser-1.1.3.tgz#f4af3ea9f34d8a271cf58ad2b3759f431f0b318d" + integrity sha512-5jOCVXADYNuRkKFzNJ0dCCewsZiYo0dz8QNYljkOpFC6r2U4OBmKtvm/Tsuh4w1YYdDqDb31a8TVhBJ2OJKdqQ== + dependencies: + punycode "^1.3.2" + +fastq@^1.6.0: + version "1.15.0" + resolved "https://registry.yarnpkg.com/fastq/-/fastq-1.15.0.tgz#d04d07c6a2a68fe4599fea8d2e103a937fae6b3a" + integrity sha512-wBrocU2LCXXa+lWBt8RoIRD89Fi8OdABODa/kEnyeyjS5aZO5/GNvI5sEINADqP/h8M29UHTHUb53sUu5Ihqdw== + dependencies: + reusify "^1.0.4" + +figures@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/figures/-/figures-2.0.0.tgz#3ab1a2d2a62c8bfb431a0c94cb797a2fce27c962" + integrity sha1-OrGi0qYsi/tDGgyUy3l6L84nyWI= + dependencies: + escape-string-regexp "^1.0.5" + +figures@^3.1.0, figures@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/figures/-/figures-3.2.0.tgz#625c18bd293c604dc4a8ddb2febf0c88341746af" + integrity sha512-yaduQFRKLXYOGgEn6AZau90j3ggSOyiqXU0F9JZfeXYhNa+Jk4X+s45A2zg5jns87GAFa34BBm2kXw4XpNcbdg== + dependencies: + escape-string-regexp "^1.0.5" + +file-entry-cache@^6.0.1: + version "6.0.1" + resolved "https://registry.yarnpkg.com/file-entry-cache/-/file-entry-cache-6.0.1.tgz#211b2dd9659cb0394b073e7323ac3c933d522027" + integrity sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg== + dependencies: + flat-cache "^3.0.4" + +file-type@^14.1.4: + version "14.7.1" + resolved "https://registry.yarnpkg.com/file-type/-/file-type-14.7.1.tgz#f748732b3e70478bff530e1cf0ec2fe33608b1bb" + integrity sha512-sXAMgFk67fQLcetXustxfKX+PZgHIUFn96Xld9uH8aXPdX3xOp0/jg9OdouVTvQrf7mrn+wAa4jN/y9fUOOiRA== + dependencies: + readable-web-to-node-stream "^2.0.0" + strtok3 "^6.0.3" + token-types "^2.0.0" + typedarray-to-buffer "^3.1.5" + +filename-reserved-regex@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/filename-reserved-regex/-/filename-reserved-regex-2.0.0.tgz#abf73dfab735d045440abfea2d91f389ebbfa229" + integrity sha512-lc1bnsSr4L4Bdif8Xb/qrtokGbq5zlsms/CYH8PP+WtCkGNF65DPiQY8vG3SakEdRn8Dlnm+gW/qWKKjS5sZzQ== + +filenamify@^4.3.0: + version "4.3.0" + resolved "https://registry.yarnpkg.com/filenamify/-/filenamify-4.3.0.tgz#62391cb58f02b09971c9d4f9d63b3cf9aba03106" + integrity sha512-hcFKyUG57yWGAzu1CMt/dPzYZuv+jAJUT85bL8mrXvNe6hWj6yEHEc4EdcgiA6Z3oi1/9wXJdZPXF2dZNgwgOg== + dependencies: + filename-reserved-regex "^2.0.0" + strip-outer "^1.0.1" + trim-repeated "^1.0.0" + +fill-range@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-4.0.0.tgz#d544811d428f98eb06a63dc402d2403c328c38f7" + integrity sha1-1USBHUKPmOsGpj3EAtJAPDKMOPc= + dependencies: + extend-shallow "^2.0.1" + is-number "^3.0.0" + repeat-string "^1.6.1" + to-regex-range "^2.1.0" + +fill-range@^7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-7.0.1.tgz#1919a6a7c75fe38b2c7c77e5198535da9acdda40" + integrity sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ== + dependencies: + to-regex-range "^5.0.1" + +finalhandler@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/finalhandler/-/finalhandler-1.2.0.tgz#7d23fe5731b207b4640e4fcd00aec1f9207a7b32" + integrity sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg== + dependencies: + debug "2.6.9" + encodeurl "~1.0.2" + escape-html "~1.0.3" + on-finished "2.4.1" + parseurl "~1.3.3" + statuses "2.0.1" + unpipe "~1.0.0" + +find-cache-dir@^3.2.0: + version "3.3.1" + resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-3.3.1.tgz#89b33fad4a4670daa94f855f7fbe31d6d84fe880" + integrity sha512-t2GDMt3oGC/v+BMwzmllWDuJF/xcDtE5j/fCGbqDD7OLuJkj0cfh1YSA5VKPvwMeLFLNDBkwOKZ2X85jGLVftQ== + dependencies: + commondir "^1.0.1" + make-dir "^3.0.2" + pkg-dir "^4.1.0" + +find-cache-dir@^3.3.1: + version "3.3.2" + resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-3.3.2.tgz#b30c5b6eff0730731aea9bbd9dbecbd80256d64b" + integrity sha512-wXZV5emFEjrridIgED11OoUKLxiYjAcqot/NJdAkOhlJ+vGzwhOAfcG5OX1jP+S0PcjEn8bdMJv+g2jwQ3Onig== + dependencies: + commondir "^1.0.1" + make-dir "^3.0.2" + pkg-dir "^4.1.0" + +find-node-modules@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/find-node-modules/-/find-node-modules-2.0.0.tgz#5db1fb9e668a3d451db3d618cd167cdd59e41b69" + integrity sha512-8MWIBRgJi/WpjjfVXumjPKCtmQ10B+fjx6zmSA+770GMJirLhWIzg8l763rhjl9xaeaHbnxPNRQKq2mgMhr+aw== + dependencies: + findup-sync "^3.0.0" + merge "^1.2.1" + +find-root@1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/find-root/-/find-root-1.1.0.tgz#abcfc8ba76f708c42a97b3d685b7e9450bfb9ce4" + integrity sha512-NKfW6bec6GfKc0SGx1e07QZY9PE99u0Bft/0rzSD5k3sO/vwkVUpDUKVm5Gpp5Ue3YfShPFTX2070tDs5kB9Ng== + +find-up@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7" + integrity sha512-NWzkk0jSJtTt08+FBFMvXoeZnOJD+jTtsRmBYbAIzJdX6l7dLgR7CTubCM5/eDdPUBvLCeVasP1brfVR/9/EZQ== + dependencies: + locate-path "^2.0.0" + +find-up@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-3.0.0.tgz#49169f1d7993430646da61ecc5ae355c21c97b73" + integrity sha512-1yD6RmLI1XBfxugvORwlck6f75tYL+iR0jqwsOrOxMZyGYqUuDhJ0l4AXdO1iX/FTs9cBAMEk1gWSEx1kSbylg== + dependencies: + locate-path "^3.0.0" + +find-up@^4.0.0, find-up@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-4.1.0.tgz#97afe7d6cdc0bc5928584b7c8d7b16e8a9aa5d19" + integrity sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw== + dependencies: + locate-path "^5.0.0" + path-exists "^4.0.0" + +find-up@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/find-up/-/find-up-5.0.0.tgz#4c92819ecb7083561e4f4a240a86be5198f536fc" + integrity sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng== + dependencies: + locate-path "^6.0.0" + path-exists "^4.0.0" + +find-versions@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/find-versions/-/find-versions-4.0.0.tgz#3c57e573bf97769b8cb8df16934b627915da4965" + integrity sha512-wgpWy002tA+wgmO27buH/9KzyEOQnKsG/R0yrcjPT9BOFm0zRBVQbZ95nRGXWMywS8YR5knRbpohio0bcJABxQ== + dependencies: + semver-regex "^3.1.2" + +findup-sync@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/findup-sync/-/findup-sync-3.0.0.tgz#17b108f9ee512dfb7a5c7f3c8b27ea9e1a9c08d1" + integrity sha512-YbffarhcicEhOrm4CtrwdKBdCuz576RLdhJDsIfvNtxUuhdRet1qZcsMjqbePtAseKdAnDyM/IyXbu7PRPRLYg== + dependencies: + detect-file "^1.0.0" + is-glob "^4.0.0" + micromatch "^3.0.4" + resolve-dir "^1.0.1" + +flat-cache@^3.0.4: + version "3.0.4" + resolved "https://registry.yarnpkg.com/flat-cache/-/flat-cache-3.0.4.tgz#61b0338302b2fe9f957dcc32fc2a87f1c3048b11" + integrity sha512-dm9s5Pw7Jc0GvMYbshN6zchCA9RgQlzzEZX3vylR9IqFfS8XciblUXOKfW6SiuJ0e13eDYZoZV5wdrev7P3Nwg== + dependencies: + flatted "^3.1.0" + rimraf "^3.0.2" + +flatted@^3.1.0: + version "3.2.7" + resolved "https://registry.yarnpkg.com/flatted/-/flatted-3.2.7.tgz#609f39207cb614b89d0765b477cb2d437fbf9787" + integrity sha512-5nqDSxl8nn5BSNxyR3n4I6eDmbolI6WT+QqR547RwxQapgjQBmtktdP+HTBb/a/zLsbzERTONyUB5pefh5TtjQ== + +for-each@^0.3.3: + version "0.3.3" + resolved "https://registry.yarnpkg.com/for-each/-/for-each-0.3.3.tgz#69b447e88a0a5d32c3e7084f3f1710034b21376e" + integrity sha512-jqYfLp7mo9vIyQf8ykW2v7A+2N4QjeCeI5+Dz9XraiO1ign81wjiH7Fb9vSOWvQfNtmSa4H2RoQTrrXivdUZmw== + dependencies: + is-callable "^1.1.3" + +for-in@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/for-in/-/for-in-1.0.2.tgz#81068d295a8142ec0ac726c6e2200c30fb6d5e80" + integrity sha1-gQaNKVqBQuwKxybG4iAMMPttXoA= + +foreground-child@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/foreground-child/-/foreground-child-2.0.0.tgz#71b32800c9f15aa8f2f83f4a6bd9bff35d861a53" + integrity sha512-dCIq9FpEcyQyXKCkyzmlPTFNgrCzPudOe+mhvJU5zAtlBnGVy2yKxtfsxK2tQBThwq225jcvBjpw1Gr40uzZCA== + dependencies: + cross-spawn "^7.0.0" + signal-exit "^3.0.2" + +form-data@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/form-data/-/form-data-4.0.0.tgz#93919daeaf361ee529584b9b31664dc12c9fa452" + integrity sha512-ETEklSGi5t0QMZuiXoA/Q6vcnxcLQP5vdugSpuAyi6SVGi2clPPp+xgEhuMaHC+zGgn31Kd235W35f7Hykkaww== + dependencies: + asynckit "^0.4.0" + combined-stream "^1.0.8" + mime-types "^2.1.12" + +formidable@^2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/formidable/-/formidable-2.1.2.tgz#fa973a2bec150e4ce7cac15589d7a25fc30ebd89" + integrity sha512-CM3GuJ57US06mlpQ47YcunuUZ9jpm8Vx+P2CGt2j7HpgkKZO/DJYQ0Bobim8G6PFQmK5lOqOOdUXboU+h73A4g== + dependencies: + dezalgo "^1.0.4" + hexoid "^1.0.0" + once "^1.4.0" + qs "^6.11.0" + +forwarded@0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/forwarded/-/forwarded-0.2.0.tgz#2269936428aad4c15c7ebe9779a84bf0b2a81811" + integrity sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow== + +fragment-cache@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/fragment-cache/-/fragment-cache-0.2.1.tgz#4290fad27f13e89be7f33799c6bc5a0abfff0d19" + integrity sha1-QpD60n8T6Jvn8zeZxrxaCr//DRk= + dependencies: + map-cache "^0.2.2" + +fresh@0.5.2: + version "0.5.2" + resolved "https://registry.yarnpkg.com/fresh/-/fresh-0.5.2.tgz#3d8cadd90d976569fa835ab1f8e4b23a105605a7" + integrity sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q== + +fromentries@^1.2.0: + version "1.3.2" + resolved "https://registry.yarnpkg.com/fromentries/-/fromentries-1.3.2.tgz#e4bca6808816bf8f93b52750f1127f5a6fd86e3a" + integrity sha512-cHEpEQHUg0f8XdtZCc2ZAhrHzKzT0MrFUTcvx+hfxYu7rGMDc5SKoXFh+n4YigxsHXRzc6OrCshdR1bWH6HHyg== + +fs-extra@8.1.0, fs-extra@^8.1.0: + version "8.1.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-8.1.0.tgz#49d43c45a88cd9677668cb7be1b46efdb8d2e1c0" + integrity sha512-yhlQgA6mnOJUKOsRUFsgJdQCvkKhcz8tlZG5HBQfReYZy46OwLcY+Zia0mtdHsOo9y/hP+CxMN0TU9QxoOtG4g== + dependencies: + graceful-fs "^4.2.0" + jsonfile "^4.0.0" + universalify "^0.1.0" + +fs-extra@^9.0.0, fs-extra@^9.0.1, fs-extra@^9.1.0: + version "9.1.0" + resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-9.1.0.tgz#5954460c764a8da2094ba3554bf839e6b9a7c86d" + integrity sha512-hcg3ZmepS30/7BSFqRvoo3DOMQu7IjqxO5nCDt+zM9XWjb33Wg7ziNT+Qvqbuc3+gWpzO02JubVyk2G4Zvo1OQ== + dependencies: + at-least-node "^1.0.0" + graceful-fs "^4.2.0" + jsonfile "^6.0.1" + universalify "^2.0.0" + +fs.realpath@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" + integrity sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw== + +fsevents@~2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/fsevents/-/fsevents-2.3.1.tgz#b209ab14c61012636c8863507edf7fb68cc54e9f" + integrity sha512-YR47Eg4hChJGAB1O3yEAOkGO+rlzutoICGqGo9EZ4lKWokzZRSyIW1QmTzqjtw8MJdj9srP869CuWw/hyzSiBw== + +function-bind@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d" + integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A== + +function.prototype.name@^1.1.5: + version "1.1.5" + resolved "https://registry.yarnpkg.com/function.prototype.name/-/function.prototype.name-1.1.5.tgz#cce0505fe1ffb80503e6f9e46cc64e46a12a9621" + integrity sha512-uN7m/BzVKQnCUF/iW8jYea67v++2u7m5UgENbHRtdDVclOUP+FMPlCNdmk0h/ysGyo2tavMJEDqJAkJdRa1vMA== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.3" + es-abstract "^1.19.0" + functions-have-names "^1.2.2" + +functional-red-black-tree@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/functional-red-black-tree/-/functional-red-black-tree-1.0.1.tgz#1b0ab3bd553b2a0d6399d29c0e3ea0b252078327" + integrity sha512-dsKNQNdj6xA3T+QlADDA7mOSlX0qiMINjn0cgr+eGHGsbSHzTabcIogz2+p/iqP1Xs6EP/sS2SbqH+brGTbq0g== + +functions-have-names@^1.2.2: + version "1.2.3" + resolved "https://registry.yarnpkg.com/functions-have-names/-/functions-have-names-1.2.3.tgz#0404fe4ee2ba2f607f0e0ec3c80bae994133b834" + integrity sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ== + +gensequence@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/gensequence/-/gensequence-3.1.1.tgz#95c1afc7c0680f92942c17f2d6f83f3d26ea97af" + integrity sha512-ys3h0hiteRwmY6BsvSttPmkhC0vEQHPJduANBRtH/dlDPZ0UBIb/dXy80IcckXyuQ6LKg+PloRqvGER9IS7F7g== + +gensync@^1.0.0-beta.1: + version "1.0.0-beta.2" + resolved "https://registry.yarnpkg.com/gensync/-/gensync-1.0.0-beta.2.tgz#32a6ee76c3d7f52d46b2b1ae5d93fea8580a25e0" + integrity sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg== + +get-caller-file@^2.0.1, get-caller-file@^2.0.5: + version "2.0.5" + resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-2.0.5.tgz#4f94412a82db32f36e3b0b9741f8a97feb031f7e" + integrity sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg== + +get-intrinsic@^1.0.2, get-intrinsic@^1.1.1, get-intrinsic@^1.1.3, get-intrinsic@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/get-intrinsic/-/get-intrinsic-1.2.0.tgz#7ad1dc0535f3a2904bba075772763e5051f6d05f" + integrity sha512-L049y6nFOuom5wGyRc3/gdTLO94dySVKRACj1RmJZBQXlbTMhtNIgkWkUHq+jYmZvKf14EW1EoJnnjbmoHij0Q== + dependencies: + function-bind "^1.1.1" + has "^1.0.3" + has-symbols "^1.0.3" + +get-own-enumerable-property-symbols@^3.0.0: + version "3.0.2" + resolved "https://registry.yarnpkg.com/get-own-enumerable-property-symbols/-/get-own-enumerable-property-symbols-3.0.2.tgz#b5fde77f22cbe35f390b4e089922c50bce6ef664" + integrity sha512-I0UBV/XOz1XkIJHEUDMZAbzCThU/H8DxmSfmdGcKPnVhu2VfFqr34jr9777IyaTYvxjedWhqVIilEDsCdP5G6g== + +get-package-type@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/get-package-type/-/get-package-type-0.1.0.tgz#8de2d803cff44df3bc6c456e6668b36c3926e11a" + integrity sha512-pjzuKtY64GYfWizNAJ0fr9VqttZkNiK2iS430LtIHzjBEr6bX8Am2zm4sW4Ro5wjWW5cAlRL1qAMTcXbjNAO2Q== + +get-pkg-repo@^4.0.0: + version "4.2.1" + resolved "https://registry.yarnpkg.com/get-pkg-repo/-/get-pkg-repo-4.2.1.tgz#75973e1c8050c73f48190c52047c4cee3acbf385" + integrity sha512-2+QbHjFRfGB74v/pYWjd5OhU3TDIC2Gv/YKUTk/tCvAz0pkn/Mz6P3uByuBimLOcPvN2jYdScl3xGFSrx0jEcA== + dependencies: + "@hutson/parse-repository-url" "^3.0.0" + hosted-git-info "^4.0.0" + through2 "^2.0.0" + yargs "^16.2.0" + +get-stdin@8.0.0, get-stdin@^8.0.0: + version "8.0.0" + resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-8.0.0.tgz#cbad6a73feb75f6eeb22ba9e01f89aa28aa97a53" + integrity sha512-sY22aA6xchAzprjyqmSEQv4UbAAzRN0L2dQB0NlN5acTTK9Don6nhoc3eAbUnpZiCANAMfd/+40kVdKfFygohg== + +get-stdin@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-7.0.0.tgz#8d5de98f15171a125c5e516643c7a6d0ea8a96f6" + integrity sha512-zRKcywvrXlXsA0v0i9Io4KDRaAw7+a1ZpjRwl9Wox8PFlVCCHra7E9c4kqXCoCM9nR5tBkaTTZRBoCm60bFqTQ== + +get-stream@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-4.1.0.tgz#c1b255575f3dc21d59bfc79cd3d2b46b1c3a54b5" + integrity sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w== + dependencies: + pump "^3.0.0" + +get-stream@^5.0.0, get-stream@^5.1.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-5.2.0.tgz#4966a1795ee5ace65e706c4b7beb71257d6e22d3" + integrity sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA== + dependencies: + pump "^3.0.0" + +get-symbol-description@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/get-symbol-description/-/get-symbol-description-1.0.0.tgz#7fdb81c900101fbd564dd5f1a30af5aadc1e58d6" + integrity sha512-2EmdH1YvIQiZpltCNgkuiUnyukzxM/R6NDJX31Ke3BG1Nq5b0S2PhX59UKi9vZpPDQVdqn+1IcaAwnzTT5vCjw== + dependencies: + call-bind "^1.0.2" + get-intrinsic "^1.1.1" + +get-value@^2.0.3, get-value@^2.0.6: + version "2.0.6" + resolved "https://registry.yarnpkg.com/get-value/-/get-value-2.0.6.tgz#dc15ca1c672387ca76bd37ac0a395ba2042a2c28" + integrity sha1-3BXKHGcjh8p2vTesCjlbogQqLCg= + +gh-pages@^3.1.0: + version "3.2.3" + resolved "https://registry.yarnpkg.com/gh-pages/-/gh-pages-3.2.3.tgz#897e5f15e111f42af57d21d430b83e5cdf29472c" + integrity sha512-jA1PbapQ1jqzacECfjUaO9gV8uBgU6XNMV0oXLtfCX3haGLe5Atq8BxlrADhbD6/UdG9j6tZLWAkAybndOXTJg== + dependencies: + async "^2.6.1" + commander "^2.18.0" + email-addresses "^3.0.1" + filenamify "^4.3.0" + find-cache-dir "^3.3.1" + fs-extra "^8.1.0" + globby "^6.1.0" + +git-raw-commits@^2.0.0: + version "2.0.10" + resolved "https://registry.yarnpkg.com/git-raw-commits/-/git-raw-commits-2.0.10.tgz#e2255ed9563b1c9c3ea6bd05806410290297bbc1" + integrity sha512-sHhX5lsbG9SOO6yXdlwgEMQ/ljIn7qMpAbJZCGfXX2fq5T8M5SrDnpYk9/4HswTildcIqatsWa91vty6VhWSaQ== + dependencies: + dargs "^7.0.0" + lodash "^4.17.15" + meow "^8.0.0" + split2 "^3.0.0" + through2 "^4.0.0" + +git-raw-commits@^2.0.8: + version "2.0.11" + resolved "https://registry.yarnpkg.com/git-raw-commits/-/git-raw-commits-2.0.11.tgz#bc3576638071d18655e1cc60d7f524920008d723" + integrity sha512-VnctFhw+xfj8Va1xtfEqCUD2XDrbAPSJx+hSrE5K7fGdjZruW7XV+QOrN7LF/RJyvspRiD2I0asWsxFp0ya26A== + dependencies: + dargs "^7.0.0" + lodash "^4.17.15" + meow "^8.0.0" + split2 "^3.0.0" + through2 "^4.0.0" + +git-remote-origin-url@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/git-remote-origin-url/-/git-remote-origin-url-2.0.0.tgz#5282659dae2107145a11126112ad3216ec5fa65f" + integrity sha512-eU+GGrZgccNJcsDH5LkXR3PB9M958hxc7sbA8DFJjrv9j4L2P/eZfKhM+QD6wyzpiv+b1BpK0XrYCxkovtjSLw== + dependencies: + gitconfiglocal "^1.0.0" + pify "^2.3.0" + +git-semver-tags@^4.0.0, git-semver-tags@^4.1.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/git-semver-tags/-/git-semver-tags-4.1.1.tgz#63191bcd809b0ec3e151ba4751c16c444e5b5780" + integrity sha512-OWyMt5zBe7xFs8vglMmhM9lRQzCWL3WjHtxNNfJTMngGym7pC1kh8sP6jevfydJ6LP3ZvGxfb6ABYgPUM0mtsA== + dependencies: + meow "^8.0.0" + semver "^6.0.0" + +gitconfiglocal@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/gitconfiglocal/-/gitconfiglocal-1.0.0.tgz#41d045f3851a5ea88f03f24ca1c6178114464b9b" + integrity sha512-spLUXeTAVHxDtKsJc8FkFVgFtMdEN9qPGpL23VfSHx4fP4+Ds097IXLvymbnDH8FnmxX5Nr9bPw3A+AQ6mWEaQ== + dependencies: + ini "^1.3.2" + +glob-parent@^5.1.2: + version "5.1.2" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4" + integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow== + dependencies: + is-glob "^4.0.1" + +glob-parent@~5.1.0: + version "5.1.1" + resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.1.tgz#b6c1ef417c4e5663ea498f1c45afac6916bbc229" + integrity sha512-FnI+VGOpnlGHWZxthPGR+QhR78fuiK0sNLkHQv+bL9fQi57lNNdquIbna/WrfROrolq8GK5Ek6BiMwqL/voRYQ== + dependencies: + is-glob "^4.0.1" + +glob@7.1.4: + version "7.1.4" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.4.tgz#aa608a2f6c577ad357e1ae5a5c26d9a8d1969255" + integrity sha512-hkLPepehmnKk41pUGm3sYxoFs/umurYfYJCerbXEyFIWcAzvpipAgVkBqqT9RBKMGjnq6kMuyYwha6csxbiM1A== + dependencies: + fs.realpath "^1.0.0" + inflight "^1.0.4" + inherits "2" + minimatch "^3.0.4" + once "^1.3.0" + path-is-absolute "^1.0.0" + +glob@^7.0.0, glob@^7.0.3, glob@^7.1.3, glob@^7.1.6: + version "7.2.3" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.2.3.tgz#b8df0fb802bbfa8e89bd1d938b4e16578ed44f2b" + integrity sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q== + dependencies: + fs.realpath "^1.0.0" + inflight "^1.0.4" + inherits "2" + minimatch "^3.1.1" + once "^1.3.0" + path-is-absolute "^1.0.0" + +glob@^7.1.4: + version "7.1.6" + resolved "https://registry.yarnpkg.com/glob/-/glob-7.1.6.tgz#141f33b81a7c2492e125594307480c46679278a6" + integrity sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA== + dependencies: + fs.realpath "^1.0.0" + inflight "^1.0.4" + inherits "2" + minimatch "^3.0.4" + once "^1.3.0" + path-is-absolute "^1.0.0" + +global-dirs@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-0.1.1.tgz#b319c0dd4607f353f3be9cca4c72fc148c49f445" + integrity sha512-NknMLn7F2J7aflwFOlGdNIuCDpN3VGoSoB+aap3KABFWbHVn1TCgFC+np23J8W2BiZbjfEw3BFBycSMv1AFblg== + dependencies: + ini "^1.3.4" + +global-dirs@^2.0.1: + version "2.1.0" + resolved "https://registry.yarnpkg.com/global-dirs/-/global-dirs-2.1.0.tgz#e9046a49c806ff04d6c1825e196c8f0091e8df4d" + integrity sha512-MG6kdOUh/xBnyo9cJFeIKkLEc1AyFq42QTU4XiX51i2NEdxLxLWXIjEjmqKeSuKR7pAZjTqUVoT2b2huxVLgYQ== + dependencies: + ini "1.3.7" + +global-modules@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/global-modules/-/global-modules-1.0.0.tgz#6d770f0eb523ac78164d72b5e71a8877265cc3ea" + integrity sha512-sKzpEkf11GpOFuw0Zzjzmt4B4UZwjOcG757PPvrfhxcLFbq0wpsgpOqxpxtxFiCG4DtG93M6XRVbF2oGdev7bg== + dependencies: + global-prefix "^1.0.1" + is-windows "^1.0.1" + resolve-dir "^1.0.0" + +global-prefix@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/global-prefix/-/global-prefix-1.0.2.tgz#dbf743c6c14992593c655568cb66ed32c0122ebe" + integrity sha1-2/dDxsFJklk8ZVVoy2btMsASLr4= + dependencies: + expand-tilde "^2.0.2" + homedir-polyfill "^1.0.1" + ini "^1.3.4" + is-windows "^1.0.1" + which "^1.2.14" + +globals@^11.1.0: + version "11.12.0" + resolved "https://registry.yarnpkg.com/globals/-/globals-11.12.0.tgz#ab8795338868a0babd8525758018c2a7eb95c42e" + integrity sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA== + +globals@^13.6.0, globals@^13.9.0: + version "13.20.0" + resolved "https://registry.yarnpkg.com/globals/-/globals-13.20.0.tgz#ea276a1e508ffd4f1612888f9d1bad1e2717bf82" + integrity sha512-Qg5QtVkCy/kv3FUSlu4ukeZDVf9ee0iXLAUYX13gbR17bnejFTzr4iS9bY7kwCf1NztRNm1t91fjOiyx4CSwPQ== + dependencies: + type-fest "^0.20.2" + +globalthis@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/globalthis/-/globalthis-1.0.3.tgz#5852882a52b80dc301b0660273e1ed082f0b6ccf" + integrity sha512-sFdI5LyBiNTHjRd7cGPWapiHWMOXKyuBNX/cWJ3NfzrZQVa8GI/8cofCl74AOVqq9W5kNmguTIzJ/1s2gyI9wA== + dependencies: + define-properties "^1.1.3" + +globby@^11.0.1, globby@^11.0.3: + version "11.1.0" + resolved "https://registry.yarnpkg.com/globby/-/globby-11.1.0.tgz#bd4be98bb042f83d796f7e3811991fbe82a0d34b" + integrity sha512-jhIXaOzy1sb8IyocaruWSn1TjmnBVs8Ayhcy83rmxNJ8q2uWKCAj3CnJY+KpGSXCueAPc0i05kVvVKtP1t9S3g== + dependencies: + array-union "^2.1.0" + dir-glob "^3.0.1" + fast-glob "^3.2.9" + ignore "^5.2.0" + merge2 "^1.4.1" + slash "^3.0.0" + +globby@^6.1.0: + version "6.1.0" + resolved "https://registry.yarnpkg.com/globby/-/globby-6.1.0.tgz#f5a6d70e8395e21c858fb0489d64df02424d506c" + integrity sha512-KVbFv2TQtbzCoxAnfD6JcHZTYCzyliEaaeM/gH8qQdkKr5s0OP9scEgvdcngyk7AVdY6YVW/TJHd+lQ/Df3Daw== + dependencies: + array-union "^1.0.1" + glob "^7.0.3" + object-assign "^4.0.1" + pify "^2.0.0" + pinkie-promise "^2.0.0" + +gopd@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/gopd/-/gopd-1.0.1.tgz#29ff76de69dac7489b7c0918a5788e56477c332c" + integrity sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA== + dependencies: + get-intrinsic "^1.1.3" + +got@^9.6.0: + version "9.6.0" + resolved "https://registry.yarnpkg.com/got/-/got-9.6.0.tgz#edf45e7d67f99545705de1f7bbeeeb121765ed85" + integrity sha512-R7eWptXuGYxwijs0eV+v3o6+XH1IqVK8dJOEecQfTmkncw9AV4dcw/Dhxi8MdlqPthxxpZyizMzyg8RTmEsG+Q== + dependencies: + "@sindresorhus/is" "^0.14.0" + "@szmarczak/http-timer" "^1.1.2" + cacheable-request "^6.0.0" + decompress-response "^3.3.0" + duplexer3 "^0.1.4" + get-stream "^4.1.0" + lowercase-keys "^1.0.1" + mimic-response "^1.0.1" + p-cancelable "^1.0.0" + to-readable-stream "^1.0.0" + url-parse-lax "^3.0.0" + +graceful-fs@^4.1.15, graceful-fs@^4.2.4: + version "4.2.4" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.4.tgz#2256bde14d3632958c465ebc96dc467ca07a29fb" + integrity sha512-WjKPNJF79dtJAVniUlGGWHYGz2jWxT6VhN/4m1NdkbZ2nOsEF+cI1Edgql5zCRhs/VsQYRvrXctxktVXZUkixw== + +graceful-fs@^4.1.2, graceful-fs@^4.1.6, graceful-fs@^4.2.0: + version "4.2.10" + resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.10.tgz#147d3a006da4ca3ce14728c7aefc287c367d7a6c" + integrity sha512-9ByhssR2fPVsNZj478qUUbKfmL0+t5BDVyjShtyZZLiK7ZDAArFFfopyOTj0M05wE2tJPisA4iTnnXl2YoPvOA== + +handlebars@^4.7.6, handlebars@^4.7.7: + version "4.7.7" + resolved "https://registry.yarnpkg.com/handlebars/-/handlebars-4.7.7.tgz#9ce33416aad02dbd6c8fafa8240d5d98004945a1" + integrity sha512-aAcXm5OAfE/8IXkcZvCepKU3VzW1/39Fb5ZuqMtgI/hT8X2YgoMvBY5dLhq/cpOvw7Lk1nK/UF71aLG/ZnVYRA== + dependencies: + minimist "^1.2.5" + neo-async "^2.6.0" + source-map "^0.6.1" + wordwrap "^1.0.0" + optionalDependencies: + uglify-js "^3.1.4" + +hard-rejection@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/hard-rejection/-/hard-rejection-2.1.0.tgz#1c6eda5c1685c63942766d79bb40ae773cecd883" + integrity sha512-VIZB+ibDhx7ObhAe7OVtoEbuP4h/MuOTHJ+J8h/eBXotJYl0fBgR72xDFCKgIh22OJZIOVNxBMWuhAr10r8HdA== + +has-bigints@^1.0.1, has-bigints@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/has-bigints/-/has-bigints-1.0.2.tgz#0871bd3e3d51626f6ca0966668ba35d5602d6eaa" + integrity sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ== + +has-flag@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-3.0.0.tgz#b5d454dc2199ae225699f3467e5a07f3b955bafd" + integrity sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw== + +has-flag@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b" + integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ== + +has-own-prop@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/has-own-prop/-/has-own-prop-2.0.0.tgz#f0f95d58f65804f5d218db32563bb85b8e0417af" + integrity sha512-Pq0h+hvsVm6dDEa8x82GnLSYHOzNDt7f0ddFa3FqcQlgzEiptPqL+XrOJNavjOzSYiYWIrgeVYYgGlLmnxwilQ== + +has-property-descriptors@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-property-descriptors/-/has-property-descriptors-1.0.0.tgz#610708600606d36961ed04c196193b6a607fa861" + integrity sha512-62DVLZGoiEBDHQyqG4w9xCuZ7eJEwNmJRWw2VY84Oedb7WFcA27fiEVe8oUQx9hAUJ4ekurquucTGwsyO1XGdQ== + dependencies: + get-intrinsic "^1.1.1" + +has-proto@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/has-proto/-/has-proto-1.0.1.tgz#1885c1305538958aff469fef37937c22795408e0" + integrity sha512-7qE+iP+O+bgF9clE5+UoBFzE65mlBiVj3tKCrlNQ0Ogwm0BjpT/gK4SlLYDMybDh5I3TCTKnPPa0oMG7JDYrhg== + +has-symbols@^1.0.2, has-symbols@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.3.tgz#bb7b2c4349251dce87b125f7bdf874aa7c8b39f8" + integrity sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A== + +has-tostringtag@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-tostringtag/-/has-tostringtag-1.0.0.tgz#7e133818a7d394734f941e73c3d3f9291e658b25" + integrity sha512-kFjcSNhnlGV1kyoGk7OXKSawH5JOb/LzUc5w9B02hOTO0dfFRjbHQKvg1d6cf3HbeUmtU9VbbV3qzZ2Teh97WQ== + dependencies: + has-symbols "^1.0.2" + +has-value@^0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/has-value/-/has-value-0.3.1.tgz#7b1f58bada62ca827ec0a2078025654845995e1f" + integrity sha1-ex9YutpiyoJ+wKIHgCVlSEWZXh8= + dependencies: + get-value "^2.0.3" + has-values "^0.1.4" + isobject "^2.0.0" + +has-value@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-value/-/has-value-1.0.0.tgz#18b281da585b1c5c51def24c930ed29a0be6b177" + integrity sha1-GLKB2lhbHFxR3vJMkw7SmgvmsXc= + dependencies: + get-value "^2.0.6" + has-values "^1.0.0" + isobject "^3.0.0" + +has-values@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/has-values/-/has-values-0.1.4.tgz#6d61de95d91dfca9b9a02089ad384bff8f62b771" + integrity sha1-bWHeldkd/Km5oCCJrThL/49it3E= + +has-values@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/has-values/-/has-values-1.0.0.tgz#95b0b63fec2146619a6fe57fe75628d5a39efe4f" + integrity sha1-lbC2P+whRmGab+V/51Yo1aOe/k8= + dependencies: + is-number "^3.0.0" + kind-of "^4.0.0" + +has-yarn@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/has-yarn/-/has-yarn-2.1.0.tgz#137e11354a7b5bf11aa5cb649cf0c6f3ff2b2e77" + integrity sha512-UqBRqi4ju7T+TqGNdqAO0PaSVGsDGJUBQvk9eUWNGRY1CFGDzYhLWoM7JQEemnlvVcv/YEmc2wNW8BC24EnUsw== + +has@^1.0.3: + version "1.0.3" + resolved "https://registry.yarnpkg.com/has/-/has-1.0.3.tgz#722d7cbfc1f6aa8241f16dd814e011e1f41e8796" + integrity sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw== + dependencies: + function-bind "^1.1.1" + +hasha@^5.0.0: + version "5.2.2" + resolved "https://registry.yarnpkg.com/hasha/-/hasha-5.2.2.tgz#a48477989b3b327aea3c04f53096d816d97522a1" + integrity sha512-Hrp5vIK/xr5SkeN2onO32H0MgNZ0f17HRNH39WfL0SYUNOTZ5Lz1TJ8Pajo/87dYGEFlLMm7mIc/k/s6Bvz9HQ== + dependencies: + is-stream "^2.0.0" + type-fest "^0.8.0" + +hexoid@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/hexoid/-/hexoid-1.0.0.tgz#ad10c6573fb907de23d9ec63a711267d9dc9bc18" + integrity sha512-QFLV0taWQOZtvIRIAdBChesmogZrtuXvVWsFHZTk2SU+anspqZ2vMnoLg7IE1+Uk16N19APic1BuF8bC8c2m5g== + +highlight.js@^10.2.0: + version "10.5.0" + resolved "https://registry.yarnpkg.com/highlight.js/-/highlight.js-10.5.0.tgz#3f09fede6a865757378f2d9ebdcbc15ba268f98f" + integrity sha512-xTmvd9HiIHR6L53TMC7TKolEj65zG1XU+Onr8oi86mYa+nLcIbxTTWkpW7CsEwv/vK7u1zb8alZIMLDqqN6KTw== + +homedir-polyfill@^1.0.1: + version "1.0.3" + resolved "https://registry.yarnpkg.com/homedir-polyfill/-/homedir-polyfill-1.0.3.tgz#743298cef4e5af3e194161fbadcc2151d3a058e8" + integrity sha512-eSmmWE5bZTK2Nou4g0AI3zZ9rswp7GRKoKXS1BLUkvPviOqs4YTN1djQIqrXy9k5gEtdLPy86JjRwsNM9tnDcA== + dependencies: + parse-passwd "^1.0.0" + +hosted-git-info@^2.1.4: + version "2.8.9" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-2.8.9.tgz#dffc0bf9a21c02209090f2aa69429e1414daf3f9" + integrity sha512-mxIDAb9Lsm6DoOJ7xH+5+X4y1LU/4Hi50L9C5sIswK3JzULS4bwk1FvjdBgvYR4bzT4tuUQiC15FE2f5HbLvYw== + +hosted-git-info@^4.0.0, hosted-git-info@^4.0.1: + version "4.1.0" + resolved "https://registry.yarnpkg.com/hosted-git-info/-/hosted-git-info-4.1.0.tgz#827b82867e9ff1c8d0c4d9d53880397d2c86d224" + integrity sha512-kyCuEOWjJqZuDbRHzL8V93NzQhwIB71oFWSyzVo+KPZI+pnQPPxucdkrOZvkLRnrf5URsQM+IJ09Dw29cRALIA== + dependencies: + lru-cache "^6.0.0" + +html-escaper@^2.0.0: + version "2.0.2" + resolved "https://registry.yarnpkg.com/html-escaper/-/html-escaper-2.0.2.tgz#dfd60027da36a36dfcbe236262c00a5822681453" + integrity sha512-H2iMtd0I4Mt5eYiapRdIDjp+XzelXQ0tFE4JS7YFwFevXXMmOp9myNrUvCg0D6ws8iqkRPBfKHgbwig1SmlLfg== + +http-cache-semantics@^4.0.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/http-cache-semantics/-/http-cache-semantics-4.1.0.tgz#49e91c5cbf36c9b94bcfcd71c23d5249ec74e390" + integrity sha512-carPklcUh7ROWRK7Cv27RPtdhYhUsela/ue5/jKzjegVvXDqM2ILE9Q2BGn9JZJh1g87cp56su/FgQSzcWS8cQ== + +http-errors@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/http-errors/-/http-errors-2.0.0.tgz#b7774a1486ef73cf7667ac9ae0858c012c57b9d3" + integrity sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ== + dependencies: + depd "2.0.0" + inherits "2.0.4" + setprototypeof "1.2.0" + statuses "2.0.1" + toidentifier "1.0.1" + +http-proxy-agent@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/http-proxy-agent/-/http-proxy-agent-4.0.1.tgz#8a8c8ef7f5932ccf953c296ca8291b95aa74aa3a" + integrity sha512-k0zdNgqWTGA6aeIRVpvfVob4fL52dTfaehylg0Y4UvSySvOq/Y+BOyPrgpUrA7HylqvU8vIZGsRuXmspskV0Tg== + dependencies: + "@tootallnate/once" "1" + agent-base "6" + debug "4" + +https-proxy-agent@^5.0.0: + version "5.0.1" + resolved "https://registry.yarnpkg.com/https-proxy-agent/-/https-proxy-agent-5.0.1.tgz#c59ef224a04fe8b754f3db0063a25ea30d0005d6" + integrity sha512-dFcAjpTQFgoLMzC2VwU+C/CbS7uRL0lWmxDITmqm7C+7F0Odmj6s9l6alZc6AELXhrnggM2CeWSXHGOdX2YtwA== + dependencies: + agent-base "6" + debug "4" + +human-signals@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/human-signals/-/human-signals-1.1.1.tgz#c5b1cd14f50aeae09ab6c59fe63ba3395fe4dfa3" + integrity sha512-SEQu7vl8KjNL2eoGBLF3+wAjpsNfA9XMlXAYj/3EdaNfAlxKthD1xjEQfGOUhllCGGJVNY34bRr6lPINhNjyZw== + +husky@4: + version "4.3.8" + resolved "https://registry.yarnpkg.com/husky/-/husky-4.3.8.tgz#31144060be963fd6850e5cc8f019a1dfe194296d" + integrity sha512-LCqqsB0PzJQ/AlCgfrfzRe3e3+NvmefAdKQhRYpxS4u6clblBoDdzzvHi8fmxKRzvMxPY/1WZWzomPZww0Anow== + dependencies: + chalk "^4.0.0" + ci-info "^2.0.0" + compare-versions "^3.6.0" + cosmiconfig "^7.0.0" + find-versions "^4.0.0" + opencollective-postinstall "^2.0.2" + pkg-dir "^5.0.0" + please-upgrade-node "^3.2.0" + slash "^3.0.0" + which-pm-runs "^1.0.0" + +iconv-lite@0.4.24, iconv-lite@^0.4.24: + version "0.4.24" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.4.24.tgz#2022b4b25fbddc21d2f524974a474aafe733908b" + integrity sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA== + dependencies: + safer-buffer ">= 2.1.2 < 3" + +iconv-lite@^0.6.2: + version "0.6.3" + resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.6.3.tgz#a52f80bf38da1952eb5c681790719871a1a72501" + integrity sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw== + dependencies: + safer-buffer ">= 2.1.2 < 3.0.0" + +ieee754@^1.1.13: + version "1.2.1" + resolved "https://registry.yarnpkg.com/ieee754/-/ieee754-1.2.1.tgz#8eb7a10a63fff25d15a57b001586d177d1b0d352" + integrity sha512-dcyqhDvX1C46lXZcVqCpK+FtMRQVdIMN6/Df5js2zouUsqG7I6sFxitIC+7KYK29KdXOLHdu9zL4sFnoVQnqaA== + +ignore-by-default@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ignore-by-default/-/ignore-by-default-2.0.0.tgz#537092018540640459569fe7c8c7a408af581146" + integrity sha512-+mQSgMRiFD3L3AOxLYOCxjIq4OnAmo5CIuC+lj5ehCJcPtV++QacEV7FdpzvYxH6DaOySWzQU6RR0lPLy37ckA== + +ignore-walk@3.0.4: + version "3.0.4" + resolved "https://registry.yarnpkg.com/ignore-walk/-/ignore-walk-3.0.4.tgz#c9a09f69b7c7b479a5d74ac1a3c0d4236d2a6335" + integrity sha512-PY6Ii8o1jMRA1z4F2hRkH/xN59ox43DavKvD3oDpfurRlOJyAHpifIwpbdv1n4jt4ov0jSpw3kQ4GhJnpBL6WQ== + dependencies: + minimatch "^3.0.4" + +ignore@^4.0.6: + version "4.0.6" + resolved "https://registry.yarnpkg.com/ignore/-/ignore-4.0.6.tgz#750e3db5862087b4737ebac8207ffd1ef27b25fc" + integrity sha512-cyFDKrqc/YdcWFniJhzI42+AzS+gNwmUzOSFcRCQYwySuBBBy/KjuxWLZ/FHEH6Moq1NizMOBWyTcv8O4OZIMg== + +ignore@^5.0.5, ignore@^5.1.1: + version "5.1.8" + resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.1.8.tgz#f150a8b50a34289b33e22f5889abd4d8016f0e57" + integrity sha512-BMpfD7PpiETpBl/A6S498BaIJ6Y/ABT93ETbby2fP00v4EbvPBXWEoaR1UBPKs3iR53pJY7EtZk5KACI57i1Uw== + +ignore@^5.1.8, ignore@^5.2.0: + version "5.2.4" + resolved "https://registry.yarnpkg.com/ignore/-/ignore-5.2.4.tgz#a291c0c6178ff1b960befe47fcdec301674a6324" + integrity sha512-MAb38BcSbH0eHNBxn7ql2NH/kX33OkB3lZ1BNdh7ENeRChHTYsTvWrMubiIAMNS2llXEEgZ1MUOBtXChP3kaFQ== + +import-fresh@^3.0.0, import-fresh@^3.2.1: + version "3.3.0" + resolved "https://registry.yarnpkg.com/import-fresh/-/import-fresh-3.3.0.tgz#37162c25fcb9ebaa2e6e53d5b4d88ce17d9e0c2b" + integrity sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw== + dependencies: + parent-module "^1.0.0" + resolve-from "^4.0.0" + +import-lazy@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/import-lazy/-/import-lazy-2.1.0.tgz#05698e3d45c88e8d7e9d92cb0584e77f096f3e43" + integrity sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM= + +import-local@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/import-local/-/import-local-3.0.2.tgz#a8cfd0431d1de4a2199703d003e3e62364fa6db6" + integrity sha512-vjL3+w0oulAVZ0hBHnxa/Nm5TAurf9YLQJDhqRZyqb+VKGOB6LU8t9H1Nr5CIo16vh9XfJTOoHwU0B71S557gA== + dependencies: + pkg-dir "^4.2.0" + resolve-cwd "^3.0.0" + +imurmurhash@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea" + integrity sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA== + +indent-string@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-4.0.0.tgz#624f8f4497d619b2d9768531d58f4122854d7251" + integrity sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg== + +inflight@^1.0.4: + version "1.0.6" + resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9" + integrity sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA== + dependencies: + once "^1.3.0" + wrappy "1" + +inherits@2, inherits@2.0.4, inherits@^2.0.1, inherits@^2.0.3, inherits@^2.0.4, inherits@~2.0.3: + version "2.0.4" + resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c" + integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ== + +ini@1.3.7: + version "1.3.7" + resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.7.tgz#a09363e1911972ea16d7a8851005d84cf09a9a84" + integrity sha512-iKpRpXP+CrP2jyrxvg1kMUpXDyRUFDWurxbnVT1vQPx+Wz9uCYsMIqYuSBLV+PAaZG/d7kRLKRFc9oDMsH+mFQ== + +ini@^1.3.2, ini@^1.3.4, ini@~1.3.0: + version "1.3.8" + resolved "https://registry.yarnpkg.com/ini/-/ini-1.3.8.tgz#a29da425b48806f34767a4efce397269af28432c" + integrity sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew== + +inquirer@6.5.2: + version "6.5.2" + resolved "https://registry.yarnpkg.com/inquirer/-/inquirer-6.5.2.tgz#ad50942375d036d327ff528c08bd5fab089928ca" + integrity sha512-cntlB5ghuB0iuO65Ovoi8ogLHiWGs/5yNrtUcKjFhSSiVeAIVpD7koaSU9RM8mpXw5YDi9RdYXGQMaOURB7ycQ== + dependencies: + ansi-escapes "^3.2.0" + chalk "^2.4.2" + cli-cursor "^2.1.0" + cli-width "^2.0.0" + external-editor "^3.0.3" + figures "^2.0.0" + lodash "^4.17.12" + mute-stream "0.0.7" + run-async "^2.2.0" + rxjs "^6.4.0" + string-width "^2.1.0" + strip-ansi "^5.1.0" + through "^2.3.6" + +internal-slot@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/internal-slot/-/internal-slot-1.0.5.tgz#f2a2ee21f668f8627a4667f309dc0f4fb6674986" + integrity sha512-Y+R5hJrzs52QCG2laLn4udYVnxsfny9CpOhNhUvk/SSSVyF6T27FzRbF0sroPidSu3X8oEAkOn2K804mjpt6UQ== + dependencies: + get-intrinsic "^1.2.0" + has "^1.0.3" + side-channel "^1.0.4" + +interpret@^1.0.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.4.0.tgz#665ab8bc4da27a774a40584e812e3e0fa45b1a1e" + integrity sha512-agE4QfB2Lkp9uICn7BAqoscw4SZP9kTE2hxiFI3jBPmXJfdqiahTbUuKGsMoN2GtqL9AxhYioAcVvgsb1HvRbA== + +ip@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ip/-/ip-2.0.0.tgz#4cf4ab182fee2314c75ede1276f8c80b479936da" + integrity sha512-WKa+XuLG1A1R0UWhl2+1XQSi+fZWMsYKffMZTTYsiZaUD8k2yDAj5atimTUD2TZkyCkNEeYE5NhFZmupOGtjYQ== + +ipaddr.js@1.9.1: + version "1.9.1" + resolved "https://registry.yarnpkg.com/ipaddr.js/-/ipaddr.js-1.9.1.tgz#bff38543eeb8984825079ff3a2a8e6cbd46781b3" + integrity sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g== + +irregular-plurals@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/irregular-plurals/-/irregular-plurals-3.2.0.tgz#b19c490a0723798db51b235d7e39add44dab0822" + integrity sha512-YqTdPLfwP7YFN0SsD3QUVCkm9ZG2VzOXv3DOrw5G5mkMbVwptTwVcFv7/C0vOpBmgTxAeTG19XpUs1E522LW9Q== + +is-accessor-descriptor@^0.1.6: + version "0.1.6" + resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-0.1.6.tgz#a9e12cb3ae8d876727eeef3843f8a0897b5c98d6" + integrity sha1-qeEss66Nh2cn7u84Q/igiXtcmNY= + dependencies: + kind-of "^3.0.2" + +is-accessor-descriptor@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-accessor-descriptor/-/is-accessor-descriptor-1.0.0.tgz#169c2f6d3df1f992618072365c9b0ea1f6878656" + integrity sha512-m5hnHTkcVsPfqx3AKlyttIPb7J+XykHvJP2B9bZDjlhLIoEq4XoK64Vg7boZlVWYK6LUY94dYPEE7Lh0ZkZKcQ== + dependencies: + kind-of "^6.0.0" + +is-array-buffer@^3.0.1, is-array-buffer@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/is-array-buffer/-/is-array-buffer-3.0.2.tgz#f2653ced8412081638ecb0ebbd0c41c6e0aecbbe" + integrity sha512-y+FyyR/w8vfIRq4eQcM1EYgSTnmHXPqaF+IgzgraytCFq5Xh8lllDVmAZolPJiZttZLeFSINPYMaEJ7/vWUa1w== + dependencies: + call-bind "^1.0.2" + get-intrinsic "^1.2.0" + is-typed-array "^1.1.10" + +is-arrayish@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/is-arrayish/-/is-arrayish-0.2.1.tgz#77c99840527aa8ecb1a8ba697b80645a7a926a9d" + integrity sha512-zz06S8t0ozoDXMG+ube26zeCTNXcKIPJZJi8hBrF4idCLms4CG9QtK7qBl1boi5ODzFpjswb5JPmHCbMpjaYzg== + +is-bigint@^1.0.1: + version "1.0.4" + resolved "https://registry.yarnpkg.com/is-bigint/-/is-bigint-1.0.4.tgz#08147a1875bc2b32005d41ccd8291dffc6691df3" + integrity sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg== + dependencies: + has-bigints "^1.0.1" + +is-binary-path@~2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/is-binary-path/-/is-binary-path-2.1.0.tgz#ea1f7f3b80f064236e83470f86c09c254fb45b09" + integrity sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw== + dependencies: + binary-extensions "^2.0.0" + +is-boolean-object@^1.1.0: + version "1.1.2" + resolved "https://registry.yarnpkg.com/is-boolean-object/-/is-boolean-object-1.1.2.tgz#5c6dc200246dd9321ae4b885a114bb1f75f63719" + integrity sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA== + dependencies: + call-bind "^1.0.2" + has-tostringtag "^1.0.0" + +is-buffer@^1.1.5: + version "1.1.6" + resolved "https://registry.yarnpkg.com/is-buffer/-/is-buffer-1.1.6.tgz#efaa2ea9daa0d7ab2ea13a97b2b8ad51fefbe8be" + integrity sha512-NcdALwpXkTm5Zvvbk7owOUSvVvBKDgKP5/ewfXEznmQFfs4ZRmanOeKBTjRVjka3QFoN6XJ+9F3USqfHqTaU5w== + +is-callable@^1.1.3, is-callable@^1.1.4, is-callable@^1.2.7: + version "1.2.7" + resolved "https://registry.yarnpkg.com/is-callable/-/is-callable-1.2.7.tgz#3bc2a85ea742d9e36205dcacdd72ca1fdc51b055" + integrity sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA== + +is-ci@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-ci/-/is-ci-2.0.0.tgz#6bc6334181810e04b5c22b3d589fdca55026404c" + integrity sha512-YfJT7rkpQB0updsdHLGWrvhBJfcfzNNawYDNIyQXJz0IViGf75O8EBPKSdvw2rF+LGCsX4FZ8tcr3b19LcZq4w== + dependencies: + ci-info "^2.0.0" + +is-core-module@^2.1.0, is-core-module@^2.11.0, is-core-module@^2.5.0, is-core-module@^2.9.0: + version "2.11.0" + resolved "https://registry.yarnpkg.com/is-core-module/-/is-core-module-2.11.0.tgz#ad4cb3e3863e814523c96f3f58d26cc570ff0144" + integrity sha512-RRjxlvLDkD1YJwDbroBHMb+cukurkDWNyHx7D3oNB5x9rb5ogcksMC5wHCadcXoo67gVr/+3GFySh3134zi6rw== + dependencies: + has "^1.0.3" + +is-data-descriptor@^0.1.4: + version "0.1.4" + resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-0.1.4.tgz#0b5ee648388e2c860282e793f1856fec3f301b56" + integrity sha1-C17mSDiOLIYCgueT8YVv7D8wG1Y= + dependencies: + kind-of "^3.0.2" + +is-data-descriptor@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-data-descriptor/-/is-data-descriptor-1.0.0.tgz#d84876321d0e7add03990406abbbbd36ba9268c7" + integrity sha512-jbRXy1FmtAoCjQkVmIVYwuuqDFUbaOeDjmed1tOGPrsMhtJA4rD9tkgA0F1qJ3gRFRXcHYVkdeaP50Q5rE/jLQ== + dependencies: + kind-of "^6.0.0" + +is-date-object@^1.0.1: + version "1.0.5" + resolved "https://registry.yarnpkg.com/is-date-object/-/is-date-object-1.0.5.tgz#0841d5536e724c25597bf6ea62e1bd38298df31f" + integrity sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ== + dependencies: + has-tostringtag "^1.0.0" + +is-descriptor@^0.1.0: + version "0.1.6" + resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-0.1.6.tgz#366d8240dde487ca51823b1ab9f07a10a78251ca" + integrity sha512-avDYr0SB3DwO9zsMov0gKCESFYqCnE4hq/4z3TdUlukEy5t9C0YRq7HLrsN52NAcqXKaepeCD0n+B0arnVG3Hg== + dependencies: + is-accessor-descriptor "^0.1.6" + is-data-descriptor "^0.1.4" + kind-of "^5.0.0" + +is-descriptor@^1.0.0, is-descriptor@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-descriptor/-/is-descriptor-1.0.2.tgz#3b159746a66604b04f8c81524ba365c5f14d86ec" + integrity sha512-2eis5WqQGV7peooDyLmNEPUrps9+SXX5c9pL3xEB+4e9HnGuDa7mB7kHxHw4CbqS9k1T2hOH3miL8n8WtiYVtg== + dependencies: + is-accessor-descriptor "^1.0.0" + is-data-descriptor "^1.0.0" + kind-of "^6.0.2" + +is-docker@^2.0.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/is-docker/-/is-docker-2.1.1.tgz#4125a88e44e450d384e09047ede71adc2d144156" + integrity sha512-ZOoqiXfEwtGknTiuDEy8pN2CfE3TxMHprvNer1mXiqwkOT77Rw3YVrUQ52EqAOU3QAWDQ+bQdx7HJzrv7LS2Hw== + +is-error@^2.2.2: + version "2.2.2" + resolved "https://registry.yarnpkg.com/is-error/-/is-error-2.2.2.tgz#c10ade187b3c93510c5470a5567833ee25649843" + integrity sha512-IOQqts/aHWbiisY5DuPJQ0gcbvaLFCa7fBa9xoLfxBZvQ+ZI/Zh9xoI7Gk+G64N0FdK4AbibytHht2tWgpJWLg== + +is-extendable@^0.1.0, is-extendable@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-0.1.1.tgz#62b110e289a471418e3ec36a617d472e301dfc89" + integrity sha1-YrEQ4omkcUGOPsNqYX1HLjAd/Ik= + +is-extendable@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-extendable/-/is-extendable-1.0.1.tgz#a7470f9e426733d81bd81e1155264e3a3507cab4" + integrity sha512-arnXMxT1hhoKo9k1LZdmlNyJdDDfy2v0fXjFlmok4+i8ul/6WlbVge9bhM74OpNPQPMGUToDtz+KXa1PneJxOA== + dependencies: + is-plain-object "^2.0.4" + +is-extglob@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" + integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ== + +is-fullwidth-code-point@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-2.0.0.tgz#a3b30a5c4f199183167aaab93beefae3ddfb654f" + integrity sha1-o7MKXE8ZkYMWeqq5O+764937ZU8= + +is-fullwidth-code-point@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz#f116f8064fe90b3f7844a38997c0b75051269f1d" + integrity sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg== + +is-glob@^4.0.0, is-glob@^4.0.1, is-glob@^4.0.3: + version "4.0.3" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084" + integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg== + dependencies: + is-extglob "^2.1.1" + +is-glob@~4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.1.tgz#7567dbe9f2f5e2467bc77ab83c4a29482407a5dc" + integrity sha512-5G0tKtBTFImOqDnLB2hG6Bp2qcKEFduo4tZu9MT/H6NQv/ghhy30o55ufafxJ/LdH79LLs2Kfrn85TLKyA7BUg== + dependencies: + is-extglob "^2.1.1" + +is-installed-globally@^0.3.2: + version "0.3.2" + resolved "https://registry.yarnpkg.com/is-installed-globally/-/is-installed-globally-0.3.2.tgz#fd3efa79ee670d1187233182d5b0a1dd00313141" + integrity sha512-wZ8x1js7Ia0kecP/CHM/3ABkAmujX7WPvQk6uu3Fly/Mk44pySulQpnHG46OMjHGXApINnV4QhY3SWnECO2z5g== + dependencies: + global-dirs "^2.0.1" + is-path-inside "^3.0.1" + +is-interactive@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-interactive/-/is-interactive-1.0.0.tgz#cea6e6ae5c870a7b0a0004070b7b587e0252912e" + integrity sha512-2HvIEKRoqS62guEC+qBjpvRubdX910WCMuJTZ+I9yvqKU2/12eSL549HMwtabb4oupdj2sMP50k+XJfB/8JE6w== + +is-negative-zero@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/is-negative-zero/-/is-negative-zero-2.0.2.tgz#7bf6f03a28003b8b3965de3ac26f664d765f3150" + integrity sha512-dqJvarLawXsFbNDeJW7zAz8ItJ9cd28YufuuFzh0G8pNHjJMnY08Dv7sYX2uF5UpQOwieAeOExEYAWWfu7ZZUA== + +is-npm@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/is-npm/-/is-npm-5.0.0.tgz#43e8d65cc56e1b67f8d47262cf667099193f45a8" + integrity sha512-WW/rQLOazUq+ST/bCAVBp/2oMERWLsR7OrKyt052dNDk4DHcDE0/7QSXITlmi+VBcV13DfIbysG3tZJm5RfdBA== + +is-number-object@^1.0.4: + version "1.0.7" + resolved "https://registry.yarnpkg.com/is-number-object/-/is-number-object-1.0.7.tgz#59d50ada4c45251784e9904f5246c742f07a42fc" + integrity sha512-k1U0IRzLMo7ZlYIfzRu23Oh6MiIFasgpb9X76eqfFZAqwH44UI4KTBvBYIZ1dSL9ZzChTB9ShHfLkR4pdW5krQ== + dependencies: + has-tostringtag "^1.0.0" + +is-number@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-3.0.0.tgz#24fd6201a4782cf50561c810276afc7d12d71195" + integrity sha1-JP1iAaR4LPUFYcgQJ2r8fRLXEZU= + dependencies: + kind-of "^3.0.2" + +is-number@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/is-number/-/is-number-7.0.0.tgz#7535345b896734d5f80c4d06c50955527a14f12b" + integrity sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng== + +is-obj@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-1.0.1.tgz#3e4729ac1f5fde025cd7d83a896dab9f4f67db0f" + integrity sha1-PkcprB9f3gJc19g6iW2rn09n2w8= + +is-obj@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-obj/-/is-obj-2.0.0.tgz#473fb05d973705e3fd9620545018ca8e22ef4982" + integrity sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w== + +is-path-cwd@^2.2.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/is-path-cwd/-/is-path-cwd-2.2.0.tgz#67d43b82664a7b5191fd9119127eb300048a9fdb" + integrity sha512-w942bTcih8fdJPJmQHFzkS76NEP8Kzzvmw92cXsazb8intwLqPibPPdXf4ANdKV3rYMuuQYGIWtvz9JilB3NFQ== + +is-path-inside@^3.0.1, is-path-inside@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/is-path-inside/-/is-path-inside-3.0.2.tgz#f5220fc82a3e233757291dddc9c5877f2a1f3017" + integrity sha512-/2UGPSgmtqwo1ktx8NDHjuPwZWmHhO+gj0f93EkhLB5RgW9RZevWYYlIkS6zePc6U2WpOdQYIwHe9YC4DWEBVg== + +is-plain-obj@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/is-plain-obj/-/is-plain-obj-1.1.0.tgz#71a50c8429dfca773c92a390a4a03b39fcd51d3e" + integrity sha512-yvkRyxmFKEOQ4pNXCmJG5AEQNlXJS5LaONXo5/cLdTZdWvsZ1ioJEonLGAosKlMWE8lwUy/bJzMjcw8az73+Fg== + +is-plain-object@^2.0.3, is-plain-object@^2.0.4: + version "2.0.4" + resolved "https://registry.yarnpkg.com/is-plain-object/-/is-plain-object-2.0.4.tgz#2c163b3fafb1b606d9d17928f05c2a1c38e07677" + integrity sha512-h5PpgXkWitc38BBMYawTYMWJHFZJVnBquFE57xFpjB8pJFiF6gZ+bU+WyI/yqXiFR5mdLsgYNaPe8uao6Uv9Og== + dependencies: + isobject "^3.0.1" + +is-plain-object@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/is-plain-object/-/is-plain-object-5.0.0.tgz#4427f50ab3429e9025ea7d52e9043a9ef4159344" + integrity sha512-VRSzKkbMm5jMDoKLbltAkFQ5Qr7VDiTFGXxYFXXowVj387GeGNOCsOH6Msy00SGZ3Fp84b1Naa1psqgcCIEP5Q== + +is-promise@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/is-promise/-/is-promise-4.0.0.tgz#42ff9f84206c1991d26debf520dd5c01042dd2f3" + integrity sha512-hvpoI6korhJMnej285dSg6nu1+e6uxs7zG3BYAm5byqDsgJNWwxzM6z6iZiAgQR4TJ30JmBTOwqZUw3WlyH3AQ== + +is-regex@^1.1.4: + version "1.1.4" + resolved "https://registry.yarnpkg.com/is-regex/-/is-regex-1.1.4.tgz#eef5663cd59fa4c0ae339505323df6854bb15958" + integrity sha512-kvRdxDsxZjhzUX07ZnLydzS1TU/TJlTUHHY4YLL87e37oUA49DfkLqgy+VjFocowy29cKvcSiu+kIv728jTTVg== + dependencies: + call-bind "^1.0.2" + has-tostringtag "^1.0.0" + +is-regexp@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-regexp/-/is-regexp-1.0.0.tgz#fd2d883545c46bac5a633e7b9a09e87fa2cb5069" + integrity sha1-/S2INUXEa6xaYz57mgnof6LLUGk= + +is-shared-array-buffer@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-shared-array-buffer/-/is-shared-array-buffer-1.0.2.tgz#8f259c573b60b6a32d4058a1a07430c0a7344c79" + integrity sha512-sqN2UDu1/0y6uvXyStCOzyhAjCSlHceFoMKJW8W9EU9cvic/QdsZ0kEU93HEy3IUEFZIiH/3w+AH/UQbPHNdhA== + dependencies: + call-bind "^1.0.2" + +is-stream@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-2.0.0.tgz#bde9c32680d6fae04129d6ac9d921ce7815f78e3" + integrity sha512-XCoy+WlUr7d1+Z8GgSuXmpuUFC9fOhRXglJMx+dwLKTkL44Cjd4W1Z5P+BQZpr+cR93aGP4S/s7Ftw6Nd/kiEw== + +is-string@^1.0.5, is-string@^1.0.7: + version "1.0.7" + resolved "https://registry.yarnpkg.com/is-string/-/is-string-1.0.7.tgz#0dd12bf2006f255bb58f695110eff7491eebc0fd" + integrity sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg== + dependencies: + has-tostringtag "^1.0.0" + +is-symbol@^1.0.2, is-symbol@^1.0.3: + version "1.0.4" + resolved "https://registry.yarnpkg.com/is-symbol/-/is-symbol-1.0.4.tgz#a6dac93b635b063ca6872236de88910a57af139c" + integrity sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg== + dependencies: + has-symbols "^1.0.2" + +is-text-path@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/is-text-path/-/is-text-path-1.0.1.tgz#4e1aa0fb51bfbcb3e92688001397202c1775b66e" + integrity sha512-xFuJpne9oFz5qDaodwmmG08e3CawH/2ZV8Qqza1Ko7Sk8POWbkRdwIoAWVhqvq0XeUzANEhKo2n0IXUGBm7A/w== + dependencies: + text-extensions "^1.0.0" + +is-typed-array@^1.1.10, is-typed-array@^1.1.9: + version "1.1.10" + resolved "https://registry.yarnpkg.com/is-typed-array/-/is-typed-array-1.1.10.tgz#36a5b5cb4189b575d1a3e4b08536bfb485801e3f" + integrity sha512-PJqgEHiWZvMpaFZ3uTc8kHPM4+4ADTlDniuQL7cU/UDA0Ql7F70yGfHph3cLNe+c9toaigv+DFzTJKhc2CtO6A== + dependencies: + available-typed-arrays "^1.0.5" + call-bind "^1.0.2" + for-each "^0.3.3" + gopd "^1.0.1" + has-tostringtag "^1.0.0" + +is-typedarray@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/is-typedarray/-/is-typedarray-1.0.0.tgz#e479c80858df0c1b11ddda6940f96011fcda4a9a" + integrity sha512-cyA56iCMHAh5CdzjJIa4aohJyeO1YbwLi3Jc35MmRU6poroFjIGZzUzupGiRPOjgHg9TLu43xbpwXk523fMxKA== + +is-utf8@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/is-utf8/-/is-utf8-0.2.1.tgz#4b0da1442104d1b336340e80797e865cf39f7d72" + integrity sha1-Sw2hRCEE0bM2NA6AeX6GXPOffXI= + +is-weakref@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-weakref/-/is-weakref-1.0.2.tgz#9529f383a9338205e89765e0392efc2f100f06f2" + integrity sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ== + dependencies: + call-bind "^1.0.2" + +is-windows@^1.0.1, is-windows@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/is-windows/-/is-windows-1.0.2.tgz#d1850eb9791ecd18e6182ce12a30f396634bb19d" + integrity sha512-eXK1UInq2bPmjyX6e3VHIzMLobc4J94i4AWn+Hpq3OU5KkrRC96OAcR3PRJ/pGu6m8TRnBHP9dkXQVsT/COVIA== + +is-wsl@^2.1.1: + version "2.2.0" + resolved "https://registry.yarnpkg.com/is-wsl/-/is-wsl-2.2.0.tgz#74a4c76e77ca9fd3f932f290c17ea326cd157271" + integrity sha512-fKzAra0rGJUUBwGBgNkHZuToZcn+TtXHpeCgmkMJMMYx1sQDYaCSyjJBSCa2nH1DGm7s3n1oBnohoVTBaN7Lww== + dependencies: + is-docker "^2.0.0" + +is-yarn-global@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/is-yarn-global/-/is-yarn-global-0.3.0.tgz#d502d3382590ea3004893746754c89139973e232" + integrity sha512-VjSeb/lHmkoyd8ryPVIKvOCn4D1koMqY+vqyjjUfc3xyKtP4dYOxM44sZrnqQSzSds3xyOrUTLTC9LVCVgLngw== + +isarray@1.0.0, isarray@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/isarray/-/isarray-1.0.0.tgz#bb935d48582cba168c06834957a54a3e07124f11" + integrity sha1-u5NdSFgsuhaMBoNJV6VKPgcSTxE= + +isexe@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/isexe/-/isexe-2.0.0.tgz#e8fbf374dc556ff8947a10dcb0572d633f2cfa10" + integrity sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw== + +isobject@^2.0.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/isobject/-/isobject-2.1.0.tgz#f065561096a3f1da2ef46272f815c840d87e0c89" + integrity sha1-8GVWEJaj8dou9GJy+BXIQNh+DIk= + dependencies: + isarray "1.0.0" + +isobject@^3.0.0, isobject@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/isobject/-/isobject-3.0.1.tgz#4e431e92b11a9731636aa1f9c8d1ccbcfdab78df" + integrity sha1-TkMekrEalzFjaqH5yNHMvP2reN8= + +istanbul-lib-coverage@^3.0.0, istanbul-lib-coverage@^3.0.0-alpha.1: + version "3.0.0" + resolved "https://registry.yarnpkg.com/istanbul-lib-coverage/-/istanbul-lib-coverage-3.0.0.tgz#f5944a37c70b550b02a78a5c3b2055b280cec8ec" + integrity sha512-UiUIqxMgRDET6eR+o5HbfRYP1l0hqkWOs7vNxC/mggutCMUIhWMm8gAHb8tHlyfD3/l6rlgNA5cKdDzEAf6hEg== + +istanbul-lib-hook@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/istanbul-lib-hook/-/istanbul-lib-hook-3.0.0.tgz#8f84c9434888cc6b1d0a9d7092a76d239ebf0cc6" + integrity sha512-Pt/uge1Q9s+5VAZ+pCo16TYMWPBIl+oaNIjgLQxcX0itS6ueeaA+pEfThZpH8WxhFgCiEb8sAJY6MdUKgiIWaQ== + dependencies: + append-transform "^2.0.0" + +istanbul-lib-instrument@^4.0.0: + version "4.0.3" + resolved "https://registry.yarnpkg.com/istanbul-lib-instrument/-/istanbul-lib-instrument-4.0.3.tgz#873c6fff897450118222774696a3f28902d77c1d" + integrity sha512-BXgQl9kf4WTCPCCpmFGoJkz/+uhvm7h7PFKUYxh7qarQd3ER33vHG//qaE8eN25l07YqZPpHXU9I09l/RD5aGQ== + dependencies: + "@babel/core" "^7.7.5" + "@istanbuljs/schema" "^0.1.2" + istanbul-lib-coverage "^3.0.0" + semver "^6.3.0" + +istanbul-lib-processinfo@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/istanbul-lib-processinfo/-/istanbul-lib-processinfo-2.0.2.tgz#e1426514662244b2f25df728e8fd1ba35fe53b9c" + integrity sha512-kOwpa7z9hme+IBPZMzQ5vdQj8srYgAtaRqeI48NGmAQ+/5yKiHLV0QbYqQpxsdEF0+w14SoB8YbnHKcXE2KnYw== + dependencies: + archy "^1.0.0" + cross-spawn "^7.0.0" + istanbul-lib-coverage "^3.0.0-alpha.1" + make-dir "^3.0.0" + p-map "^3.0.0" + rimraf "^3.0.0" + uuid "^3.3.3" + +istanbul-lib-report@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/istanbul-lib-report/-/istanbul-lib-report-3.0.0.tgz#7518fe52ea44de372f460a76b5ecda9ffb73d8a6" + integrity sha512-wcdi+uAKzfiGT2abPpKZ0hSU1rGQjUQnLvtY5MpQ7QCTahD3VODhcu4wcfY1YtkGaDD5yuydOLINXsfbus9ROw== + dependencies: + istanbul-lib-coverage "^3.0.0" + make-dir "^3.0.0" + supports-color "^7.1.0" + +istanbul-lib-source-maps@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/istanbul-lib-source-maps/-/istanbul-lib-source-maps-4.0.0.tgz#75743ce6d96bb86dc7ee4352cf6366a23f0b1ad9" + integrity sha512-c16LpFRkR8vQXyHZ5nLpY35JZtzj1PQY1iZmesUbf1FZHbIupcWfjgOXBY9YHkLEQ6puz1u4Dgj6qmU/DisrZg== + dependencies: + debug "^4.1.1" + istanbul-lib-coverage "^3.0.0" + source-map "^0.6.1" + +istanbul-reports@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/istanbul-reports/-/istanbul-reports-3.0.2.tgz#d593210e5000683750cb09fc0644e4b6e27fd53b" + integrity sha512-9tZvz7AiR3PEDNGiV9vIouQ/EAcqMXFmkcA1CDFTwOB98OZVDL0PH9glHotf5Ugp6GCOTypfzGWI/OqjWNCRUw== + dependencies: + html-escaper "^2.0.0" + istanbul-lib-report "^3.0.0" + +iterable-to-stream@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/iterable-to-stream/-/iterable-to-stream-1.0.1.tgz#37e86baacf6b1a0e9233dad4eb526d0423d08bf3" + integrity sha512-O62gD5ADMUGtJoOoM9U6LQ7i4byPXUNoHJ6mqsmkQJcom331ZJGDApWgDESWyBMEHEJRjtHozgIiTzYo9RU4UA== + +js-string-escape@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/js-string-escape/-/js-string-escape-1.0.1.tgz#e2625badbc0d67c7533e9edc1068c587ae4137ef" + integrity sha1-4mJbrbwNZ8dTPp7cEGjFh65BN+8= + +js-tokens@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/js-tokens/-/js-tokens-4.0.0.tgz#19203fb59991df98e3a287050d4647cdeaf32499" + integrity sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ== + +js-yaml@3.14.1, js-yaml@^3.13.1, js-yaml@^3.14.0: + version "3.14.1" + resolved "https://registry.yarnpkg.com/js-yaml/-/js-yaml-3.14.1.tgz#dae812fdb3825fa306609a8717383c50c36a0537" + integrity sha512-okMH7OXXJ7YrN9Ok3/SXrnu4iX9yOk+25nqX4imS2npuvTYDmo/QEZoqwZkYaIDk3jVvBOTOIEgEhaLOynBS9g== + dependencies: + argparse "^1.0.7" + esprima "^4.0.0" + +jsesc@^2.5.1: + version "2.5.2" + resolved "https://registry.yarnpkg.com/jsesc/-/jsesc-2.5.2.tgz#80564d2e483dacf6e8ef209650a67df3f0c283a4" + integrity sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA== + +json-buffer@3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/json-buffer/-/json-buffer-3.0.0.tgz#5b1f397afc75d677bde8bcfc0e47e1f9a3d9a898" + integrity sha1-Wx85evx11ne96Lz8Dkfh+aPZqJg= + +json-parse-better-errors@^1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/json-parse-better-errors/-/json-parse-better-errors-1.0.2.tgz#bb867cfb3450e69107c131d1c514bab3dc8bcaa9" + integrity sha512-mrqyZKfX5EhL7hvqcV6WG1yYjnjeuYDzDhhcAAUrq8Po85NBQBJP+ZDUT75qZQ98IkUoBqdkExkukOU7Ts2wrw== + +json-parse-even-better-errors@^2.3.0: + version "2.3.1" + resolved "https://registry.yarnpkg.com/json-parse-even-better-errors/-/json-parse-even-better-errors-2.3.1.tgz#7c47805a94319928e05777405dc12e1f7a4ee02d" + integrity sha512-xyFwyhro/JEof6Ghe2iz2NcXoj2sloNsWr/XsERDK/oiPCfaNhl5ONfp+jQdAZRQQ0IJWNzH9zIZF7li91kh2w== + +json-schema-traverse@^0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz#69f6a87d9513ab8bb8fe63bdb0979c448e684660" + integrity sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg== + +json-schema-traverse@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-1.0.0.tgz#ae7bcb3656ab77a73ba5c49bf654f38e6b6860e2" + integrity sha512-NM8/P9n3XjXhIZn1lLhkFaACTOURQXjWhV4BA/RnOv8xvgqtqpAX9IO4mRQxSx1Rlo4tqzeqb0sOlruaOy3dug== + +json-stable-stringify-without-jsonify@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz#9db7b59496ad3f3cfef30a75142d2d930ad72651" + integrity sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw== + +json-stringify-safe@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/json-stringify-safe/-/json-stringify-safe-5.0.1.tgz#1296a2d58fd45f19a0f6ce01d65701e2c735b6eb" + integrity sha512-ZClg6AaYvamvYEE82d3Iyd3vSSIjQ+odgjaTzRuO3s7toCdFKczob2i0zCh7JE8kWn17yvAWhUVxvqGwUalsRA== + +json5@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/json5/-/json5-1.0.2.tgz#63d98d60f21b313b77c4d6da18bfa69d80e1d593" + integrity sha512-g1MWMLBiz8FKi1e4w0UyVL3w+iJceWAFBAaBnnGKOpNa5f8TLktkbre1+s6oICydWAm+HRUGTmI+//xv2hvXYA== + dependencies: + minimist "^1.2.0" + +json5@^2.1.2: + version "2.1.3" + resolved "https://registry.yarnpkg.com/json5/-/json5-2.1.3.tgz#c9b0f7fa9233bfe5807fe66fcf3a5617ed597d43" + integrity sha512-KXPvOm8K9IJKFM0bmdn8QXh7udDh1g/giieX0NLCaMnb4hEiVFqnop2ImTXCc5e0/oHz3LTqmHGtExn5hfMkOA== + dependencies: + minimist "^1.2.5" + +jsonfile@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-4.0.0.tgz#8771aae0799b64076b76640fca058f9c10e33ecb" + integrity sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg== + optionalDependencies: + graceful-fs "^4.1.6" + +jsonfile@^6.0.1: + version "6.1.0" + resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-6.1.0.tgz#bc55b2634793c679ec6403094eb13698a6ec0aae" + integrity sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ== + dependencies: + universalify "^2.0.0" + optionalDependencies: + graceful-fs "^4.1.6" + +jsonparse@^1.2.0: + version "1.3.1" + resolved "https://registry.yarnpkg.com/jsonparse/-/jsonparse-1.3.1.tgz#3f4dae4a91fac315f71062f8521cc239f1366280" + integrity sha512-POQXvpdL69+CluYsillJ7SUhKvytYjW9vG/GKpnf+xP8UWgYEM/RaMzHHofbALDiKbbP1W8UEYmgGl39WkPZsg== + +keyv@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/keyv/-/keyv-3.1.0.tgz#ecc228486f69991e49e9476485a5be1e8fc5c4d9" + integrity sha512-9ykJ/46SN/9KPM/sichzQ7OvXyGDYKGTaDlKMGCAlg2UK8KRy4jb0d8sFc+0Tt0YYnThq8X2RZgCg74RPxgcVA== + dependencies: + json-buffer "3.0.0" + +kind-of@^3.0.2, kind-of@^3.0.3, kind-of@^3.2.0: + version "3.2.2" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-3.2.2.tgz#31ea21a734bab9bbb0f32466d893aea51e4a3c64" + integrity sha1-MeohpzS6ubuw8yRm2JOupR5KPGQ= + dependencies: + is-buffer "^1.1.5" + +kind-of@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-4.0.0.tgz#20813df3d712928b207378691a45066fae72dd57" + integrity sha1-IIE989cSkosgc3hpGkUGb65y3Vc= + dependencies: + is-buffer "^1.1.5" + +kind-of@^5.0.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-5.1.0.tgz#729c91e2d857b7a419a1f9aa65685c4c33f5845d" + integrity sha512-NGEErnH6F2vUuXDh+OlbcKW7/wOcfdRHaZ7VWtqCztfHri/++YKmP51OdWeGPuqCOba6kk2OTe5d02VmTB80Pw== + +kind-of@^6.0.0, kind-of@^6.0.2, kind-of@^6.0.3: + version "6.0.3" + resolved "https://registry.yarnpkg.com/kind-of/-/kind-of-6.0.3.tgz#07c05034a6c349fa06e24fa35aa76db4580ce4dd" + integrity sha512-dcS1ul+9tmeD95T+x28/ehLgd9mENa3LsvDTtzm3vyBEO7RPptvAD+t44WVXaUjTBRcrpFeFlC8WCruUR456hw== + +kruptein@^3.0.0: + version "3.0.6" + resolved "https://registry.yarnpkg.com/kruptein/-/kruptein-3.0.6.tgz#9cf976225af4bc1fbeba069dbb24f17eebad974d" + integrity sha512-EQJjTwAJfQkC4NfdQdo3HXM2a9pmBm8oidzH270cYu1MbgXPNPMJuldN7OPX+qdhPO5rw4X3/iKz0BFBfkXGKA== + dependencies: + asn1.js "^5.4.1" + +latest-version@^5.1.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/latest-version/-/latest-version-5.1.0.tgz#119dfe908fe38d15dfa43ecd13fa12ec8832face" + integrity sha512-weT+r0kTkRQdCdYCNtkMwWXQTMEswKrFBkm4ckQOMVhhqhIMI1UT2hMj+1iigIhgSZm5gTmrRXBNoGUgaTY1xA== + dependencies: + package-json "^6.3.0" + +levn@^0.4.1: + version "0.4.1" + resolved "https://registry.yarnpkg.com/levn/-/levn-0.4.1.tgz#ae4562c007473b932a6200d403268dd2fffc6ade" + integrity sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ== + dependencies: + prelude-ls "^1.2.1" + type-check "~0.4.0" + +lines-and-columns@^1.1.6: + version "1.2.4" + resolved "https://registry.yarnpkg.com/lines-and-columns/-/lines-and-columns-1.2.4.tgz#eca284f75d2965079309dc0ad9255abb2ebc1632" + integrity sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg== + +lint-staged@^10.5.4: + version "10.5.4" + resolved "https://registry.yarnpkg.com/lint-staged/-/lint-staged-10.5.4.tgz#cd153b5f0987d2371fc1d2847a409a2fe705b665" + integrity sha512-EechC3DdFic/TdOPgj/RB3FicqE6932LTHCUm0Y2fsD9KGlLB+RwJl2q1IYBIvEsKzDOgn0D4gll+YxG5RsrKg== + dependencies: + chalk "^4.1.0" + cli-truncate "^2.1.0" + commander "^6.2.0" + cosmiconfig "^7.0.0" + debug "^4.2.0" + dedent "^0.7.0" + enquirer "^2.3.6" + execa "^4.1.0" + listr2 "^3.2.2" + log-symbols "^4.0.0" + micromatch "^4.0.2" + normalize-path "^3.0.0" + please-upgrade-node "^3.2.0" + string-argv "0.3.1" + stringify-object "^3.3.0" + +listr2@^3.2.2: + version "3.3.1" + resolved "https://registry.yarnpkg.com/listr2/-/listr2-3.3.1.tgz#87b57cc0b8541fa794b814c8bcb76f1211cfbf5c" + integrity sha512-8Zoxe7s/8nNr4bJ8bdAduHD8uJce+exmMmUWTXlq0WuUdffnH3muisHPHPFtW2vvOfohIsq7FGCaguUxN/h3Iw== + dependencies: + chalk "^4.1.0" + cli-truncate "^2.1.0" + figures "^3.2.0" + indent-string "^4.0.0" + log-update "^4.0.0" + p-map "^4.0.0" + rxjs "^6.6.3" + through "^2.3.8" + wrap-ansi "^7.0.0" + +load-json-file@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-4.0.0.tgz#2f5f45ab91e33216234fd53adab668eb4ec0993b" + integrity sha512-Kx8hMakjX03tiGTLAIdJ+lL0htKnXjEZN6hk/tozf/WOuYGdZBJrZ+rCJRbVCugsjB3jMLn9746NsQIf5VjBMw== + dependencies: + graceful-fs "^4.1.2" + parse-json "^4.0.0" + pify "^3.0.0" + strip-bom "^3.0.0" + +load-json-file@^5.2.0: + version "5.3.0" + resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-5.3.0.tgz#4d3c1e01fa1c03ea78a60ac7af932c9ce53403f3" + integrity sha512-cJGP40Jc/VXUsp8/OrnyKyTZ1y6v/dphm3bioS+RrKXjK2BB6wHUd6JptZEFDGgGahMT+InnZO5i1Ei9mpC8Bw== + dependencies: + graceful-fs "^4.1.15" + parse-json "^4.0.0" + pify "^4.0.1" + strip-bom "^3.0.0" + type-fest "^0.3.0" + +locate-path@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-2.0.0.tgz#2b568b265eec944c6d9c0de9c3dbbbca0354cd8e" + integrity sha512-NCI2kiDkyR7VeEKm27Kda/iQHyKJe1Bu0FlTbYp3CqJu+9IFe9bLyAjMxf5ZDDbEg+iMPzB5zYyUTSm8wVTKmA== + dependencies: + p-locate "^2.0.0" + path-exists "^3.0.0" + +locate-path@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-3.0.0.tgz#dbec3b3ab759758071b58fe59fc41871af21400e" + integrity sha512-7AO748wWnIhNqAuaty2ZWHkQHRSNfPVIsPIfwEOWO22AmaoVrWavlOcMR5nzTLNYvp36X220/maaRsrec1G65A== + dependencies: + p-locate "^3.0.0" + path-exists "^3.0.0" + +locate-path@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-5.0.0.tgz#1afba396afd676a6d42504d0a67a3a7eb9f62aa0" + integrity sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g== + dependencies: + p-locate "^4.1.0" + +locate-path@^6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/locate-path/-/locate-path-6.0.0.tgz#55321eb309febbc59c4801d931a72452a681d286" + integrity sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw== + dependencies: + p-locate "^5.0.0" + +lodash.flattendeep@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/lodash.flattendeep/-/lodash.flattendeep-4.4.0.tgz#fb030917f86a3134e5bc9bec0d69e0013ddfedb2" + integrity sha1-+wMJF/hqMTTlvJvsDWngAT3f7bI= + +lodash.ismatch@^4.4.0: + version "4.4.0" + resolved "https://registry.yarnpkg.com/lodash.ismatch/-/lodash.ismatch-4.4.0.tgz#756cb5150ca3ba6f11085a78849645f188f85f37" + integrity sha512-fPMfXjGQEV9Xsq/8MTSgUf255gawYRbjwMyDbcvDhXgV7enSZA0hynz6vMPnpAb5iONEzBHBPsT+0zes5Z301g== + +lodash.map@^4.5.1: + version "4.6.0" + resolved "https://registry.yarnpkg.com/lodash.map/-/lodash.map-4.6.0.tgz#771ec7839e3473d9c4cde28b19394c3562f4f6d3" + integrity sha1-dx7Hg540c9nEzeKLGTlMNWL09tM= + +lodash.merge@^4.6.2: + version "4.6.2" + resolved "https://registry.yarnpkg.com/lodash.merge/-/lodash.merge-4.6.2.tgz#558aa53b43b661e1925a0afdfa36a9a1085fe57a" + integrity sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ== + +lodash.truncate@^4.4.2: + version "4.4.2" + resolved "https://registry.yarnpkg.com/lodash.truncate/-/lodash.truncate-4.4.2.tgz#5a350da0b1113b837ecfffd5812cbe58d6eae193" + integrity sha512-jttmRe7bRse52OsWIMDLaXxWqRAmtIUccAQ3garviCqJjafXOfNMO0yMfNpdD6zbGaTU0P5Nz7e7gAT6cKmJRw== + +lodash@^4.17.12: + version "4.17.20" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.20.tgz#b44a9b6297bcb698f1c51a3545a2b3b368d59c52" + integrity sha512-PlhdFcillOINfeV7Ni6oF1TAEayyZBoZ8bcshTHqOYJYlrqzRK5hagpagky5o4HfCzzd1TRkXPMFq6cKk9rGmA== + +lodash@^4.17.14, lodash@^4.17.15, lodash@^4.17.19, lodash@^4.17.20: + version "4.17.21" + resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.21.tgz#679591c564c3bffaae8454cf0b3df370c3d6911c" + integrity sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg== + +log-symbols@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/log-symbols/-/log-symbols-4.0.0.tgz#69b3cc46d20f448eccdb75ea1fa733d9e821c920" + integrity sha512-FN8JBzLx6CzeMrB0tg6pqlGU1wCrXW+ZXGH481kfsBqer0hToTIiHdjH4Mq8xJUbvATujKCvaREGWpGUionraA== + dependencies: + chalk "^4.0.0" + +log-update@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/log-update/-/log-update-4.0.0.tgz#589ecd352471f2a1c0c570287543a64dfd20e0a1" + integrity sha512-9fkkDevMefjg0mmzWFBW8YkFP91OrizzkW3diF7CpG+S2EYdy4+TVfGwz1zeF8x7hCx1ovSPTOE9Ngib74qqUg== + dependencies: + ansi-escapes "^4.3.0" + cli-cursor "^3.1.0" + slice-ansi "^4.0.0" + wrap-ansi "^6.2.0" + +longest@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/longest/-/longest-2.0.1.tgz#781e183296aa94f6d4d916dc335d0d17aefa23f8" + integrity sha1-eB4YMpaqlPbU2RbcM10NF676I/g= + +lowercase-keys@^1.0.0, lowercase-keys@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-1.0.1.tgz#6f9e30b47084d971a7c820ff15a6c5167b74c26f" + integrity sha512-G2Lj61tXDnVFFOi8VZds+SoQjtQC3dgokKdDG2mTm1tx4m50NUHBOZSBwQQHyy0V12A0JTG4icfZQH+xPyh8VA== + +lowercase-keys@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-2.0.0.tgz#2603e78b7b4b0006cbca2fbcc8a3202558ac9479" + integrity sha512-tqNXrS78oMOE73NMxK4EMLQsQowWf8jKooH9g7xPavRT706R6bkQJ6DY2Te7QukaZsulxa30wQ7bk0pm4XiHmA== + +lru-cache@^6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/lru-cache/-/lru-cache-6.0.0.tgz#6d6fe6570ebd96aaf90fcad1dafa3b2566db3a94" + integrity sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA== + dependencies: + yallist "^4.0.0" + +lunr@^2.3.9: + version "2.3.9" + resolved "https://registry.yarnpkg.com/lunr/-/lunr-2.3.9.tgz#18b123142832337dd6e964df1a5a7707b25d35e1" + integrity sha512-zTU3DaZaF3Rt9rhN3uBMGQD3dD2/vFQqnvZCDv4dl5iOzq2IZQqTxu90r4E5J+nP70J3ilqVCrbho2eWaeW8Ow== + +make-dir@^3.0.0, make-dir@^3.0.2: + version "3.1.0" + resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-3.1.0.tgz#415e967046b3a7f1d185277d84aa58203726a13f" + integrity sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw== + dependencies: + semver "^6.0.0" + +make-error@^1.1.1: + version "1.3.6" + resolved "https://registry.yarnpkg.com/make-error/-/make-error-1.3.6.tgz#2eb2e37ea9b67c4891f684a1394799af484cf7a2" + integrity sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw== + +map-age-cleaner@^0.1.3: + version "0.1.3" + resolved "https://registry.yarnpkg.com/map-age-cleaner/-/map-age-cleaner-0.1.3.tgz#7d583a7306434c055fe474b0f45078e6e1b4b92a" + integrity sha512-bJzx6nMoP6PDLPBFmg7+xRKeFZvFboMrGlxmNj9ClvX53KrmvM5bXFXEWjbz4cz1AFn+jWJ9z/DJSz7hrs0w3w== + dependencies: + p-defer "^1.0.0" + +map-cache@^0.2.2: + version "0.2.2" + resolved "https://registry.yarnpkg.com/map-cache/-/map-cache-0.2.2.tgz#c32abd0bd6525d9b051645bb4f26ac5dc98a0dbf" + integrity sha1-wyq9C9ZSXZsFFkW7TyasXcmKDb8= + +map-obj@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d" + integrity sha512-7N/q3lyZ+LVCp7PzuxrJr4KMbBE2hW7BT7YNia330OFxIf4d3r5zVpicP2650l7CPN6RM9zOJRl3NGpqSiw3Eg== + +map-obj@^4.0.0: + version "4.3.0" + resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-4.3.0.tgz#9304f906e93faae70880da102a9f1df0ea8bb05a" + integrity sha512-hdN1wVrZbb29eBGiGjJbeP8JbKjq1urkHJ/LIP/NY48MZ1QVXUsQBV1G1zvYFHn1XE06cwjBsOI2K3Ulnj1YXQ== + +map-visit@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/map-visit/-/map-visit-1.0.0.tgz#ecdca8f13144e660f1b5bd41f12f3479d98dfb8f" + integrity sha1-7Nyo8TFE5mDxtb1B8S80edmN+48= + dependencies: + object-visit "^1.0.0" + +marked@^1.1.1: + version "1.2.7" + resolved "https://registry.yarnpkg.com/marked/-/marked-1.2.7.tgz#6e14b595581d2319cdcf033a24caaf41455a01fb" + integrity sha512-No11hFYcXr/zkBvL6qFmAp1z6BKY3zqLMHny/JN/ey+al7qwCM2+CMBL9BOgqMxZU36fz4cCWfn2poWIf7QRXA== + +matcher@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/matcher/-/matcher-3.0.0.tgz#bd9060f4c5b70aa8041ccc6f80368760994f30ca" + integrity sha512-OkeDaAZ/bQCxeFAozM55PKcKU0yJMPGifLwV4Qgjitu+5MoAfSQN4lsLJeXZ1b8w0x+/Emda6MZgXS1jvsapng== + dependencies: + escape-string-regexp "^4.0.0" + +md5-hex@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/md5-hex/-/md5-hex-3.0.1.tgz#be3741b510591434b2784d79e556eefc2c9a8e5c" + integrity sha512-BUiRtTtV39LIJwinWBjqVsU9xhdnz7/i889V859IBFpuqGAj6LuOvHv5XLbgZ2R7ptJoJaEcxkv88/h25T7Ciw== + dependencies: + blueimp-md5 "^2.10.0" + +media-typer@0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/media-typer/-/media-typer-0.3.0.tgz#8710d7af0aa626f8fffa1ce00168545263255748" + integrity sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ== + +mem@^8.0.0: + version "8.0.0" + resolved "https://registry.yarnpkg.com/mem/-/mem-8.0.0.tgz#b5e4b6d2d241c6296da05436173b4d0c7ae1f9ac" + integrity sha512-qrcJOe6uD+EW8Wrci1Vdiua/15Xw3n/QnaNXE7varnB6InxSk7nu3/i5jfy3S6kWxr8WYJ6R1o0afMUtvorTsA== + dependencies: + map-age-cleaner "^0.1.3" + mimic-fn "^3.1.0" + +memory-pager@^1.0.2: + version "1.5.0" + resolved "https://registry.yarnpkg.com/memory-pager/-/memory-pager-1.5.0.tgz#d8751655d22d384682741c972f2c3d6dfa3e66b5" + integrity sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg== + +memorystream@^0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/memorystream/-/memorystream-0.3.1.tgz#86d7090b30ce455d63fbae12dda51a47ddcaf9b2" + integrity sha1-htcJCzDORV1j+64S3aUaR93K+bI= + +meow@^6.1.0: + version "6.1.1" + resolved "https://registry.yarnpkg.com/meow/-/meow-6.1.1.tgz#1ad64c4b76b2a24dfb2f635fddcadf320d251467" + integrity sha512-3YffViIt2QWgTy6Pale5QpopX/IvU3LPL03jOTqp6pGj3VjesdO/U8CuHMKpnQr4shCNCM5fd5XFFvIIl6JBHg== + dependencies: + "@types/minimist" "^1.2.0" + camelcase-keys "^6.2.2" + decamelize-keys "^1.1.0" + hard-rejection "^2.1.0" + minimist-options "^4.0.2" + normalize-package-data "^2.5.0" + read-pkg-up "^7.0.1" + redent "^3.0.0" + trim-newlines "^3.0.0" + type-fest "^0.13.1" + yargs-parser "^18.1.3" + +meow@^8.0.0: + version "8.1.2" + resolved "https://registry.yarnpkg.com/meow/-/meow-8.1.2.tgz#bcbe45bda0ee1729d350c03cffc8395a36c4e897" + integrity sha512-r85E3NdZ+mpYk1C6RjPFEMSE+s1iZMuHtsHAqY0DT3jZczl0diWUZ8g6oU7h0M9cD2EL+PzaYghhCLzR0ZNn5Q== + dependencies: + "@types/minimist" "^1.2.0" + camelcase-keys "^6.2.2" + decamelize-keys "^1.1.0" + hard-rejection "^2.1.0" + minimist-options "4.1.0" + normalize-package-data "^3.0.0" + read-pkg-up "^7.0.1" + redent "^3.0.0" + trim-newlines "^3.0.0" + type-fest "^0.18.0" + yargs-parser "^20.2.3" + +merge-descriptors@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61" + integrity sha512-cCi6g3/Zr1iqQi6ySbseM1Xvooa98N0w31jzUYrXPX2xqObmFGHJ0tQ5u74H3mVh7wLouTseZyYIq39g8cNp1w== + +merge-stream@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/merge-stream/-/merge-stream-2.0.0.tgz#52823629a14dd00c9770fb6ad47dc6310f2c1f60" + integrity sha512-abv/qOcuPfk3URPfDzmZU1LKmuw8kT+0nIHvKrKgFrwifol/doWcdA4ZqsWQ8ENrFKkd67Mfpo/LovbIUsbt3w== + +merge2@^1.3.0, merge2@^1.4.1: + version "1.4.1" + resolved "https://registry.yarnpkg.com/merge2/-/merge2-1.4.1.tgz#4368892f885e907455a6fd7dc55c0c9d404990ae" + integrity sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg== + +merge@^1.2.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/merge/-/merge-1.2.1.tgz#38bebf80c3220a8a487b6fcfb3941bb11720c145" + integrity sha512-VjFo4P5Whtj4vsLzsYBu5ayHhoHJ0UqNm7ibvShmbmoz7tGi0vXaoJbGdB+GmDMLUdg8DpQXEIeVDAe8MaABvQ== + +methods@^1.1.2, methods@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/methods/-/methods-1.1.2.tgz#5529a4d67654134edcc5266656835b0f851afcee" + integrity sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w== + +micromatch@^3.0.4: + version "3.1.10" + resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-3.1.10.tgz#70859bc95c9840952f359a068a3fc49f9ecfac23" + integrity sha512-MWikgl9n9M3w+bpsY3He8L+w9eF9338xRl8IAO5viDizwSzziFEyUzo2xrrloB64ADbTf8uA8vRqqttDTOmccg== + dependencies: + arr-diff "^4.0.0" + array-unique "^0.3.2" + braces "^2.3.1" + define-property "^2.0.2" + extend-shallow "^3.0.2" + extglob "^2.0.4" + fragment-cache "^0.2.1" + kind-of "^6.0.2" + nanomatch "^1.2.9" + object.pick "^1.3.0" + regex-not "^1.0.0" + snapdragon "^0.8.1" + to-regex "^3.0.2" + +micromatch@^4.0.2, micromatch@^4.0.4: + version "4.0.5" + resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-4.0.5.tgz#bc8999a7cbbf77cdc89f132f6e467051b49090c6" + integrity sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA== + dependencies: + braces "^3.0.2" + picomatch "^2.3.1" + +mime-db@1.52.0: + version "1.52.0" + resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.52.0.tgz#bbabcdc02859f4987301c856e3387ce5ec43bf70" + integrity sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg== + +mime-types@^2.1.12, mime-types@~2.1.24, mime-types@~2.1.34: + version "2.1.35" + resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.35.tgz#381a871b62a734450660ae3deee44813f70d959a" + integrity sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw== + dependencies: + mime-db "1.52.0" + +mime@1.6.0: + version "1.6.0" + resolved "https://registry.yarnpkg.com/mime/-/mime-1.6.0.tgz#32cd9e5c64553bd58d19a568af452acff04981b1" + integrity sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg== + +mime@2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/mime/-/mime-2.6.0.tgz#a2a682a95cd4d0cb1d6257e28f83da7e35800367" + integrity sha512-USPkMeET31rOMiarsBNIHZKLGgvKc/LrjofAnBlOttf5ajRvqiRA8QsenbcooctK6d6Ts6aqZXBA+XbkKthiQg== + +mimic-fn@^1.0.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.2.0.tgz#820c86a39334640e99516928bd03fca88057d022" + integrity sha512-jf84uxzwiuiIVKiOLpfYk7N46TSy8ubTonmneY9vrpHNAnp0QBt2BxWV9dO3/j+BoVAb+a5G6YDPW3M5HOdMWQ== + +mimic-fn@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-2.1.0.tgz#7ed2c2ccccaf84d3ffcb7a69b57711fc2083401b" + integrity sha512-OqbOk5oEQeAZ8WXWydlu9HJjz9WVdEIvamMCcXmuqUYjTknH/sqsWvhQ3vgwKFRR1HpjvNBKQ37nbJgYzGqGcg== + +mimic-fn@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-3.1.0.tgz#65755145bbf3e36954b949c16450427451d5ca74" + integrity sha512-Ysbi9uYW9hFyfrThdDEQuykN4Ey6BuwPD2kpI5ES/nFTDn/98yxYNLZJcgUAKPT/mcrLLKaGzJR9YVxJrIdASQ== + +mimic-response@^1.0.0, mimic-response@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/mimic-response/-/mimic-response-1.0.1.tgz#4923538878eef42063cb8a3e3b0798781487ab1b" + integrity sha512-j5EctnkH7amfV/q5Hgmoal1g2QHFJRraOtmx0JpIqkxhBhI/lJSl1nMpQ45hVarwNETOoWEimndZ4QK0RHxuxQ== + +min-indent@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/min-indent/-/min-indent-1.0.1.tgz#a63f681673b30571fbe8bc25686ae746eefa9869" + integrity sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg== + +minimalistic-assert@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz#2e194de044626d4a10e7f7fbc00ce73e83e4d5c7" + integrity sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A== + +minimatch@^3.0.0: + version "3.0.4" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.0.4.tgz#5166e286457f03306064be5497e8dbb0c3d32083" + integrity sha512-yJHVQEhyqPLUTgt9B83PXu6W3rx4MvvHvSUvToogpwoGDOUQ+yDrR0HRot+yOCdCO7u4hX3pWft6kWBBcqh0UA== + dependencies: + brace-expansion "^1.1.7" + +minimatch@^3.0.4, minimatch@^3.1.1, minimatch@^3.1.2: + version "3.1.2" + resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b" + integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw== + dependencies: + brace-expansion "^1.1.7" + +minimist-options@4.1.0, minimist-options@^4.0.2: + version "4.1.0" + resolved "https://registry.yarnpkg.com/minimist-options/-/minimist-options-4.1.0.tgz#c0655713c53a8a2ebd77ffa247d342c40f010619" + integrity sha512-Q4r8ghd80yhO/0j1O3B2BjweX3fiHg9cdOwjJd2J76Q135c+NDxGCqdYKQ1SKBuFfgWbAUzBfvYjPUEeNgqN1A== + dependencies: + arrify "^1.0.1" + is-plain-obj "^1.1.0" + kind-of "^6.0.3" + +minimist@1.2.5: + version "1.2.5" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.5.tgz#67d66014b66a6a8aaa0c083c5fd58df4e4e97602" + integrity sha512-FM9nNUYrRBAELZQT3xeZQ7fmMOBg6nWNmJKTcgsJeaLstP/UODVpGsr5OhXhhXg6f+qtJ8uiZ+PUxkDWcgIXLw== + +minimist@^1.2.0, minimist@^1.2.5, minimist@^1.2.6: + version "1.2.8" + resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.8.tgz#c1a464e7693302e082a075cee0c057741ac4772c" + integrity sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA== + +mixin-deep@^1.2.0: + version "1.3.2" + resolved "https://registry.yarnpkg.com/mixin-deep/-/mixin-deep-1.3.2.tgz#1120b43dc359a785dce65b55b82e257ccf479566" + integrity sha512-WRoDn//mXBiJ1H40rqa3vH0toePwSsGb45iInWlTySa+Uu4k3tYUSxa2v1KqAiLtvlrSzaExqS1gtk96A9zvEA== + dependencies: + for-in "^1.0.2" + is-extendable "^1.0.1" + +modify-values@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/modify-values/-/modify-values-1.0.1.tgz#b3939fa605546474e3e3e3c63d64bd43b4ee6022" + integrity sha512-xV2bxeN6F7oYjZWTe/YPAy6MN2M+sL4u/Rlm2AHCIVGfo2p1yGmBHQ6vHehl4bRTZBdHu3TSkWdYgkwpYzAGSw== + +mongodb-connection-string-url@^2.6.0: + version "2.6.0" + resolved "https://registry.yarnpkg.com/mongodb-connection-string-url/-/mongodb-connection-string-url-2.6.0.tgz#57901bf352372abdde812c81be47b75c6b2ec5cf" + integrity sha512-WvTZlI9ab0QYtTYnuMLgobULWhokRjtC7db9LtcVfJ+Hsnyr5eo6ZtNAt3Ly24XZScGMelOcGtm7lSn0332tPQ== + dependencies: + "@types/whatwg-url" "^8.2.1" + whatwg-url "^11.0.0" + +mongodb@^5.1.0: + version "5.9.0" + resolved "https://registry.yarnpkg.com/mongodb/-/mongodb-5.9.0.tgz#5a22065fa8cfaf1d58bf2e3c451cd2c4bfa983a2" + integrity sha512-g+GCMHN1CoRUA+wb1Agv0TI4YTSiWr42B5ulkiAfLLHitGK1R+PkSAf3Lr5rPZwi/3F04LiaZEW0Kxro9Fi2TA== + dependencies: + bson "^5.5.0" + mongodb-connection-string-url "^2.6.0" + socks "^2.7.1" + optionalDependencies: + "@mongodb-js/saslprep" "^1.1.0" + +ms@2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8" + integrity sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A== + +ms@2.1.2: + version "2.1.2" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.2.tgz#d09d1f357b443f493382a8eb3ccd183872ae6009" + integrity sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w== + +ms@2.1.3, ms@^2.1.1, ms@^2.1.3: + version "2.1.3" + resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2" + integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA== + +mute-stream@0.0.7: + version "0.0.7" + resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.7.tgz#3075ce93bc21b8fab43e1bc4da7e8115ed1e7bab" + integrity sha1-MHXOk7whuPq0PhvE2n6BFe0ee6s= + +nanomatch@^1.2.9: + version "1.2.13" + resolved "https://registry.yarnpkg.com/nanomatch/-/nanomatch-1.2.13.tgz#b87a8aa4fc0de8fe6be88895b38983ff265bd119" + integrity sha512-fpoe2T0RbHwBTBUOftAfBPaDEi06ufaUai0mE6Yn1kacc3SnTErfb/h+X94VXzI64rKFHYImXSvdwGGCmwOqCA== + dependencies: + arr-diff "^4.0.0" + array-unique "^0.3.2" + define-property "^2.0.2" + extend-shallow "^3.0.2" + fragment-cache "^0.2.1" + is-windows "^1.0.2" + kind-of "^6.0.2" + object.pick "^1.3.0" + regex-not "^1.0.0" + snapdragon "^0.8.1" + to-regex "^3.0.1" + +natural-compare@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/natural-compare/-/natural-compare-1.4.0.tgz#4abebfeed7541f2c27acfb29bdbbd15c8d5ba4f7" + integrity sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw== + +negotiator@0.6.3: + version "0.6.3" + resolved "https://registry.yarnpkg.com/negotiator/-/negotiator-0.6.3.tgz#58e323a72fedc0d6f9cd4d31fe49f51479590ccd" + integrity sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg== + +neo-async@^2.6.0: + version "2.6.2" + resolved "https://registry.yarnpkg.com/neo-async/-/neo-async-2.6.2.tgz#b4aafb93e3aeb2d8174ca53cf163ab7d7308305f" + integrity sha512-Yd3UES5mWCSqR+qNT93S3UoYUkqAZ9lLg8a7g9rimsWmYGK8cVToA4/sF3RrshdyV3sAGMXVUmpMYOw+dLpOuw== + +nice-try@^1.0.4: + version "1.0.5" + resolved "https://registry.yarnpkg.com/nice-try/-/nice-try-1.0.5.tgz#a3378a7696ce7d223e88fc9b764bd7ef1089e366" + integrity sha512-1nh45deeb5olNY7eX82BkPO7SSxR5SSYJiPTrTdFUVYwAl8CKMA5N9PjTYkHiRjisVcxcQ1HXdLhx2qxxJzLNQ== + +node-fetch@^2.6.1: + version "2.6.9" + resolved "https://registry.yarnpkg.com/node-fetch/-/node-fetch-2.6.9.tgz#7c7f744b5cc6eb5fd404e0c7a9fec630a55657e6" + integrity sha512-DJm/CJkZkRjKKj4Zi4BsKVZh3ValV5IR5s7LVZnW+6YMh0W1BfNA8XSs6DLMGYlId5F3KnA70uu2qepcR08Qqg== + dependencies: + whatwg-url "^5.0.0" + +node-preload@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/node-preload/-/node-preload-0.2.1.tgz#c03043bb327f417a18fee7ab7ee57b408a144301" + integrity sha512-RM5oyBy45cLEoHqCeh+MNuFAxO0vTFBLskvQbOKnEE7YTTSN4tbN8QWDIPQ6L+WvKsB/qLEGpYe2ZZ9d4W9OIQ== + dependencies: + process-on-spawn "^1.0.0" + +normalize-package-data@^2.3.2, normalize-package-data@^2.5.0: + version "2.5.0" + resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.5.0.tgz#e66db1838b200c1dfc233225d12cb36520e234a8" + integrity sha512-/5CMN3T0R4XTj4DcGaexo+roZSdSFW/0AOOTROrjxzCG1wrWXEsGbRKevjlIL+ZDE4sZlJr5ED4YW0yqmkK+eA== + dependencies: + hosted-git-info "^2.1.4" + resolve "^1.10.0" + semver "2 || 3 || 4 || 5" + validate-npm-package-license "^3.0.1" + +normalize-package-data@^3.0.0: + version "3.0.3" + resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-3.0.3.tgz#dbcc3e2da59509a0983422884cd172eefdfa525e" + integrity sha512-p2W1sgqij3zMMyRC067Dg16bfzVH+w7hyegmpIvZ4JNjqtGOVAIvLmjBx3yP7YTe9vKJgkoNOPjwQGogDoMXFA== + dependencies: + hosted-git-info "^4.0.1" + is-core-module "^2.5.0" + semver "^7.3.4" + validate-npm-package-license "^3.0.1" + +normalize-path@^3.0.0, normalize-path@~3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/normalize-path/-/normalize-path-3.0.0.tgz#0dcd69ff23a1c9b11fd0978316644a0388216a65" + integrity sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA== + +normalize-url@^4.1.0: + version "4.5.0" + resolved "https://registry.yarnpkg.com/normalize-url/-/normalize-url-4.5.0.tgz#453354087e6ca96957bd8f5baf753f5982142129" + integrity sha512-2s47yzUxdexf1OhyRi4Em83iQk0aPvwTddtFz4hnSSw9dCEsLEGf6SwIO8ss/19S9iBb5sJaOuTvTGDeZI00BQ== + +npm-run-all@^4.1.5: + version "4.1.5" + resolved "https://registry.yarnpkg.com/npm-run-all/-/npm-run-all-4.1.5.tgz#04476202a15ee0e2e214080861bff12a51d98fba" + integrity sha512-Oo82gJDAVcaMdi3nuoKFavkIHBRVqQ1qvMb+9LHk/cF4P6B2m8aP04hGf7oL6wZ9BuGwX1onlLhpuoofSyoQDQ== + dependencies: + ansi-styles "^3.2.1" + chalk "^2.4.1" + cross-spawn "^6.0.5" + memorystream "^0.3.1" + minimatch "^3.0.4" + pidtree "^0.3.0" + read-pkg "^3.0.0" + shell-quote "^1.6.1" + string.prototype.padend "^3.0.0" + +npm-run-path@^4.0.0: + version "4.0.1" + resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-4.0.1.tgz#b7ecd1e5ed53da8e37a55e1c2269e0b97ed748ea" + integrity sha512-S48WzZW777zhNIrn7gxOlISNAqi9ZC/uQFnRdbeIHhZhCA6UqpkOT8T1G7BvfdgP4Er8gF4sUbaS0i7QvIfCWw== + dependencies: + path-key "^3.0.0" + +nyc@^15.1.0: + version "15.1.0" + resolved "https://registry.yarnpkg.com/nyc/-/nyc-15.1.0.tgz#1335dae12ddc87b6e249d5a1994ca4bdaea75f02" + integrity sha512-jMW04n9SxKdKi1ZMGhvUTHBN0EICCRkHemEoE5jm6mTYcqcdas0ATzgUgejlQUHMvpnOZqGB5Xxsv9KxJW1j8A== + dependencies: + "@istanbuljs/load-nyc-config" "^1.0.0" + "@istanbuljs/schema" "^0.1.2" + caching-transform "^4.0.0" + convert-source-map "^1.7.0" + decamelize "^1.2.0" + find-cache-dir "^3.2.0" + find-up "^4.1.0" + foreground-child "^2.0.0" + get-package-type "^0.1.0" + glob "^7.1.6" + istanbul-lib-coverage "^3.0.0" + istanbul-lib-hook "^3.0.0" + istanbul-lib-instrument "^4.0.0" + istanbul-lib-processinfo "^2.0.2" + istanbul-lib-report "^3.0.0" + istanbul-lib-source-maps "^4.0.0" + istanbul-reports "^3.0.2" + make-dir "^3.0.0" + node-preload "^0.2.1" + p-map "^3.0.0" + process-on-spawn "^1.0.0" + resolve-from "^5.0.0" + rimraf "^3.0.0" + signal-exit "^3.0.2" + spawn-wrap "^2.0.0" + test-exclude "^6.0.0" + yargs "^15.0.2" + +object-assign@^4.0.1: + version "4.1.1" + resolved "https://registry.yarnpkg.com/object-assign/-/object-assign-4.1.1.tgz#2109adc7965887cfc05cbbd442cac8bfbb360863" + integrity sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg== + +object-copy@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/object-copy/-/object-copy-0.1.0.tgz#7e7d858b781bd7c991a41ba975ed3812754e998c" + integrity sha1-fn2Fi3gb18mRpBupde04EnVOmYw= + dependencies: + copy-descriptor "^0.1.0" + define-property "^0.2.5" + kind-of "^3.0.3" + +object-inspect@^1.12.3, object-inspect@^1.9.0: + version "1.12.3" + resolved "https://registry.yarnpkg.com/object-inspect/-/object-inspect-1.12.3.tgz#ba62dffd67ee256c8c086dfae69e016cd1f198b9" + integrity sha512-geUvdk7c+eizMNUDkRpW1wJwgfOiOeHbxBR/hLXK1aT6zmVSO0jsQcs7fj6MGw89jC/cjGfLcNOrtMYtGqm81g== + +object-keys@^1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/object-keys/-/object-keys-1.1.1.tgz#1c47f272df277f3b1daf061677d9c82e2322c60e" + integrity sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA== + +object-visit@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/object-visit/-/object-visit-1.0.1.tgz#f79c4493af0c5377b59fe39d395e41042dd045bb" + integrity sha1-95xEk68MU3e1n+OdOV5BBC3QRbs= + dependencies: + isobject "^3.0.0" + +object.assign@^4.1.4: + version "4.1.4" + resolved "https://registry.yarnpkg.com/object.assign/-/object.assign-4.1.4.tgz#9673c7c7c351ab8c4d0b516f4343ebf4dfb7799f" + integrity sha512-1mxKf0e58bvyjSCtKYY4sRe9itRk3PJpquJOjeIkz885CczcI4IvJJDLPS72oowuSh+pBxUFROpX+TU++hxhZQ== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + has-symbols "^1.0.3" + object-keys "^1.1.1" + +object.pick@^1.3.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/object.pick/-/object.pick-1.3.0.tgz#87a10ac4c1694bd2e1cbf53591a66141fb5dd747" + integrity sha1-h6EKxMFpS9Lhy/U1kaZhQftd10c= + dependencies: + isobject "^3.0.1" + +object.values@^1.1.6: + version "1.1.6" + resolved "https://registry.yarnpkg.com/object.values/-/object.values-1.1.6.tgz#4abbaa71eba47d63589d402856f908243eea9b1d" + integrity sha512-FVVTkD1vENCsAcwNs9k6jea2uHC/X0+JcjG8YA60FN5CMaJmG95wT9jek/xX9nornqGRrBkKtzuAu2wuHpKqvw== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + +on-finished@2.4.1: + version "2.4.1" + resolved "https://registry.yarnpkg.com/on-finished/-/on-finished-2.4.1.tgz#58c8c44116e54845ad57f14ab10b03533184ac3f" + integrity sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg== + dependencies: + ee-first "1.1.1" + +on-headers@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/on-headers/-/on-headers-1.0.2.tgz#772b0ae6aaa525c399e489adfad90c403eb3c28f" + integrity sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA== + +once@^1.3.0, once@^1.3.1, once@^1.4.0: + version "1.4.0" + resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" + integrity sha1-WDsap3WWHUsROsF9nFC6753Xa9E= + dependencies: + wrappy "1" + +onetime@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/onetime/-/onetime-2.0.1.tgz#067428230fd67443b2794b22bba528b6867962d4" + integrity sha1-BnQoIw/WdEOyeUsiu6UotoZ5YtQ= + dependencies: + mimic-fn "^1.0.0" + +onetime@^5.1.0: + version "5.1.2" + resolved "https://registry.yarnpkg.com/onetime/-/onetime-5.1.2.tgz#d0e96ebb56b07476df1dd9c4806e5237985ca45e" + integrity sha512-kbpaSSGJTWdAY5KPVeMOKXSrPtr8C8C7wodJbcsd51jRnmD+GZu8Y0VoU6Dm5Z4vWr0Ig/1NKuWRKf7j5aaYSg== + dependencies: + mimic-fn "^2.1.0" + +open-cli@^6.0.1: + version "6.0.1" + resolved "https://registry.yarnpkg.com/open-cli/-/open-cli-6.0.1.tgz#adcee24967dc12c65d8cb8bf994e7dc40aed7a8e" + integrity sha512-A5h8MF3GrT1efn9TiO9LPajDnLtuEiGQT5G8TxWObBlgt1cZJF1YbQo/kNtsD1bJb7HxnT6SaSjzeLq0Rfhygw== + dependencies: + file-type "^14.1.4" + get-stdin "^7.0.0" + meow "^6.1.0" + open "^7.0.3" + temp-write "^4.0.0" + +open@^7.0.3: + version "7.3.1" + resolved "https://registry.yarnpkg.com/open/-/open-7.3.1.tgz#111119cb919ca1acd988f49685c4fdd0f4755356" + integrity sha512-f2wt9DCBKKjlFbjzGb8MOAW8LH8F0mrs1zc7KTjAJ9PZNQbfenzWbNP1VZJvw6ICMG9r14Ah6yfwPn7T7i646A== + dependencies: + is-docker "^2.0.0" + is-wsl "^2.1.1" + +opencollective-postinstall@^2.0.2: + version "2.0.3" + resolved "https://registry.yarnpkg.com/opencollective-postinstall/-/opencollective-postinstall-2.0.3.tgz#7a0fff978f6dbfa4d006238fbac98ed4198c3259" + integrity sha512-8AV/sCtuzUeTo8gQK5qDZzARrulB3egtLzFgteqB2tcT4Mw7B8Kt7JcDHmltjz6FOAHsvTevk70gZEbhM4ZS9Q== + +optionator@^0.9.1: + version "0.9.1" + resolved "https://registry.yarnpkg.com/optionator/-/optionator-0.9.1.tgz#4f236a6373dae0566a6d43e1326674f50c291499" + integrity sha512-74RlY5FCnhq4jRxVUPKDaRwrVNXMqsGsiW6AJw4XK8hmtm10wC0ypZBLw5IIp85NZMr91+qd1RvvENwg7jjRFw== + dependencies: + deep-is "^0.1.3" + fast-levenshtein "^2.0.6" + levn "^0.4.1" + prelude-ls "^1.2.1" + type-check "^0.4.0" + word-wrap "^1.2.3" + +ora@^5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/ora/-/ora-5.2.0.tgz#de10bfd2d15514384af45f3fa9d9b1aaf344fda1" + integrity sha512-+wG2v8TUU8EgzPHun1k/n45pXquQ9fHnbXVetl9rRgO6kjZszGGbraF3XPTIdgeA+s1lbRjSEftAnyT0w8ZMvQ== + dependencies: + bl "^4.0.3" + chalk "^4.1.0" + cli-cursor "^3.1.0" + cli-spinners "^2.5.0" + is-interactive "^1.0.0" + log-symbols "^4.0.0" + strip-ansi "^6.0.0" + wcwidth "^1.0.1" + +os-tmpdir@~1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274" + integrity sha1-u+Z0BseaqFxc/sdm/lc0VV36EnQ= + +p-cancelable@^1.0.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/p-cancelable/-/p-cancelable-1.1.0.tgz#d078d15a3af409220c886f1d9a0ca2e441ab26cc" + integrity sha512-s73XxOZ4zpt1edZYZzvhqFa6uvQc1vwUa0K0BdtIZgQMAJj9IbebH+JkgKZc9h+B05PKHLOTl4ajG1BmNrVZlw== + +p-defer@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-defer/-/p-defer-1.0.0.tgz#9f6eb182f6c9aa8cd743004a7d4f96b196b0fb0c" + integrity sha1-n26xgvbJqozXQwBKfU+WsZaw+ww= + +p-event@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/p-event/-/p-event-4.2.0.tgz#af4b049c8acd91ae81083ebd1e6f5cae2044c1b5" + integrity sha512-KXatOjCRXXkSePPb1Nbi0p0m+gQAwdlbhi4wQKJPI1HsMQS9g+Sqp2o+QHziPr7eYJyOZet836KoHEVM1mwOrQ== + dependencies: + p-timeout "^3.1.0" + +p-finally@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-finally/-/p-finally-1.0.0.tgz#3fbcfb15b899a44123b34b6dcc18b724336a2cae" + integrity sha1-P7z7FbiZpEEjs0ttzBi3JDNqLK4= + +p-limit@^1.1.0: + version "1.3.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-1.3.0.tgz#b86bd5f0c25690911c7590fcbfc2010d54b3ccb8" + integrity sha512-vvcXsLAJ9Dr5rQOPk7toZQZJApBl2K4J6dANSsEuh6QI41JYcsS/qhTGa9ErIUUgK3WNQoJYvylxvjqmiqEA9Q== + dependencies: + p-try "^1.0.0" + +p-limit@^2.0.0, p-limit@^2.2.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-2.3.0.tgz#3dd33c647a214fdfffd835933eb086da0dc21db1" + integrity sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w== + dependencies: + p-try "^2.0.0" + +p-limit@^3.0.2: + version "3.1.0" + resolved "https://registry.yarnpkg.com/p-limit/-/p-limit-3.1.0.tgz#e1daccbe78d0d1388ca18c64fea38e3e57e3706b" + integrity sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ== + dependencies: + yocto-queue "^0.1.0" + +p-locate@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-2.0.0.tgz#20a0103b222a70c8fd39cc2e580680f3dde5ec43" + integrity sha512-nQja7m7gSKuewoVRen45CtVfODR3crN3goVQ0DDZ9N3yHxgpkuBhZqsaiotSQRrADUrne346peY7kT3TSACykg== + dependencies: + p-limit "^1.1.0" + +p-locate@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-3.0.0.tgz#322d69a05c0264b25997d9f40cd8a891ab0064a4" + integrity sha512-x+12w/To+4GFfgJhBEpiDcLozRJGegY+Ei7/z0tSLkMmxGZNybVMSfWj9aJn8Z5Fc7dBUNJOOVgPv2H7IwulSQ== + dependencies: + p-limit "^2.0.0" + +p-locate@^4.1.0: + version "4.1.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-4.1.0.tgz#a3428bb7088b3a60292f66919278b7c297ad4f07" + integrity sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A== + dependencies: + p-limit "^2.2.0" + +p-locate@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/p-locate/-/p-locate-5.0.0.tgz#83c8315c6785005e3bd021839411c9e110e6d834" + integrity sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw== + dependencies: + p-limit "^3.0.2" + +p-map@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/p-map/-/p-map-3.0.0.tgz#d704d9af8a2ba684e2600d9a215983d4141a979d" + integrity sha512-d3qXVTF/s+W+CdJ5A29wywV2n8CQQYahlgz2bFiA+4eVNJbHJodPZ+/gXwPGh0bOqA+j8S+6+ckmvLGPk1QpxQ== + dependencies: + aggregate-error "^3.0.0" + +p-map@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/p-map/-/p-map-4.0.0.tgz#bb2f95a5eda2ec168ec9274e06a747c3e2904d2b" + integrity sha512-/bjOqmgETBYB5BoEeGVea8dmvHb2m9GLy1E9W43yeyfP6QQCZGFNa+XRceJEuDB6zqr+gKpIAmlLebMpykw/MQ== + dependencies: + aggregate-error "^3.0.0" + +p-timeout@^3.1.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/p-timeout/-/p-timeout-3.2.0.tgz#c7e17abc971d2a7962ef83626b35d635acf23dfe" + integrity sha512-rhIwUycgwwKcP9yTOOFK/AKsAopjjCakVqLHePO3CC6Mir1Z99xT+R63jZxAT5lFZLa2inS5h+ZS2GvR99/FBg== + dependencies: + p-finally "^1.0.0" + +p-try@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/p-try/-/p-try-1.0.0.tgz#cbc79cdbaf8fd4228e13f621f2b1a237c1b207b3" + integrity sha512-U1etNYuMJoIz3ZXSrrySFjsXQTWOx2/jdi86L+2pRvph/qMKL6sbcCYdH23fqsbm8TH2Gn0OybpT4eSFlCVHww== + +p-try@^2.0.0: + version "2.2.0" + resolved "https://registry.yarnpkg.com/p-try/-/p-try-2.2.0.tgz#cb2868540e313d61de58fafbe35ce9004d5540e6" + integrity sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ== + +package-hash@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/package-hash/-/package-hash-4.0.0.tgz#3537f654665ec3cc38827387fc904c163c54f506" + integrity sha512-whdkPIooSu/bASggZ96BWVvZTRMOFxnyUG5PnTSGKoJE2gd5mbVNmR2Nj20QFzxYYgAXpoqC+AiXzl+UMRh7zQ== + dependencies: + graceful-fs "^4.1.15" + hasha "^5.0.0" + lodash.flattendeep "^4.4.0" + release-zalgo "^1.0.0" + +package-json@^6.3.0: + version "6.5.0" + resolved "https://registry.yarnpkg.com/package-json/-/package-json-6.5.0.tgz#6feedaca35e75725876d0b0e64974697fed145b0" + integrity sha512-k3bdm2n25tkyxcjSKzB5x8kfVxlMdgsbPr0GkZcwHsLpba6cBjqCt1KlcChKEvxHIcTB1FVMuwoijZ26xex5MQ== + dependencies: + got "^9.6.0" + registry-auth-token "^4.0.0" + registry-url "^5.0.0" + semver "^6.2.0" + +parent-module@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/parent-module/-/parent-module-1.0.1.tgz#691d2709e78c79fae3a156622452d00762caaaa2" + integrity sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g== + dependencies: + callsites "^3.0.0" + +parse-json@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-4.0.0.tgz#be35f5425be1f7f6c747184f98a788cb99477ee0" + integrity sha512-aOIos8bujGN93/8Ox/jPLh7RwVnPEysynVFE+fQZyg6jKELEHwzgKdLRFHUgXJL6kylijVSBC4BvN9OmsB48Rw== + dependencies: + error-ex "^1.3.1" + json-parse-better-errors "^1.0.1" + +parse-json@^5.0.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/parse-json/-/parse-json-5.2.0.tgz#c76fc66dee54231c962b22bcc8a72cf2f99753cd" + integrity sha512-ayCKvm/phCGxOkYRSCM82iDwct8/EonSEgCSxWxD7ve6jHggsFl4fZVQBPRNgQoKiuV/odhFrGzQXZwbifC8Rg== + dependencies: + "@babel/code-frame" "^7.0.0" + error-ex "^1.3.1" + json-parse-even-better-errors "^2.3.0" + lines-and-columns "^1.1.6" + +parse-ms@^2.1.0: + version "2.1.0" + resolved "https://registry.yarnpkg.com/parse-ms/-/parse-ms-2.1.0.tgz#348565a753d4391fa524029956b172cb7753097d" + integrity sha512-kHt7kzLoS9VBZfUsiKjv43mr91ea+U05EyKkEtqp7vNbHxmaVuEqN7XxeEVnGrMtYOAxGrDElSi96K7EgO1zCA== + +parse-passwd@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/parse-passwd/-/parse-passwd-1.0.0.tgz#6d5b934a456993b23d37f40a382d6f1666a8e5c6" + integrity sha1-bVuTSkVpk7I9N/QKOC1vFmao5cY= + +parseurl@~1.3.3: + version "1.3.3" + resolved "https://registry.yarnpkg.com/parseurl/-/parseurl-1.3.3.tgz#9da19e7bee8d12dff0513ed5b76957793bc2e8d4" + integrity sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ== + +pascalcase@^0.1.1: + version "0.1.1" + resolved "https://registry.yarnpkg.com/pascalcase/-/pascalcase-0.1.1.tgz#b363e55e8006ca6fe21784d2db22bd15d7917f14" + integrity sha1-s2PlXoAGym/iF4TS2yK9FdeRfxQ= + +path-exists@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-3.0.0.tgz#ce0ebeaa5f78cb18925ea7d810d7b59b010fd515" + integrity sha512-bpC7GYwiDYQ4wYLe+FA8lhRjhQCMcQGuSgGGqDkg/QerRWw9CmGRT0iSOVRSZJ29NMLZgIzqaljJ63oaL4NIJQ== + +path-exists@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/path-exists/-/path-exists-4.0.0.tgz#513bdbe2d3b95d7762e8c1137efa195c6c61b5b3" + integrity sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w== + +path-is-absolute@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" + integrity sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg== + +path-key@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40" + integrity sha1-QRyttXTFoUDTpLGRDUDYDMn0C0A= + +path-key@^3.0.0, path-key@^3.1.0: + version "3.1.1" + resolved "https://registry.yarnpkg.com/path-key/-/path-key-3.1.1.tgz#581f6ade658cbba65a0d3380de7753295054f375" + integrity sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q== + +path-parse@^1.0.6, path-parse@^1.0.7: + version "1.0.7" + resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.7.tgz#fbc114b60ca42b30d9daf5858e4bd68bbedb6735" + integrity sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw== + +path-to-regexp@0.1.7: + version "0.1.7" + resolved "https://registry.yarnpkg.com/path-to-regexp/-/path-to-regexp-0.1.7.tgz#df604178005f522f15eb4490e7247a1bfaa67f8c" + integrity sha512-5DFkuoqlv1uYQKxy8omFBeJPQcdoE07Kv2sferDCrAq1ohOU+MSDswDIbnx3YAM60qIOnYa53wBhXW0EbMonrQ== + +path-type@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-3.0.0.tgz#cef31dc8e0a1a3bb0d105c0cd97cf3bf47f4e36f" + integrity sha512-T2ZUsdZFHgA3u4e5PfPbjd7HDDpxPnQb5jN0SrDsjNSuVXHJqtwTnWqG0B1jZrgmJ/7lj1EmVIByWt1gxGkWvg== + dependencies: + pify "^3.0.0" + +path-type@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/path-type/-/path-type-4.0.0.tgz#84ed01c0a7ba380afe09d90a8c180dcd9d03043b" + integrity sha512-gDKb8aZMDeD/tZWs9P6+q0J9Mwkdl6xMV8TjnGP3qJVJ06bdMgkbBlLU8IdfOsIsFz2BW1rNVT3XuNEl8zPAvw== + +peek-readable@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/peek-readable/-/peek-readable-3.1.1.tgz#795c1429374f256e4b5ab6c584cecfd3a110024f" + integrity sha512-QHJag0oYYPVkx6rVPEgCLEUMo6VRYbV3GUrqy00lxXJBEIw9LhPCP5MQI6mEfahJO9KYUP8W8qD8kC0V9RyZFQ== + +picomatch@^2.0.4, picomatch@^2.2.2: + version "2.2.2" + resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.2.2.tgz#21f333e9b6b8eaff02468f5146ea406d345f4dad" + integrity sha512-q0M/9eZHzmr0AulXyPwNfZjtwZ/RBZlbN3K3CErVrk50T2ASYI7Bye0EvekFY3IP1Nt2DHu0re+V2ZHIpMkuWg== + +picomatch@^2.2.1, picomatch@^2.3.1: + version "2.3.1" + resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42" + integrity sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA== + +pidtree@^0.3.0: + version "0.3.1" + resolved "https://registry.yarnpkg.com/pidtree/-/pidtree-0.3.1.tgz#ef09ac2cc0533df1f3250ccf2c4d366b0d12114a" + integrity sha512-qQbW94hLHEqCg7nhby4yRC7G2+jYHY4Rguc2bjw7Uug4GIJuu1tvf2uHaZv5Q8zdt+WKJ6qK1FOI6amaWUo5FA== + +pify@^2.0.0, pify@^2.3.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c" + integrity sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog== + +pify@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/pify/-/pify-3.0.0.tgz#e5a4acd2c101fdf3d9a4d07f0dbc4db49dd28176" + integrity sha512-C3FsVNH1udSEX48gGX1xfvwTWfsYWj5U+8/uK15BGzIGrKoUpghX8hWZwa/OFnakBiiVNmBvemTJR5mcy7iPcg== + +pify@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/pify/-/pify-4.0.1.tgz#4b2cd25c50d598735c50292224fd8c6df41e3231" + integrity sha512-uB80kBFb/tfd68bVleG9T5GGsGPjJrLAUpR5PZIrhBnIaRTQRjqdJSsIKkOP6OAIFbj7GOrcudc5pNjZ+geV2g== + +pinkie-promise@^2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/pinkie-promise/-/pinkie-promise-2.0.1.tgz#2135d6dfa7a358c069ac9b178776288228450ffa" + integrity sha512-0Gni6D4UcLTbv9c57DfxDGdr41XfgUjqWZu492f0cIGr16zDU06BWP/RAEvOuo7CQ0CNjHaLlM59YJJFm3NWlw== + dependencies: + pinkie "^2.0.0" + +pinkie@^2.0.0: + version "2.0.4" + resolved "https://registry.yarnpkg.com/pinkie/-/pinkie-2.0.4.tgz#72556b80cfa0d48a974e80e77248e80ed4f7f870" + integrity sha512-MnUuEycAemtSaeFSjXKW/aroV7akBbY+Sv+RkyqFjgAe73F+MR0TBWKBRDkmfWq/HiFmdavfZ1G7h4SPZXaCSg== + +pkg-conf@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/pkg-conf/-/pkg-conf-3.1.0.tgz#d9f9c75ea1bae0e77938cde045b276dac7cc69ae" + integrity sha512-m0OTbR/5VPNPqO1ph6Fqbj7Hv6QU7gR/tQW40ZqrL1rjgCU85W6C1bJn0BItuJqnR98PWzw7Z8hHeChD1WrgdQ== + dependencies: + find-up "^3.0.0" + load-json-file "^5.2.0" + +pkg-dir@^4.1.0, pkg-dir@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-4.2.0.tgz#f099133df7ede422e81d1d8448270eeb3e4261f3" + integrity sha512-HRDzbaKjC+AOWVXxAU/x54COGeIv9eb+6CkDSQoNTt4XyWoIJvuPsXizxu/Fr23EiekbtZwmh1IcIG/l/a10GQ== + dependencies: + find-up "^4.0.0" + +pkg-dir@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-5.0.0.tgz#a02d6aebe6ba133a928f74aec20bafdfe6b8e760" + integrity sha512-NPE8TDbzl/3YQYY7CSS228s3g2ollTFnc+Qi3tqmqJp9Vg2ovUpixcJEo2HJScN2Ez+kEaal6y70c0ehqJBJeA== + dependencies: + find-up "^5.0.0" + +please-upgrade-node@^3.2.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/please-upgrade-node/-/please-upgrade-node-3.2.0.tgz#aeddd3f994c933e4ad98b99d9a556efa0e2fe942" + integrity sha512-gQR3WpIgNIKwBMVLkpMUeR3e1/E1y42bqDQZfql+kDeXd8COYfM8PQA4X6y7a8u9Ua9FHmsrrmirW2vHs45hWg== + dependencies: + semver-compare "^1.0.0" + +plur@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/plur/-/plur-4.0.0.tgz#729aedb08f452645fe8c58ef115bf16b0a73ef84" + integrity sha512-4UGewrYgqDFw9vV6zNV+ADmPAUAfJPKtGvb/VdpQAx25X5f3xXdGdyOEVFwkl8Hl/tl7+xbeHqSEM+D5/TirUg== + dependencies: + irregular-plurals "^3.2.0" + +posix-character-classes@^0.1.0: + version "0.1.1" + resolved "https://registry.yarnpkg.com/posix-character-classes/-/posix-character-classes-0.1.1.tgz#01eac0fe3b5af71a2a6c02feabb8c1fef7e00eab" + integrity sha1-AerA/jta9xoqbAL+q7jB/vfgDqs= + +prelude-ls@^1.2.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/prelude-ls/-/prelude-ls-1.2.1.tgz#debc6489d7a6e6b0e7611888cec880337d316396" + integrity sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g== + +prepend-http@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/prepend-http/-/prepend-http-2.0.0.tgz#e92434bfa5ea8c19f41cdfd401d741a3c819d897" + integrity sha1-6SQ0v6XqjBn0HN/UAddBo8gZ2Jc= + +prettier-linter-helpers@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/prettier-linter-helpers/-/prettier-linter-helpers-1.0.0.tgz#d23d41fe1375646de2d0104d3454a3008802cf7b" + integrity sha512-GbK2cP9nraSSUF9N2XwUwqfzlAFlMNYYl+ShE/V+H8a9uNl/oUqB1w2EL54Jh0OlyRSd8RfWYJ3coVS4TROP2w== + dependencies: + fast-diff "^1.1.2" + +prettier@^2.2.1: + version "2.8.4" + resolved "https://registry.yarnpkg.com/prettier/-/prettier-2.8.4.tgz#34dd2595629bfbb79d344ac4a91ff948694463c3" + integrity sha512-vIS4Rlc2FNh0BySk3Wkd6xmwxB0FpOndW5fisM5H8hsZSxU2VWVB5CWIkIjWvrHjIhxk2g3bfMKM87zNTrZddw== + +pretty-ms@^7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/pretty-ms/-/pretty-ms-7.0.1.tgz#7d903eaab281f7d8e03c66f867e239dc32fb73e8" + integrity sha512-973driJZvxiGOQ5ONsFhOF/DtzPMOMtgC11kCpUrPGMTgqp2q/1gwzCquocrN33is0VZ5GFHXZYMM9l6h67v2Q== + dependencies: + parse-ms "^2.1.0" + +process-nextick-args@~2.0.0: + version "2.0.1" + resolved "https://registry.yarnpkg.com/process-nextick-args/-/process-nextick-args-2.0.1.tgz#7820d9b16120cc55ca9ae7792680ae7dba6d7fe2" + integrity sha512-3ouUOpQhtgrbOa17J7+uxOTpITYWaGP7/AhoR3+A+/1e9skrzelGi/dXzEYyvbxubEF6Wn2ypscTKiKJFFn1ag== + +process-on-spawn@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/process-on-spawn/-/process-on-spawn-1.0.0.tgz#95b05a23073d30a17acfdc92a440efd2baefdc93" + integrity sha512-1WsPDsUSMmZH5LeMLegqkPDrsGgsWwk1Exipy2hvB0o/F0ASzbpIctSCcZIK1ykJvtTJULEH+20WOFjMvGnCTg== + dependencies: + fromentries "^1.2.0" + +progress@^2.0.0, progress@^2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/progress/-/progress-2.0.3.tgz#7e8cf8d8f5b8f239c1bc68beb4eb78567d572ef8" + integrity sha512-7PiHtLll5LdnKIMw100I+8xJXR5gW2QwWYkT6iJva0bXitZKa/XMrSbdmg3r2Xnaidz9Qumd0VPaMrZlF9V9sA== + +proxy-addr@~2.0.7: + version "2.0.7" + resolved "https://registry.yarnpkg.com/proxy-addr/-/proxy-addr-2.0.7.tgz#f19fe69ceab311eeb94b42e70e8c2070f9ba1025" + integrity sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg== + dependencies: + forwarded "0.2.0" + ipaddr.js "1.9.1" + +pump@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/pump/-/pump-3.0.0.tgz#b4a2116815bde2f4e1ea602354e8c75565107a64" + integrity sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww== + dependencies: + end-of-stream "^1.1.0" + once "^1.3.1" + +punycode@^1.3.2: + version "1.4.1" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-1.4.1.tgz#c0d5a63b2718800ad8e1eb0fa5269c84dd41845e" + integrity sha512-jmYNElW7yvO7TV33CjSmvSiE2yco3bV2czu/OzDKdMNVZQWfxCblURLhf+47syQRBntjfLdd/H0egrzIG+oaFQ== + +punycode@^2.1.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.3.0.tgz#f67fa67c94da8f4d0cfff981aee4118064199b8f" + integrity sha512-rRV+zQD8tVFys26lAGR9WUuS4iUAngJScM+ZRSKtvl5tKeZ2t5bvdNFdNHBW9FWR4guGHlgmsZ1G7BSm2wTbuA== + +punycode@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/punycode/-/punycode-2.1.1.tgz#b58b010ac40c22c5657616c8d2c2c02c7bf479ec" + integrity sha512-XRsRjdf+j5ml+y/6GKHPZbrF/8p2Yga0JPtdqTIY2Xe5ohJPD9saDJJLPvp9+NSBprVvevdXZybnj2cv8OEd0A== + +pupa@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/pupa/-/pupa-2.1.1.tgz#f5e8fd4afc2c5d97828faa523549ed8744a20d62" + integrity sha512-l1jNAspIBSFqbT+y+5FosojNpVpF94nlI+wDUpqP9enwOTfHx9f0gh5nB96vl+6yTpsJsypeNrwfzPrKuHB41A== + dependencies: + escape-goat "^2.0.0" + +q@^1.5.1: + version "1.5.1" + resolved "https://registry.yarnpkg.com/q/-/q-1.5.1.tgz#7e32f75b41381291d04611f1bf14109ac00651d7" + integrity sha512-kV/CThkXo6xyFEZUugw/+pIOywXcDbFYgSct5cT3gqlbkBE1SJdwy6UQoZvodiWF/ckQLZyDE/Bu1M6gVu5lVw== + +qs@6.11.0: + version "6.11.0" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.11.0.tgz#fd0d963446f7a65e1367e01abd85429453f0c37a" + integrity sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q== + dependencies: + side-channel "^1.0.4" + +qs@^6.11.0: + version "6.11.1" + resolved "https://registry.yarnpkg.com/qs/-/qs-6.11.1.tgz#6c29dff97f0c0060765911ba65cbc9764186109f" + integrity sha512-0wsrzgTz/kAVIeuxSjnpGC56rzYtr6JT/2BwEvMaPhFIoYa1aGO8LbzuU1R0uUYQkLpWBTOj0l/CLAJB64J6nQ== + dependencies: + side-channel "^1.0.4" + +queue-microtask@^1.2.2: + version "1.2.3" + resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243" + integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A== + +quick-lru@^4.0.1: + version "4.0.1" + resolved "https://registry.yarnpkg.com/quick-lru/-/quick-lru-4.0.1.tgz#5b8878f113a58217848c6482026c73e1ba57727f" + integrity sha512-ARhCpm70fzdcvNQfPoy49IaanKkTlRWF2JMzqhcJbhSFRZv7nPTvZJdcY7301IPmvW+/p0RgIWnQDLJxifsQ7g== + +random-bytes@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/random-bytes/-/random-bytes-1.0.0.tgz#4f68a1dc0ae58bd3fb95848c30324db75d64360b" + integrity sha512-iv7LhNVO047HzYR3InF6pUcUsPQiHTM1Qal51DcGSuZFBil1aBBWG5eHPNek7bvILMaYJ/8RU1e8w1AMdHmLQQ== + +range-parser@~1.2.1: + version "1.2.1" + resolved "https://registry.yarnpkg.com/range-parser/-/range-parser-1.2.1.tgz#3cf37023d199e1c24d1a55b84800c2f3e6468031" + integrity sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg== + +raw-body@2.5.1: + version "2.5.1" + resolved "https://registry.yarnpkg.com/raw-body/-/raw-body-2.5.1.tgz#fe1b1628b181b700215e5fd42389f98b71392857" + integrity sha512-qqJBtEyVgS0ZmPGdCFPWJ3FreoqvG4MVQln/kCgF7Olq95IbOp0/BWyMwbdtn4VTvkM8Y7khCQ2Xgk/tcrCXig== + dependencies: + bytes "3.1.2" + http-errors "2.0.0" + iconv-lite "0.4.24" + unpipe "1.0.0" + +rc@^1.2.8: + version "1.2.8" + resolved "https://registry.yarnpkg.com/rc/-/rc-1.2.8.tgz#cd924bf5200a075b83c188cd6b9e211b7fc0d3ed" + integrity sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw== + dependencies: + deep-extend "^0.6.0" + ini "~1.3.0" + minimist "^1.2.0" + strip-json-comments "~2.0.1" + +read-pkg-up@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-3.0.0.tgz#3ed496685dba0f8fe118d0691dc51f4a1ff96f07" + integrity sha512-YFzFrVvpC6frF1sz8psoHDBGF7fLPc+llq/8NB43oagqWkx8ar5zYtsTORtOjw9W2RHLpWP+zTWwBvf1bCmcSw== + dependencies: + find-up "^2.0.0" + read-pkg "^3.0.0" + +read-pkg-up@^7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-7.0.1.tgz#f3a6135758459733ae2b95638056e1854e7ef507" + integrity sha512-zK0TB7Xd6JpCLmlLmufqykGE+/TlOePD6qKClNW7hHDKFh/J7/7gCWGR7joEQEW1bKq3a3yUZSObOoWLFQ4ohg== + dependencies: + find-up "^4.1.0" + read-pkg "^5.2.0" + type-fest "^0.8.1" + +read-pkg@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-3.0.0.tgz#9cbc686978fee65d16c00e2b19c237fcf6e38389" + integrity sha512-BLq/cCO9two+lBgiTYNqD6GdtK8s4NpaWrl6/rCO9w0TUS8oJl7cmToOZfRYllKTISY6nt1U7jQ53brmKqY6BA== + dependencies: + load-json-file "^4.0.0" + normalize-package-data "^2.3.2" + path-type "^3.0.0" + +read-pkg@^5.2.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-5.2.0.tgz#7bf295438ca5a33e56cd30e053b34ee7250c93cc" + integrity sha512-Ug69mNOpfvKDAc2Q8DRpMjjzdtrnv9HcSMX+4VsZxD1aZ6ZzrIE7rlzXBtWTyhULSMKg076AW6WR5iZpD0JiOg== + dependencies: + "@types/normalize-package-data" "^2.4.0" + normalize-package-data "^2.5.0" + parse-json "^5.0.0" + type-fest "^0.6.0" + +readable-stream@3, readable-stream@^3.0.0, readable-stream@^3.0.2: + version "3.6.2" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-3.6.2.tgz#56a9b36ea965c00c5a93ef31eb111a0f11056967" + integrity sha512-9u/sniCrY3D5WdsERHzHE4G2YCXqoG5FTHUiCC4SIbr6XcLZBY05ya9EKjYek9O5xOAwjGq+1JdGBAS7Q9ScoA== + dependencies: + inherits "^2.0.3" + string_decoder "^1.1.1" + util-deprecate "^1.0.1" + +readable-stream@^3.4.0: + version "3.6.0" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-3.6.0.tgz#337bbda3adc0706bd3e024426a286d4b4b2c9198" + integrity sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA== + dependencies: + inherits "^2.0.3" + string_decoder "^1.1.1" + util-deprecate "^1.0.1" + +readable-stream@~2.3.6: + version "2.3.8" + resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.3.8.tgz#91125e8042bba1b9887f49345f6277027ce8be9b" + integrity sha512-8p0AUk4XODgIewSi0l8Epjs+EVnWiK7NoDIEGU0HhE7+ZyY8D1IMY7odu5lRrFXGg71L15KG8QrPmum45RTtdA== + dependencies: + core-util-is "~1.0.0" + inherits "~2.0.3" + isarray "~1.0.0" + process-nextick-args "~2.0.0" + safe-buffer "~5.1.1" + string_decoder "~1.1.1" + util-deprecate "~1.0.1" + +readable-web-to-node-stream@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/readable-web-to-node-stream/-/readable-web-to-node-stream-2.0.0.tgz#751e632f466552ac0d5c440cc01470352f93c4b7" + integrity sha512-+oZJurc4hXpaaqsN68GoZGQAQIA3qr09Or4fqEsargABnbe5Aau8hFn6ISVleT3cpY/0n/8drn7huyyEvTbghA== + +readdirp@~3.5.0: + version "3.5.0" + resolved "https://registry.yarnpkg.com/readdirp/-/readdirp-3.5.0.tgz#9ba74c019b15d365278d2e91bb8c48d7b4d42c9e" + integrity sha512-cMhu7c/8rdhkHXWsY+osBhfSy0JikwpHK/5+imo+LpeasTF8ouErHrlYkwT0++njiyuDvc7OFY5T3ukvZ8qmFQ== + dependencies: + picomatch "^2.2.1" + +rechoir@^0.6.2: + version "0.6.2" + resolved "https://registry.yarnpkg.com/rechoir/-/rechoir-0.6.2.tgz#85204b54dba82d5742e28c96756ef43af50e3384" + integrity sha512-HFM8rkZ+i3zrV+4LQjwQ0W+ez98pApMGM3HUrN04j3CqzPOzl9nmP15Y8YXNm8QHGv/eacOVEjqhmWpkRV0NAw== + dependencies: + resolve "^1.1.6" + +redent@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/redent/-/redent-3.0.0.tgz#e557b7998316bb53c9f1f56fa626352c6963059f" + integrity sha512-6tDA8g98We0zd0GvVeMT9arEOnTw9qM03L9cJXaCjrip1OO764RDBLBfrB4cwzNGDj5OA5ioymC9GkizgWJDUg== + dependencies: + indent-string "^4.0.0" + strip-indent "^3.0.0" + +regenerator-runtime@^0.13.4: + version "0.13.7" + resolved "https://registry.yarnpkg.com/regenerator-runtime/-/regenerator-runtime-0.13.7.tgz#cac2dacc8a1ea675feaabaeb8ae833898ae46f55" + integrity sha512-a54FxoJDIr27pgf7IgeQGxmqUNYrcV338lf/6gH456HZ/PhX+5BcwHXG9ajESmwe6WRO0tAzRUrRmNONWgkrew== + +regex-not@^1.0.0, regex-not@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/regex-not/-/regex-not-1.0.2.tgz#1f4ece27e00b0b65e0247a6810e6a85d83a5752c" + integrity sha512-J6SDjUgDxQj5NusnOtdFxDwN/+HWykR8GELwctJ7mdqhcyy1xEc4SRFHUXvxTp661YaVKAjfRLZ9cCqS6tn32A== + dependencies: + extend-shallow "^3.0.2" + safe-regex "^1.1.0" + +regexp.prototype.flags@^1.4.3: + version "1.4.3" + resolved "https://registry.yarnpkg.com/regexp.prototype.flags/-/regexp.prototype.flags-1.4.3.tgz#87cab30f80f66660181a3bb7bf5981a872b367ac" + integrity sha512-fjggEOO3slI6Wvgjwflkc4NFRCTZAu5CnNfBd5qOMYhWdn67nJBBu34/TkD++eeFmd8C9r9jfXJ27+nSiRkSUA== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.3" + functions-have-names "^1.2.2" + +regexpp@^3.0.0, regexpp@^3.1.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/regexpp/-/regexpp-3.2.0.tgz#0425a2768d8f23bad70ca4b90461fa2f1213e1b2" + integrity sha512-pq2bWo9mVD43nbts2wGv17XLiNLya+GklZ8kaDLV2Z08gDCsGpnKn9BFMepvWuHCbyVvY7J5o5+BVvoQbmlJLg== + +registry-auth-token@^4.0.0: + version "4.2.1" + resolved "https://registry.yarnpkg.com/registry-auth-token/-/registry-auth-token-4.2.1.tgz#6d7b4006441918972ccd5fedcd41dc322c79b250" + integrity sha512-6gkSb4U6aWJB4SF2ZvLb76yCBjcvufXBqvvEx1HbmKPkutswjW1xNVRY0+daljIYRbogN7O0etYSlbiaEQyMyw== + dependencies: + rc "^1.2.8" + +registry-url@^5.0.0: + version "5.1.0" + resolved "https://registry.yarnpkg.com/registry-url/-/registry-url-5.1.0.tgz#e98334b50d5434b81136b44ec638d9c2009c5009" + integrity sha512-8acYXXTI0AkQv6RAOjE3vOaIXZkT9wo4LOFbBKYQEEnnMNBpKqdUrI6S4NT0KPIo/WVvJ5tE/X5LF/TQUf0ekw== + dependencies: + rc "^1.2.8" + +release-zalgo@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/release-zalgo/-/release-zalgo-1.0.0.tgz#09700b7e5074329739330e535c5a90fb67851730" + integrity sha1-CXALflB0Mpc5Mw5TXFqQ+2eFFzA= + dependencies: + es6-error "^4.0.1" + +repeat-element@^1.1.2: + version "1.1.3" + resolved "https://registry.yarnpkg.com/repeat-element/-/repeat-element-1.1.3.tgz#782e0d825c0c5a3bb39731f84efee6b742e6b1ce" + integrity sha512-ahGq0ZnV5m5XtZLMb+vP76kcAM5nkLqk0lpqAuojSKGgQtn4eRi4ZZGm2olo2zKFH+sMsWaqOCW1dqAnOru72g== + +repeat-string@^1.6.1: + version "1.6.1" + resolved "https://registry.yarnpkg.com/repeat-string/-/repeat-string-1.6.1.tgz#8dcae470e1c88abc2d600fff4a776286da75e637" + integrity sha512-PV0dzCYDNfRi1jCDbJzpW7jNNDRuCOG/jI5ctQcGKt/clZD+YcPS3yIlWuTJMmESC8aevCFmWJy5wjAFgNqN6w== + +require-directory@^2.1.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/require-directory/-/require-directory-2.1.1.tgz#8c64ad5fd30dab1c976e2344ffe7f792a6a6df42" + integrity sha512-fGxEI7+wsG9xrvdjsrlmL22OMTTiHRwAMroiEeMgq8gzoLC/PQr7RsRDSTLUg/bZAZtF+TVIkHc6/4RIKrui+Q== + +require-from-string@^2.0.2: + version "2.0.2" + resolved "https://registry.yarnpkg.com/require-from-string/-/require-from-string-2.0.2.tgz#89a7fdd938261267318eafe14f9c32e598c36909" + integrity sha512-Xf0nWe6RseziFMu+Ap9biiUbmplq6S9/p+7w7YXP/JBHhrUDDUhwa+vANyubuqfZWTveU//DYVGsDG7RKL/vEw== + +require-main-filename@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/require-main-filename/-/require-main-filename-2.0.0.tgz#d0b329ecc7cc0f61649f62215be69af54aa8989b" + integrity sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg== + +resolve-cwd@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/resolve-cwd/-/resolve-cwd-3.0.0.tgz#0f0075f1bb2544766cf73ba6a6e2adfebcb13f2d" + integrity sha512-OrZaX2Mb+rJCpH/6CpSqt9xFVpN++x01XnN2ie9g6P5/3xelLAkXWVADpdz1IHD/KFfEXyE6V0U01OQ3UO2rEg== + dependencies: + resolve-from "^5.0.0" + +resolve-dir@^1.0.0, resolve-dir@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/resolve-dir/-/resolve-dir-1.0.1.tgz#79a40644c362be82f26effe739c9bb5382046f43" + integrity sha1-eaQGRMNivoLybv/nOcm7U4IEb0M= + dependencies: + expand-tilde "^2.0.0" + global-modules "^1.0.0" + +resolve-from@5.0.0, resolve-from@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-5.0.0.tgz#c35225843df8f776df21c57557bc087e9dfdfc69" + integrity sha512-qYg9KP24dD5qka9J47d0aVky0N+b4fTU89LN9iDnjB5waksiC49rvMB0PrUJQGoTmH50XPiqOvAjDfaijGxYZw== + +resolve-from@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/resolve-from/-/resolve-from-4.0.0.tgz#4abcd852ad32dd7baabfe9b40e00a36db5f392e6" + integrity sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g== + +resolve-global@1.0.0, resolve-global@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/resolve-global/-/resolve-global-1.0.0.tgz#a2a79df4af2ca3f49bf77ef9ddacd322dad19255" + integrity sha512-zFa12V4OLtT5XUX/Q4VLvTfBf+Ok0SPc1FNGM/z9ctUdiU618qwKpWnd0CHs3+RqROfyEg/DhuHbMWYqcgljEw== + dependencies: + global-dirs "^0.1.1" + +resolve-url@^0.2.1: + version "0.2.1" + resolved "https://registry.yarnpkg.com/resolve-url/-/resolve-url-0.2.1.tgz#2c637fe77c893afd2a663fe21aa9080068e2052a" + integrity sha1-LGN/53yJOv0qZj/iGqkIAGjiBSo= + +resolve@^1.1.6, resolve@^1.10.0, resolve@^1.22.1: + version "1.22.1" + resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.22.1.tgz#27cb2ebb53f91abb49470a928bba7558066ac177" + integrity sha512-nBpuuYuY5jFsli/JIs1oldw6fOQCBioohqWZg/2hiaOybXOft4lonv85uDOKXdf8rhyK159cxU5cDcK/NKk8zw== + dependencies: + is-core-module "^2.9.0" + path-parse "^1.0.7" + supports-preserve-symlinks-flag "^1.0.0" + +resolve@^1.10.1: + version "1.19.0" + resolved "https://registry.yarnpkg.com/resolve/-/resolve-1.19.0.tgz#1af5bf630409734a067cae29318aac7fa29a267c" + integrity sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg== + dependencies: + is-core-module "^2.1.0" + path-parse "^1.0.6" + +responselike@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/responselike/-/responselike-1.0.2.tgz#918720ef3b631c5642be068f15ade5a46f4ba1e7" + integrity sha1-kYcg7ztjHFZCvgaPFa3lpG9Loec= + dependencies: + lowercase-keys "^1.0.0" + +restore-cursor@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-2.0.0.tgz#9f7ee287f82fd326d4fd162923d62129eee0dfaf" + integrity sha1-n37ih/gv0ybU/RYpI9YhKe7g368= + dependencies: + onetime "^2.0.0" + signal-exit "^3.0.2" + +restore-cursor@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/restore-cursor/-/restore-cursor-3.1.0.tgz#39f67c54b3a7a58cea5236d95cf0034239631f7e" + integrity sha512-l+sSefzHpj5qimhFSE5a8nufZYAM3sBSVMAPtYkmC+4EH2anSGaEMXSD0izRQbu9nfyQ9y5JrVmp7E8oZrUjvA== + dependencies: + onetime "^5.1.0" + signal-exit "^3.0.2" + +ret@~0.1.10: + version "0.1.15" + resolved "https://registry.yarnpkg.com/ret/-/ret-0.1.15.tgz#b8a4825d5bdb1fc3f6f53c2bc33f81388681c7bc" + integrity sha512-TTlYpa+OL+vMMNG24xSlQGEJ3B/RzEfUlLct7b5G/ytav+wPrplCpVMFuwzXbkecJrb6IYo1iFb0S9v37754mg== + +reusify@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76" + integrity sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw== + +rimraf@^3.0.0, rimraf@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/rimraf/-/rimraf-3.0.2.tgz#f1a5402ba6220ad52cc1282bac1ae3aa49fd061a" + integrity sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA== + dependencies: + glob "^7.1.3" + +run-async@^2.2.0: + version "2.4.1" + resolved "https://registry.yarnpkg.com/run-async/-/run-async-2.4.1.tgz#8440eccf99ea3e70bd409d49aab88e10c189a455" + integrity sha512-tvVnVv01b8c1RrA6Ep7JkStj85Guv/YrMcwqYQnwjsAS2cTmmPGBBjAjpCW7RrSodNSoE2/qg9O4bceNvUuDgQ== + +run-parallel@^1.1.9: + version "1.2.0" + resolved "https://registry.yarnpkg.com/run-parallel/-/run-parallel-1.2.0.tgz#66d1368da7bdf921eb9d95bd1a9229e7f21a43ee" + integrity sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA== + dependencies: + queue-microtask "^1.2.2" + +rxjs@^6.4.0, rxjs@^6.6.3: + version "6.6.3" + resolved "https://registry.yarnpkg.com/rxjs/-/rxjs-6.6.3.tgz#8ca84635c4daa900c0d3967a6ee7ac60271ee552" + integrity sha512-trsQc+xYYXZ3urjOiJOuCOa5N3jAZ3eiSpQB5hIT8zGlL2QfnHLJ2r7GMkBGuIausdJN1OneaI6gQlsqNHHmZQ== + dependencies: + tslib "^1.9.0" + +safe-buffer@5.2.1, safe-buffer@~5.2.0: + version "5.2.1" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.2.1.tgz#1eaf9fa9bdb1fdd4ec75f58f9cdb4e6b7827eec6" + integrity sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ== + +safe-buffer@~5.1.0, safe-buffer@~5.1.1: + version "5.1.2" + resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d" + integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g== + +safe-regex-test@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/safe-regex-test/-/safe-regex-test-1.0.0.tgz#793b874d524eb3640d1873aad03596db2d4f2295" + integrity sha512-JBUUzyOgEwXQY1NuPtvcj/qcBDbDmEvWufhlnXZIm75DEHp+afM1r1ujJpJsV/gSM4t59tpDyPi1sd6ZaPFfsA== + dependencies: + call-bind "^1.0.2" + get-intrinsic "^1.1.3" + is-regex "^1.1.4" + +safe-regex@^1.1.0: + version "1.1.0" + resolved "https://registry.yarnpkg.com/safe-regex/-/safe-regex-1.1.0.tgz#40a3669f3b077d1e943d44629e157dd48023bf2e" + integrity sha1-QKNmnzsHfR6UPURinhV91IAjvy4= + dependencies: + ret "~0.1.10" + +"safer-buffer@>= 2.1.2 < 3", "safer-buffer@>= 2.1.2 < 3.0.0", safer-buffer@^2.1.0: + version "2.1.2" + resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a" + integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg== + +semver-compare@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/semver-compare/-/semver-compare-1.0.0.tgz#0dee216a1c941ab37e9efb1788f6afc5ff5537fc" + integrity sha1-De4hahyUGrN+nvsXiPavxf9VN/w= + +semver-diff@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/semver-diff/-/semver-diff-3.1.1.tgz#05f77ce59f325e00e2706afd67bb506ddb1ca32b" + integrity sha512-GX0Ix/CJcHyB8c4ykpHGIAvLyOwOobtM/8d+TQkAd81/bEjgPHrfba41Vpesr7jX/t8Uh+R3EX9eAS5be+jQYg== + dependencies: + semver "^6.3.0" + +semver-regex@^3.1.2: + version "3.1.2" + resolved "https://registry.yarnpkg.com/semver-regex/-/semver-regex-3.1.2.tgz#34b4c0d361eef262e07199dbef316d0f2ab11807" + integrity sha512-bXWyL6EAKOJa81XG1OZ/Yyuq+oT0b2YLlxx7c+mrdYPaPbnj6WgVULXhinMIeZGufuUBu/eVRqXEhiv4imfwxA== + +"semver@2 || 3 || 4 || 5", semver@^5.4.1, semver@^5.5.0: + version "5.7.1" + resolved "https://registry.yarnpkg.com/semver/-/semver-5.7.1.tgz#a954f931aeba508d307bbf069eff0c01c96116f7" + integrity sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ== + +semver@7.3.2: + version "7.3.2" + resolved "https://registry.yarnpkg.com/semver/-/semver-7.3.2.tgz#604962b052b81ed0786aae84389ffba70ffd3938" + integrity sha512-OrOb32TeeambH6UrhtShmF7CRDqhL6/5XpPNp2DuRH6+9QLw/orhp72j87v8Qa1ScDkvrrBNpZcDejAirJmfXQ== + +semver@^6.0.0, semver@^6.1.0, semver@^6.2.0, semver@^6.3.0: + version "6.3.0" + resolved "https://registry.yarnpkg.com/semver/-/semver-6.3.0.tgz#ee0a64c8af5e8ceea67687b133761e1becbd1d3d" + integrity sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw== + +semver@^7.1.1, semver@^7.2.1, semver@^7.3.2, semver@^7.3.4, semver@^7.3.5, semver@^7.3.8: + version "7.3.8" + resolved "https://registry.yarnpkg.com/semver/-/semver-7.3.8.tgz#07a78feafb3f7b32347d725e33de7e2a2df67798" + integrity sha512-NB1ctGL5rlHrPJtFDVIVzTyQylMLu9N9VICA6HSFJo8MCGVTMW6gfpicwKmmK/dAjTOrqu5l63JJOpDSrAis3A== + dependencies: + lru-cache "^6.0.0" + +send@0.18.0: + version "0.18.0" + resolved "https://registry.yarnpkg.com/send/-/send-0.18.0.tgz#670167cc654b05f5aa4a767f9113bb371bc706be" + integrity sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg== + dependencies: + debug "2.6.9" + depd "2.0.0" + destroy "1.2.0" + encodeurl "~1.0.2" + escape-html "~1.0.3" + etag "~1.8.1" + fresh "0.5.2" + http-errors "2.0.0" + mime "1.6.0" + ms "2.1.3" + on-finished "2.4.1" + range-parser "~1.2.1" + statuses "2.0.1" + +serialize-error@^7.0.1: + version "7.0.1" + resolved "https://registry.yarnpkg.com/serialize-error/-/serialize-error-7.0.1.tgz#f1360b0447f61ffb483ec4157c737fab7d778e18" + integrity sha512-8I8TjW5KMOKsZQTvoxjuSIa7foAwPWGOts+6o7sgjz41/qMD9VQHEDxi6PBvK2l0MXUmqZyNpUK+T2tQaaElvw== + dependencies: + type-fest "^0.13.1" + +serve-static@1.15.0: + version "1.15.0" + resolved "https://registry.yarnpkg.com/serve-static/-/serve-static-1.15.0.tgz#faaef08cffe0a1a62f60cad0c4e513cff0ac9540" + integrity sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g== + dependencies: + encodeurl "~1.0.2" + escape-html "~1.0.3" + parseurl "~1.3.3" + send "0.18.0" + +set-blocking@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/set-blocking/-/set-blocking-2.0.0.tgz#045f9782d011ae9a6803ddd382b24392b3d890f7" + integrity sha512-KiKBS8AnWGEyLzofFfmvKwpdPzqiy16LvQfK3yv/fVH7Bj13/wl3JSR1J+rfgRE9q7xUJK4qvgS8raSOeLUehw== + +set-value@^2.0.0, set-value@^2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/set-value/-/set-value-2.0.1.tgz#a18d40530e6f07de4228c7defe4227af8cad005b" + integrity sha512-JxHc1weCN68wRY0fhCoXpyK55m/XPHafOmK4UWD7m2CI14GMcFypt4w/0+NV5f/ZMby2F6S2wwA7fgynh9gWSw== + dependencies: + extend-shallow "^2.0.1" + is-extendable "^0.1.1" + is-plain-object "^2.0.3" + split-string "^3.0.1" + +setprototypeof@1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/setprototypeof/-/setprototypeof-1.2.0.tgz#66c9a24a73f9fc28cbe66b09fed3d33dcaf1b424" + integrity sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw== + +shebang-command@^1.2.0: + version "1.2.0" + resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea" + integrity sha1-RKrGW2lbAzmJaMOfNj/uXer98eo= + dependencies: + shebang-regex "^1.0.0" + +shebang-command@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-2.0.0.tgz#ccd0af4f8835fbdc265b82461aaf0c36663f34ea" + integrity sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA== + dependencies: + shebang-regex "^3.0.0" + +shebang-regex@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3" + integrity sha1-2kL0l0DAtC2yypcoVxyxkMmO/qM= + +shebang-regex@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-3.0.0.tgz#ae16f1644d873ecad843b0307b143362d4c42172" + integrity sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A== + +shell-quote@^1.6.1: + version "1.7.2" + resolved "https://registry.yarnpkg.com/shell-quote/-/shell-quote-1.7.2.tgz#67a7d02c76c9da24f99d20808fcaded0e0e04be2" + integrity sha512-mRz/m/JVscCrkMyPqHc/bczi3OQHkLTqXHEFu0zDhK/qfv3UcOA4SVmRCLmos4bhjr9ekVQubj/R7waKapmiQg== + +shelljs@^0.8.4: + version "0.8.4" + resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.8.4.tgz#de7684feeb767f8716b326078a8a00875890e3c2" + integrity sha512-7gk3UZ9kOfPLIAbslLzyWeGiEqx9e3rxwZM0KE6EL8GlGwjym9Mrlx5/p33bWTu9YG6vcS4MBxYZDHYr5lr8BQ== + dependencies: + glob "^7.0.0" + interpret "^1.0.0" + rechoir "^0.6.2" + +side-channel@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/side-channel/-/side-channel-1.0.4.tgz#efce5c8fdc104ee751b25c58d4290011fa5ea2cf" + integrity sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw== + dependencies: + call-bind "^1.0.0" + get-intrinsic "^1.0.2" + object-inspect "^1.9.0" + +signal-exit@^3.0.2: + version "3.0.7" + resolved "https://registry.yarnpkg.com/signal-exit/-/signal-exit-3.0.7.tgz#a9a1767f8af84155114eaabd73f99273c8f59ad9" + integrity sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ== + +slash@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/slash/-/slash-3.0.0.tgz#6539be870c165adbd5240220dbe361f1bc4d4634" + integrity sha512-g9Q1haeby36OSStwb4ntCGGGaKsaVSjQ68fBxoQcutl5fS1vuY18H3wSt3jFyFtrkx+Kz0V1G85A4MyAdDMi2Q== + +slice-ansi@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-3.0.0.tgz#31ddc10930a1b7e0b67b08c96c2f49b77a789787" + integrity sha512-pSyv7bSTC7ig9Dcgbw9AuRNUb5k5V6oDudjZoMBSr13qpLBG7tB+zgCkARjq7xIUgdz5P1Qe8u+rSGdouOOIyQ== + dependencies: + ansi-styles "^4.0.0" + astral-regex "^2.0.0" + is-fullwidth-code-point "^3.0.0" + +slice-ansi@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/slice-ansi/-/slice-ansi-4.0.0.tgz#500e8dd0fd55b05815086255b3195adf2a45fe6b" + integrity sha512-qMCMfhY040cVHT43K9BFygqYbUPFZKHOg7K73mtTWJRb8pyP3fzf4Ixd5SzdEJQ6MRUg/WBnOLxghZtKKurENQ== + dependencies: + ansi-styles "^4.0.0" + astral-regex "^2.0.0" + is-fullwidth-code-point "^3.0.0" + +smart-buffer@^4.2.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/smart-buffer/-/smart-buffer-4.2.0.tgz#6e1d71fa4f18c05f7d0ff216dd16a481d0e8d9ae" + integrity sha512-94hK0Hh8rPqQl2xXc3HsaBoOXKV20MToPkcXvwbISWLEs+64sBq5kFgn2kJDHb1Pry9yrP0dxrCI9RRci7RXKg== + +snapdragon-node@^2.0.1: + version "2.1.1" + resolved "https://registry.yarnpkg.com/snapdragon-node/-/snapdragon-node-2.1.1.tgz#6c175f86ff14bdb0724563e8f3c1b021a286853b" + integrity sha512-O27l4xaMYt/RSQ5TR3vpWCAB5Kb/czIcqUFOM/C4fYcLnbZUc1PkjTAMjof2pBWaSTwOUd6qUHcFGVGj7aIwnw== + dependencies: + define-property "^1.0.0" + isobject "^3.0.0" + snapdragon-util "^3.0.1" + +snapdragon-util@^3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/snapdragon-util/-/snapdragon-util-3.0.1.tgz#f956479486f2acd79700693f6f7b805e45ab56e2" + integrity sha512-mbKkMdQKsjX4BAL4bRYTj21edOf8cN7XHdYUJEe+Zn99hVEYcMvKPct1IqNe7+AZPirn8BCDOQBHQZknqmKlZQ== + dependencies: + kind-of "^3.2.0" + +snapdragon@^0.8.1: + version "0.8.2" + resolved "https://registry.yarnpkg.com/snapdragon/-/snapdragon-0.8.2.tgz#64922e7c565b0e14204ba1aa7d6964278d25182d" + integrity sha512-FtyOnWN/wCHTVXOMwvSv26d+ko5vWlIDD6zoUJ7LW8vh+ZBC8QdljveRP+crNrtBwioEUWy/4dMtbBjA4ioNlg== + dependencies: + base "^0.11.1" + debug "^2.2.0" + define-property "^0.2.5" + extend-shallow "^2.0.1" + map-cache "^0.2.2" + source-map "^0.5.6" + source-map-resolve "^0.5.0" + use "^3.1.0" + +socks@^2.7.1: + version "2.7.1" + resolved "https://registry.yarnpkg.com/socks/-/socks-2.7.1.tgz#d8e651247178fde79c0663043e07240196857d55" + integrity sha512-7maUZy1N7uo6+WVEX6psASxtNlKaNVMlGQKkG/63nEDdLOWNbiUMoLK7X4uYoLhQstau72mLgfEWcXcwsaHbYQ== + dependencies: + ip "^2.0.0" + smart-buffer "^4.2.0" + +source-map-resolve@^0.5.0: + version "0.5.3" + resolved "https://registry.yarnpkg.com/source-map-resolve/-/source-map-resolve-0.5.3.tgz#190866bece7553e1f8f267a2ee82c606b5509a1a" + integrity sha512-Htz+RnsXWk5+P2slx5Jh3Q66vhQj1Cllm0zvnaY98+NFx+Dv2CF/f5O/t8x+KaNdrdIAsruNzoh/KpialbqAnw== + dependencies: + atob "^2.1.2" + decode-uri-component "^0.2.0" + resolve-url "^0.2.1" + source-map-url "^0.4.0" + urix "^0.1.0" + +source-map-support@^0.5.17, source-map-support@^0.5.19: + version "0.5.19" + resolved "https://registry.yarnpkg.com/source-map-support/-/source-map-support-0.5.19.tgz#a98b62f86dcaf4f67399648c085291ab9e8fed61" + integrity sha512-Wonm7zOCIJzBGQdB+thsPar0kYuCIzYvxZwlBa87yi/Mdjv7Tip2cyVbLj5o0cFPN4EVkuTwb3GDDyUx2DGnGw== + dependencies: + buffer-from "^1.0.0" + source-map "^0.6.0" + +source-map-url@^0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/source-map-url/-/source-map-url-0.4.0.tgz#3e935d7ddd73631b97659956d55128e87b5084a3" + integrity sha1-PpNdfd1zYxuXZZlW1VEo6HtQhKM= + +source-map@^0.5.0, source-map@^0.5.6: + version "0.5.7" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.5.7.tgz#8a039d2d1021d22d1ea14c80d8ea468ba2ef3fcc" + integrity sha1-igOdLRAh0i0eoUyA2OpGi6LvP8w= + +source-map@^0.6.0, source-map@^0.6.1: + version "0.6.1" + resolved "https://registry.yarnpkg.com/source-map/-/source-map-0.6.1.tgz#74722af32e9614e9c287a8d0bbde48b5e2f1a263" + integrity sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g== + +sparse-bitfield@^3.0.3: + version "3.0.3" + resolved "https://registry.yarnpkg.com/sparse-bitfield/-/sparse-bitfield-3.0.3.tgz#ff4ae6e68656056ba4b3e792ab3334d38273ca11" + integrity sha1-/0rm5oZWBWuks+eSqzM004JzyhE= + dependencies: + memory-pager "^1.0.2" + +spawn-wrap@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/spawn-wrap/-/spawn-wrap-2.0.0.tgz#103685b8b8f9b79771318827aa78650a610d457e" + integrity sha512-EeajNjfN9zMnULLwhZZQU3GWBoFNkbngTUPfaawT4RkMiviTxcX0qfhVbGey39mfctfDHkWtuecgQ8NJcyQWHg== + dependencies: + foreground-child "^2.0.0" + is-windows "^1.0.2" + make-dir "^3.0.0" + rimraf "^3.0.0" + signal-exit "^3.0.2" + which "^2.0.1" + +spdx-correct@^3.0.0: + version "3.2.0" + resolved "https://registry.yarnpkg.com/spdx-correct/-/spdx-correct-3.2.0.tgz#4f5ab0668f0059e34f9c00dce331784a12de4e9c" + integrity sha512-kN9dJbvnySHULIluDHy32WHRUu3Og7B9sbY7tsFLctQkIqnMh3hErYgdMjTYuqmcXX+lK5T1lnUt3G7zNswmZA== + dependencies: + spdx-expression-parse "^3.0.0" + spdx-license-ids "^3.0.0" + +spdx-exceptions@^2.1.0: + version "2.3.0" + resolved "https://registry.yarnpkg.com/spdx-exceptions/-/spdx-exceptions-2.3.0.tgz#3f28ce1a77a00372683eade4a433183527a2163d" + integrity sha512-/tTrYOC7PPI1nUAgx34hUpqXuyJG+DTHJTnIULG4rDygi4xu/tfgmq1e1cIRwRzwZgo4NLySi+ricLkZkw4i5A== + +spdx-expression-parse@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/spdx-expression-parse/-/spdx-expression-parse-3.0.1.tgz#cf70f50482eefdc98e3ce0a6833e4a53ceeba679" + integrity sha512-cbqHunsQWnJNE6KhVSMsMeH5H/L9EpymbzqTQ3uLwNCLZ1Q481oWaofqH7nO6V07xlXwY6PhQdQ2IedWx/ZK4Q== + dependencies: + spdx-exceptions "^2.1.0" + spdx-license-ids "^3.0.0" + +spdx-license-ids@^3.0.0: + version "3.0.13" + resolved "https://registry.yarnpkg.com/spdx-license-ids/-/spdx-license-ids-3.0.13.tgz#7189a474c46f8d47c7b0da4b987bb45e908bd2d5" + integrity sha512-XkD+zwiqXHikFZm4AX/7JSCXA98U5Db4AFd5XUg/+9UNtnH75+Z9KxtpYiJZx36mUDVOwH83pl7yvCer6ewM3w== + +split-string@^3.0.1, split-string@^3.0.2: + version "3.1.0" + resolved "https://registry.yarnpkg.com/split-string/-/split-string-3.1.0.tgz#7cb09dda3a86585705c64b39a6466038682e8fe2" + integrity sha512-NzNVhJDYpwceVVii8/Hu6DKfD2G+NrQHlS/V/qgv763EYudVwEcMQNxd2lh+0VrUByXN/oJkl5grOhYWvQUYiw== + dependencies: + extend-shallow "^3.0.0" + +split2@^3.0.0: + version "3.2.2" + resolved "https://registry.yarnpkg.com/split2/-/split2-3.2.2.tgz#bf2cf2a37d838312c249c89206fd7a17dd12365f" + integrity sha512-9NThjpgZnifTkJpzTZ7Eue85S49QwpNhZTq6GRJwObb6jnLFNGB7Qm73V5HewTROPyxD0C29xqmaI68bQtV+hg== + dependencies: + readable-stream "^3.0.0" + +split@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/split/-/split-1.0.1.tgz#605bd9be303aa59fb35f9229fbea0ddec9ea07d9" + integrity sha512-mTyOoPbrivtXnwnIxZRFYRrPNtEFKlpB2fvjSnCQUiAA6qAZzqwna5envK4uk6OIeP17CsdF3rSBGYVBsU0Tkg== + dependencies: + through "2" + +sprintf-js@~1.0.2: + version "1.0.3" + resolved "https://registry.yarnpkg.com/sprintf-js/-/sprintf-js-1.0.3.tgz#04e6926f662895354f3dd015203633b857297e2c" + integrity sha512-D9cPgkvLlV3t3IzL0D0YLvGA9Ahk4PcvVwUbN0dSGr1aP0Nrt4AEnTUbuGvquEC0mA64Gqt1fzirlRs5ibXx8g== + +stack-utils@^2.0.3: + version "2.0.3" + resolved "https://registry.yarnpkg.com/stack-utils/-/stack-utils-2.0.3.tgz#cd5f030126ff116b78ccb3c027fe302713b61277" + integrity sha512-gL//fkxfWUsIlFL2Tl42Cl6+HFALEaB1FU76I/Fy+oZjRreP7OPMXFlGbxM7NQsI0ZpUfw76sHnv0WNYuTb7Iw== + dependencies: + escape-string-regexp "^2.0.0" + +standard-version@^9.0.0: + version "9.5.0" + resolved "https://registry.yarnpkg.com/standard-version/-/standard-version-9.5.0.tgz#851d6dcddf5320d5079601832aeb185dbf497949" + integrity sha512-3zWJ/mmZQsOaO+fOlsa0+QK90pwhNd042qEcw6hKFNoLFs7peGyvPffpEBbK/DSGPbyOvli0mUIFv5A4qTjh2Q== + dependencies: + chalk "^2.4.2" + conventional-changelog "3.1.25" + conventional-changelog-config-spec "2.1.0" + conventional-changelog-conventionalcommits "4.6.3" + conventional-recommended-bump "6.1.0" + detect-indent "^6.0.0" + detect-newline "^3.1.0" + dotgitignore "^2.1.0" + figures "^3.1.0" + find-up "^5.0.0" + git-semver-tags "^4.0.0" + semver "^7.1.1" + stringify-package "^1.0.1" + yargs "^16.0.0" + +static-extend@^0.1.1: + version "0.1.2" + resolved "https://registry.yarnpkg.com/static-extend/-/static-extend-0.1.2.tgz#60809c39cbff55337226fd5e0b520f341f1fb5c6" + integrity sha1-YICcOcv/VTNyJv1eC1IPNB8ftcY= + dependencies: + define-property "^0.2.5" + object-copy "^0.1.0" + +statuses@2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/statuses/-/statuses-2.0.1.tgz#55cb000ccf1d48728bd23c685a063998cf1a1b63" + integrity sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ== + +stream-events@^1.0.5: + version "1.0.5" + resolved "https://registry.yarnpkg.com/stream-events/-/stream-events-1.0.5.tgz#bbc898ec4df33a4902d892333d47da9bf1c406d5" + integrity sha512-E1GUzBSgvct8Jsb3v2X15pjzN1tYebtbLaMg+eBOUOAxgbLoSbT2NS91ckc5lJD1KfLjId+jXJRgo0qnV5Nerg== + dependencies: + stubs "^3.0.0" + +string-argv@0.3.1: + version "0.3.1" + resolved "https://registry.yarnpkg.com/string-argv/-/string-argv-0.3.1.tgz#95e2fbec0427ae19184935f816d74aaa4c5c19da" + integrity sha512-a1uQGz7IyVy9YwhqjZIZu1c8JO8dNIe20xBmSS6qu9kv++k3JGzCVmprbNN5Kn+BgzD5E7YYwg1CcjuJMRNsvg== + +string-width@^2.1.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-2.1.1.tgz#ab93f27a8dc13d28cac815c462143a6d9012ae9e" + integrity sha512-nOqH59deCq9SRHlxq1Aw85Jnt4w6KvLKqWVik6oA9ZklXLNIOlqg4F2yrT1MVaTjAqvVwdfeZ7w7aCvJD7ugkw== + dependencies: + is-fullwidth-code-point "^2.0.0" + strip-ansi "^4.0.0" + +string-width@^3.0.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-3.1.0.tgz#22767be21b62af1081574306f69ac51b62203961" + integrity sha512-vafcv6KjVZKSgz06oM/H6GDBrAtz8vdhQakGjFIvNrHA6y3HCF1CInLy+QLq8dTJPQ1b+KDUqDFctkdRW44e1w== + dependencies: + emoji-regex "^7.0.1" + is-fullwidth-code-point "^2.0.0" + strip-ansi "^5.1.0" + +string-width@^4.0.0: + version "4.2.0" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.0.tgz#952182c46cc7b2c313d1596e623992bd163b72b5" + integrity sha512-zUz5JD+tgqtuDjMhwIg5uFVV3dtqZ9yQJlZVfq4I01/K5Paj5UHj7VyrQOJvzawSVlKpObApbfD0Ed6yJc+1eg== + dependencies: + emoji-regex "^8.0.0" + is-fullwidth-code-point "^3.0.0" + strip-ansi "^6.0.0" + +string-width@^4.1.0, string-width@^4.2.0, string-width@^4.2.3: + version "4.2.3" + resolved "https://registry.yarnpkg.com/string-width/-/string-width-4.2.3.tgz#269c7117d27b05ad2e536830a8ec895ef9c6d010" + integrity sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g== + dependencies: + emoji-regex "^8.0.0" + is-fullwidth-code-point "^3.0.0" + strip-ansi "^6.0.1" + +string.prototype.padend@^3.0.0: + version "3.1.1" + resolved "https://registry.yarnpkg.com/string.prototype.padend/-/string.prototype.padend-3.1.1.tgz#824c84265dbac46cade2b957b38b6a5d8d1683c5" + integrity sha512-eCzTASPnoCr5Ht+Vn1YXgm8SB015hHKgEIMu9Nr9bQmLhRBxKRfmzSj/IQsxDFc8JInJDDFA0qXwK+xxI7wDkg== + dependencies: + call-bind "^1.0.0" + define-properties "^1.1.3" + es-abstract "^1.18.0-next.1" + +string.prototype.trim@^1.2.7: + version "1.2.7" + resolved "https://registry.yarnpkg.com/string.prototype.trim/-/string.prototype.trim-1.2.7.tgz#a68352740859f6893f14ce3ef1bb3037f7a90533" + integrity sha512-p6TmeT1T3411M8Cgg9wBTMRtY2q9+PNy9EV1i2lIXUN/btt763oIfxwN3RR8VU6wHX8j/1CFy0L+YuThm6bgOg== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + +string.prototype.trimend@^1.0.6: + version "1.0.6" + resolved "https://registry.yarnpkg.com/string.prototype.trimend/-/string.prototype.trimend-1.0.6.tgz#c4a27fa026d979d79c04f17397f250a462944533" + integrity sha512-JySq+4mrPf9EsDBEDYMOb/lM7XQLulwg5R/m1r0PXEFqrV0qHvl58sdTilSXtKOflCsK2E8jxf+GKC0T07RWwQ== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + +string.prototype.trimstart@^1.0.6: + version "1.0.6" + resolved "https://registry.yarnpkg.com/string.prototype.trimstart/-/string.prototype.trimstart-1.0.6.tgz#e90ab66aa8e4007d92ef591bbf3cd422c56bdcf4" + integrity sha512-omqjMDaY92pbn5HOX7f9IccLA+U1tA9GvtU4JrodiXFfYB7jPzzHpRzpglLAjtUV6bB557zwClJezTqnAiYnQA== + dependencies: + call-bind "^1.0.2" + define-properties "^1.1.4" + es-abstract "^1.20.4" + +string_decoder@^1.1.1: + version "1.3.0" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.3.0.tgz#42f114594a46cf1a8e30b0a84f56c78c3edac21e" + integrity sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA== + dependencies: + safe-buffer "~5.2.0" + +string_decoder@~1.1.1: + version "1.1.1" + resolved "https://registry.yarnpkg.com/string_decoder/-/string_decoder-1.1.1.tgz#9cf1611ba62685d7030ae9e4ba34149c3af03fc8" + integrity sha512-n/ShnvDi6FHbbVfviro+WojiFzv+s8MPMHBczVePfUpDJLwoLT0ht1l4YwBCbi8pJAveEEdnkHyPyTP/mzRfwg== + dependencies: + safe-buffer "~5.1.0" + +stringify-object@^3.3.0: + version "3.3.0" + resolved "https://registry.yarnpkg.com/stringify-object/-/stringify-object-3.3.0.tgz#703065aefca19300d3ce88af4f5b3956d7556629" + integrity sha512-rHqiFh1elqCQ9WPLIC8I0Q/g/wj5J1eMkyoiD6eoQApWHP0FtlK7rqnhmabL5VUY9JQCcqwwvlOaSuutekgyrw== + dependencies: + get-own-enumerable-property-symbols "^3.0.0" + is-obj "^1.0.1" + is-regexp "^1.0.0" + +stringify-package@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/stringify-package/-/stringify-package-1.0.1.tgz#e5aa3643e7f74d0f28628b72f3dad5cecfc3ba85" + integrity sha512-sa4DUQsYciMP1xhKWGuFM04fB0LG/9DlluZoSVywUMRNvzid6XucHK0/90xGxRoHrAaROrcHK1aPKaijCtSrhg== + +strip-ansi@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-4.0.0.tgz#a8479022eb1ac368a871389b635262c505ee368f" + integrity sha1-qEeQIusaw2iocTibY1JixQXuNo8= + dependencies: + ansi-regex "^3.0.0" + +strip-ansi@^5.1.0: + version "5.2.0" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-5.2.0.tgz#8c9a536feb6afc962bdfa5b104a5091c1ad9c0ae" + integrity sha512-DuRs1gKbBqsMKIZlrffwlug8MHkcnpjs5VPmL1PAh+mA30U0DTotfDZ0d2UUsXpPmPmMMJ6W773MaA3J+lbiWA== + dependencies: + ansi-regex "^4.1.0" + +strip-ansi@^6.0.0, strip-ansi@^6.0.1: + version "6.0.1" + resolved "https://registry.yarnpkg.com/strip-ansi/-/strip-ansi-6.0.1.tgz#9e26c63d30f53443e9489495b2105d37b67a85d9" + integrity sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A== + dependencies: + ansi-regex "^5.0.1" + +strip-bom@4.0.0, strip-bom@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-4.0.0.tgz#9c3505c1db45bcedca3d9cf7a16f5c5aa3901878" + integrity sha512-3xurFv5tEgii33Zi8Jtp55wEIILR9eh34FAW00PZf+JnSsTmV/ioewSgQl97JHvgjoRGwPShsWm+IdrxB35d0w== + +strip-bom@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3" + integrity sha512-vavAMRXOgBVNF6nyEEmL3DBK19iRpDcoIwW+swQ+CbGiu7lju6t+JklA1MHweoWtadgt4ISVUsXLyDq34ddcwA== + +strip-final-newline@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/strip-final-newline/-/strip-final-newline-2.0.0.tgz#89b852fb2fcbe936f6f4b3187afb0a12c1ab58ad" + integrity sha512-BrpvfNAE3dcvq7ll3xVumzjKjZQ5tI1sEUIKr3Uoks0XUl45St3FlatVqef9prk4jRDzhW6WZg+3bk93y6pLjA== + +strip-indent@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-3.0.0.tgz#c32e1cee940b6b3432c771bc2c54bcce73cd3001" + integrity sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ== + dependencies: + min-indent "^1.0.0" + +strip-json-comments@3.0.1: + version "3.0.1" + resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.0.1.tgz#85713975a91fb87bf1b305cca77395e40d2a64a7" + integrity sha512-VTyMAUfdm047mwKl+u79WIdrZxtFtn+nBxHeb844XBQ9uMNTuTHdx2hc5RiAJYqwTj3wc/xe5HLSdJSkJ+WfZw== + +strip-json-comments@^3.1.0, strip-json-comments@^3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-3.1.1.tgz#31f1281b3832630434831c310c01cccda8cbe006" + integrity sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig== + +strip-json-comments@~2.0.1: + version "2.0.1" + resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-2.0.1.tgz#3c531942e908c2697c0ec344858c286c7ca0a60a" + integrity sha1-PFMZQukIwml8DsNEhYwobHygpgo= + +strip-outer@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/strip-outer/-/strip-outer-1.0.1.tgz#b2fd2abf6604b9d1e6013057195df836b8a9d631" + integrity sha512-k55yxKHwaXnpYGsOzg4Vl8+tDrWylxDEpknGjhTiZB8dFRU5rTo9CAzeycivxV3s+zlTKwrs6WxMxR95n26kwg== + dependencies: + escape-string-regexp "^1.0.2" + +strtok3@^6.0.3: + version "6.0.6" + resolved "https://registry.yarnpkg.com/strtok3/-/strtok3-6.0.6.tgz#65ad16df313c8dfbf075ab0bcb1edd070002fcb3" + integrity sha512-fVxvAEKDwHFfbQO1yKxKBPfkWZyBr0Zf20UQ/mblbkAQe5h0Xdd2jDb3Mh7yRZd7LSItJ9JWgQWelpEmVoBe2g== + dependencies: + "@tokenizer/token" "^0.1.1" + "@types/debug" "^4.1.5" + peek-readable "^3.1.1" + +stubs@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/stubs/-/stubs-3.0.0.tgz#e8d2ba1fa9c90570303c030b6900f7d5f89abe5b" + integrity sha512-PdHt7hHUJKxvTCgbKX9C1V/ftOcjJQgz8BZwNfV5c4B6dcGqlpelTbJ999jBGZ2jYiPAwcX5dP6oBwVlBlUbxw== + +superagent@^8.0.5: + version "8.0.9" + resolved "https://registry.yarnpkg.com/superagent/-/superagent-8.0.9.tgz#2c6fda6fadb40516515f93e9098c0eb1602e0535" + integrity sha512-4C7Bh5pyHTvU33KpZgwrNKh/VQnvgtCSqPRfJAUdmrtSYePVzVg4E4OzsrbkhJj9O7SO6Bnv75K/F8XVZT8YHA== + dependencies: + component-emitter "^1.3.0" + cookiejar "^2.1.4" + debug "^4.3.4" + fast-safe-stringify "^2.1.1" + form-data "^4.0.0" + formidable "^2.1.2" + methods "^1.1.2" + mime "2.6.0" + qs "^6.11.0" + semver "^7.3.8" + +supertap@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/supertap/-/supertap-2.0.0.tgz#8b587d6e14b8e885fa5183a9c45abf429feb9f7f" + integrity sha512-jRzcXlCeDYvKoZGA5oRhYyR3jUIYu0enkSxtmAgHRlD7HwrovTpH4bDSi0py9FtuA8si9cW/fKommJHuaoDHJA== + dependencies: + arrify "^2.0.1" + indent-string "^4.0.0" + js-yaml "^3.14.0" + serialize-error "^7.0.1" + strip-ansi "^6.0.0" + +supertest@^6.1.3: + version "6.3.3" + resolved "https://registry.yarnpkg.com/supertest/-/supertest-6.3.3.tgz#42f4da199fee656106fd422c094cf6c9578141db" + integrity sha512-EMCG6G8gDu5qEqRQ3JjjPs6+FYT1a7Hv5ApHvtSghmOFJYtsU5S+pSb6Y2EUeCEY3CmEL3mmQ8YWlPOzQomabA== + dependencies: + methods "^1.1.2" + superagent "^8.0.5" + +supports-color@^5.3.0: + version "5.5.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-5.5.0.tgz#e2e69a44ac8772f78a1ec0b35b689df6530efc8f" + integrity sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow== + dependencies: + has-flag "^3.0.0" + +supports-color@^7.1.0: + version "7.2.0" + resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da" + integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw== + dependencies: + has-flag "^4.0.0" + +supports-preserve-symlinks-flag@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz#6eda4bd344a3c94aea376d4cc31bc77311039e09" + integrity sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w== + +table@^6.0.9: + version "6.8.1" + resolved "https://registry.yarnpkg.com/table/-/table-6.8.1.tgz#ea2b71359fe03b017a5fbc296204471158080bdf" + integrity sha512-Y4X9zqrCftUhMeH2EptSSERdVKt/nEdijTOacGD/97EKjhQ/Qs8RTlEGABSJNNN8lac9kheH+af7yAkEWlgneA== + dependencies: + ajv "^8.0.1" + lodash.truncate "^4.4.2" + slice-ansi "^4.0.0" + string-width "^4.2.3" + strip-ansi "^6.0.1" + +teeny-request@7.1.1: + version "7.1.1" + resolved "https://registry.yarnpkg.com/teeny-request/-/teeny-request-7.1.1.tgz#2b0d156f4a8ad81de44303302ba8d7f1f05e20e6" + integrity sha512-iwY6rkW5DDGq8hE2YgNQlKbptYpY5Nn2xecjQiNjOXWbKzPGUfmeUBCSQbbr306d7Z7U2N0TPl+/SwYRfua1Dg== + dependencies: + http-proxy-agent "^4.0.0" + https-proxy-agent "^5.0.0" + node-fetch "^2.6.1" + stream-events "^1.0.5" + uuid "^8.0.0" + +temp-dir@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/temp-dir/-/temp-dir-1.0.0.tgz#0a7c0ea26d3a39afa7e0ebea9c1fc0bc4daa011d" + integrity sha1-CnwOom06Oa+n4OvqnB/AvE2qAR0= + +temp-dir@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/temp-dir/-/temp-dir-2.0.0.tgz#bde92b05bdfeb1516e804c9c00ad45177f31321e" + integrity sha512-aoBAniQmmwtcKp/7BzsH8Cxzv8OL736p7v1ihGb5e9DJ9kTwGWHrQrVB5+lfVDzfGrdRzXch+ig7LHaY1JTOrg== + +temp-write@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/temp-write/-/temp-write-4.0.0.tgz#cd2e0825fc826ae72d201dc26eef3bf7e6fc9320" + integrity sha512-HIeWmj77uOOHb0QX7siN3OtwV3CTntquin6TNVg6SHOqCP3hYKmox90eeFOGaY1MqJ9WYDDjkyZrW6qS5AWpbw== + dependencies: + graceful-fs "^4.1.15" + is-stream "^2.0.0" + make-dir "^3.0.0" + temp-dir "^1.0.0" + uuid "^3.3.2" + +term-size@^2.1.0: + version "2.2.1" + resolved "https://registry.yarnpkg.com/term-size/-/term-size-2.2.1.tgz#2a6a54840432c2fb6320fea0f415531e90189f54" + integrity sha512-wK0Ri4fOGjv/XPy8SBHZChl8CM7uMc5VML7SqiQ0zG7+J5Vr+RMQDoHa2CNT6KHUnTGIXH34UDMkPzAUyapBZg== + +test-exclude@^6.0.0: + version "6.0.0" + resolved "https://registry.yarnpkg.com/test-exclude/-/test-exclude-6.0.0.tgz#04a8698661d805ea6fa293b6cb9e63ac044ef15e" + integrity sha512-cAGWPIyOHU6zlmg88jwm7VRyXnMN7iV68OGAbYDk/Mh/xC/pzVPlQtY6ngoIH/5/tciuhGfvESU8GrHrcxD56w== + dependencies: + "@istanbuljs/schema" "^0.1.2" + glob "^7.1.4" + minimatch "^3.0.4" + +text-extensions@^1.0.0: + version "1.9.0" + resolved "https://registry.yarnpkg.com/text-extensions/-/text-extensions-1.9.0.tgz#1853e45fee39c945ce6f6c36b2d659b5aabc2a26" + integrity sha512-wiBrwC1EhBelW12Zy26JeOUkQ5mRu+5o8rpsJk5+2t+Y5vE7e842qtZDQ2g1NpX/29HdyFeJ4nSIhI47ENSxlQ== + +text-table@^0.2.0: + version "0.2.0" + resolved "https://registry.yarnpkg.com/text-table/-/text-table-0.2.0.tgz#7f5ee823ae805207c00af2df4a84ec3fcfa570b4" + integrity sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw== + +through2@^2.0.0: + version "2.0.5" + resolved "https://registry.yarnpkg.com/through2/-/through2-2.0.5.tgz#01c1e39eb31d07cb7d03a96a70823260b23132cd" + integrity sha512-/mrRod8xqpA+IHSLyGCQ2s8SPHiCDEeQJSep1jqLYeEUClOFG2Qsh+4FU6G9VeqpZnGW/Su8LQGc4YKni5rYSQ== + dependencies: + readable-stream "~2.3.6" + xtend "~4.0.1" + +through2@^4.0.0: + version "4.0.2" + resolved "https://registry.yarnpkg.com/through2/-/through2-4.0.2.tgz#a7ce3ac2a7a8b0b966c80e7c49f0484c3b239764" + integrity sha512-iOqSav00cVxEEICeD7TjLB1sueEL+81Wpzp2bY17uZjZN0pWZPuo4suZ/61VujxmqSGFfgOcNuTZ85QJwNZQpw== + dependencies: + readable-stream "3" + +through@2, "through@>=2.2.7 <3", through@^2.3.6, through@^2.3.8: + version "2.3.8" + resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5" + integrity sha512-w89qg7PI8wAdvX60bMDP+bFoD5Dvhm9oLheFp5O4a2QF0cSBGsBX4qZmadPMvVqlLJBBci+WqGGOAPvcDeNSVg== + +time-zone@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/time-zone/-/time-zone-1.0.0.tgz#99c5bf55958966af6d06d83bdf3800dc82faec5d" + integrity sha1-mcW/VZWJZq9tBtg73zgA3IL67F0= + +tmp@^0.0.33: + version "0.0.33" + resolved "https://registry.yarnpkg.com/tmp/-/tmp-0.0.33.tgz#6d34335889768d21b2bcda0aa277ced3b1bfadf9" + integrity sha512-jRCJlojKnZ3addtTOjdIqoRuPEKBvNXcGYqzO6zWZX8KfKEpnGY5jfggJQ3EjKuu8D4bJRr0y+cYJFmYbImXGw== + dependencies: + os-tmpdir "~1.0.2" + +to-fast-properties@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/to-fast-properties/-/to-fast-properties-2.0.0.tgz#dc5e698cbd079265bc73e0377681a4e4e83f616e" + integrity sha1-3F5pjL0HkmW8c+A3doGk5Og/YW4= + +to-object-path@^0.3.0: + version "0.3.0" + resolved "https://registry.yarnpkg.com/to-object-path/-/to-object-path-0.3.0.tgz#297588b7b0e7e0ac08e04e672f85c1f4999e17af" + integrity sha1-KXWIt7Dn4KwI4E5nL4XB9JmeF68= + dependencies: + kind-of "^3.0.2" + +to-readable-stream@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/to-readable-stream/-/to-readable-stream-1.0.0.tgz#ce0aa0c2f3df6adf852efb404a783e77c0475771" + integrity sha512-Iq25XBt6zD5npPhlLVXGFN3/gyR2/qODcKNNyTMd4vbm39HUaOiAM4PMq0eMVC/Tkxz+Zjdsc55g9yyz+Yq00Q== + +to-regex-range@^2.1.0: + version "2.1.1" + resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-2.1.1.tgz#7c80c17b9dfebe599e27367e0d4dd5590141db38" + integrity sha1-fIDBe53+vlmeJzZ+DU3VWQFB2zg= + dependencies: + is-number "^3.0.0" + repeat-string "^1.6.1" + +to-regex-range@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-5.0.1.tgz#1648c44aae7c8d988a326018ed72f5b4dd0392e4" + integrity sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ== + dependencies: + is-number "^7.0.0" + +to-regex@^3.0.1, to-regex@^3.0.2: + version "3.0.2" + resolved "https://registry.yarnpkg.com/to-regex/-/to-regex-3.0.2.tgz#13cfdd9b336552f30b51f33a8ae1b42a7a7599ce" + integrity sha512-FWtleNAtZ/Ki2qtqej2CXTOayOH9bHDQF+Q48VpWyDXjbYxA4Yz8iDB31zXOBUlOHHKidDbqGVrTUvQMPmBGBw== + dependencies: + define-property "^2.0.2" + extend-shallow "^3.0.2" + regex-not "^1.0.2" + safe-regex "^1.1.0" + +toidentifier@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/toidentifier/-/toidentifier-1.0.1.tgz#3be34321a88a820ed1bd80dfaa33e479fbb8dd35" + integrity sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA== + +token-types@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/token-types/-/token-types-2.0.0.tgz#b23618af744818299c6fbf125e0fdad98bab7e85" + integrity sha512-WWvu8sGK8/ZmGusekZJJ5NM6rRVTTDO7/bahz4NGiSDb/XsmdYBn6a1N/bymUHuWYTWeuLUg98wUzvE4jPdCZw== + dependencies: + "@tokenizer/token" "^0.1.0" + ieee754 "^1.1.13" + +tr46@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/tr46/-/tr46-3.0.0.tgz#555c4e297a950617e8eeddef633c87d4d9d6cbf9" + integrity sha512-l7FvfAHlcmulp8kr+flpQZmVwtu7nfRV7NZujtN0OqES8EL4O4e0qqzL0DC5gAvx/ZC/9lk6rhcUwYvkBnBnYA== + dependencies: + punycode "^2.1.1" + +tr46@~0.0.3: + version "0.0.3" + resolved "https://registry.yarnpkg.com/tr46/-/tr46-0.0.3.tgz#8184fd347dac9cdc185992f3a6622e14b9d9ab6a" + integrity sha512-N3WMsuqV66lT30CrXNbEjx4GEwlow3v6rr4mCcv6prnfwhS01rkgyFdjPNBYd9br7LpXV1+Emh01fHnq2Gdgrw== + +trim-newlines@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-3.0.1.tgz#260a5d962d8b752425b32f3a7db0dcacd176c144" + integrity sha512-c1PTsA3tYrIsLGkJkzHF+w9F2EyxfXGo4UyJc4pFL++FMjnq0HJS69T3M7d//gKrFKwy429bouPescbjecU+Zw== + +trim-off-newlines@^1.0.0: + version "1.0.3" + resolved "https://registry.yarnpkg.com/trim-off-newlines/-/trim-off-newlines-1.0.3.tgz#8df24847fcb821b0ab27d58ab6efec9f2fe961a1" + integrity sha512-kh6Tu6GbeSNMGfrrZh6Bb/4ZEHV1QlB4xNDBeog8Y9/QwFlKTRyWvY3Fs9tRDAMZliVUwieMgEdIeL/FtqjkJg== + +trim-off-newlines@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/trim-off-newlines/-/trim-off-newlines-1.0.1.tgz#9f9ba9d9efa8764c387698bcbfeb2c848f11adb3" + integrity sha1-n5up2e+odkw4dpi8v+sshI8RrbM= + +trim-repeated@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/trim-repeated/-/trim-repeated-1.0.0.tgz#e3646a2ea4e891312bf7eace6cfb05380bc01c21" + integrity sha512-pkonvlKk8/ZuR0D5tLW8ljt5I8kmxp2XKymhepUeOdCEfKpZaktSArkLHZt76OB1ZvO9bssUsDty4SWhLvZpLg== + dependencies: + escape-string-regexp "^1.0.2" + +ts-node@^9.0.0: + version "9.1.1" + resolved "https://registry.yarnpkg.com/ts-node/-/ts-node-9.1.1.tgz#51a9a450a3e959401bda5f004a72d54b936d376d" + integrity sha512-hPlt7ZACERQGf03M253ytLY3dHbGNGrAq9qIHWUY9XHYl1z7wYngSr3OQ5xmui8o2AaxsONxIzjafLUiWBo1Fg== + dependencies: + arg "^4.1.0" + create-require "^1.1.0" + diff "^4.0.1" + make-error "^1.1.1" + source-map-support "^0.5.17" + yn "3.1.1" + +tsconfig-paths@^3.14.1: + version "3.14.2" + resolved "https://registry.yarnpkg.com/tsconfig-paths/-/tsconfig-paths-3.14.2.tgz#6e32f1f79412decd261f92d633a9dc1cfa99f088" + integrity sha512-o/9iXgCYc5L/JxCHPe3Hvh8Q/2xm5Z+p18PESBU6Ff33695QnCHBEjcytY2q19ua7Mbl/DavtBOLq+oG0RCL+g== + dependencies: + "@types/json5" "^0.0.29" + json5 "^1.0.2" + minimist "^1.2.6" + strip-bom "^3.0.0" + +tslib@^1.8.1, tslib@^1.9.0: + version "1.14.1" + resolved "https://registry.yarnpkg.com/tslib/-/tslib-1.14.1.tgz#cf2d38bdc34a134bcaf1091c41f6619e2f672d00" + integrity sha512-Xni35NKzjgMrwevysHTCArtLDpPvye8zV/0E4EyYn43P7/7qvQwPh9BGkHewbMulVntbigmcT7rdX3BNo9wRJg== + +tsutils@^3.21.0: + version "3.21.0" + resolved "https://registry.yarnpkg.com/tsutils/-/tsutils-3.21.0.tgz#b48717d394cea6c1e096983eed58e9d61715b623" + integrity sha512-mHKK3iUXL+3UF6xL5k0PEhKRUBKPBCv/+RkEOpjRWxxx27KKRBmmA60A9pgOUvMi8GKhRMPEmjBRPzs2W7O1OA== + dependencies: + tslib "^1.8.1" + +type-check@^0.4.0, type-check@~0.4.0: + version "0.4.0" + resolved "https://registry.yarnpkg.com/type-check/-/type-check-0.4.0.tgz#07b8203bfa7056c0657050e3ccd2c37730bab8f1" + integrity sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew== + dependencies: + prelude-ls "^1.2.1" + +type-fest@^0.11.0: + version "0.11.0" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.11.0.tgz#97abf0872310fed88a5c466b25681576145e33f1" + integrity sha512-OdjXJxnCN1AvyLSzeKIgXTXxV+99ZuXl3Hpo9XpJAv9MBcHrrJOQ5kV7ypXOuQie+AmWG25hLbiKdwYTifzcfQ== + +type-fest@^0.13.1: + version "0.13.1" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.13.1.tgz#0172cb5bce80b0bd542ea348db50c7e21834d934" + integrity sha512-34R7HTnG0XIJcBSn5XhDd7nNFPRcXYRZrBB2O2jdKqYODldSzBAqzsWoZYYvduky73toYS/ESqxPvkDf/F0XMg== + +type-fest@^0.18.0: + version "0.18.1" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.18.1.tgz#db4bc151a4a2cf4eebf9add5db75508db6cc841f" + integrity sha512-OIAYXk8+ISY+qTOwkHtKqzAuxchoMiD9Udx+FSGQDuiRR+PJKJHc2NJAXlbhkGwTt/4/nKZxELY1w3ReWOL8mw== + +type-fest@^0.20.2: + version "0.20.2" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.20.2.tgz#1bf207f4b28f91583666cb5fbd327887301cd5f4" + integrity sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ== + +type-fest@^0.3.0: + version "0.3.1" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.3.1.tgz#63d00d204e059474fe5e1b7c011112bbd1dc29e1" + integrity sha512-cUGJnCdr4STbePCgqNFbpVNCepa+kAVohJs1sLhxzdH+gnEoOd8VhbYa7pD3zZYGiURWM2xzEII3fQcRizDkYQ== + +type-fest@^0.6.0: + version "0.6.0" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.6.0.tgz#8d2a2370d3df886eb5c90ada1c5bf6188acf838b" + integrity sha512-q+MB8nYR1KDLrgr4G5yemftpMC7/QLqVndBmEEdqzmNj5dcFOO4Oo8qlwZE3ULT3+Zim1F8Kq4cBnikNhlCMlg== + +type-fest@^0.8.0, type-fest@^0.8.1: + version "0.8.1" + resolved "https://registry.yarnpkg.com/type-fest/-/type-fest-0.8.1.tgz#09e249ebde851d3b1e48d27c105444667f17b83d" + integrity sha512-4dbzIzqvjtgiM5rw1k5rEHtBANKmdudhGyBEajN01fEyhaAIhsoKNy6y7+IN93IfpFtwY9iqi7kD+xwKhQsNJA== + +type-is@~1.6.18: + version "1.6.18" + resolved "https://registry.yarnpkg.com/type-is/-/type-is-1.6.18.tgz#4e552cd05df09467dcbc4ef739de89f2cf37c131" + integrity sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g== + dependencies: + media-typer "0.3.0" + mime-types "~2.1.24" + +typed-array-length@^1.0.4: + version "1.0.4" + resolved "https://registry.yarnpkg.com/typed-array-length/-/typed-array-length-1.0.4.tgz#89d83785e5c4098bec72e08b319651f0eac9c1bb" + integrity sha512-KjZypGq+I/H7HI5HlOoGHkWUUGq+Q0TPhQurLbyrVrvnKTBgzLhIJ7j6J/XTQOi0d1RjyZ0wdas8bKs2p0x3Ng== + dependencies: + call-bind "^1.0.2" + for-each "^0.3.3" + is-typed-array "^1.1.9" + +typedarray-to-buffer@^3.1.5: + version "3.1.5" + resolved "https://registry.yarnpkg.com/typedarray-to-buffer/-/typedarray-to-buffer-3.1.5.tgz#a97ee7a9ff42691b9f783ff1bc5112fe3fca9080" + integrity sha512-zdu8XMNEDepKKR+XYOXAVPtWui0ly0NtohUscw+UmaHiAWT8hrV1rr//H6V+0DvJ3OQ19S979M0laLfX8rm82Q== + dependencies: + is-typedarray "^1.0.0" + +typedarray@^0.0.6: + version "0.0.6" + resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777" + integrity sha512-/aCDEGatGvZ2BIk+HmLf4ifCJFwvKFNb9/JeZPMulfgFracn9QFcAf5GO8B/mweUjSoblS5In0cWhqpfs/5PQA== + +typedoc-default-themes@^0.11.4: + version "0.11.4" + resolved "https://registry.yarnpkg.com/typedoc-default-themes/-/typedoc-default-themes-0.11.4.tgz#1bc55b7c8d1132844616ff6f570e1e2cd0eb7343" + integrity sha512-Y4Lf+qIb9NTydrexlazAM46SSLrmrQRqWiD52593g53SsmUFioAsMWt8m834J6qsp+7wHRjxCXSZeiiW5cMUdw== + +typedoc@^0.19.0: + version "0.19.2" + resolved "https://registry.yarnpkg.com/typedoc/-/typedoc-0.19.2.tgz#842a63a581f4920f76b0346bb80eb2a49afc2c28" + integrity sha512-oDEg1BLEzi1qvgdQXc658EYgJ5qJLVSeZ0hQ57Eq4JXy6Vj2VX4RVo18qYxRWz75ifAaYuYNBUCnbhjd37TfOg== + dependencies: + fs-extra "^9.0.1" + handlebars "^4.7.6" + highlight.js "^10.2.0" + lodash "^4.17.20" + lunr "^2.3.9" + marked "^1.1.1" + minimatch "^3.0.0" + progress "^2.0.3" + semver "^7.3.2" + shelljs "^0.8.4" + typedoc-default-themes "^0.11.4" + +typescript@^4.0.2: + version "4.9.5" + resolved "https://registry.yarnpkg.com/typescript/-/typescript-4.9.5.tgz#095979f9bcc0d09da324d58d03ce8f8374cbe65a" + integrity sha512-1FXk9E2Hm+QzZQ7z+McJiHL4NW1F2EzMu9Nq9i3zAaGqibafqYwCVU6WyWAuyQRRzOlxou8xZSyXLEN8oKj24g== + +uglify-js@^3.1.4: + version "3.17.4" + resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-3.17.4.tgz#61678cf5fa3f5b7eb789bb345df29afb8257c22c" + integrity sha512-T9q82TJI9e/C1TAxYvfb16xO120tMVFZrGA3f9/P4424DNu6ypK103y0GPFVa17yotwSyZW5iYXgjYHkGrJW/g== + +uid-safe@~2.1.5: + version "2.1.5" + resolved "https://registry.yarnpkg.com/uid-safe/-/uid-safe-2.1.5.tgz#2b3d5c7240e8fc2e58f8aa269e5ee49c0857bd3a" + integrity sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA== + dependencies: + random-bytes "~1.0.0" + +unbox-primitive@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/unbox-primitive/-/unbox-primitive-1.0.2.tgz#29032021057d5e6cdbd08c5129c226dff8ed6f9e" + integrity sha512-61pPlCD9h51VoreyJ0BReideM3MDKMKnh6+V9L08331ipq6Q8OFXZYiqP6n/tbHx4s5I9uRhcye6BrbkizkBDw== + dependencies: + call-bind "^1.0.2" + has-bigints "^1.0.2" + has-symbols "^1.0.3" + which-boxed-primitive "^1.0.2" + +union-value@^1.0.0: + version "1.0.1" + resolved "https://registry.yarnpkg.com/union-value/-/union-value-1.0.1.tgz#0b6fe7b835aecda61c6ea4d4f02c14221e109847" + integrity sha512-tJfXmxMeWYnczCVs7XAEvIV7ieppALdyepWMkHkwciRpZraG/xwT+s2JN8+pr1+8jCRf80FFzvr+MpQeeoF4Xg== + dependencies: + arr-union "^3.1.0" + get-value "^2.0.6" + is-extendable "^0.1.1" + set-value "^2.0.1" + +unique-string@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/unique-string/-/unique-string-2.0.0.tgz#39c6451f81afb2749de2b233e3f7c5e8843bd89d" + integrity sha512-uNaeirEPvpZWSgzwsPGtU2zVSTrn/8L5q/IexZmH0eH6SA73CmAA5U4GwORTxQAZs95TAXLNqeLoPPNO5gZfWg== + dependencies: + crypto-random-string "^2.0.0" + +universalify@^0.1.0: + version "0.1.2" + resolved "https://registry.yarnpkg.com/universalify/-/universalify-0.1.2.tgz#b646f69be3942dabcecc9d6639c80dc105efaa66" + integrity sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg== + +universalify@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/universalify/-/universalify-2.0.0.tgz#75a4984efedc4b08975c5aeb73f530d02df25717" + integrity sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ== + +unpipe@1.0.0, unpipe@~1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/unpipe/-/unpipe-1.0.0.tgz#b2bf4ee8514aae6165b4817829d21b2ef49904ec" + integrity sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ== + +unset-value@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/unset-value/-/unset-value-1.0.0.tgz#8376873f7d2335179ffb1e6fc3a8ed0dfc8ab559" + integrity sha1-g3aHP30jNRef+x5vw6jtDfyKtVk= + dependencies: + has-value "^0.3.1" + isobject "^3.0.0" + +update-notifier@^5.0.1: + version "5.0.1" + resolved "https://registry.yarnpkg.com/update-notifier/-/update-notifier-5.0.1.tgz#1f92d45fb1f70b9e33880a72dd262bc12d22c20d" + integrity sha512-BuVpRdlwxeIOvmc32AGYvO1KVdPlsmqSh8KDDBxS6kDE5VR7R8OMP1d8MdhaVBvxl4H3551k9akXr0Y1iIB2Wg== + dependencies: + boxen "^4.2.0" + chalk "^4.1.0" + configstore "^5.0.1" + has-yarn "^2.1.0" + import-lazy "^2.1.0" + is-ci "^2.0.0" + is-installed-globally "^0.3.2" + is-npm "^5.0.0" + is-yarn-global "^0.3.0" + latest-version "^5.1.0" + pupa "^2.1.1" + semver "^7.3.2" + semver-diff "^3.1.1" + xdg-basedir "^4.0.0" + +uri-js@^4.2.2: + version "4.4.1" + resolved "https://registry.yarnpkg.com/uri-js/-/uri-js-4.4.1.tgz#9b1a52595225859e55f669d928f88c6c57f2a77e" + integrity sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg== + dependencies: + punycode "^2.1.0" + +urix@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/urix/-/urix-0.1.0.tgz#da937f7a62e21fec1fd18d49b35c2935067a6c72" + integrity sha1-2pN/emLiH+wf0Y1Js1wpNQZ6bHI= + +url-parse-lax@^3.0.0: + version "3.0.0" + resolved "https://registry.yarnpkg.com/url-parse-lax/-/url-parse-lax-3.0.0.tgz#16b5cafc07dbe3676c1b1999177823d6503acb0c" + integrity sha1-FrXK/Afb42dsGxmZF3gj1lA6yww= + dependencies: + prepend-http "^2.0.0" + +urlgrey@1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/urlgrey/-/urlgrey-1.0.0.tgz#72d2f904482d0b602e3c7fa599343d699bbe1017" + integrity sha512-hJfIzMPJmI9IlLkby8QrsCykQ+SXDeO2W5Q9QTW3QpqZVTx4a/K7p8/5q+/isD8vsbVaFgql/gvAoQCRQ2Cb5w== + dependencies: + fast-url-parser "^1.1.3" + +use@^3.1.0: + version "3.1.1" + resolved "https://registry.yarnpkg.com/use/-/use-3.1.1.tgz#d50c8cac79a19fbc20f2911f56eb973f4e10070f" + integrity sha512-cwESVXlO3url9YWlFW/TA9cshCEhtu7IKJ/p5soJ/gGpj7vbvFrAY/eIioQ6Dw23KjZhYgiIo8HOs1nQ2vr/oQ== + +util-deprecate@^1.0.1, util-deprecate@~1.0.1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/util-deprecate/-/util-deprecate-1.0.2.tgz#450d4dc9fa70de732762fbd2d4a28981419a0ccf" + integrity sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw== + +utils-merge@1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/utils-merge/-/utils-merge-1.0.1.tgz#9f95710f50a267947b2ccc124741c1028427e713" + integrity sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA== + +uuid@^3.3.2, uuid@^3.3.3: + version "3.4.0" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-3.4.0.tgz#b23e4358afa8a202fe7a100af1f5f883f02007ee" + integrity sha512-HjSDRw6gZE5JMggctHBcjVak08+KEVhSIiDzFnT9S9aegmp85S/bReBVTb4QTFaRNptJ9kuYaNhnbNEOkbKb/A== + +uuid@^8.0.0: + version "8.3.2" + resolved "https://registry.yarnpkg.com/uuid/-/uuid-8.3.2.tgz#80d5b5ced271bb9af6c445f21a1a04c606cefbe2" + integrity sha512-+NYs2QeMWy+GWFOEm9xnn6HCDp0l7QBD7ml8zLUmJ+93Q5NF0NocErnwkTkXVFNiX3/fpC6afS8Dhb/gz7R7eg== + +v8-compile-cache@^2.0.3: + version "2.3.0" + resolved "https://registry.yarnpkg.com/v8-compile-cache/-/v8-compile-cache-2.3.0.tgz#2de19618c66dc247dcfb6f99338035d8245a2cee" + integrity sha512-l8lCEmLcLYZh4nbunNZvQCJc5pv7+RCwa8q/LdUx8u7lsWvPDKmpodJAJNwkAhJC//dFY48KuIEmjtd4RViDrA== + +validate-npm-package-license@^3.0.1: + version "3.0.4" + resolved "https://registry.yarnpkg.com/validate-npm-package-license/-/validate-npm-package-license-3.0.4.tgz#fc91f6b9c7ba15c857f4cb2c5defeec39d4f410a" + integrity sha512-DpKm2Ui/xN7/HQKCtpZxoRWBhZ9Z0kqtygG8XCgNQ8ZlDnxuQmWhj566j8fN4Cu3/JmbhsDo7fcAJq4s9h27Ew== + dependencies: + spdx-correct "^3.0.0" + spdx-expression-parse "^3.0.0" + +vary@~1.1.2: + version "1.1.2" + resolved "https://registry.yarnpkg.com/vary/-/vary-1.1.2.tgz#2299f02c6ded30d4a5961b0b9f74524a18f634fc" + integrity sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg== + +vscode-uri@^3.0.2: + version "3.0.7" + resolved "https://registry.yarnpkg.com/vscode-uri/-/vscode-uri-3.0.7.tgz#6d19fef387ee6b46c479e5fb00870e15e58c1eb8" + integrity sha512-eOpPHogvorZRobNqJGhapa0JdwaxpjVvyBp0QIUMRMSf8ZAlqOdEquKuRmw9Qwu0qXtJIWqFtMkmvJjUZmMjVA== + +wcwidth@^1.0.1: + version "1.0.1" + resolved "https://registry.yarnpkg.com/wcwidth/-/wcwidth-1.0.1.tgz#f0b0dcf915bc5ff1528afadb2c0e17b532da2fe8" + integrity sha1-8LDc+RW8X/FSivrbLA4XtTLaL+g= + dependencies: + defaults "^1.0.3" + +webidl-conversions@^3.0.0: + version "3.0.1" + resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-3.0.1.tgz#24534275e2a7bc6be7bc86611cc16ae0a5654871" + integrity sha512-2JAn3z8AR6rjK8Sm8orRC0h/bcl/DqL7tRPdGZ4I1CjdF+EaMLmYxBHyXuKL849eucPFhvBoxMsflfOb8kxaeQ== + +webidl-conversions@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/webidl-conversions/-/webidl-conversions-7.0.0.tgz#256b4e1882be7debbf01d05f0aa2039778ea080a" + integrity sha512-VwddBukDzu71offAQR975unBIGqfKZpM+8ZX6ySk8nYhVoo5CYaZyzt3YBvYtRtO+aoGlqxPg/B87NGVZ/fu6g== + +well-known-symbols@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/well-known-symbols/-/well-known-symbols-2.0.0.tgz#e9c7c07dbd132b7b84212c8174391ec1f9871ba5" + integrity sha512-ZMjC3ho+KXo0BfJb7JgtQ5IBuvnShdlACNkKkdsqBmYw3bPAaJfPeYUo6tLUaT5tG/Gkh7xkpBhKRQ9e7pyg9Q== + +whatwg-url@^11.0.0: + version "11.0.0" + resolved "https://registry.yarnpkg.com/whatwg-url/-/whatwg-url-11.0.0.tgz#0a849eebb5faf2119b901bb76fd795c2848d4018" + integrity sha512-RKT8HExMpoYx4igMiVMY83lN6UeITKJlBQ+vR/8ZJ8OCdSiN3RwCq+9gH0+Xzj0+5IrM6i4j/6LuvzbZIQgEcQ== + dependencies: + tr46 "^3.0.0" + webidl-conversions "^7.0.0" + +whatwg-url@^5.0.0: + version "5.0.0" + resolved "https://registry.yarnpkg.com/whatwg-url/-/whatwg-url-5.0.0.tgz#966454e8765462e37644d3626f6742ce8b70965d" + integrity sha512-saE57nupxk6v3HY35+jzBwYa0rKSy0XR8JSxZPwgLr7ys0IBzhGviA1/TUGJLmSVqs8pb9AnvICXEuOHLprYTw== + dependencies: + tr46 "~0.0.3" + webidl-conversions "^3.0.0" + +which-boxed-primitive@^1.0.2: + version "1.0.2" + resolved "https://registry.yarnpkg.com/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz#13757bc89b209b049fe5d86430e21cf40a89a8e6" + integrity sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg== + dependencies: + is-bigint "^1.0.1" + is-boolean-object "^1.1.0" + is-number-object "^1.0.4" + is-string "^1.0.5" + is-symbol "^1.0.3" + +which-module@^2.0.0: + version "2.0.0" + resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a" + integrity sha512-B+enWhmw6cjfVC7kS8Pj9pCrKSc5txArRyaYGe088shv/FGWH+0Rjx/xPgtsWfsUtS27FkP697E4DDhgrgoc0Q== + +which-pm-runs@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/which-pm-runs/-/which-pm-runs-1.0.0.tgz#670b3afbc552e0b55df6b7780ca74615f23ad1cb" + integrity sha1-Zws6+8VS4LVd9rd4DKdGFfI60cs= + +which-typed-array@^1.1.9: + version "1.1.9" + resolved "https://registry.yarnpkg.com/which-typed-array/-/which-typed-array-1.1.9.tgz#307cf898025848cf995e795e8423c7f337efbde6" + integrity sha512-w9c4xkx6mPidwp7180ckYWfMmvxpjlZuIudNtDf4N/tTAUB8VJbX25qZoAsrtGuYNnGw3pa0AXgbGKRB8/EceA== + dependencies: + available-typed-arrays "^1.0.5" + call-bind "^1.0.2" + for-each "^0.3.3" + gopd "^1.0.1" + has-tostringtag "^1.0.0" + is-typed-array "^1.1.10" + +which@^1.2.14, which@^1.2.9: + version "1.3.1" + resolved "https://registry.yarnpkg.com/which/-/which-1.3.1.tgz#a45043d54f5805316da8d62f9f50918d3da70b0a" + integrity sha512-HxJdYWq1MTIQbJ3nw0cqssHoTNU267KlrDuGZ1WYlxDStUtKUhOaJmh112/TZmHxxUfuJqPXSOm7tDyas0OSIQ== + dependencies: + isexe "^2.0.0" + +which@^2.0.1: + version "2.0.2" + resolved "https://registry.yarnpkg.com/which/-/which-2.0.2.tgz#7c6a8dd0a636a0327e10b59c9286eee93f3f51b1" + integrity sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA== + dependencies: + isexe "^2.0.0" + +widest-line@^3.1.0: + version "3.1.0" + resolved "https://registry.yarnpkg.com/widest-line/-/widest-line-3.1.0.tgz#8292333bbf66cb45ff0de1603b136b7ae1496eca" + integrity sha512-NsmoXalsWVDMGupxZ5R08ka9flZjjiLvHVAWYOKtiKM8ujtZWr9cRffak+uSE48+Ob8ObalXpwyeUiyDD6QFgg== + dependencies: + string-width "^4.0.0" + +word-wrap@^1.0.3, word-wrap@^1.2.3: + version "1.2.3" + resolved "https://registry.yarnpkg.com/word-wrap/-/word-wrap-1.2.3.tgz#610636f6b1f703891bd34771ccb17fb93b47079c" + integrity sha512-Hz/mrNwitNRh/HUAtM/VT/5VH+ygD6DV7mYKZAtHOrbs8U7lvPS6xf7EJKMF0uW1KJCl0H701g3ZGus+muE5vQ== + +wordwrap@^1.0.0: + version "1.0.0" + resolved "https://registry.yarnpkg.com/wordwrap/-/wordwrap-1.0.0.tgz#27584810891456a4171c8d0226441ade90cbcaeb" + integrity sha512-gvVzJFlPycKc5dZN4yPkP8w7Dc37BtP1yczEneOb4uq34pXZcvrtRTmWV8W+Ume+XCxKgbjM+nevkyFPMybd4Q== + +wrap-ansi@^6.2.0: + version "6.2.0" + resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-6.2.0.tgz#e9393ba07102e6c91a3b221478f0257cd2856e53" + integrity sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA== + dependencies: + ansi-styles "^4.0.0" + string-width "^4.1.0" + strip-ansi "^6.0.0" + +wrap-ansi@^7.0.0: + version "7.0.0" + resolved "https://registry.yarnpkg.com/wrap-ansi/-/wrap-ansi-7.0.0.tgz#67e145cff510a6a6984bdf1152911d69d2eb9e43" + integrity sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q== + dependencies: + ansi-styles "^4.0.0" + string-width "^4.1.0" + strip-ansi "^6.0.0" + +wrappy@1: + version "1.0.2" + resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" + integrity sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ== + +write-file-atomic@^3.0.0, write-file-atomic@^3.0.3: + version "3.0.3" + resolved "https://registry.yarnpkg.com/write-file-atomic/-/write-file-atomic-3.0.3.tgz#56bd5c5a5c70481cd19c571bd39ab965a5de56e8" + integrity sha512-AvHcyZ5JnSfq3ioSyjrBkH9yW4m7Ayk8/9My/DD9onKeu/94fwrMocemO2QAJFAlnnDN+ZDS+ZjAR5ua1/PV/Q== + dependencies: + imurmurhash "^0.1.4" + is-typedarray "^1.0.0" + signal-exit "^3.0.2" + typedarray-to-buffer "^3.1.5" + +xdg-basedir@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/xdg-basedir/-/xdg-basedir-4.0.0.tgz#4bc8d9984403696225ef83a1573cbbcb4e79db13" + integrity sha512-PSNhEJDejZYV7h50BohL09Er9VaIefr2LMAf3OEmpCkjOi34eYyQYAXUTjEQtZJTKcF0E2UKTh+osDLsgNim9Q== + +xtend@~4.0.1: + version "4.0.2" + resolved "https://registry.yarnpkg.com/xtend/-/xtend-4.0.2.tgz#bb72779f5fa465186b1f438f674fa347fdb5db54" + integrity sha512-LKYU1iAXJXUgAXn9URjiu+MWhyUXHsvfp7mcuYm9dSUKK0/CjtrUwFAxD82/mCWbtLsGjFIad0wIsod4zrTAEQ== + +y18n@^4.0.0: + version "4.0.3" + resolved "https://registry.yarnpkg.com/y18n/-/y18n-4.0.3.tgz#b5f259c82cd6e336921efd7bfd8bf560de9eeedf" + integrity sha512-JKhqTOwSrqNA1NY5lSztJ1GrBiUodLMmIZuLiDaMRJ+itFd+ABVE8XBjOvIWL+rSqNDC74LCSFmlb/U4UZ4hJQ== + +y18n@^5.0.5: + version "5.0.5" + resolved "https://registry.yarnpkg.com/y18n/-/y18n-5.0.5.tgz#8769ec08d03b1ea2df2500acef561743bbb9ab18" + integrity sha512-hsRUr4FFrvhhRH12wOdfs38Gy7k2FFzB9qgN9v3aLykRq0dRcdcpz5C9FxdS2NuhOrI/628b/KSTJ3rwHysYSg== + +yallist@^4.0.0: + version "4.0.0" + resolved "https://registry.yarnpkg.com/yallist/-/yallist-4.0.0.tgz#9bb92790d9c0effec63be73519e11a35019a3a72" + integrity sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A== + +yaml@^1.10.0: + version "1.10.0" + resolved "https://registry.yarnpkg.com/yaml/-/yaml-1.10.0.tgz#3b593add944876077d4d683fee01081bd9fff31e" + integrity sha512-yr2icI4glYaNG+KWONODapy2/jDdMSDnrONSjblABjD9B4Z5LgiircSt8m8sRZFNi08kG9Sm0uSHtEmP3zaEGg== + +yargs-parser@^18.1.2, yargs-parser@^18.1.3: + version "18.1.3" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-18.1.3.tgz#be68c4975c6b2abf469236b0c870362fab09a7b0" + integrity sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ== + dependencies: + camelcase "^5.0.0" + decamelize "^1.2.0" + +yargs-parser@^20.2.2: + version "20.2.4" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-20.2.4.tgz#b42890f14566796f85ae8e3a25290d205f154a54" + integrity sha512-WOkpgNhPTlE73h4VFAFsOnomJVaovO8VqLDzy5saChRBFQFBoMYirowyW+Q9HB4HFF4Z7VZTiG3iSzJJA29yRA== + +yargs-parser@^20.2.3: + version "20.2.9" + resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-20.2.9.tgz#2eb7dc3b0289718fc295f362753845c41a0c94ee" + integrity sha512-y11nGElTIV+CT3Zv9t7VKl+Q3hTQoT9a1Qzezhhl6Rp21gJ/IVTW7Z3y9EWXhuUBC2Shnf+DX0antecpAwSP8w== + +yargs@^15.0.2, yargs@^15.1.0: + version "15.4.1" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-15.4.1.tgz#0d87a16de01aee9d8bec2bfbf74f67851730f4f8" + integrity sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A== + dependencies: + cliui "^6.0.0" + decamelize "^1.2.0" + find-up "^4.1.0" + get-caller-file "^2.0.1" + require-directory "^2.1.1" + require-main-filename "^2.0.0" + set-blocking "^2.0.0" + string-width "^4.2.0" + which-module "^2.0.0" + y18n "^4.0.0" + yargs-parser "^18.1.2" + +yargs@^16.0.0, yargs@^16.2.0: + version "16.2.0" + resolved "https://registry.yarnpkg.com/yargs/-/yargs-16.2.0.tgz#1c82bf0f6b6a66eafce7ef30e376f49a12477f66" + integrity sha512-D1mvvtDG0L5ft/jGWkLpG1+m0eQxOfaBvTNELraWj22wSVUMWxZUvYgJYcKh6jGGIkJFhH4IZPQhR4TKpc8mBw== + dependencies: + cliui "^7.0.2" + escalade "^3.1.1" + get-caller-file "^2.0.5" + require-directory "^2.1.1" + string-width "^4.2.0" + y18n "^5.0.5" + yargs-parser "^20.2.2" + +yn@3.1.1: + version "3.1.1" + resolved "https://registry.yarnpkg.com/yn/-/yn-3.1.1.tgz#1e87401a09d767c1d5eab26a6e4c185182d2eb50" + integrity sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q== + +yocto-queue@^0.1.0: + version "0.1.0" + resolved "https://registry.yarnpkg.com/yocto-queue/-/yocto-queue-0.1.0.tgz#0294eb3dee05028d31ee1a5fa2c556a6aaf10a1b" + integrity sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q== diff --git a/node_modules/express-session/HISTORY.md b/node_modules/express-session/HISTORY.md new file mode 100644 index 0000000..57c68d3 --- /dev/null +++ b/node_modules/express-session/HISTORY.md @@ -0,0 +1,470 @@ +1.18.1 / 2024-10-08 +========== + + * deps: cookie@0.7.2 + - Fix object assignment of `hasOwnProperty` + * deps: cookie@0.7.1 + - Allow leading dot for domain + - Although not permitted in the spec, some users expect this to work and user agents ignore the leading dot according to spec + - Add fast path for `serialize` without options, use `obj.hasOwnProperty` when parsing + * deps: cookie@0.7.0 + - perf: parse cookies ~10% faster + - fix: narrow the validation of cookies to match RFC6265 + - fix: add `main` to `package.json` for rspack + +1.18.0 / 2024-01-28 +=================== + + * Add debug log for pathname mismatch + * Add `partitioned` to `cookie` options + * Add `priority` to `cookie` options + * Fix handling errors from setting cookie + * Support any type in `secret` that `crypto.createHmac` supports + * deps: cookie@0.6.0 + - Fix `expires` option to reject invalid dates + - perf: improve default decode speed + - perf: remove slow string split in parse + * deps: cookie-signature@1.0.7 + +1.17.3 / 2022-05-11 +=================== + + * Fix resaving already-saved new session at end of request + * deps: cookie@0.4.2 + +1.17.2 / 2021-05-19 +=================== + + * Fix `res.end` patch to always commit headers + * deps: cookie@0.4.1 + * deps: safe-buffer@5.2.1 + +1.17.1 / 2020-04-16 +=================== + + * Fix internal method wrapping error on failed reloads + +1.17.0 / 2019-10-10 +=================== + + * deps: cookie@0.4.0 + - Add `SameSite=None` support + * deps: safe-buffer@5.2.0 + +1.16.2 / 2019-06-12 +=================== + + * Fix restoring `cookie.originalMaxAge` when store returns `Date` + * deps: parseurl@~1.3.3 + +1.16.1 / 2019-04-11 +=================== + + * Fix error passing `data` option to `Cookie` constructor + * Fix uncaught error from bad session data + +1.16.0 / 2019-04-10 +=================== + + * Catch invalid `cookie.maxAge` value earlier + * Deprecate setting `cookie.maxAge` to a `Date` object + * Fix issue where `resave: false` may not save altered sessions + * Remove `utils-merge` dependency + * Use `safe-buffer` for improved Buffer API + * Use `Set-Cookie` as cookie header name for compatibility + * deps: depd@~2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + - perf: remove argument reassignment + * deps: on-headers@~1.0.2 + - Fix `res.writeHead` patch missing return value + +1.15.6 / 2017-09-26 +=================== + + * deps: debug@2.6.9 + * deps: parseurl@~1.3.2 + - perf: reduce overhead for full URLs + - perf: unroll the "fast-path" `RegExp` + * deps: uid-safe@~2.1.5 + - perf: remove only trailing `=` + * deps: utils-merge@1.0.1 + +1.15.5 / 2017-08-02 +=================== + + * Fix `TypeError` when `req.url` is an empty string + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + +1.15.4 / 2017-07-18 +=================== + + * deps: debug@2.6.8 + +1.15.3 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - deps: ms@2.0.0 + +1.15.2 / 2017-03-26 +=================== + + * deps: debug@2.6.3 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + * deps: uid-safe@~2.1.4 + - Remove `base64-url` dependency + +1.15.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.15.0 / 2017-01-22 +=================== + + * Fix detecting modified session when session contains "cookie" property + * Fix resaving already-saved reloaded session at end of request + * deps: crc@3.4.4 + - perf: use `Buffer.from` when available + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Use same color for same namespace + - Fix error when running under React Native + - deps: ms@0.7.2 + * perf: remove unreachable branch in set-cookie method + +1.14.2 / 2016-10-30 +=================== + + * deps: crc@3.4.1 + - Fix deprecation warning in Node.js 7.x + * deps: uid-safe@~2.1.3 + - deps: base64-url@1.3.3 + +1.14.1 / 2016-08-24 +=================== + + * Fix not always resetting session max age before session save + * Fix the cookie `sameSite` option to actually alter the `Set-Cookie` + * deps: uid-safe@~2.1.2 + - deps: base64-url@1.3.2 + +1.14.0 / 2016-07-01 +=================== + + * Correctly inherit from `EventEmitter` class in `Store` base class + * Fix issue where `Set-Cookie` `Expires` was not always updated + * Methods are no longer enumerable on `req.session` object + * deps: cookie@0.3.1 + - Add `sameSite` option + - Improve error message when `encode` is not a function + - Improve error message when `expires` is not a `Date` + - perf: enable strict mode + - perf: use for loop in parse + - perf: use string concatination for serialization + * deps: parseurl@~1.3.1 + - perf: enable strict mode + * deps: uid-safe@~2.1.1 + - Use `random-bytes` for byte source + - deps: base64-url@1.2.2 + * perf: enable strict mode + * perf: remove argument reassignment + +1.13.0 / 2016-01-10 +=================== + + * Fix `rolling: true` to not set cookie when no session exists + - Better `saveUninitialized: false` + `rolling: true` behavior + * deps: crc@3.4.0 + +1.12.1 / 2015-10-29 +=================== + + * deps: cookie@0.2.3 + - Fix cookie `Max-Age` to never be a floating point number + +1.12.0 / 2015-10-25 +=================== + + * Support the value `'auto'` in the `cookie.secure` option + * deps: cookie@0.2.2 + - Throw on invalid values provided to `serialize` + * deps: depd@~1.1.0 + - Enable strict mode in more places + - Support web browser loading + * deps: on-headers@~1.0.1 + - perf: enable strict mode + +1.11.3 / 2015-05-22 +=================== + + * deps: cookie@0.1.3 + - Slight optimizations + * deps: crc@3.3.0 + +1.11.2 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + * deps: uid-safe@~2.0.0 + +1.11.1 / 2015-04-08 +=================== + + * Fix mutating `options.secret` value + +1.11.0 / 2015-04-07 +=================== + + * Support an array in `secret` option for key rotation + * deps: depd@~1.0.1 + +1.10.4 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +1.10.3 / 2015-02-16 +=================== + + * deps: cookie-signature@1.0.6 + * deps: uid-safe@1.1.0 + - Use `crypto.randomBytes`, if available + - deps: base64-url@1.2.1 + +1.10.2 / 2015-01-31 +=================== + + * deps: uid-safe@1.0.3 + - Fix error branch that would throw + - deps: base64-url@1.2.0 + +1.10.1 / 2015-01-08 +=================== + + * deps: uid-safe@1.0.2 + - Remove dependency on `mz` + +1.10.0 / 2015-01-05 +=================== + + * Add `store.touch` interface for session stores + * Fix `MemoryStore` expiration with `resave: false` + * deps: debug@~2.1.1 + +1.9.3 / 2014-12-02 +================== + + * Fix error when `req.sessionID` contains a non-string value + +1.9.2 / 2014-11-22 +================== + + * deps: crc@3.2.1 + - Minor fixes + +1.9.1 / 2014-10-22 +================== + + * Remove unnecessary empty write call + - Fixes Node.js 0.11.14 behavior change + - Helps work-around Node.js 0.10.1 zlib bug + +1.9.0 / 2014-09-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + * deps: depd@~1.0.0 + +1.8.2 / 2014-09-15 +================== + + * Use `crc` instead of `buffer-crc32` for speed + * deps: depd@0.4.5 + +1.8.1 / 2014-09-08 +================== + + * Keep `req.session.save` non-enumerable + * Prevent session prototype methods from being overwritten + +1.8.0 / 2014-09-07 +================== + + * Do not resave already-saved session at end of request + * deps: cookie-signature@1.0.5 + * deps: debug@~2.0.0 + +1.7.6 / 2014-08-18 +================== + + * Fix exception on `res.end(null)` calls + +1.7.5 / 2014-08-10 +================== + + * Fix parsing original URL + * deps: on-headers@~1.0.0 + * deps: parseurl@~1.3.0 + +1.7.4 / 2014-08-05 +================== + + * Fix response end delay for non-chunked responses + +1.7.3 / 2014-08-05 +================== + + * Fix `res.end` patch to call correct upstream `res.write` + +1.7.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.7.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.7.0 / 2014-07-22 +================== + + * Improve session-ending error handling + - Errors are passed to `next(err)` instead of `console.error` + * deps: debug@1.0.4 + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + +1.6.5 / 2014-07-11 +================== + + * Do not require `req.originalUrl` + * deps: debug@1.0.3 + - Add support for multiple wildcards in namespaces + +1.6.4 / 2014-07-07 +================== + + * Fix blank responses for stores with synchronous operations + +1.6.3 / 2014-07-04 +================== + + * Fix resave deprecation message + +1.6.2 / 2014-07-04 +================== + + * Fix confusing option deprecation messages + +1.6.1 / 2014-06-28 +================== + + * Fix saveUninitialized deprecation message + +1.6.0 / 2014-06-28 +================== + + * Add deprecation message to undefined `resave` option + * Add deprecation message to undefined `saveUninitialized` option + * Fix `res.end` patch to return correct value + * Fix `res.end` patch to handle multiple `res.end` calls + * Reject cookies with missing signatures + +1.5.2 / 2014-06-26 +================== + + * deps: cookie-signature@1.0.4 + - fix for timing attacks + +1.5.1 / 2014-06-21 +================== + + * Move hard-to-track-down `req.secret` deprecation message + +1.5.0 / 2014-06-19 +================== + + * Debug name is now "express-session" + * Deprecate integration with `cookie-parser` middleware + * Deprecate looking for secret in `req.secret` + * Directly read cookies; `cookie-parser` no longer required + * Directly set cookies; `res.cookie` no longer required + * Generate session IDs with `uid-safe`, faster and even less collisions + +1.4.0 / 2014-06-17 +================== + + * Add `genid` option to generate custom session IDs + * Add `saveUninitialized` option to control saving uninitialized sessions + * Add `unset` option to control unsetting `req.session` + * Generate session IDs with `rand-token` by default; reduce collisions + * deps: buffer-crc32@0.2.3 + +1.3.1 / 2014-06-14 +================== + + * Add description in package for npmjs.org listing + +1.3.0 / 2014-06-14 +================== + + * Integrate with express "trust proxy" by default + * deps: debug@1.0.2 + +1.2.1 / 2014-05-27 +================== + + * Fix `resave` such that `resave: true` works + +1.2.0 / 2014-05-19 +================== + + * Add `resave` option to control saving unmodified sessions + +1.1.0 / 2014-05-12 +================== + + * Add `name` option; replacement for `key` option + * Use `setImmediate` in MemoryStore for node.js >= 0.10 + +1.0.4 / 2014-04-27 +================== + + * deps: debug@0.8.1 + +1.0.3 / 2014-04-19 +================== + + * Use `res.cookie()` instead of `res.setHeader()` + * deps: cookie@0.1.2 + +1.0.2 / 2014-02-23 +================== + + * Add missing dependency to `package.json` + +1.0.1 / 2014-02-15 +================== + + * Add missing dependencies to `package.json` + +1.0.0 / 2014-02-15 +================== + + * Genesis from `connect` diff --git a/node_modules/express-session/LICENSE b/node_modules/express-session/LICENSE new file mode 100644 index 0000000..9b59ff8 --- /dev/null +++ b/node_modules/express-session/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2010 Sencha Inc. +Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2014-2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/express-session/README.md b/node_modules/express-session/README.md new file mode 100644 index 0000000..65a37e6 --- /dev/null +++ b/node_modules/express-session/README.md @@ -0,0 +1,1032 @@ +# express-session + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install express-session +``` + +## API + +```js +var session = require('express-session') +``` + +### session(options) + +Create a session middleware with the given `options`. + +**Note** Session data is _not_ saved in the cookie itself, just the session ID. +Session data is stored server-side. + +**Note** Since version 1.5.0, the [`cookie-parser` middleware](https://www.npmjs.com/package/cookie-parser) +no longer needs to be used for this module to work. This module now directly reads +and writes cookies on `req`/`res`. Using `cookie-parser` may result in issues +if the `secret` is not the same between this module and `cookie-parser`. + +**Warning** The default server-side session storage, `MemoryStore`, is _purposely_ +not designed for a production environment. It will leak memory under most +conditions, does not scale past a single process, and is meant for debugging and +developing. + +For a list of stores, see [compatible session stores](#compatible-session-stores). + +#### Options + +`express-session` accepts these properties in the options object. + +##### cookie + +Settings object for the session ID cookie. The default value is +`{ path: '/', httpOnly: true, secure: false, maxAge: null }`. + +The following are options that can be set in this object. + +##### cookie.domain + +Specifies the value for the `Domain` `Set-Cookie` attribute. By default, no domain +is set, and most clients will consider the cookie to apply to only the current +domain. + +##### cookie.expires + +Specifies the `Date` object to be the value for the `Expires` `Set-Cookie` attribute. +By default, no expiration is set, and most clients will consider this a +"non-persistent cookie" and will delete it on a condition like exiting a web browser +application. + +**Note** If both `expires` and `maxAge` are set in the options, then the last one +defined in the object is what is used. + +**Note** The `expires` option should not be set directly; instead only use the `maxAge` +option. + +##### cookie.httpOnly + +Specifies the `boolean` value for the `HttpOnly` `Set-Cookie` attribute. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` +attribute is set. + +**Note** be careful when setting this to `true`, as compliant clients will not allow +client-side JavaScript to see the cookie in `document.cookie`. + +##### cookie.maxAge + +Specifies the `number` (in milliseconds) to use when calculating the `Expires` +`Set-Cookie` attribute. This is done by taking the current server time and adding +`maxAge` milliseconds to the value to calculate an `Expires` datetime. By default, +no maximum age is set. + +**Note** If both `expires` and `maxAge` are set in the options, then the last one +defined in the object is what is used. + +##### cookie.partitioned + +Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies) +attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. +By default, the `Partitioned` attribute is not set. + +**Note** This is an attribute that has not yet been fully standardized, and may +change in the future. This also means many clients may ignore this attribute until +they understand it. + +More information about can be found in [the proposal](https://github.com/privacycg/CHIPS). + +##### cookie.path + +Specifies the value for the `Path` `Set-Cookie`. By default, this is set to `'/'`, which +is the root path of the domain. + +##### cookie.priority + +Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1]. + + - `'low'` will set the `Priority` attribute to `Low`. + - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set. + - `'high'` will set the `Priority` attribute to `High`. + +More information about the different priority levels can be found in +[the specification][rfc-west-cookie-priority-00-4.1]. + +**Note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### cookie.sameSite + +Specifies the `boolean` or `string` to be the value for the `SameSite` `Set-Cookie` attribute. +By default, this is `false`. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-03-4.1.2.7]. + +**Note** This is an attribute that has not yet been fully standardized, and may change in +the future. This also means many clients may ignore this attribute until they understand it. + +**Note** There is a [draft spec](https://tools.ietf.org/html/draft-west-cookie-incrementalism-01) +that requires that the `Secure` attribute be set to `true` when the `SameSite` attribute has been +set to `'none'`. Some web browsers or other clients may be adopting this specification. + +##### cookie.secure + +Specifies the `boolean` value for the `Secure` `Set-Cookie` attribute. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` +attribute is not set. + +**Note** be careful when setting this to `true`, as compliant clients will not send +the cookie back to the server in the future if the browser does not have an HTTPS +connection. + +Please note that `secure: true` is a **recommended** option. However, it requires +an https-enabled website, i.e., HTTPS is necessary for secure cookies. If `secure` +is set, and you access your site over HTTP, the cookie will not be set. If you +have your node.js behind a proxy and are using `secure: true`, you need to set +"trust proxy" in express: + +```js +var app = express() +app.set('trust proxy', 1) // trust first proxy +app.use(session({ + secret: 'keyboard cat', + resave: false, + saveUninitialized: true, + cookie: { secure: true } +})) +``` + +For using secure cookies in production, but allowing for testing in development, +the following is an example of enabling this setup based on `NODE_ENV` in express: + +```js +var app = express() +var sess = { + secret: 'keyboard cat', + cookie: {} +} + +if (app.get('env') === 'production') { + app.set('trust proxy', 1) // trust first proxy + sess.cookie.secure = true // serve secure cookies +} + +app.use(session(sess)) +``` + +The `cookie.secure` option can also be set to the special value `'auto'` to have +this setting automatically match the determined security of the connection. Be +careful when using this setting if the site is available both as HTTP and HTTPS, +as once the cookie is set on HTTPS, it will no longer be visible over HTTP. This +is useful when the Express `"trust proxy"` setting is properly setup to simplify +development vs production configuration. + +##### genid + +Function to call to generate a new session ID. Provide a function that returns +a string that will be used as a session ID. The function is given `req` as the +first argument if you want to use some value attached to `req` when generating +the ID. + +The default value is a function which uses the `uid-safe` library to generate IDs. + +**NOTE** be careful to generate unique IDs so your sessions do not conflict. + +```js +app.use(session({ + genid: function(req) { + return genuuid() // use UUIDs for session IDs + }, + secret: 'keyboard cat' +})) +``` + +##### name + +The name of the session ID cookie to set in the response (and read from in the +request). + +The default value is `'connect.sid'`. + +**Note** if you have multiple apps running on the same hostname (this is just +the name, i.e. `localhost` or `127.0.0.1`; different schemes and ports do not +name a different hostname), then you need to separate the session cookies from +each other. The simplest method is to simply set different `name`s per app. + +##### proxy + +Trust the reverse proxy when setting secure cookies (via the "X-Forwarded-Proto" +header). + +The default value is `undefined`. + + - `true` The "X-Forwarded-Proto" header will be used. + - `false` All headers are ignored and the connection is considered secure only + if there is a direct TLS/SSL connection. + - `undefined` Uses the "trust proxy" setting from express + +##### resave + +Forces the session to be saved back to the session store, even if the session +was never modified during the request. Depending on your store this may be +necessary, but it can also create race conditions where a client makes two +parallel requests to your server and changes made to the session in one +request may get overwritten when the other request ends, even if it made no +changes (this behavior also depends on what store you're using). + +The default value is `true`, but using the default has been deprecated, +as the default will change in the future. Please research into this setting +and choose what is appropriate to your use-case. Typically, you'll want +`false`. + +How do I know if this is necessary for my store? The best way to know is to +check with your store if it implements the `touch` method. If it does, then +you can safely set `resave: false`. If it does not implement the `touch` +method and your store sets an expiration date on stored sessions, then you +likely need `resave: true`. + +##### rolling + +Force the session identifier cookie to be set on every response. The expiration +is reset to the original [`maxAge`](#cookiemaxage), resetting the expiration +countdown. + +The default value is `false`. + +With this enabled, the session identifier cookie will expire in +[`maxAge`](#cookiemaxage) since the last response was sent instead of in +[`maxAge`](#cookiemaxage) since the session was last modified by the server. + +This is typically used in conjuction with short, non-session-length +[`maxAge`](#cookiemaxage) values to provide a quick timeout of the session data +with reduced potential of it occurring during on going server interactions. + +**Note** When this option is set to `true` but the `saveUninitialized` option is +set to `false`, the cookie will not be set on a response with an uninitialized +session. This option only modifies the behavior when an existing session was +loaded for the request. + +##### saveUninitialized + +Forces a session that is "uninitialized" to be saved to the store. A session is +uninitialized when it is new but not modified. Choosing `false` is useful for +implementing login sessions, reducing server storage usage, or complying with +laws that require permission before setting a cookie. Choosing `false` will also +help with race conditions where a client makes multiple parallel requests +without a session. + +The default value is `true`, but using the default has been deprecated, as the +default will change in the future. Please research into this setting and +choose what is appropriate to your use-case. + +**Note** if you are using Session in conjunction with PassportJS, Passport +will add an empty Passport object to the session for use after a user is +authenticated, which will be treated as a modification to the session, causing +it to be saved. *This has been fixed in PassportJS 0.3.0* + +##### secret + +**Required option** + +This is the secret used to sign the session ID cookie. The secret can be any type +of value that is supported by Node.js `crypto.createHmac` (like a string or a +`Buffer`). This can be either a single secret, or an array of multiple secrets. If +an array of secrets is provided, only the first element will be used to sign the +session ID cookie, while all the elements will be considered when verifying the +signature in requests. The secret itself should be not easily parsed by a human and +would best be a random set of characters. A best practice may include: + + - The use of environment variables to store the secret, ensuring the secret itself + does not exist in your repository. + - Periodic updates of the secret, while ensuring the previous secret is in the + array. + +Using a secret that cannot be guessed will reduce the ability to hijack a session to +only guessing the session ID (as determined by the `genid` option). + +Changing the secret value will invalidate all existing sessions. In order to rotate +the secret without invalidating sessions, provide an array of secrets, with the new +secret as first element of the array, and including previous secrets as the later +elements. + +**Note** HMAC-256 is used to sign the session ID. For this reason, the secret should +contain at least 32 bytes of entropy. + +##### store + +The session store instance, defaults to a new `MemoryStore` instance. + +##### unset + +Control the result of unsetting `req.session` (through `delete`, setting to `null`, +etc.). + +The default value is `'keep'`. + + - `'destroy'` The session will be destroyed (deleted) when the response ends. + - `'keep'` The session in the store will be kept, but modifications made during + the request are ignored and not saved. + +### req.session + +To store or access session data, simply use the request property `req.session`, +which is (generally) serialized as JSON by the store, so nested objects +are typically fine. For example below is a user-specific view counter: + +```js +// Use the session middleware +app.use(session({ secret: 'keyboard cat', cookie: { maxAge: 60000 }})) + +// Access the session as req.session +app.get('/', function(req, res, next) { + if (req.session.views) { + req.session.views++ + res.setHeader('Content-Type', 'text/html') + res.write('<p>views: ' + req.session.views + '</p>') + res.write('<p>expires in: ' + (req.session.cookie.maxAge / 1000) + 's</p>') + res.end() + } else { + req.session.views = 1 + res.end('welcome to the session demo. refresh!') + } +}) +``` + +#### Session.regenerate(callback) + +To regenerate the session simply invoke the method. Once complete, +a new SID and `Session` instance will be initialized at `req.session` +and the `callback` will be invoked. + +```js +req.session.regenerate(function(err) { + // will have a new session here +}) +``` + +#### Session.destroy(callback) + +Destroys the session and will unset the `req.session` property. +Once complete, the `callback` will be invoked. + +```js +req.session.destroy(function(err) { + // cannot access session here +}) +``` + +#### Session.reload(callback) + +Reloads the session data from the store and re-populates the +`req.session` object. Once complete, the `callback` will be invoked. + +```js +req.session.reload(function(err) { + // session updated +}) +``` + +#### Session.save(callback) + +Save the session back to the store, replacing the contents on the store with the +contents in memory (though a store may do something else--consult the store's +documentation for exact behavior). + +This method is automatically called at the end of the HTTP response if the +session data has been altered (though this behavior can be altered with various +options in the middleware constructor). Because of this, typically this method +does not need to be called. + +There are some cases where it is useful to call this method, for example, +redirects, long-lived requests or in WebSockets. + +```js +req.session.save(function(err) { + // session saved +}) +``` + +#### Session.touch() + +Updates the `.maxAge` property. Typically this is +not necessary to call, as the session middleware does this for you. + +### req.session.id + +Each session has a unique ID associated with it. This property is an +alias of [`req.sessionID`](#reqsessionid-1) and cannot be modified. +It has been added to make the session ID accessible from the `session` +object. + +### req.session.cookie + +Each session has a unique cookie object accompany it. This allows +you to alter the session cookie per visitor. For example we can +set `req.session.cookie.expires` to `false` to enable the cookie +to remain for only the duration of the user-agent. + +#### Cookie.maxAge + +Alternatively `req.session.cookie.maxAge` will return the time +remaining in milliseconds, which we may also re-assign a new value +to adjust the `.expires` property appropriately. The following +are essentially equivalent + +```js +var hour = 3600000 +req.session.cookie.expires = new Date(Date.now() + hour) +req.session.cookie.maxAge = hour +``` + +For example when `maxAge` is set to `60000` (one minute), and 30 seconds +has elapsed it will return `30000` until the current request has completed, +at which time `req.session.touch()` is called to reset +`req.session.cookie.maxAge` to its original value. + +```js +req.session.cookie.maxAge // => 30000 +``` + +#### Cookie.originalMaxAge + +The `req.session.cookie.originalMaxAge` property returns the original +`maxAge` (time-to-live), in milliseconds, of the session cookie. + +### req.sessionID + +To get the ID of the loaded session, access the request property +`req.sessionID`. This is simply a read-only value set when a session +is loaded/created. + +## Session Store Implementation + +Every session store _must_ be an `EventEmitter` and implement specific +methods. The following methods are the list of **required**, **recommended**, +and **optional**. + + * Required methods are ones that this module will always call on the store. + * Recommended methods are ones that this module will call on the store if + available. + * Optional methods are ones this module does not call at all, but helps + present uniform stores to users. + +For an example implementation view the [connect-redis](http://github.com/visionmedia/connect-redis) repo. + +### store.all(callback) + +**Optional** + +This optional method is used to get all sessions in the store as an array. The +`callback` should be called as `callback(error, sessions)`. + +### store.destroy(sid, callback) + +**Required** + +This required method is used to destroy/delete a session from the store given +a session ID (`sid`). The `callback` should be called as `callback(error)` once +the session is destroyed. + +### store.clear(callback) + +**Optional** + +This optional method is used to delete all sessions from the store. The +`callback` should be called as `callback(error)` once the store is cleared. + +### store.length(callback) + +**Optional** + +This optional method is used to get the count of all sessions in the store. +The `callback` should be called as `callback(error, len)`. + +### store.get(sid, callback) + +**Required** + +This required method is used to get a session from the store given a session +ID (`sid`). The `callback` should be called as `callback(error, session)`. + +The `session` argument should be a session if found, otherwise `null` or +`undefined` if the session was not found (and there was no error). A special +case is made when `error.code === 'ENOENT'` to act like `callback(null, null)`. + +### store.set(sid, session, callback) + +**Required** + +This required method is used to upsert a session into the store given a +session ID (`sid`) and session (`session`) object. The callback should be +called as `callback(error)` once the session has been set in the store. + +### store.touch(sid, session, callback) + +**Recommended** + +This recommended method is used to "touch" a given session given a +session ID (`sid`) and session (`session`) object. The `callback` should be +called as `callback(error)` once the session has been touched. + +This is primarily used when the store will automatically delete idle sessions +and this method is used to signal to the store the given session is active, +potentially resetting the idle timer. + +## Compatible Session Stores + +The following modules implement a session store that is compatible with this +module. Please make a PR to add additional modules :) + +[![★][aerospike-session-store-image] aerospike-session-store][aerospike-session-store-url] A session store using [Aerospike](http://www.aerospike.com/). + +[aerospike-session-store-url]: https://www.npmjs.com/package/aerospike-session-store +[aerospike-session-store-image]: https://badgen.net/github/stars/aerospike/aerospike-session-store-expressjs?label=%E2%98%85 + +[![★][better-sqlite3-session-store-image] better-sqlite3-session-store][better-sqlite3-session-store-url] A session store based on [better-sqlite3](https://github.com/JoshuaWise/better-sqlite3). + +[better-sqlite3-session-store-url]: https://www.npmjs.com/package/better-sqlite3-session-store +[better-sqlite3-session-store-image]: https://badgen.net/github/stars/timdaub/better-sqlite3-session-store?label=%E2%98%85 + +[![★][cassandra-store-image] cassandra-store][cassandra-store-url] An Apache Cassandra-based session store. + +[cassandra-store-url]: https://www.npmjs.com/package/cassandra-store +[cassandra-store-image]: https://badgen.net/github/stars/webcc/cassandra-store?label=%E2%98%85 + +[![★][cluster-store-image] cluster-store][cluster-store-url] A wrapper for using in-process / embedded +stores - such as SQLite (via knex), leveldb, files, or memory - with node cluster (desirable for Raspberry Pi 2 +and other multi-core embedded devices). + +[cluster-store-url]: https://www.npmjs.com/package/cluster-store +[cluster-store-image]: https://badgen.net/github/stars/coolaj86/cluster-store?label=%E2%98%85 + +[![★][connect-arango-image] connect-arango][connect-arango-url] An ArangoDB-based session store. + +[connect-arango-url]: https://www.npmjs.com/package/connect-arango +[connect-arango-image]: https://badgen.net/github/stars/AlexanderArvidsson/connect-arango?label=%E2%98%85 + +[![★][connect-azuretables-image] connect-azuretables][connect-azuretables-url] An [Azure Table Storage](https://azure.microsoft.com/en-gb/services/storage/tables/)-based session store. + +[connect-azuretables-url]: https://www.npmjs.com/package/connect-azuretables +[connect-azuretables-image]: https://badgen.net/github/stars/mike-goodwin/connect-azuretables?label=%E2%98%85 + +[![★][connect-cloudant-store-image] connect-cloudant-store][connect-cloudant-store-url] An [IBM Cloudant](https://cloudant.com/)-based session store. + +[connect-cloudant-store-url]: https://www.npmjs.com/package/connect-cloudant-store +[connect-cloudant-store-image]: https://badgen.net/github/stars/adriantanasa/connect-cloudant-store?label=%E2%98%85 + +[![★][connect-cosmosdb-image] connect-cosmosdb][connect-cosmosdb-url] An Azure [Cosmos DB](https://azure.microsoft.com/en-us/products/cosmos-db/)-based session store. + +[connect-cosmosdb-url]: https://www.npmjs.com/package/connect-cosmosdb +[connect-cosmosdb-image]: https://badgen.net/github/stars/thekillingspree/connect-cosmosdb?label=%E2%98%85 + +[![★][connect-couchbase-image] connect-couchbase][connect-couchbase-url] A [couchbase](http://www.couchbase.com/)-based session store. + +[connect-couchbase-url]: https://www.npmjs.com/package/connect-couchbase +[connect-couchbase-image]: https://badgen.net/github/stars/christophermina/connect-couchbase?label=%E2%98%85 + +[![★][connect-datacache-image] connect-datacache][connect-datacache-url] An [IBM Bluemix Data Cache](http://www.ibm.com/cloud-computing/bluemix/)-based session store. + +[connect-datacache-url]: https://www.npmjs.com/package/connect-datacache +[connect-datacache-image]: https://badgen.net/github/stars/adriantanasa/connect-datacache?label=%E2%98%85 + +[![★][@google-cloud/connect-datastore-image] @google-cloud/connect-datastore][@google-cloud/connect-datastore-url] A [Google Cloud Datastore](https://cloud.google.com/datastore/docs/concepts/overview)-based session store. + +[@google-cloud/connect-datastore-url]: https://www.npmjs.com/package/@google-cloud/connect-datastore +[@google-cloud/connect-datastore-image]: https://badgen.net/github/stars/GoogleCloudPlatform/cloud-datastore-session-node?label=%E2%98%85 + +[![★][connect-db2-image] connect-db2][connect-db2-url] An IBM DB2-based session store built using [ibm_db](https://www.npmjs.com/package/ibm_db) module. + +[connect-db2-url]: https://www.npmjs.com/package/connect-db2 +[connect-db2-image]: https://badgen.net/github/stars/wallali/connect-db2?label=%E2%98%85 + +[![★][connect-dynamodb-image] connect-dynamodb][connect-dynamodb-url] A DynamoDB-based session store. + +[connect-dynamodb-url]: https://www.npmjs.com/package/connect-dynamodb +[connect-dynamodb-image]: https://badgen.net/github/stars/ca98am79/connect-dynamodb?label=%E2%98%85 + +[![★][@google-cloud/connect-firestore-image] @google-cloud/connect-firestore][@google-cloud/connect-firestore-url] A [Google Cloud Firestore](https://cloud.google.com/firestore/docs/overview)-based session store. + +[@google-cloud/connect-firestore-url]: https://www.npmjs.com/package/@google-cloud/connect-firestore +[@google-cloud/connect-firestore-image]: https://badgen.net/github/stars/googleapis/nodejs-firestore-session?label=%E2%98%85 + +[![★][connect-hazelcast-image] connect-hazelcast][connect-hazelcast-url] Hazelcast session store for Connect and Express. + +[connect-hazelcast-url]: https://www.npmjs.com/package/connect-hazelcast +[connect-hazelcast-image]: https://badgen.net/github/stars/huseyinbabal/connect-hazelcast?label=%E2%98%85 + +[![★][connect-loki-image] connect-loki][connect-loki-url] A Loki.js-based session store. + +[connect-loki-url]: https://www.npmjs.com/package/connect-loki +[connect-loki-image]: https://badgen.net/github/stars/Requarks/connect-loki?label=%E2%98%85 + +[![★][connect-lowdb-image] connect-lowdb][connect-lowdb-url] A lowdb-based session store. + +[connect-lowdb-url]: https://www.npmjs.com/package/connect-lowdb +[connect-lowdb-image]: https://badgen.net/github/stars/travishorn/connect-lowdb?label=%E2%98%85 + +[![★][connect-memcached-image] connect-memcached][connect-memcached-url] A memcached-based session store. + +[connect-memcached-url]: https://www.npmjs.com/package/connect-memcached +[connect-memcached-image]: https://badgen.net/github/stars/balor/connect-memcached?label=%E2%98%85 + +[![★][connect-memjs-image] connect-memjs][connect-memjs-url] A memcached-based session store using +[memjs](https://www.npmjs.com/package/memjs) as the memcached client. + +[connect-memjs-url]: https://www.npmjs.com/package/connect-memjs +[connect-memjs-image]: https://badgen.net/github/stars/liamdon/connect-memjs?label=%E2%98%85 + +[![★][connect-ml-image] connect-ml][connect-ml-url] A MarkLogic Server-based session store. + +[connect-ml-url]: https://www.npmjs.com/package/connect-ml +[connect-ml-image]: https://badgen.net/github/stars/bluetorch/connect-ml?label=%E2%98%85 + +[![★][connect-monetdb-image] connect-monetdb][connect-monetdb-url] A MonetDB-based session store. + +[connect-monetdb-url]: https://www.npmjs.com/package/connect-monetdb +[connect-monetdb-image]: https://badgen.net/github/stars/MonetDB/npm-connect-monetdb?label=%E2%98%85 + +[![★][connect-mongo-image] connect-mongo][connect-mongo-url] A MongoDB-based session store. + +[connect-mongo-url]: https://www.npmjs.com/package/connect-mongo +[connect-mongo-image]: https://badgen.net/github/stars/kcbanner/connect-mongo?label=%E2%98%85 + +[![★][connect-mongodb-session-image] connect-mongodb-session][connect-mongodb-session-url] Lightweight MongoDB-based session store built and maintained by MongoDB. + +[connect-mongodb-session-url]: https://www.npmjs.com/package/connect-mongodb-session +[connect-mongodb-session-image]: https://badgen.net/github/stars/mongodb-js/connect-mongodb-session?label=%E2%98%85 + +[![★][connect-mssql-v2-image] connect-mssql-v2][connect-mssql-v2-url] A Microsoft SQL Server-based session store based on [connect-mssql](https://www.npmjs.com/package/connect-mssql). + +[connect-mssql-v2-url]: https://www.npmjs.com/package/connect-mssql-v2 +[connect-mssql-v2-image]: https://badgen.net/github/stars/jluboff/connect-mssql-v2?label=%E2%98%85 + +[![★][connect-neo4j-image] connect-neo4j][connect-neo4j-url] A [Neo4j](https://neo4j.com)-based session store. + +[connect-neo4j-url]: https://www.npmjs.com/package/connect-neo4j +[connect-neo4j-image]: https://badgen.net/github/stars/MaxAndersson/connect-neo4j?label=%E2%98%85 + +[![★][connect-ottoman-image] connect-ottoman][connect-ottoman-url] A [couchbase ottoman](http://www.couchbase.com/)-based session store. + +[connect-ottoman-url]: https://www.npmjs.com/package/connect-ottoman +[connect-ottoman-image]: https://badgen.net/github/stars/noiissyboy/connect-ottoman?label=%E2%98%85 + +[![★][connect-pg-simple-image] connect-pg-simple][connect-pg-simple-url] A PostgreSQL-based session store. + +[connect-pg-simple-url]: https://www.npmjs.com/package/connect-pg-simple +[connect-pg-simple-image]: https://badgen.net/github/stars/voxpelli/node-connect-pg-simple?label=%E2%98%85 + +[![★][connect-redis-image] connect-redis][connect-redis-url] A Redis-based session store. + +[connect-redis-url]: https://www.npmjs.com/package/connect-redis +[connect-redis-image]: https://badgen.net/github/stars/tj/connect-redis?label=%E2%98%85 + +[![★][connect-session-firebase-image] connect-session-firebase][connect-session-firebase-url] A session store based on the [Firebase Realtime Database](https://firebase.google.com/docs/database/) + +[connect-session-firebase-url]: https://www.npmjs.com/package/connect-session-firebase +[connect-session-firebase-image]: https://badgen.net/github/stars/benweier/connect-session-firebase?label=%E2%98%85 + +[![★][connect-session-knex-image] connect-session-knex][connect-session-knex-url] A session store using +[Knex.js](http://knexjs.org/), which is a SQL query builder for PostgreSQL, MySQL, MariaDB, SQLite3, and Oracle. + +[connect-session-knex-url]: https://www.npmjs.com/package/connect-session-knex +[connect-session-knex-image]: https://badgen.net/github/stars/llambda/connect-session-knex?label=%E2%98%85 + +[![★][connect-session-sequelize-image] connect-session-sequelize][connect-session-sequelize-url] A session store using +[Sequelize.js](http://sequelizejs.com/), which is a Node.js / io.js ORM for PostgreSQL, MySQL, SQLite and MSSQL. + +[connect-session-sequelize-url]: https://www.npmjs.com/package/connect-session-sequelize +[connect-session-sequelize-image]: https://badgen.net/github/stars/mweibel/connect-session-sequelize?label=%E2%98%85 + +[![★][connect-sqlite3-image] connect-sqlite3][connect-sqlite3-url] A [SQLite3](https://github.com/mapbox/node-sqlite3) session store modeled after the TJ's `connect-redis` store. + +[connect-sqlite3-url]: https://www.npmjs.com/package/connect-sqlite3 +[connect-sqlite3-image]: https://badgen.net/github/stars/rawberg/connect-sqlite3?label=%E2%98%85 + +[![★][connect-typeorm-image] connect-typeorm][connect-typeorm-url] A [TypeORM](https://github.com/typeorm/typeorm)-based session store. + +[connect-typeorm-url]: https://www.npmjs.com/package/connect-typeorm +[connect-typeorm-image]: https://badgen.net/github/stars/makepost/connect-typeorm?label=%E2%98%85 + +[![★][couchdb-expression-image] couchdb-expression][couchdb-expression-url] A [CouchDB](https://couchdb.apache.org/)-based session store. + +[couchdb-expression-url]: https://www.npmjs.com/package/couchdb-expression +[couchdb-expression-image]: https://badgen.net/github/stars/tkshnwesper/couchdb-expression?label=%E2%98%85 + +[![★][dynamodb-store-image] dynamodb-store][dynamodb-store-url] A DynamoDB-based session store. + +[dynamodb-store-url]: https://www.npmjs.com/package/dynamodb-store +[dynamodb-store-image]: https://badgen.net/github/stars/rafaelrpinto/dynamodb-store?label=%E2%98%85 + +[![★][dynamodb-store-v3-image] dynamodb-store-v3][dynamodb-store-v3-url] Implementation of a session store using DynamoDB backed by the [AWS SDK for JavaScript v3](https://github.com/aws/aws-sdk-js-v3). + +[dynamodb-store-v3-url]: https://www.npmjs.com/package/dynamodb-store-v3 +[dynamodb-store-v3-image]: https://badgen.net/github/stars/FryDay/dynamodb-store-v3?label=%E2%98%85 + +[![★][express-etcd-image] express-etcd][express-etcd-url] An [etcd](https://github.com/stianeikeland/node-etcd) based session store. + +[express-etcd-url]: https://www.npmjs.com/package/express-etcd +[express-etcd-image]: https://badgen.net/github/stars/gildean/express-etcd?label=%E2%98%85 + +[![★][express-mysql-session-image] express-mysql-session][express-mysql-session-url] A session store using native +[MySQL](https://www.mysql.com/) via the [node-mysql](https://github.com/felixge/node-mysql) module. + +[express-mysql-session-url]: https://www.npmjs.com/package/express-mysql-session +[express-mysql-session-image]: https://badgen.net/github/stars/chill117/express-mysql-session?label=%E2%98%85 + +[![★][express-nedb-session-image] express-nedb-session][express-nedb-session-url] A NeDB-based session store. + +[express-nedb-session-url]: https://www.npmjs.com/package/express-nedb-session +[express-nedb-session-image]: https://badgen.net/github/stars/louischatriot/express-nedb-session?label=%E2%98%85 + +[![★][express-oracle-session-image] express-oracle-session][express-oracle-session-url] A session store using native +[oracle](https://www.oracle.com/) via the [node-oracledb](https://www.npmjs.com/package/oracledb) module. + +[express-oracle-session-url]: https://www.npmjs.com/package/express-oracle-session +[express-oracle-session-image]: https://badgen.net/github/stars/slumber86/express-oracle-session?label=%E2%98%85 + +[![★][express-session-cache-manager-image] express-session-cache-manager][express-session-cache-manager-url] +A store that implements [cache-manager](https://www.npmjs.com/package/cache-manager), which supports +a [variety of storage types](https://www.npmjs.com/package/cache-manager#store-engines). + +[express-session-cache-manager-url]: https://www.npmjs.com/package/express-session-cache-manager +[express-session-cache-manager-image]: https://badgen.net/github/stars/theogravity/express-session-cache-manager?label=%E2%98%85 + +[![★][express-session-etcd3-image] express-session-etcd3][express-session-etcd3-url] An [etcd3](https://github.com/mixer/etcd3) based session store. + +[express-session-etcd3-url]: https://www.npmjs.com/package/express-session-etcd3 +[express-session-etcd3-image]: https://badgen.net/github/stars/willgm/express-session-etcd3?label=%E2%98%85 + +[![★][express-session-level-image] express-session-level][express-session-level-url] A [LevelDB](https://github.com/Level/levelup) based session store. + +[express-session-level-url]: https://www.npmjs.com/package/express-session-level +[express-session-level-image]: https://badgen.net/github/stars/tgohn/express-session-level?label=%E2%98%85 + +[![★][express-session-rsdb-image] express-session-rsdb][express-session-rsdb-url] Session store based on Rocket-Store: A very simple, super fast and yet powerfull, flat file database. + +[express-session-rsdb-url]: https://www.npmjs.com/package/express-session-rsdb +[express-session-rsdb-image]: https://badgen.net/github/stars/paragi/express-session-rsdb?label=%E2%98%85 + +[![★][express-sessions-image] express-sessions][express-sessions-url] A session store supporting both MongoDB and Redis. + +[express-sessions-url]: https://www.npmjs.com/package/express-sessions +[express-sessions-image]: https://badgen.net/github/stars/konteck/express-sessions?label=%E2%98%85 + +[![★][firestore-store-image] firestore-store][firestore-store-url] A [Firestore](https://github.com/hendrysadrak/firestore-store)-based session store. + +[firestore-store-url]: https://www.npmjs.com/package/firestore-store +[firestore-store-image]: https://badgen.net/github/stars/hendrysadrak/firestore-store?label=%E2%98%85 + +[![★][fortune-session-image] fortune-session][fortune-session-url] A [Fortune.js](https://github.com/fortunejs/fortune) +based session store. Supports all backends supported by Fortune (MongoDB, Redis, Postgres, NeDB). + +[fortune-session-url]: https://www.npmjs.com/package/fortune-session +[fortune-session-image]: https://badgen.net/github/stars/aliceklipper/fortune-session?label=%E2%98%85 + +[![★][hazelcast-store-image] hazelcast-store][hazelcast-store-url] A Hazelcast-based session store built on the [Hazelcast Node Client](https://www.npmjs.com/package/hazelcast-client). + +[hazelcast-store-url]: https://www.npmjs.com/package/hazelcast-store +[hazelcast-store-image]: https://badgen.net/github/stars/jackspaniel/hazelcast-store?label=%E2%98%85 + +[![★][level-session-store-image] level-session-store][level-session-store-url] A LevelDB-based session store. + +[level-session-store-url]: https://www.npmjs.com/package/level-session-store +[level-session-store-image]: https://badgen.net/github/stars/toddself/level-session-store?label=%E2%98%85 + +[![★][lowdb-session-store-image] lowdb-session-store][lowdb-session-store-url] A [lowdb](https://www.npmjs.com/package/lowdb)-based session store. + +[lowdb-session-store-url]: https://www.npmjs.com/package/lowdb-session-store +[lowdb-session-store-image]: https://badgen.net/github/stars/fhellwig/lowdb-session-store?label=%E2%98%85 + +[![★][medea-session-store-image] medea-session-store][medea-session-store-url] A Medea-based session store. + +[medea-session-store-url]: https://www.npmjs.com/package/medea-session-store +[medea-session-store-image]: https://badgen.net/github/stars/BenjaminVadant/medea-session-store?label=%E2%98%85 + +[![★][memorystore-image] memorystore][memorystore-url] A memory session store made for production. + +[memorystore-url]: https://www.npmjs.com/package/memorystore +[memorystore-image]: https://badgen.net/github/stars/roccomuso/memorystore?label=%E2%98%85 + +[![★][mssql-session-store-image] mssql-session-store][mssql-session-store-url] A SQL Server-based session store. + +[mssql-session-store-url]: https://www.npmjs.com/package/mssql-session-store +[mssql-session-store-image]: https://badgen.net/github/stars/jwathen/mssql-session-store?label=%E2%98%85 + +[![★][nedb-session-store-image] nedb-session-store][nedb-session-store-url] An alternate NeDB-based (either in-memory or file-persisted) session store. + +[nedb-session-store-url]: https://www.npmjs.com/package/nedb-session-store +[nedb-session-store-image]: https://badgen.net/github/stars/JamesMGreene/nedb-session-store?label=%E2%98%85 + +[![★][@quixo3/prisma-session-store-image] @quixo3/prisma-session-store][@quixo3/prisma-session-store-url] A session store for the [Prisma Framework](https://www.prisma.io). + +[@quixo3/prisma-session-store-url]: https://www.npmjs.com/package/@quixo3/prisma-session-store +[@quixo3/prisma-session-store-image]: https://badgen.net/github/stars/kleydon/prisma-session-store?label=%E2%98%85 + +[![★][restsession-image] restsession][restsession-url] Store sessions utilizing a RESTful API + +[restsession-url]: https://www.npmjs.com/package/restsession +[restsession-image]: https://badgen.net/github/stars/jankal/restsession?label=%E2%98%85 + +[![★][sequelstore-connect-image] sequelstore-connect][sequelstore-connect-url] A session store using [Sequelize.js](http://sequelizejs.com/). + +[sequelstore-connect-url]: https://www.npmjs.com/package/sequelstore-connect +[sequelstore-connect-image]: https://badgen.net/github/stars/MattMcFarland/sequelstore-connect?label=%E2%98%85 + +[![★][session-file-store-image] session-file-store][session-file-store-url] A file system-based session store. + +[session-file-store-url]: https://www.npmjs.com/package/session-file-store +[session-file-store-image]: https://badgen.net/github/stars/valery-barysok/session-file-store?label=%E2%98%85 + +[![★][session-pouchdb-store-image] session-pouchdb-store][session-pouchdb-store-url] Session store for PouchDB / CouchDB. Accepts embedded, custom, or remote PouchDB instance and realtime synchronization. + +[session-pouchdb-store-url]: https://www.npmjs.com/package/session-pouchdb-store +[session-pouchdb-store-image]: https://badgen.net/github/stars/solzimer/session-pouchdb-store?label=%E2%98%85 + +[![★][@cyclic.sh/session-store-image] @cyclic.sh/session-store][@cyclic.sh/session-store-url] A DynamoDB-based session store for [Cyclic.sh](https://www.cyclic.sh/) apps. + +[@cyclic.sh/session-store-url]: https://www.npmjs.com/package/@cyclic.sh/session-store +[@cyclic.sh/session-store-image]: https://badgen.net/github/stars/cyclic-software/session-store?label=%E2%98%85 + +[![★][@databunker/session-store-image] @databunker/session-store][@databunker/session-store-url] A [Databunker](https://databunker.org/)-based encrypted session store. + +[@databunker/session-store-url]: https://www.npmjs.com/package/@databunker/session-store +[@databunker/session-store-image]: https://badgen.net/github/stars/securitybunker/databunker-session-store?label=%E2%98%85 + +[![★][sessionstore-image] sessionstore][sessionstore-url] A session store that works with various databases. + +[sessionstore-url]: https://www.npmjs.com/package/sessionstore +[sessionstore-image]: https://badgen.net/github/stars/adrai/sessionstore?label=%E2%98%85 + +[![★][tch-nedb-session-image] tch-nedb-session][tch-nedb-session-url] A file system session store based on NeDB. + +[tch-nedb-session-url]: https://www.npmjs.com/package/tch-nedb-session +[tch-nedb-session-image]: https://badgen.net/github/stars/tomaschyly/NeDBSession?label=%E2%98%85 + +## Examples + +### View counter + +A simple example using `express-session` to store page views for a user. + +```js +var express = require('express') +var parseurl = require('parseurl') +var session = require('express-session') + +var app = express() + +app.use(session({ + secret: 'keyboard cat', + resave: false, + saveUninitialized: true +})) + +app.use(function (req, res, next) { + if (!req.session.views) { + req.session.views = {} + } + + // get the url pathname + var pathname = parseurl(req).pathname + + // count the views + req.session.views[pathname] = (req.session.views[pathname] || 0) + 1 + + next() +}) + +app.get('/foo', function (req, res, next) { + res.send('you viewed this page ' + req.session.views['/foo'] + ' times') +}) + +app.get('/bar', function (req, res, next) { + res.send('you viewed this page ' + req.session.views['/bar'] + ' times') +}) + +app.listen(3000) +``` + +### User login + +A simple example using `express-session` to keep a user log in session. + +```js +var escapeHtml = require('escape-html') +var express = require('express') +var session = require('express-session') + +var app = express() + +app.use(session({ + secret: 'keyboard cat', + resave: false, + saveUninitialized: true +})) + +// middleware to test if authenticated +function isAuthenticated (req, res, next) { + if (req.session.user) next() + else next('route') +} + +app.get('/', isAuthenticated, function (req, res) { + // this is only called when there is an authentication user due to isAuthenticated + res.send('hello, ' + escapeHtml(req.session.user) + '!' + + ' <a href="/logout">Logout</a>') +}) + +app.get('/', function (req, res) { + res.send('<form action="/login" method="post">' + + 'Username: <input name="user"><br>' + + 'Password: <input name="pass" type="password"><br>' + + '<input type="submit" text="Login"></form>') +}) + +app.post('/login', express.urlencoded({ extended: false }), function (req, res) { + // login logic to validate req.body.user and req.body.pass + // would be implemented here. for this example any combo works + + // regenerate the session, which is good practice to help + // guard against forms of session fixation + req.session.regenerate(function (err) { + if (err) next(err) + + // store user information in session, typically a user id + req.session.user = req.body.user + + // save the session before redirection to ensure page + // load does not happen before session is saved + req.session.save(function (err) { + if (err) return next(err) + res.redirect('/') + }) + }) +}) + +app.get('/logout', function (req, res, next) { + // logout logic + + // clear the user from the session object and save. + // this will ensure that re-using the old session id + // does not have a logged in user + req.session.user = null + req.session.save(function (err) { + if (err) next(err) + + // regenerate the session, which is good practice to help + // guard against forms of session fixation + req.session.regenerate(function (err) { + if (err) next(err) + res.redirect('/') + }) + }) +}) + +app.listen(3000) +``` + +## Debugging + +This module uses the [debug](https://www.npmjs.com/package/debug) module +internally to log information about session operations. + +To see all the internal logs, set the `DEBUG` environment variable to +`express-session` when launching your app (`npm start`, in this example): + +```sh +$ DEBUG=express-session npm start +``` + +On Windows, use the corresponding command; + +```sh +> set DEBUG=express-session & npm start +``` + +## License + +[MIT](LICENSE) + +[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7 +[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/ +[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1 +[ci-image]: https://badgen.net/github/checks/expressjs/session/master?label=ci +[ci-url]: https://github.com/expressjs/session/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/session/master +[coveralls-url]: https://coveralls.io/r/expressjs/session?branch=master +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/express-session +[npm-url]: https://npmjs.org/package/express-session +[npm-version-image]: https://badgen.net/npm/v/express-session diff --git a/node_modules/express-session/index.js b/node_modules/express-session/index.js new file mode 100644 index 0000000..d41b237 --- /dev/null +++ b/node_modules/express-session/index.js @@ -0,0 +1,693 @@ +/*! + * express-session + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Buffer = require('safe-buffer').Buffer +var cookie = require('cookie'); +var crypto = require('crypto') +var debug = require('debug')('express-session'); +var deprecate = require('depd')('express-session'); +var onHeaders = require('on-headers') +var parseUrl = require('parseurl'); +var signature = require('cookie-signature') +var uid = require('uid-safe').sync + +var Cookie = require('./session/cookie') +var MemoryStore = require('./session/memory') +var Session = require('./session/session') +var Store = require('./session/store') + +// environment + +var env = process.env.NODE_ENV; + +/** + * Expose the middleware. + */ + +exports = module.exports = session; + +/** + * Expose constructors. + */ + +exports.Store = Store; +exports.Cookie = Cookie; +exports.Session = Session; +exports.MemoryStore = MemoryStore; + +/** + * Warning message for `MemoryStore` usage in production. + * @private + */ + +var warning = 'Warning: connect.session() MemoryStore is not\n' + + 'designed for a production environment, as it will leak\n' + + 'memory, and will not scale past a single process.'; + +/** + * Node.js 0.8+ async implementation. + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Setup session store with the given `options`. + * + * @param {Object} [options] + * @param {Object} [options.cookie] Options for cookie + * @param {Function} [options.genid] + * @param {String} [options.name=connect.sid] Session ID cookie name + * @param {Boolean} [options.proxy] + * @param {Boolean} [options.resave] Resave unmodified sessions back to the store + * @param {Boolean} [options.rolling] Enable/disable rolling session expiration + * @param {Boolean} [options.saveUninitialized] Save uninitialized sessions to the store + * @param {String|Array} [options.secret] Secret for signing session ID + * @param {Object} [options.store=MemoryStore] Session store + * @param {String} [options.unset] + * @return {Function} middleware + * @public + */ + +function session(options) { + var opts = options || {} + + // get the cookie options + var cookieOptions = opts.cookie || {} + + // get the session id generate function + var generateId = opts.genid || generateSessionId + + // get the session cookie name + var name = opts.name || opts.key || 'connect.sid' + + // get the session store + var store = opts.store || new MemoryStore() + + // get the trust proxy setting + var trustProxy = opts.proxy + + // get the resave session option + var resaveSession = opts.resave; + + // get the rolling session option + var rollingSessions = Boolean(opts.rolling) + + // get the save uninitialized session option + var saveUninitializedSession = opts.saveUninitialized + + // get the cookie signing secret + var secret = opts.secret + + if (typeof generateId !== 'function') { + throw new TypeError('genid option must be a function'); + } + + if (resaveSession === undefined) { + deprecate('undefined resave option; provide resave option'); + resaveSession = true; + } + + if (saveUninitializedSession === undefined) { + deprecate('undefined saveUninitialized option; provide saveUninitialized option'); + saveUninitializedSession = true; + } + + if (opts.unset && opts.unset !== 'destroy' && opts.unset !== 'keep') { + throw new TypeError('unset option must be "destroy" or "keep"'); + } + + // TODO: switch to "destroy" on next major + var unsetDestroy = opts.unset === 'destroy' + + if (Array.isArray(secret) && secret.length === 0) { + throw new TypeError('secret option array must contain one or more strings'); + } + + if (secret && !Array.isArray(secret)) { + secret = [secret]; + } + + if (!secret) { + deprecate('req.secret; provide secret option'); + } + + // notify user that this store is not + // meant for a production environment + /* istanbul ignore next: not tested */ + if (env === 'production' && store instanceof MemoryStore) { + console.warn(warning); + } + + // generates the new session + store.generate = function(req){ + req.sessionID = generateId(req); + req.session = new Session(req); + req.session.cookie = new Cookie(cookieOptions); + + if (cookieOptions.secure === 'auto') { + req.session.cookie.secure = issecure(req, trustProxy); + } + }; + + var storeImplementsTouch = typeof store.touch === 'function'; + + // register event listeners for the store to track readiness + var storeReady = true + store.on('disconnect', function ondisconnect() { + storeReady = false + }) + store.on('connect', function onconnect() { + storeReady = true + }) + + return function session(req, res, next) { + // self-awareness + if (req.session) { + next() + return + } + + // Handle connection as if there is no session if + // the store has temporarily disconnected etc + if (!storeReady) { + debug('store is disconnected') + next() + return + } + + // pathname mismatch + var originalPath = parseUrl.original(req).pathname || '/' + if (originalPath.indexOf(cookieOptions.path || '/') !== 0) { + debug('pathname mismatch') + next() + return + } + + // ensure a secret is available or bail + if (!secret && !req.secret) { + next(new Error('secret option required for sessions')); + return; + } + + // backwards compatibility for signed cookies + // req.secret is passed from the cookie parser middleware + var secrets = secret || [req.secret]; + + var originalHash; + var originalId; + var savedHash; + var touched = false + + // expose store + req.sessionStore = store; + + // get the session ID from the cookie + var cookieId = req.sessionID = getcookie(req, name, secrets); + + // set-cookie + onHeaders(res, function(){ + if (!req.session) { + debug('no session'); + return; + } + + if (!shouldSetCookie(req)) { + return; + } + + // only send secure cookies via https + if (req.session.cookie.secure && !issecure(req, trustProxy)) { + debug('not secured'); + return; + } + + if (!touched) { + // touch session + req.session.touch() + touched = true + } + + // set cookie + try { + setcookie(res, name, req.sessionID, secrets[0], req.session.cookie.data) + } catch (err) { + defer(next, err) + } + }); + + // proxy end() to commit the session + var _end = res.end; + var _write = res.write; + var ended = false; + res.end = function end(chunk, encoding) { + if (ended) { + return false; + } + + ended = true; + + var ret; + var sync = true; + + function writeend() { + if (sync) { + ret = _end.call(res, chunk, encoding); + sync = false; + return; + } + + _end.call(res); + } + + function writetop() { + if (!sync) { + return ret; + } + + if (!res._header) { + res._implicitHeader() + } + + if (chunk == null) { + ret = true; + return ret; + } + + var contentLength = Number(res.getHeader('Content-Length')); + + if (!isNaN(contentLength) && contentLength > 0) { + // measure chunk + chunk = !Buffer.isBuffer(chunk) + ? Buffer.from(chunk, encoding) + : chunk; + encoding = undefined; + + if (chunk.length !== 0) { + debug('split response'); + ret = _write.call(res, chunk.slice(0, chunk.length - 1)); + chunk = chunk.slice(chunk.length - 1, chunk.length); + return ret; + } + } + + ret = _write.call(res, chunk, encoding); + sync = false; + + return ret; + } + + if (shouldDestroy(req)) { + // destroy session + debug('destroying'); + store.destroy(req.sessionID, function ondestroy(err) { + if (err) { + defer(next, err); + } + + debug('destroyed'); + writeend(); + }); + + return writetop(); + } + + // no session to save + if (!req.session) { + debug('no session'); + return _end.call(res, chunk, encoding); + } + + if (!touched) { + // touch session + req.session.touch() + touched = true + } + + if (shouldSave(req)) { + req.session.save(function onsave(err) { + if (err) { + defer(next, err); + } + + writeend(); + }); + + return writetop(); + } else if (storeImplementsTouch && shouldTouch(req)) { + // store implements touch method + debug('touching'); + store.touch(req.sessionID, req.session, function ontouch(err) { + if (err) { + defer(next, err); + } + + debug('touched'); + writeend(); + }); + + return writetop(); + } + + return _end.call(res, chunk, encoding); + }; + + // generate the session + function generate() { + store.generate(req); + originalId = req.sessionID; + originalHash = hash(req.session); + wrapmethods(req.session); + } + + // inflate the session + function inflate (req, sess) { + store.createSession(req, sess) + originalId = req.sessionID + originalHash = hash(sess) + + if (!resaveSession) { + savedHash = originalHash + } + + wrapmethods(req.session) + } + + function rewrapmethods (sess, callback) { + return function () { + if (req.session !== sess) { + wrapmethods(req.session) + } + + callback.apply(this, arguments) + } + } + + // wrap session methods + function wrapmethods(sess) { + var _reload = sess.reload + var _save = sess.save; + + function reload(callback) { + debug('reloading %s', this.id) + _reload.call(this, rewrapmethods(this, callback)) + } + + function save() { + debug('saving %s', this.id); + savedHash = hash(this); + _save.apply(this, arguments); + } + + Object.defineProperty(sess, 'reload', { + configurable: true, + enumerable: false, + value: reload, + writable: true + }) + + Object.defineProperty(sess, 'save', { + configurable: true, + enumerable: false, + value: save, + writable: true + }); + } + + // check if session has been modified + function isModified(sess) { + return originalId !== sess.id || originalHash !== hash(sess); + } + + // check if session has been saved + function isSaved(sess) { + return originalId === sess.id && savedHash === hash(sess); + } + + // determine if session should be destroyed + function shouldDestroy(req) { + return req.sessionID && unsetDestroy && req.session == null; + } + + // determine if session should be saved to store + function shouldSave(req) { + // cannot set cookie without a session ID + if (typeof req.sessionID !== 'string') { + debug('session ignored because of bogus req.sessionID %o', req.sessionID); + return false; + } + + return !saveUninitializedSession && !savedHash && cookieId !== req.sessionID + ? isModified(req.session) + : !isSaved(req.session) + } + + // determine if session should be touched + function shouldTouch(req) { + // cannot set cookie without a session ID + if (typeof req.sessionID !== 'string') { + debug('session ignored because of bogus req.sessionID %o', req.sessionID); + return false; + } + + return cookieId === req.sessionID && !shouldSave(req); + } + + // determine if cookie should be set on response + function shouldSetCookie(req) { + // cannot set cookie without a session ID + if (typeof req.sessionID !== 'string') { + return false; + } + + return cookieId !== req.sessionID + ? saveUninitializedSession || isModified(req.session) + : rollingSessions || req.session.cookie.expires != null && isModified(req.session); + } + + // generate a session if the browser doesn't send a sessionID + if (!req.sessionID) { + debug('no SID sent, generating session'); + generate(); + next(); + return; + } + + // generate the session object + debug('fetching %s', req.sessionID); + store.get(req.sessionID, function(err, sess){ + // error handling + if (err && err.code !== 'ENOENT') { + debug('error %j', err); + next(err) + return + } + + try { + if (err || !sess) { + debug('no session found') + generate() + } else { + debug('session found') + inflate(req, sess) + } + } catch (e) { + next(e) + return + } + + next() + }); + }; +}; + +/** + * Generate a session ID for a new session. + * + * @return {String} + * @private + */ + +function generateSessionId(sess) { + return uid(24); +} + +/** + * Get the session ID cookie from request. + * + * @return {string} + * @private + */ + +function getcookie(req, name, secrets) { + var header = req.headers.cookie; + var raw; + var val; + + // read from cookie header + if (header) { + var cookies = cookie.parse(header); + + raw = cookies[name]; + + if (raw) { + if (raw.substr(0, 2) === 's:') { + val = unsigncookie(raw.slice(2), secrets); + + if (val === false) { + debug('cookie signature invalid'); + val = undefined; + } + } else { + debug('cookie unsigned') + } + } + } + + // back-compat read from cookieParser() signedCookies data + if (!val && req.signedCookies) { + val = req.signedCookies[name]; + + if (val) { + deprecate('cookie should be available in req.headers.cookie'); + } + } + + // back-compat read from cookieParser() cookies data + if (!val && req.cookies) { + raw = req.cookies[name]; + + if (raw) { + if (raw.substr(0, 2) === 's:') { + val = unsigncookie(raw.slice(2), secrets); + + if (val) { + deprecate('cookie should be available in req.headers.cookie'); + } + + if (val === false) { + debug('cookie signature invalid'); + val = undefined; + } + } else { + debug('cookie unsigned') + } + } + } + + return val; +} + +/** + * Hash the given `sess` object omitting changes to `.cookie`. + * + * @param {Object} sess + * @return {String} + * @private + */ + +function hash(sess) { + // serialize + var str = JSON.stringify(sess, function (key, val) { + // ignore sess.cookie property + if (this === sess && key === 'cookie') { + return + } + + return val + }) + + // hash + return crypto + .createHash('sha1') + .update(str, 'utf8') + .digest('hex') +} + +/** + * Determine if request is secure. + * + * @param {Object} req + * @param {Boolean} [trustProxy] + * @return {Boolean} + * @private + */ + +function issecure(req, trustProxy) { + // socket is https server + if (req.connection && req.connection.encrypted) { + return true; + } + + // do not trust proxy + if (trustProxy === false) { + return false; + } + + // no explicit trust; try req.secure from express + if (trustProxy !== true) { + return req.secure === true + } + + // read the proto from x-forwarded-proto header + var header = req.headers['x-forwarded-proto'] || ''; + var index = header.indexOf(','); + var proto = index !== -1 + ? header.substr(0, index).toLowerCase().trim() + : header.toLowerCase().trim() + + return proto === 'https'; +} + +/** + * Set cookie on response. + * + * @private + */ + +function setcookie(res, name, val, secret, options) { + var signed = 's:' + signature.sign(val, secret); + var data = cookie.serialize(name, signed, options); + + debug('set-cookie %s', data); + + var prev = res.getHeader('Set-Cookie') || [] + var header = Array.isArray(prev) ? prev.concat(data) : [prev, data]; + + res.setHeader('Set-Cookie', header) +} + +/** + * Verify and decode the given `val` with `secrets`. + * + * @param {String} val + * @param {Array} secrets + * @returns {String|Boolean} + * @private + */ +function unsigncookie(val, secrets) { + for (var i = 0; i < secrets.length; i++) { + var result = signature.unsign(val, secrets[i]); + + if (result !== false) { + return result; + } + } + + return false; +} diff --git a/node_modules/express-session/node_modules/cookie-signature/History.md b/node_modules/express-session/node_modules/cookie-signature/History.md new file mode 100644 index 0000000..bcf8cc9 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie-signature/History.md @@ -0,0 +1,42 @@ +1.0.7 / 2023-04-12 +================== + +* backport the buffer support from the 1.2.x release branch (thanks @FadhiliNjagi!) + +1.0.6 / 2015-02-03 +================== + +* use `npm test` instead of `make test` to run tests +* clearer assertion messages when checking input + +1.0.5 / 2014-09-05 +================== + +* add license to package.json + +1.0.4 / 2014-06-25 +================== + + * corrected avoidance of timing attacks (thanks @tenbits!) + +1.0.3 / 2014-01-28 +================== + + * [incorrect] fix for timing attacks + +1.0.2 / 2014-01-28 +================== + + * fix missing repository warning + * fix typo in test + +1.0.1 / 2013-04-15 +================== + + * Revert "Changed underlying HMAC algo. to sha512." + * Revert "Fix for timing attacks on MAC verification." + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/express-session/node_modules/cookie-signature/Readme.md b/node_modules/express-session/node_modules/cookie-signature/Readme.md new file mode 100644 index 0000000..2559e84 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie-signature/Readme.md @@ -0,0 +1,42 @@ + +# cookie-signature + + Sign and unsign cookies. + +## Example + +```js +var cookie = require('cookie-signature'); + +var val = cookie.sign('hello', 'tobiiscool'); +val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI'); + +var val = cookie.sign('hello', 'tobiiscool'); +cookie.unsign(val, 'tobiiscool').should.equal('hello'); +cookie.unsign(val, 'luna').should.be.false; +``` + +## License + +(The MIT License) + +Copyright (c) 2012 LearnBoost <tj@learnboost.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/express-session/node_modules/cookie-signature/index.js b/node_modules/express-session/node_modules/cookie-signature/index.js new file mode 100644 index 0000000..336d487 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie-signature/index.js @@ -0,0 +1,51 @@ +/** + * Module dependencies. + */ + +var crypto = require('crypto'); + +/** + * Sign the given `val` with `secret`. + * + * @param {String} val + * @param {String|NodeJS.ArrayBufferView|crypto.KeyObject} secret + * @return {String} + * @api private + */ + +exports.sign = function(val, secret){ + if ('string' !== typeof val) throw new TypeError("Cookie value must be provided as a string."); + if (null == secret) throw new TypeError("Secret key must be provided."); + return val + '.' + crypto + .createHmac('sha256', secret) + .update(val) + .digest('base64') + .replace(/\=+$/, ''); +}; + +/** + * Unsign and decode the given `val` with `secret`, + * returning `false` if the signature is invalid. + * + * @param {String} val + * @param {String|NodeJS.ArrayBufferView|crypto.KeyObject} secret + * @return {String|Boolean} + * @api private + */ + +exports.unsign = function(val, secret){ + if ('string' !== typeof val) throw new TypeError("Signed cookie string must be provided."); + if (null == secret) throw new TypeError("Secret key must be provided."); + var str = val.slice(0, val.lastIndexOf('.')) + , mac = exports.sign(str, secret); + + return sha1(mac) == sha1(val) ? str : false; +}; + +/** + * Private + */ + +function sha1(str){ + return crypto.createHash('sha1').update(str).digest('hex'); +} diff --git a/node_modules/express-session/node_modules/cookie-signature/package.json b/node_modules/express-session/node_modules/cookie-signature/package.json new file mode 100644 index 0000000..738487b --- /dev/null +++ b/node_modules/express-session/node_modules/cookie-signature/package.json @@ -0,0 +1,18 @@ +{ + "name": "cookie-signature", + "version": "1.0.7", + "description": "Sign and unsign cookies", + "keywords": ["cookie", "sign", "unsign"], + "author": "TJ Holowaychuk <tj@learnboost.com>", + "license": "MIT", + "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"}, + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "scripts": { + "test": "mocha --require should --reporter spec" + }, + "main": "index" +} \ No newline at end of file diff --git a/node_modules/express-session/node_modules/cookie/LICENSE b/node_modules/express-session/node_modules/cookie/LICENSE new file mode 100644 index 0000000..058b6b4 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012-2014 Roman Shtylman <shtylman@gmail.com> +Copyright (c) 2015 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/express-session/node_modules/cookie/README.md b/node_modules/express-session/node_modules/cookie/README.md new file mode 100644 index 0000000..71fdac1 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie/README.md @@ -0,0 +1,317 @@ +# cookie + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][ci-image]][ci-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Basic HTTP cookie parser and serializer for HTTP servers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install cookie +``` + +## API + +```js +var cookie = require('cookie'); +``` + +### cookie.parse(str, options) + +Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs. +The `str` argument is the string representing a `Cookie` header value and `options` is an +optional object containing additional parsing options. + +```js +var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2'); +// { foo: 'bar', equation: 'E=mc^2' } +``` + +#### Options + +`cookie.parse` accepts these properties in the options object. + +##### decode + +Specifies a function that will be used to decode a cookie's value. Since the value of a cookie +has a limited character set (and must be a simple string), this function can be used to decode +a previously-encoded cookie value into a JavaScript string or other object. + +The default function is the global `decodeURIComponent`, which will decode any URL-encoded +sequences into their byte representations. + +**note** if an error is thrown from this function, the original, non-decoded cookie value will +be returned as the cookie's value. + +### cookie.serialize(name, value, options) + +Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the +name for the cookie, the `value` argument is the value to set the cookie to, and the `options` +argument is an optional object containing additional serialization options. + +```js +var setCookie = cookie.serialize('foo', 'bar'); +// foo=bar +``` + +#### Options + +`cookie.serialize` accepts these properties in the options object. + +##### domain + +Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no +domain is set, and most clients will consider the cookie to apply to only the current domain. + +##### encode + +Specifies a function that will be used to encode a cookie's value. Since value of a cookie +has a limited character set (and must be a simple string), this function can be used to encode +a value into a string suited for a cookie's value. + +The default function is the global `encodeURIComponent`, which will encode a JavaScript string +into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range. + +##### expires + +Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1]. +By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and +will delete it on a condition like exiting a web browser application. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### httpOnly + +Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy, +the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not allow client-side +JavaScript to see the cookie in `document.cookie`. + +##### maxAge + +Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2]. +The given number will be converted to an integer by rounding down. By default, no maximum age is set. + +**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and +`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this, +so if both are set, they should point to the same date and time. + +##### partitioned + +Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies) +attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the +`Partitioned` attribute is not set. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +More information about can be found in [the proposal](https://github.com/privacycg/CHIPS). + +##### path + +Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path +is considered the ["default path"][rfc-6265-5.1.4]. + +##### priority + +Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1]. + + - `'low'` will set the `Priority` attribute to `Low`. + - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set. + - `'high'` will set the `Priority` attribute to `High`. + +More information about the different priority levels can be found in +[the specification][rfc-west-cookie-priority-00-4.1]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### sameSite + +Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7]. + + - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + - `false` will not set the `SameSite` attribute. + - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement. + - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie. + - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement. + +More information about the different enforcement levels can be found in +[the specification][rfc-6265bis-09-5.4.7]. + +**note** This is an attribute that has not yet been fully standardized, and may change in the future. +This also means many clients may ignore this attribute until they understand it. + +##### secure + +Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy, +the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set. + +**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to +the server in the future if the browser does not have an HTTPS connection. + +## Example + +The following example uses this module in conjunction with the Node.js core HTTP server +to prompt a user for their name and display it back on future visits. + +```js +var cookie = require('cookie'); +var escapeHtml = require('escape-html'); +var http = require('http'); +var url = require('url'); + +function onRequest(req, res) { + // Parse the query string + var query = url.parse(req.url, true, true).query; + + if (query && query.name) { + // Set a new cookie with the name + res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), { + httpOnly: true, + maxAge: 60 * 60 * 24 * 7 // 1 week + })); + + // Redirect back after setting cookie + res.statusCode = 302; + res.setHeader('Location', req.headers.referer || '/'); + res.end(); + return; + } + + // Parse the cookies on the request + var cookies = cookie.parse(req.headers.cookie || ''); + + // Get the visitor name set in the cookie + var name = cookies.name; + + res.setHeader('Content-Type', 'text/html; charset=UTF-8'); + + if (name) { + res.write('<p>Welcome back, <b>' + escapeHtml(name) + '</b>!</p>'); + } else { + res.write('<p>Hello, new visitor!</p>'); + } + + res.write('<form method="GET">'); + res.write('<input placeholder="enter your name" name="name"> <input type="submit" value="Set Name">'); + res.end('</form>'); +} + +http.createServer(onRequest).listen(3000); +``` + +## Testing + +```sh +$ npm test +``` + +## Benchmark + +``` +$ npm run bench + +> cookie@0.5.0 bench +> node benchmark/index.js + + node@18.18.2 + acorn@8.10.0 + ada@2.6.0 + ares@1.19.1 + brotli@1.0.9 + cldr@43.1 + icu@73.2 + llhttp@6.0.11 + modules@108 + napi@9 + nghttp2@1.57.0 + nghttp3@0.7.0 + ngtcp2@0.8.1 + openssl@3.0.10+quic + simdutf@3.2.14 + tz@2023c + undici@5.26.3 + unicode@15.0 + uv@1.44.2 + uvwasi@0.0.18 + v8@10.2.154.26-node.26 + zlib@1.2.13.1-motley + +> node benchmark/parse-top.js + + cookie.parse - top sites + + 14 tests completed. + + parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled) + parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled) + parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled) + parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled) + parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled) + parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled) + parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled) + parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled) + parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled) + parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled) + parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled) + parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled) + parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled) + parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled) + +> node benchmark/parse.js + + cookie.parse - generic + + 6 tests completed. + + simple x 3,214,032 ops/sec ±1.61% (183 runs sampled) + decode x 587,237 ops/sec ±1.16% (187 runs sampled) + unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled) + duplicates x 857,008 ops/sec ±0.89% (187 runs sampled) + 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled) + 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled) +``` + +## References + +- [RFC 6265: HTTP State Management Mechanism][rfc-6265] +- [Same-site Cookies][rfc-6265bis-09-5.4.7] + +[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/ +[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1 +[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7 +[rfc-6265]: https://tools.ietf.org/html/rfc6265 +[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4 +[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1 +[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2 +[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3 +[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4 +[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5 +[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6 +[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3 + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci +[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master +[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master +[node-image]: https://badgen.net/npm/node/cookie +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/cookie +[npm-url]: https://npmjs.org/package/cookie +[npm-version-image]: https://badgen.net/npm/v/cookie diff --git a/node_modules/express-session/node_modules/cookie/SECURITY.md b/node_modules/express-session/node_modules/cookie/SECURITY.md new file mode 100644 index 0000000..fd4a6c5 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The `cookie` team and community take all security bugs seriously. Thank +you for improving the security of the project. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `cookie`. This +information can be found in the npm registry using the command +`npm owner ls cookie`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/jshttp/cookie/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/node_modules/express-session/node_modules/cookie/index.js b/node_modules/express-session/node_modules/cookie/index.js new file mode 100644 index 0000000..acd5acd --- /dev/null +++ b/node_modules/express-session/node_modules/cookie/index.js @@ -0,0 +1,335 @@ +/*! + * cookie + * Copyright(c) 2012-2014 Roman Shtylman + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +exports.parse = parse; +exports.serialize = serialize; + +/** + * Module variables. + * @private + */ + +var __toString = Object.prototype.toString +var __hasOwnProperty = Object.prototype.hasOwnProperty + +/** + * RegExp to match cookie-name in RFC 6265 sec 4.1.1 + * This refers out to the obsoleted definition of token in RFC 2616 sec 2.2 + * which has been replaced by the token definition in RFC 7230 appendix B. + * + * cookie-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / + * "*" / "+" / "-" / "." / "^" / "_" / + * "`" / "|" / "~" / DIGIT / ALPHA + */ + +var cookieNameRegExp = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/; + +/** + * RegExp to match cookie-value in RFC 6265 sec 4.1.1 + * + * cookie-value = *cookie-octet / ( DQUOTE *cookie-octet DQUOTE ) + * cookie-octet = %x21 / %x23-2B / %x2D-3A / %x3C-5B / %x5D-7E + * ; US-ASCII characters excluding CTLs, + * ; whitespace DQUOTE, comma, semicolon, + * ; and backslash + */ + +var cookieValueRegExp = /^("?)[\u0021\u0023-\u002B\u002D-\u003A\u003C-\u005B\u005D-\u007E]*\1$/; + +/** + * RegExp to match domain-value in RFC 6265 sec 4.1.1 + * + * domain-value = <subdomain> + * ; defined in [RFC1034], Section 3.5, as + * ; enhanced by [RFC1123], Section 2.1 + * <subdomain> = <label> | <subdomain> "." <label> + * <label> = <let-dig> [ [ <ldh-str> ] <let-dig> ] + * Labels must be 63 characters or less. + * 'let-dig' not 'letter' in the first char, per RFC1123 + * <ldh-str> = <let-dig-hyp> | <let-dig-hyp> <ldh-str> + * <let-dig-hyp> = <let-dig> | "-" + * <let-dig> = <letter> | <digit> + * <letter> = any one of the 52 alphabetic characters A through Z in + * upper case and a through z in lower case + * <digit> = any one of the ten digits 0 through 9 + * + * Keep support for leading dot: https://github.com/jshttp/cookie/issues/173 + * + * > (Note that a leading %x2E ("."), if present, is ignored even though that + * character is not permitted, but a trailing %x2E ("."), if present, will + * cause the user agent to ignore the attribute.) + */ + +var domainValueRegExp = /^([.]?[a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)([.][a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)*$/i; + +/** + * RegExp to match path-value in RFC 6265 sec 4.1.1 + * + * path-value = <any CHAR except CTLs or ";"> + * CHAR = %x01-7F + * ; defined in RFC 5234 appendix B.1 + */ + +var pathValueRegExp = /^[\u0020-\u003A\u003D-\u007E]*$/; + +/** + * Parse a cookie header. + * + * Parse the given cookie header string into an object + * The object has the various cookies as keys(names) => values + * + * @param {string} str + * @param {object} [opt] + * @return {object} + * @public + */ + +function parse(str, opt) { + if (typeof str !== 'string') { + throw new TypeError('argument str must be a string'); + } + + var obj = {}; + var len = str.length; + // RFC 6265 sec 4.1.1, RFC 2616 2.2 defines a cookie name consists of one char minimum, plus '='. + if (len < 2) return obj; + + var dec = (opt && opt.decode) || decode; + var index = 0; + var eqIdx = 0; + var endIdx = 0; + + do { + eqIdx = str.indexOf('=', index); + if (eqIdx === -1) break; // No more cookie pairs. + + endIdx = str.indexOf(';', index); + + if (endIdx === -1) { + endIdx = len; + } else if (eqIdx > endIdx) { + // backtrack on prior semicolon + index = str.lastIndexOf(';', eqIdx - 1) + 1; + continue; + } + + var keyStartIdx = startIndex(str, index, eqIdx); + var keyEndIdx = endIndex(str, eqIdx, keyStartIdx); + var key = str.slice(keyStartIdx, keyEndIdx); + + // only assign once + if (!__hasOwnProperty.call(obj, key)) { + var valStartIdx = startIndex(str, eqIdx + 1, endIdx); + var valEndIdx = endIndex(str, endIdx, valStartIdx); + + if (str.charCodeAt(valStartIdx) === 0x22 /* " */ && str.charCodeAt(valEndIdx - 1) === 0x22 /* " */) { + valStartIdx++; + valEndIdx--; + } + + var val = str.slice(valStartIdx, valEndIdx); + obj[key] = tryDecode(val, dec); + } + + index = endIdx + 1 + } while (index < len); + + return obj; +} + +function startIndex(str, index, max) { + do { + var code = str.charCodeAt(index); + if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index; + } while (++index < max); + return max; +} + +function endIndex(str, index, min) { + while (index > min) { + var code = str.charCodeAt(--index); + if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index + 1; + } + return min; +} + +/** + * Serialize data into a cookie header. + * + * Serialize a name value pair into a cookie string suitable for + * http headers. An optional options object specifies cookie parameters. + * + * serialize('foo', 'bar', { httpOnly: true }) + * => "foo=bar; httpOnly" + * + * @param {string} name + * @param {string} val + * @param {object} [opt] + * @return {string} + * @public + */ + +function serialize(name, val, opt) { + var enc = (opt && opt.encode) || encodeURIComponent; + + if (typeof enc !== 'function') { + throw new TypeError('option encode is invalid'); + } + + if (!cookieNameRegExp.test(name)) { + throw new TypeError('argument name is invalid'); + } + + var value = enc(val); + + if (!cookieValueRegExp.test(value)) { + throw new TypeError('argument val is invalid'); + } + + var str = name + '=' + value; + if (!opt) return str; + + if (null != opt.maxAge) { + var maxAge = Math.floor(opt.maxAge); + + if (!isFinite(maxAge)) { + throw new TypeError('option maxAge is invalid') + } + + str += '; Max-Age=' + maxAge; + } + + if (opt.domain) { + if (!domainValueRegExp.test(opt.domain)) { + throw new TypeError('option domain is invalid'); + } + + str += '; Domain=' + opt.domain; + } + + if (opt.path) { + if (!pathValueRegExp.test(opt.path)) { + throw new TypeError('option path is invalid'); + } + + str += '; Path=' + opt.path; + } + + if (opt.expires) { + var expires = opt.expires + + if (!isDate(expires) || isNaN(expires.valueOf())) { + throw new TypeError('option expires is invalid'); + } + + str += '; Expires=' + expires.toUTCString() + } + + if (opt.httpOnly) { + str += '; HttpOnly'; + } + + if (opt.secure) { + str += '; Secure'; + } + + if (opt.partitioned) { + str += '; Partitioned' + } + + if (opt.priority) { + var priority = typeof opt.priority === 'string' + ? opt.priority.toLowerCase() : opt.priority; + + switch (priority) { + case 'low': + str += '; Priority=Low' + break + case 'medium': + str += '; Priority=Medium' + break + case 'high': + str += '; Priority=High' + break + default: + throw new TypeError('option priority is invalid') + } + } + + if (opt.sameSite) { + var sameSite = typeof opt.sameSite === 'string' + ? opt.sameSite.toLowerCase() : opt.sameSite; + + switch (sameSite) { + case true: + str += '; SameSite=Strict'; + break; + case 'lax': + str += '; SameSite=Lax'; + break; + case 'strict': + str += '; SameSite=Strict'; + break; + case 'none': + str += '; SameSite=None'; + break; + default: + throw new TypeError('option sameSite is invalid'); + } + } + + return str; +} + +/** + * URL-decode string value. Optimized to skip native call when no %. + * + * @param {string} str + * @returns {string} + */ + +function decode (str) { + return str.indexOf('%') !== -1 + ? decodeURIComponent(str) + : str +} + +/** + * Determine if value is a Date. + * + * @param {*} val + * @private + */ + +function isDate (val) { + return __toString.call(val) === '[object Date]'; +} + +/** + * Try decoding a string using a decoding function. + * + * @param {string} str + * @param {function} decode + * @private + */ + +function tryDecode(str, decode) { + try { + return decode(str); + } catch (e) { + return str; + } +} diff --git a/node_modules/express-session/node_modules/cookie/package.json b/node_modules/express-session/node_modules/cookie/package.json new file mode 100644 index 0000000..22e3f92 --- /dev/null +++ b/node_modules/express-session/node_modules/cookie/package.json @@ -0,0 +1,44 @@ +{ + "name": "cookie", + "description": "HTTP server cookie parsing and serialization", + "version": "0.7.2", + "author": "Roman Shtylman <shtylman@gmail.com>", + "contributors": [ + "Douglas Christopher Wilson <doug@somethingdoug.com>" + ], + "license": "MIT", + "keywords": [ + "cookie", + "cookies" + ], + "repository": "jshttp/cookie", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "8.53.0", + "eslint-plugin-markdown": "3.0.1", + "mocha": "10.2.0", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "top-sites": "1.1.194" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "SECURITY.md", + "index.js" + ], + "main": "index.js", + "engines": { + "node": ">= 0.6" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "update-bench": "node scripts/update-benchmark.js" + } +} diff --git a/node_modules/express-session/package.json b/node_modules/express-session/package.json new file mode 100644 index 0000000..e332243 --- /dev/null +++ b/node_modules/express-session/package.json @@ -0,0 +1,47 @@ +{ + "name": "express-session", + "version": "1.18.1", + "description": "Simple session middleware for Express", + "author": "TJ Holowaychuk <tj@vision-media.ca> (http://tjholowaychuk.com)", + "contributors": [ + "Douglas Christopher Wilson <doug@somethingdoug.com>", + "Joe Wagner <njwjs722@gmail.com>" + ], + "repository": "expressjs/session", + "license": "MIT", + "dependencies": { + "cookie": "0.7.2", + "cookie-signature": "1.0.7", + "debug": "2.6.9", + "depd": "~2.0.0", + "on-headers": "~1.0.2", + "parseurl": "~1.3.3", + "safe-buffer": "5.2.1", + "uid-safe": "~2.1.5" + }, + "devDependencies": { + "after": "0.8.2", + "cookie-parser": "1.4.6", + "eslint": "8.56.0", + "eslint-plugin-markdown": "3.0.1", + "express": "4.17.3", + "mocha": "10.2.0", + "nyc": "15.1.0", + "supertest": "6.3.4" + }, + "files": [ + "session/", + "HISTORY.md", + "index.js" + ], + "engines": { + "node": ">= 0.8.0" + }, + "scripts": { + "lint": "eslint . && node ./scripts/lint-readme.js", + "test": "mocha --require test/support/env --check-leaks --bail --no-exit --reporter spec test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/express-session/session/cookie.js b/node_modules/express-session/session/cookie.js new file mode 100644 index 0000000..8bb5907 --- /dev/null +++ b/node_modules/express-session/session/cookie.js @@ -0,0 +1,152 @@ +/*! + * Connect - session - Cookie + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + */ + +var cookie = require('cookie') +var deprecate = require('depd')('express-session') + +/** + * Initialize a new `Cookie` with the given `options`. + * + * @param {IncomingMessage} req + * @param {Object} options + * @api private + */ + +var Cookie = module.exports = function Cookie(options) { + this.path = '/'; + this.maxAge = null; + this.httpOnly = true; + + if (options) { + if (typeof options !== 'object') { + throw new TypeError('argument options must be a object') + } + + for (var key in options) { + if (key !== 'data') { + this[key] = options[key] + } + } + } + + if (this.originalMaxAge === undefined || this.originalMaxAge === null) { + this.originalMaxAge = this.maxAge + } +}; + +/*! + * Prototype. + */ + +Cookie.prototype = { + + /** + * Set expires `date`. + * + * @param {Date} date + * @api public + */ + + set expires(date) { + this._expires = date; + this.originalMaxAge = this.maxAge; + }, + + /** + * Get expires `date`. + * + * @return {Date} + * @api public + */ + + get expires() { + return this._expires; + }, + + /** + * Set expires via max-age in `ms`. + * + * @param {Number} ms + * @api public + */ + + set maxAge(ms) { + if (ms && typeof ms !== 'number' && !(ms instanceof Date)) { + throw new TypeError('maxAge must be a number or Date') + } + + if (ms instanceof Date) { + deprecate('maxAge as Date; pass number of milliseconds instead') + } + + this.expires = typeof ms === 'number' + ? new Date(Date.now() + ms) + : ms; + }, + + /** + * Get expires max-age in `ms`. + * + * @return {Number} + * @api public + */ + + get maxAge() { + return this.expires instanceof Date + ? this.expires.valueOf() - Date.now() + : this.expires; + }, + + /** + * Return cookie data object. + * + * @return {Object} + * @api private + */ + + get data() { + return { + originalMaxAge: this.originalMaxAge, + partitioned: this.partitioned, + priority: this.priority + , expires: this._expires + , secure: this.secure + , httpOnly: this.httpOnly + , domain: this.domain + , path: this.path + , sameSite: this.sameSite + } + }, + + /** + * Return a serialized cookie string. + * + * @return {String} + * @api public + */ + + serialize: function(name, val){ + return cookie.serialize(name, val, this.data); + }, + + /** + * Return JSON representation of this cookie. + * + * @return {Object} + * @api private + */ + + toJSON: function(){ + return this.data; + } +}; diff --git a/node_modules/express-session/session/memory.js b/node_modules/express-session/session/memory.js new file mode 100644 index 0000000..11ed686 --- /dev/null +++ b/node_modules/express-session/session/memory.js @@ -0,0 +1,187 @@ +/*! + * express-session + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Store = require('./store') +var util = require('util') + +/** + * Shim setImmediate for node.js < 0.10 + * @private + */ + +/* istanbul ignore next */ +var defer = typeof setImmediate === 'function' + ? setImmediate + : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) } + +/** + * Module exports. + */ + +module.exports = MemoryStore + +/** + * A session store in memory. + * @public + */ + +function MemoryStore() { + Store.call(this) + this.sessions = Object.create(null) +} + +/** + * Inherit from Store. + */ + +util.inherits(MemoryStore, Store) + +/** + * Get all active sessions. + * + * @param {function} callback + * @public + */ + +MemoryStore.prototype.all = function all(callback) { + var sessionIds = Object.keys(this.sessions) + var sessions = Object.create(null) + + for (var i = 0; i < sessionIds.length; i++) { + var sessionId = sessionIds[i] + var session = getSession.call(this, sessionId) + + if (session) { + sessions[sessionId] = session; + } + } + + callback && defer(callback, null, sessions) +} + +/** + * Clear all sessions. + * + * @param {function} callback + * @public + */ + +MemoryStore.prototype.clear = function clear(callback) { + this.sessions = Object.create(null) + callback && defer(callback) +} + +/** + * Destroy the session associated with the given session ID. + * + * @param {string} sessionId + * @public + */ + +MemoryStore.prototype.destroy = function destroy(sessionId, callback) { + delete this.sessions[sessionId] + callback && defer(callback) +} + +/** + * Fetch session by the given session ID. + * + * @param {string} sessionId + * @param {function} callback + * @public + */ + +MemoryStore.prototype.get = function get(sessionId, callback) { + defer(callback, null, getSession.call(this, sessionId)) +} + +/** + * Commit the given session associated with the given sessionId to the store. + * + * @param {string} sessionId + * @param {object} session + * @param {function} callback + * @public + */ + +MemoryStore.prototype.set = function set(sessionId, session, callback) { + this.sessions[sessionId] = JSON.stringify(session) + callback && defer(callback) +} + +/** + * Get number of active sessions. + * + * @param {function} callback + * @public + */ + +MemoryStore.prototype.length = function length(callback) { + this.all(function (err, sessions) { + if (err) return callback(err) + callback(null, Object.keys(sessions).length) + }) +} + +/** + * Touch the given session object associated with the given session ID. + * + * @param {string} sessionId + * @param {object} session + * @param {function} callback + * @public + */ + +MemoryStore.prototype.touch = function touch(sessionId, session, callback) { + var currentSession = getSession.call(this, sessionId) + + if (currentSession) { + // update expiration + currentSession.cookie = session.cookie + this.sessions[sessionId] = JSON.stringify(currentSession) + } + + callback && defer(callback) +} + +/** + * Get session from the store. + * @private + */ + +function getSession(sessionId) { + var sess = this.sessions[sessionId] + + if (!sess) { + return + } + + // parse + sess = JSON.parse(sess) + + if (sess.cookie) { + var expires = typeof sess.cookie.expires === 'string' + ? new Date(sess.cookie.expires) + : sess.cookie.expires + + // destroy expired session + if (expires && expires <= Date.now()) { + delete this.sessions[sessionId] + return + } + } + + return sess +} diff --git a/node_modules/express-session/session/session.js b/node_modules/express-session/session/session.js new file mode 100644 index 0000000..fee7608 --- /dev/null +++ b/node_modules/express-session/session/session.js @@ -0,0 +1,143 @@ +/*! + * Connect - session - Session + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +'use strict'; + +/** + * Expose Session. + */ + +module.exports = Session; + +/** + * Create a new `Session` with the given request and `data`. + * + * @param {IncomingRequest} req + * @param {Object} data + * @api private + */ + +function Session(req, data) { + Object.defineProperty(this, 'req', { value: req }); + Object.defineProperty(this, 'id', { value: req.sessionID }); + + if (typeof data === 'object' && data !== null) { + // merge data into this, ignoring prototype properties + for (var prop in data) { + if (!(prop in this)) { + this[prop] = data[prop] + } + } + } +} + +/** + * Update reset `.cookie.maxAge` to prevent + * the cookie from expiring when the + * session is still active. + * + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'touch', function touch() { + return this.resetMaxAge(); +}); + +/** + * Reset `.maxAge` to `.originalMaxAge`. + * + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'resetMaxAge', function resetMaxAge() { + this.cookie.maxAge = this.cookie.originalMaxAge; + return this; +}); + +/** + * Save the session data with optional callback `fn(err)`. + * + * @param {Function} fn + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'save', function save(fn) { + this.req.sessionStore.set(this.id, this, fn || function(){}); + return this; +}); + +/** + * Re-loads the session data _without_ altering + * the maxAge properties. Invokes the callback `fn(err)`, + * after which time if no exception has occurred the + * `req.session` property will be a new `Session` object, + * although representing the same session. + * + * @param {Function} fn + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'reload', function reload(fn) { + var req = this.req + var store = this.req.sessionStore + + store.get(this.id, function(err, sess){ + if (err) return fn(err); + if (!sess) return fn(new Error('failed to load session')); + store.createSession(req, sess); + fn(); + }); + return this; +}); + +/** + * Destroy `this` session. + * + * @param {Function} fn + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'destroy', function destroy(fn) { + delete this.req.session; + this.req.sessionStore.destroy(this.id, fn); + return this; +}); + +/** + * Regenerate this request's session. + * + * @param {Function} fn + * @return {Session} for chaining + * @api public + */ + +defineMethod(Session.prototype, 'regenerate', function regenerate(fn) { + this.req.sessionStore.regenerate(this.req, fn); + return this; +}); + +/** + * Helper function for creating a method on a prototype. + * + * @param {Object} obj + * @param {String} name + * @param {Function} fn + * @private + */ +function defineMethod(obj, name, fn) { + Object.defineProperty(obj, name, { + configurable: true, + enumerable: false, + value: fn, + writable: true + }); +}; diff --git a/node_modules/express-session/session/store.js b/node_modules/express-session/session/store.js new file mode 100644 index 0000000..3793877 --- /dev/null +++ b/node_modules/express-session/session/store.js @@ -0,0 +1,102 @@ +/*! + * Connect - session - Store + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * MIT Licensed + */ + +'use strict'; + +/** + * Module dependencies. + * @private + */ + +var Cookie = require('./cookie') +var EventEmitter = require('events').EventEmitter +var Session = require('./session') +var util = require('util') + +/** + * Module exports. + * @public + */ + +module.exports = Store + +/** + * Abstract base class for session stores. + * @public + */ + +function Store () { + EventEmitter.call(this) +} + +/** + * Inherit from EventEmitter. + */ + +util.inherits(Store, EventEmitter) + +/** + * Re-generate the given requests's session. + * + * @param {IncomingRequest} req + * @return {Function} fn + * @api public + */ + +Store.prototype.regenerate = function(req, fn){ + var self = this; + this.destroy(req.sessionID, function(err){ + self.generate(req); + fn(err); + }); +}; + +/** + * Load a `Session` instance via the given `sid` + * and invoke the callback `fn(err, sess)`. + * + * @param {String} sid + * @param {Function} fn + * @api public + */ + +Store.prototype.load = function(sid, fn){ + var self = this; + this.get(sid, function(err, sess){ + if (err) return fn(err); + if (!sess) return fn(); + var req = { sessionID: sid, sessionStore: self }; + fn(null, self.createSession(req, sess)) + }); +}; + +/** + * Create session from JSON `sess` data. + * + * @param {IncomingRequest} req + * @param {Object} sess + * @return {Session} + * @api private + */ + +Store.prototype.createSession = function(req, sess){ + var expires = sess.cookie.expires + var originalMaxAge = sess.cookie.originalMaxAge + + sess.cookie = new Cookie(sess.cookie); + + if (typeof expires === 'string') { + // convert expires to a Date object + sess.cookie.expires = new Date(expires) + } + + // keep originalMaxAge intact + sess.cookie.originalMaxAge = originalMaxAge + + req.session = new Session(req, sess); + return req.session; +}; diff --git a/node_modules/kruptein/.test/vanilla.js b/node_modules/kruptein/.test/vanilla.js new file mode 100644 index 0000000..084a8a5 --- /dev/null +++ b/node_modules/kruptein/.test/vanilla.js @@ -0,0 +1,84 @@ +"use strict"; + +const crypto = require('crypto'); + +let secret = "squirrel", kruptein, + ciphers = [], hashes = [], + encoding = ['binary', 'hex', 'base64'], + phrases = [ + "Secret Squirrel", + "écureuil secret", + "गà¥à¤ªà¥à¤¤ गिलहरी", + "ਗà©à¨ªà¨¤ ਗਿੱਠੀ", + "veveriÈ›a secretă", + "ÑÐµÐºÑ€ÐµÑ‚Ð½Ð°Ñ Ð±ÐµÐ»ÐºÐ°", + "leyndur Ãkorna", + "السنجاب السري", + "Õ£Õ¡Õ²Õ¿Õ¶Õ« Õ½Õ¯ÕµÕ¸Ö‚Õ¼", + "feòrag dìomhair", + "গোপন কাঠবিড়ালি", + "秘密ã®ãƒªã‚¹", + "Ñ‚Ð°ÐµÐ¼Ð½Ð°Ñ Ð²Ð°Ð²Ñ‘Ñ€ÐºÐ°", + ]; + + +const options = { + use_scrypt: true, + use_asn1: true +}; + + +// Filter getCiphers() +ciphers = crypto.getCiphers().filter(cipher => { + if (cipher.match(/^aes/i) && cipher.match(/256/i)&& !cipher.match(/hmac|wrap|ccm|ecb/)) + return cipher; +}); + + +// Filter getHashes() +hashes = crypto.getHashes().filter(hash => { + if (hash.match(/^sha[2-5]/i) && !hash.match(/rsa/i)) + return hash; +}); + + +for (let cipher in ciphers) { + options.algorithm = ciphers[cipher]; + + for (let hash in hashes) { + options.hashing = hashes[hash]; + + for (let enc in encoding) { + options.encodeas = encoding[enc]; + + kruptein = require("../index.js")(options); + + console.log('kruptein: { algorithm: "'+options.algorithm+'", hashing: "'+options.hashing+'", encodeas: "'+options.encodeas+'" }'); + let ct, pt; + + for (let phrase in phrases) { + + console.log(phrases[phrase]) + + kruptein.set(secret, phrases[phrase], (err, res) => { + if (err) + console.log(err); + + ct = res; + }); + + console.log(ct); + + kruptein.get(secret, ct, (err, res) => { + if (err) + console.log(err); + + pt = res; + }); + + console.log(pt); + console.log(""); + } + } + } +} diff --git a/node_modules/kruptein/CONTRIBUTING.md b/node_modules/kruptein/CONTRIBUTING.md new file mode 100644 index 0000000..4135a2a --- /dev/null +++ b/node_modules/kruptein/CONTRIBUTING.md @@ -0,0 +1,107 @@ +Contributing to kruptein +======================== + +Code Contributions +------------------ +This document will guide you through the contribution process. + +Step 1: Fork +------------ +Fork the project [on GitHub](https://github.com/jas-/kruptein) and check out your +copy locally. + +```text +$ git clone git@github.com:username/kruptein.git +$ cd node +$ git remote add upstream git://github.com/jas-/kruptein.git +``` + +Keep your local fork update to date using the `upstream` branch indicated in +the above commands. + +Choose branch +------------- +For developing new features and bug fixes, the `master` branch should be pulled +and built upon. + +Step 2: Branch +-------------- +Create a feature branch and start hacking: + +```text +$ git checkout -b my-feature-branch -t origin/master +``` + +The branch name should be descriptive about the fixes/features it will +address. + +Step 3: Commit +-------------- +Make sure git knows your name and email address: + +```text +$ git config --global user.name "J. Random User" +$ git config --global user.email "j.random.user@example.com" +``` + +Writing good commit logs is important. A commit log should describe what +changed and why. Follow these guidelines when writing one: + +1. The first line should be 50 characters or less and contain a short description of the change prefixed with the name of the changed subsystem (e.g. "net: add localAddress and localPort to Socket"). +2. Keep the second line blank. +3. Wrap all other lines at 72 columns. + +A good commit log can look something like this: + +```text +subsystem: explaining the commit in one line + +Body of commit message is a few lines of text, explaining things +in more detail, possibly giving some background about the issue +being fixed, etc. etc. + +The body of the commit message can be several paragraphs, and +please do proper word-wrap and keep columns shorter than about +72 characters or so. That way `git log` will show things +nicely even when it is indented. +``` + +The header line should be meaningful; it is what other people see when they +run `git shortlog` or `git log --oneline`. + +Check the output of `git log --oneline files_that_you_changed` to find out +what subsystem (or subsystems) your changes touch. + +Step 4: Rebase +-------------- +Use `git rebase` (not `git merge`) to sync your work from time to time (as +mentioned in 'Step 1'). + +```text +$ git fetch upstream +$ git rebase upstream/master +``` + +Step 5: Test +------------ +Bug fixes and features **should come with tests**. Add your tests in the +test directory. Look at other tests to see how they should be +structured. + +```text +$ npm test +``` + +Step 6: Push +------------ +```text +$ git push origin my-feature-branch +``` + +Go to [https://github.com/yourusername/kruptein](https://github.com/yourusername/kruptein) and select your feature +branch. Click the 'Pull Request' button and fill out the form. + +Pull requests are usually reviewed within a few days. If there are comments +to address, apply your changes in a separate commit and push that to your +feature branch. Post a comment in the pull request afterwards; GitHub does +not send out notifications when you add commits. diff --git a/node_modules/kruptein/LICENSE b/node_modules/kruptein/LICENSE new file mode 100644 index 0000000..61a92e6 --- /dev/null +++ b/node_modules/kruptein/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2019 Jason Gerfen <jason.gerfen@gmail.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. \ No newline at end of file diff --git a/node_modules/kruptein/README.md b/node_modules/kruptein/README.md new file mode 100644 index 0000000..e889e45 --- /dev/null +++ b/node_modules/kruptein/README.md @@ -0,0 +1,144 @@ +kruptein +======== +crypto; from `kruptein` to hide or conceal. + +[](https://npmjs.com/package/kruptein) + +[](https://snyk.io/test/github/jas-/kruptein) + + +Sandbox +------- +To test the module feel free to use the [sandbox](https://codesandbox.io/p/sandbox/kruptein-test-1z9zgd) + +Install +------- +To install `npm install kruptein` + +Methods +------- +* `.set(secret, plaintext, [aad], callback)` +* `.get(secret, ciphertext, [{at: auth_tag, aad: aad}], callback)` + +Options +------- +Industry standards are used for the algorithm, hashing algorithm, key & IV sizes. The default key derivation +is pbkdf2, however use of the scrypt derivation function can be enabled. +* `algorithm`: (Optional) Cipher algorithm from `crypto.getCiphers()`. Default: `aes-256-gcm`. +* `hashing`: (Optional) Hash algorithm from `crypto.getHashes()`. Default: `sha384`. +* `encodeas`: (Optional) Output encoding. Currently supports `binary`, `hex`, & `base64`. Default: `base64`. +* `key_size`: (Optional) Key size bytes (should match block size of algorithm). Default: `32` +* `iv_size`: (Optional) IV size bytes. Default: `16`. +* `at_size`: (Optional) Authentication tag size. Applicable to `gcm` & `ocb` cipher modes. Default: `128`. +* `use_scrypt`: (Optional) Use `.scrypt()` to derive a key. Requires node > v10. Default/Fallback: `.pbkdf2()`. +* `use_asn1`: (Optional) Disable the default ASN.1 encoding. Default: true + +Usage +----- +When selecting an algorithm from `crypto.getCiphers()` the +`iv` and `key_size` values are calculated auto-magically to make implementation +easy. + +You can always define your own if the defaults per algorithm and mode +aren't what you would like; see the `options` section above. + +Create ciphertext from plaintext +----------------- +To create a new ciphertext object. Run [example](https://codesandbox.io/p/devtool/task-log/cldvsajy7000hfqgja6e28q8c?project=1z9zgd) to encrypt plaintext. + +```javascript +const kruptein = require("kruptein")(opts); +let secret = "squirrel"; + +kruptein.set(secret, "Operation mincemeat was an example of deception", (err, ct) => { + if (err) + throw err; + + console.log(ct); +}); +``` + +Get plaintext from ciphertext +------------------ +To retrieve plaintext from a ciphertext object. Run [example](https://codesandbox.io/p/devtool/task-log/cldvn1j3f0007fqgjgqzle28o?project=1z9zgd) to decrypt ciphertext. + +```javascript +const kruptein = require("kruptein")(opts); +let ciphertext, secret = "squirrel"; + +kruptein.get(secret, ciphertext, (err, pt) => { + if (err) + throw err; + + console.log(pt); +}); +``` + +Output +------ +The `.set()` method output depends on three factors; the `encodeas`, +`algorithm` and `use_asn1`. + +For any algorithm that supports authentication (AEAD), the object +structure includes the `Authentication Tag` and the `Additional +Authentication Data` attribute and value. + +When the `use_asn1` option is enabled (default is true), the result is an [ASN.1](https://letsencrypt.org/docs/a-warm-welcome-to-asn1-and-der/) +value using the `encodeas` value. While this is a more complex +encoding option, it helps standardize & minimize the resulting +ciphertext output. + + +Test harness +------------ +The included test harness, invoked with `npm test`, makes every +attempt to trap and handle errors. Some of which come from side +channel or possible malability of the resultant ciphertext. + +This can be seen within the `test/index.js` CI test harness under +the HMAC, AT & AAD validation test cases. + +An online playgound for experimenting with the module can also be +found [here](https://codesandbox.io/p/devtool/task-log/cldvmxl6k0003fqgj0dc2es4x?project=1z9zgd) + +Cryptography References +----------------------- +This module conforms to industry recommendations regarding algorithm type, +mode, key size, iv size & implementation, digests, key derivation & management +etc. References used provided here: + +**RFC:** +* [RFC 2104](https://tools.ietf.org/html/rfc2104): HMAC: Keyed-Hashing for Message Authentication +* [RFC 4086](https://tools.ietf.org/html/rfc4086): Randomness Requirements for Security +* [RFC 5084](https://tools.ietf.org/html/rfc5084): Using AES-CCM and AES-GCM Authenticated Encryption +* [RFC 7914](https://tools.ietf.org/html/rfc7914): The scrypt Password-Based Key Derivation Function +* [RFC 8018](https://tools.ietf.org/html/rfc8018): Password-Based Cryptography Specification +* [X.697](https://www.itu.int/rec/T-REC-X.697-201710-I/en): ASN.1 encoding rules: Specifications of JavaScript Object Notation Encoding Rules (JER) + +**NIST:** +* [SP 800-38A](https://nvlpubs.nist.gov/nistpubs/Legacy/SP/nistspecialpublication800-38a.pdf): Block cipher modes of operation +* [SP 800-38B](https://nvlpubs.nist.gov/nistpubs/Legacy/SP/nistspecialpublication800-38d.pdf): Recommendation for Block Cipher Modes of Operation: Galois/Counter Mode (GCM) and GMAC +* [SP 800-57P1](https://nvlpubs.nist.gov/nistpubs/SpecialPublications/NIST.SP.800-57pt1r4.pdf): Recommendations for key management +* [SP 800-107](https://nvlpubs.nist.gov/nistpubs/Legacy/SP/nistspecialpublication800-107r1.pdf): Recommendation for Applications Using Approved Hash Algorithms +* [SP 800-108](https://nvlpubs.nist.gov/nistpubs/Legacy/SP/nistspecialpublication800-108.pdf): Recommendation for Key Derivation Using Pseudorandom Functions +* [SP 800-131A](https://nvlpubs.nist.gov/nistpubs/SpecialPublications/NIST.SP.800-131Ar2.pdf): Transitioning the Use of Cryptographic Algorithms and Key Lengths +* [SP 800-132](https://nvlpubs.nist.gov/nistpubs/Legacy/SP/nistspecialpublication800-132.pdf): Recommendation for Password-Based Key Derivation +* [SP 800-175B](https://nvlpubs.nist.gov/nistpubs/SpecialPublications/NIST.SP.800-175B.pdf): Guideline for Using Cryptographic Standards in the Federal Government + +**FIPS:** +* [FIPS 197](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.197.pdf): Advanced Encryption Standard (AES) +* [FIPS 198-1](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.198-1.pdf): The Keyed-Hash Message Authentication Code (HMAC) +* [FIPS 180-4](https://nvlpubs.nist.gov/nistpubs/FIPS/NIST.FIPS.180-4.pdf): Secure Hash Standard (SHS) + +Contributing +------------ +Contributions are welcome & appreciated! + +Refer to the [contributing document](https://github.com/jas-/kruptein/blob/master/CONTRIBUTING.md) +to help facilitate pull requests. + +License +------- +This software is licensed under the [MIT License](https://github.com/jas-/kruptein/blob/master/LICENSE). + +Copyright Jason Gerfen, 2019 to 2024. diff --git a/node_modules/kruptein/SECURITY.md b/node_modules/kruptein/SECURITY.md new file mode 100644 index 0000000..80cd5ae --- /dev/null +++ b/node_modules/kruptein/SECURITY.md @@ -0,0 +1,18 @@ +# Security Policy + +## Supported Versions +The following versions are supported. + +| Version | Supported | +| ------- | ------------------ | +| 3.0.x | :white_check_mark: | +| 2.2.x | :white_check_mark: | + +## Reporting a Vulnerability +Thank you for taking the time to review and provide +valuable information about a potential problem. + +I do ask for responsible disclosure. This is a +project I maintain in my spare time, however, +security issues are important and as such are +taken seriously. diff --git a/node_modules/kruptein/index.js b/node_modules/kruptein/index.js new file mode 100644 index 0000000..3f26673 --- /dev/null +++ b/node_modules/kruptein/index.js @@ -0,0 +1,7 @@ +/*! + * kruptein + * Copyright(c) 2019 Jason Gerfen <jason.gerfen@gmail.com> + * License: MIT + */ + +module.exports = require("./lib/kruptein.js"); \ No newline at end of file diff --git a/node_modules/kruptein/lib/kruptein.js b/node_modules/kruptein/lib/kruptein.js new file mode 100644 index 0000000..b072010 --- /dev/null +++ b/node_modules/kruptein/lib/kruptein.js @@ -0,0 +1,416 @@ +/*! + * kruptein + * Copyright(c) 2019 Jason Gerfen <jason.gerfen@gmail.com> + * License: MIT + */ +"use strict"; + +class Kruptein { + + constructor(options) { + options = options || {}; + + this.crypto = require("crypto"); + + // Set defaults if the user didn't supply any + this._algorithm = options.algorithm || "aes-256-gcm"; + this._hashing = options.hashing || "sha384"; + this._encodeas = options.encodeas || "base64"; + this._use_asn1 = options.use_asn1 || true; + + // Are we using AEAD mode (authenticated ciphers)? + this._aead_mode = this._algorithm.match(/ccm|gcm|ocb/) ? true : false; + + // Set some defaults based on the algorithm used + let defaults = this._matrix(this._algorithm); + this._at_size = options._at_size || defaults._at_size; + this._iv_size = options._iv_size || defaults._iv_size; + this._key_size = options._key_size || defaults._key_size; + + // Replace pbkdf2 with scrypt for key derivation? + this._use_scrypt = options.use_scrypt || false; + + // Use asn.1 encoding? + if (this._use_asn1) { + this.asn1 = require("asn1.js"); + this.schema = this._schema(); + } + } + + + set(secret, plaintext, aad, cb) { + // If non-aead cipher then expect 3 vs. 4 args + cb = cb || aad; + + // Initialize some defaults + let iv, ct, hmac, obj, key; + + // Bail if using weak cipher algorithm modes + if (this._validator()) + return cb("Insecure cipher mode not supported!"); + + // Bail if secret is not provided + if (!secret) + return cb("Must supply a secret!"); + + // Derive a stronger key from secret; + this._derive_key(secret, (err, secret) => { + if (err) + return cb("Unable to derive key!"); + + key = secret; + }); + + // Generate a random IV based on the algorithms IV size + iv = this._iv(this._iv_size); + + // Are we dealing with an object? + let pt = plaintext; + try { + plaintext = Buffer.from(JSON.stringify(pt)); + } catch(err) { + plaintext = Buffer.from(pt); + } + + // If AEAD mode cipher used and an AAD not provided, create one + if (this._aead_mode && typeof aad === "function") { + this._digest(this._iv(128), plaintext, this._hashing, this._encodeas, (err, res) => { + if (err) + return cb("Unable to generate AAD!"); + + aad = res; + }); + } + + // Create ciphertext from plaintext with derived key + this._encrypt(key.key, plaintext, this._algorithm, this._encodeas, iv, aad, (err, ciphertext) => { + if (err) + return cb("Unable to create ciphertext!"); + + ct = ciphertext; + }); + + // Create an HMAC from the resulting ciphertext + this._digest(key.key, ct.ct, this._hashing, this._encodeas, (err, digest) => { + if (err) + return cb("Unable to create digest!"); + + hmac = digest; + }); + + // Create an object to pass back + obj = { + hmac: hmac, + ct: ct.ct, + iv: iv, + salt: key.salt + }; + + // If AEAD mode include the AAD + if (aad) + obj.aad = aad; + + // If AEAD mode include the AT + if (ct.at) + obj.at = ct.at; + + // Make sure the retured object is encoded property + return (this._use_asn1) ? + cb(null, this.schema.encode(obj).toString(this._encodeas)) : + cb(null, JSON.stringify(obj)); + } + + + get(secret, ciphertext, opts, cb) { + // If non-aead cipher then expect 3 vs. 4 args + cb = cb || opts; + + // Initialize some defaults + let ct, hmac, pt, key; + + // Bail if using weak cipher algorithm modes + if (this._validator()) + return cb("Insecure cipher mode not supported!"); + + // Bail if secret is not provided + if (!secret) + return cb("Must supply a secret!"); + + // Parse the provided ciphertext object or bail + try { + if (this._use_asn1) { + ct = this.schema.decode(Buffer.from(ciphertext, this._encodeas)); + + if (ct.at) + ct.ct = ct.ct.toString(); + + if (ct.aad) + ct.aad = ct.aad.toString(); + } else { + ct = JSON.parse(ciphertext); + } + } catch (err) { + return cb("Unable to parse ciphertext object!"); + } + + // Derive a stronger key from secret; + this._derive_key(secret, ct.salt, (err, secret) => { + if (err) + return cb("Unable to derive key!"); + + key = secret; + }); + + // Create an HMAC from the ciphertext HMAC value + this._digest(key.key, ct.ct, this._hashing, this._encodeas, (err, res) => { + if (err) + cb("Unable to generate HMAC!"); + + hmac = res; + }); + + + // Compare computed from included & bail if not identical + if (hmac !== ct.hmac.toString()) + return cb("Encrypted session was tampered with!"); + + // If provided get the AAD &/or AT values + if (opts) { + ct.aad = (opts.aad) ? opts.aad : + (ct.aad) ? ct.aad : false; + + ct.at = (opts.at && !ct.at) ? + opts.at : (ct.at) ? + ct.at : false; + } + + // Convert the AT to a buffer + if (ct.at) + ct.at = Buffer.from(ct.at, this._encodeas); + + // Create plaintext from ciphertext with derived key + this._decrypt(key.key, ct.ct, this._algorithm, this._encodeas, Buffer.from(ct.iv, this._encodeas), ct.at, ct.aad, (err, res) => { + if (err) + return cb("Unable to decrypt ciphertext!"); + + pt = res; + }); + + return cb(null, pt); + } + + _encrypt(key, pt, algo, encodeas, iv, aad, cb) { + // If non-aead cipher then expect 6 vs. 7 args + cb = cb || aad; + + // Initialize some defaults + let cipher, ct, at; + + // Create a new cipher object using algorithm, derived key & iv + cipher = this.crypto.createCipheriv(algo, key, iv, { + authTagLength: this._at_size + }); + + // If an AEAD cipher is used & an AAD supplied, include it + if (this._aead_mode && typeof aad !== "function") { + try { + cipher.setAAD(Buffer.from(aad, encodeas), { + plaintextLength: Buffer.byteLength(pt) + }); + } catch (err) { + return cb("Unable to set AAD!"); + } + } + + // Add our plaintext; encode & pad the resulting cipher text + ct = cipher.update(Buffer.from(pt, encodeas), "utf8", encodeas); + cipher.setAutoPadding(true); + ct += cipher.final(encodeas); + + // If an AEAD cipher is used, retrieve the authentication tag + if (this._aead_mode) { + try { + at = cipher.getAuthTag(); + } catch (err) { + return cb("Unable to obtain authentication tag"); + } + } + + // Return the object + return cb(null, (at) ? { "ct": ct, "at": at } : { "ct": ct }); + } + + + _decrypt(key, ct, algo, encodeas, iv, at, aad, cb) { + // If non-aead cipher then expect 6 vs. 7 args + cb = cb || aad; + + // Initialize some defaults + let cipher, pt; + + // Create a new de-cipher object using algorithm, derived key & iv + cipher = this.crypto.createDecipheriv(algo, key, iv, { + authTagLength: this._at_size + }); + + // If an AEAD cipher is used & an AT supplied, include it + if (this._aead_mode && at) { + try { + cipher.setAuthTag(Buffer.from(at, encodeas)); + } catch (err) { + return cb("Unable to set authentication tag"); + } + } + + // If an AEAD cipher is used & an AAD supplied, include it + if (this._aead_mode && typeof aad !== "function") { + try { + cipher.setAAD(Buffer.from(aad, encodeas), { + plaintextLength: ct.length + }); + } catch (err) { + return cb("Unable to set additional authentication data"); + } + } + + // Add our ciphertext & encode + try { + pt = cipher.update(ct.toString(), encodeas, "utf8"); + pt += cipher.final("utf8"); + } catch(err) { + return cb("Unable to decrypt ciphertext!"); + } + + // return the plaintext + return cb(null, pt); + } + + + _derive_key(secret, salt, cb) { + // If salt not supplied then expect 2 vs. 3 args + cb = cb || salt; + + // Initialize some defaults + let key, opts = {}; + + // If secret is an object then extract the parts; test harness only + if (typeof secret === "object") { + opts = secret.opts; + secret = secret.secret; + } + + // If a salt was NOT supplied, create one + salt = (typeof salt !== "function") ? + Buffer.from(salt) : this.crypto.randomBytes(128); + + // PBKDF2 or scrypt key derivation logic + try { + if (!this._use_scrypt || typeof this.crypto.scryptSync !== "function") { + key = this.crypto.pbkdf2Sync(secret, salt, 15000, this._key_size, this._hashing); + } else { + key = this.crypto.scryptSync(secret, salt, this._key_size, opts); + } + } catch (err) { + return cb("Unable to derive key!"); + } + + // Return the derived key and salt + return cb(null, { + key: key, + salt: salt + }); + } + + + _digest(key, obj, hashing, encodeas, cb) { + + // Initialize some defaults + let hmac; + + // Create an HMAC from the supplied data + try { + hmac = this.crypto.createHmac(hashing, key); + hmac.setEncoding(encodeas); + hmac.write(obj); + hmac.end(); + } catch (err) { + return cb("Unable to generate digest!"); + } + + // Return digest + return cb(null, hmac.read().toString(encodeas)); + } + + + _iv(iv_size) { + return this.crypto.randomBytes(iv_size); + } + + + _matrix(algo) { + let obj = { + _at_size: 16, + _iv_size: 16, + _key_size: 32 + }; + + if (algo.match(/ccm|ocb|gcm/i)) + obj._iv_size = 12; + + if (algo.match(/aes/) && algo.match(/128/)) + obj._key_size = 16; + + if (algo.match(/aes/) && algo.match(/192/)) + obj._key_size = 24; + + if (algo.match(/aes/) && algo.match(/xts/)) + obj._key_size = 32; + + if (algo.match(/aes/) && algo.match(/xts/) && algo.match(/256/)) + obj._key_size = 64; + + return obj; + } + + + _validator() { + return (this._algorithm.match(/ccm|ecb|ocb2/)); + } + + + _schema() { + let schema; + if (!this._aead_mode) { + + schema = this.asn1.define('schema', function() { + this.seq().obj( + this.key("ct").octstr(), + this.key("hmac").octstr(), + this.key("iv").octstr(), + this.key("salt").octstr() + ); + }); + + } else { + + schema = this.asn1.define('schema', function() { + this.seq().obj( + this.key("ct").octstr(), + this.key("hmac").octstr(), + this.key("iv").octstr(), + this.key("salt").octstr(), + this.key("at").octstr(), + this.key("aad").octstr() + ); + }); + } + + return schema; + } +} + + +// Robot, do work +module.exports = function(options) { + return new Kruptein(options || {}); +}; diff --git a/node_modules/kruptein/package.json b/node_modules/kruptein/package.json new file mode 100644 index 0000000..a2eba44 --- /dev/null +++ b/node_modules/kruptein/package.json @@ -0,0 +1,53 @@ +{ + "name": "kruptein", + "version": "3.0.7", + "description": "crypto; from kruptein to hide or conceal", + "keywords": [ + "crypto", + "cryptography", + "cryptr", + "crypter", + "encryption", + "decryption", + "encrypt", + "decrypt", + "AES", + "GCM", + "authenticated", + "authenticate", + "unicode", + "symmetric", + "cipher", + "key derivation", + "scrypt", + "pbkdf2", + "security", + "asn.1" + ], + "author": { + "name": "Jason Gerfen", + "email": "jason.gerfen@gmail.com" + }, + "license": "MIT", + "repository": { + "type": "git", + "url": "https://github.com/jas-/kruptein.git" + }, + "bugs": { + "url": "https://github.com/jas-/kruptein/issues" + }, + "devDependencies": { + "expect.js": "0.3.1", + "mocha": "10.7.3", + "nyc": "17.0.0" + }, + "scripts": { + "test": "nyc mocha test/*.js" + }, + "engines": { + "node": ">8" + }, + "dependencies": { + "asn1.js": "^5.4.1" + } +} diff --git a/node_modules/minimalistic-assert/LICENSE b/node_modules/minimalistic-assert/LICENSE new file mode 100644 index 0000000..adca66b --- /dev/null +++ b/node_modules/minimalistic-assert/LICENSE @@ -0,0 +1,13 @@ +Copyright 2015 Calvin Metcalf + +Permission to use, copy, modify, and/or distribute this software for any purpose +with or without fee is hereby granted, provided that the above copyright notice +and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. \ No newline at end of file diff --git a/node_modules/minimalistic-assert/index.js b/node_modules/minimalistic-assert/index.js new file mode 100644 index 0000000..70b4ea5 --- /dev/null +++ b/node_modules/minimalistic-assert/index.js @@ -0,0 +1,11 @@ +module.exports = assert; + +function assert(val, msg) { + if (!val) + throw new Error(msg || 'Assertion failed'); +} + +assert.equal = function assertEqual(l, r, msg) { + if (l != r) + throw new Error(msg || ('Assertion failed: ' + l + ' != ' + r)); +}; diff --git a/node_modules/minimalistic-assert/package.json b/node_modules/minimalistic-assert/package.json new file mode 100644 index 0000000..f8de10d --- /dev/null +++ b/node_modules/minimalistic-assert/package.json @@ -0,0 +1,19 @@ +{ + "name": "minimalistic-assert", + "version": "1.0.1", + "description": "minimalistic-assert ===", + "main": "index.js", + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "repository": { + "type": "git", + "url": "https://github.com/calvinmetcalf/minimalistic-assert.git" + }, + "author": "", + "license": "ISC", + "bugs": { + "url": "https://github.com/calvinmetcalf/minimalistic-assert/issues" + }, + "homepage": "https://github.com/calvinmetcalf/minimalistic-assert" +} diff --git a/node_modules/minimalistic-assert/readme.md b/node_modules/minimalistic-assert/readme.md new file mode 100644 index 0000000..2ca0d25 --- /dev/null +++ b/node_modules/minimalistic-assert/readme.md @@ -0,0 +1,4 @@ +minimalistic-assert +=== + +very minimalistic assert module. diff --git a/node_modules/on-headers/HISTORY.md b/node_modules/on-headers/HISTORY.md new file mode 100644 index 0000000..090598d --- /dev/null +++ b/node_modules/on-headers/HISTORY.md @@ -0,0 +1,21 @@ +1.0.2 / 2019-02-21 +================== + + * Fix `res.writeHead` patch missing return value + +1.0.1 / 2015-09-29 +================== + + * perf: enable strict mode + +1.0.0 / 2014-08-10 +================== + + * Honor `res.statusCode` change in `listener` + * Move to `jshttp` organization + * Prevent `arguments`-related de-opt + +0.0.0 / 2014-05-13 +================== + + * Initial implementation diff --git a/node_modules/on-headers/LICENSE b/node_modules/on-headers/LICENSE new file mode 100644 index 0000000..b7dce6c --- /dev/null +++ b/node_modules/on-headers/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/on-headers/README.md b/node_modules/on-headers/README.md new file mode 100644 index 0000000..ae84282 --- /dev/null +++ b/node_modules/on-headers/README.md @@ -0,0 +1,81 @@ +# on-headers + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Execute a listener when a response is about to write headers. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install on-headers +``` + +## API + +<!-- eslint-disable no-unused-vars --> + +```js +var onHeaders = require('on-headers') +``` + +### onHeaders(res, listener) + +This will add the listener `listener` to fire when headers are emitted for `res`. +The listener is passed the `response` object as it's context (`this`). Headers are +considered to be emitted only once, right before they are sent to the client. + +When this is called multiple times on the same `res`, the `listener`s are fired +in the reverse order they were added. + +## Examples + +```js +var http = require('http') +var onHeaders = require('on-headers') + +http + .createServer(onRequest) + .listen(3000) + +function addPoweredBy () { + // set if not set by end of request + if (!this.getHeader('X-Powered-By')) { + this.setHeader('X-Powered-By', 'Node.js') + } +} + +function onRequest (req, res) { + onHeaders(res, addPoweredBy) + + res.setHeader('Content-Type', 'text/plain') + res.end('hello!') +} +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/on-headers/master +[coveralls-url]: https://coveralls.io/r/jshttp/on-headers?branch=master +[node-version-image]: https://badgen.net/npm/node/on-headers +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/on-headers +[npm-url]: https://npmjs.org/package/on-headers +[npm-version-image]: https://badgen.net/npm/v/on-headers +[travis-image]: https://badgen.net/travis/jshttp/on-headers/master +[travis-url]: https://travis-ci.org/jshttp/on-headers diff --git a/node_modules/on-headers/index.js b/node_modules/on-headers/index.js new file mode 100644 index 0000000..7db6375 --- /dev/null +++ b/node_modules/on-headers/index.js @@ -0,0 +1,132 @@ +/*! + * on-headers + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = onHeaders + +/** + * Create a replacement writeHead method. + * + * @param {function} prevWriteHead + * @param {function} listener + * @private + */ + +function createWriteHead (prevWriteHead, listener) { + var fired = false + + // return function with core name and argument list + return function writeHead (statusCode) { + // set headers from arguments + var args = setWriteHeadHeaders.apply(this, arguments) + + // fire listener + if (!fired) { + fired = true + listener.call(this) + + // pass-along an updated status code + if (typeof args[0] === 'number' && this.statusCode !== args[0]) { + args[0] = this.statusCode + args.length = 1 + } + } + + return prevWriteHead.apply(this, args) + } +} + +/** + * Execute a listener when a response is about to write headers. + * + * @param {object} res + * @return {function} listener + * @public + */ + +function onHeaders (res, listener) { + if (!res) { + throw new TypeError('argument res is required') + } + + if (typeof listener !== 'function') { + throw new TypeError('argument listener must be a function') + } + + res.writeHead = createWriteHead(res.writeHead, listener) +} + +/** + * Set headers contained in array on the response object. + * + * @param {object} res + * @param {array} headers + * @private + */ + +function setHeadersFromArray (res, headers) { + for (var i = 0; i < headers.length; i++) { + res.setHeader(headers[i][0], headers[i][1]) + } +} + +/** + * Set headers contained in object on the response object. + * + * @param {object} res + * @param {object} headers + * @private + */ + +function setHeadersFromObject (res, headers) { + var keys = Object.keys(headers) + for (var i = 0; i < keys.length; i++) { + var k = keys[i] + if (k) res.setHeader(k, headers[k]) + } +} + +/** + * Set headers and other properties on the response object. + * + * @param {number} statusCode + * @private + */ + +function setWriteHeadHeaders (statusCode) { + var length = arguments.length + var headerIndex = length > 1 && typeof arguments[1] === 'string' + ? 2 + : 1 + + var headers = length >= headerIndex + 1 + ? arguments[headerIndex] + : undefined + + this.statusCode = statusCode + + if (Array.isArray(headers)) { + // handle array case + setHeadersFromArray(this, headers) + } else if (headers) { + // handle object case + setHeadersFromObject(this, headers) + } + + // copy leading arguments + var args = new Array(Math.min(length, headerIndex)) + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + + return args +} diff --git a/node_modules/on-headers/package.json b/node_modules/on-headers/package.json new file mode 100644 index 0000000..1e9bf9e --- /dev/null +++ b/node_modules/on-headers/package.json @@ -0,0 +1,42 @@ +{ + "name": "on-headers", + "description": "Execute a listener when a response is about to write headers", + "version": "1.0.2", + "author": "Douglas Christopher Wilson <doug@somethingdoug.com>", + "license": "MIT", + "keywords": [ + "event", + "headers", + "http", + "onheaders" + ], + "repository": "jshttp/on-headers", + "devDependencies": { + "eslint": "5.14.1", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.0.1", + "supertest": "3.4.2" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/", + "version": "node scripts/version-history.js && git add HISTORY.md" + } +} diff --git a/node_modules/random-bytes/HISTORY.md b/node_modules/random-bytes/HISTORY.md new file mode 100644 index 0000000..8cabd9d --- /dev/null +++ b/node_modules/random-bytes/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2016-01-17 +================== + + * Initial release diff --git a/node_modules/random-bytes/LICENSE b/node_modules/random-bytes/LICENSE new file mode 100644 index 0000000..c24dbe3 --- /dev/null +++ b/node_modules/random-bytes/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/random-bytes/README.md b/node_modules/random-bytes/README.md new file mode 100644 index 0000000..df5aacc --- /dev/null +++ b/node_modules/random-bytes/README.md @@ -0,0 +1,77 @@ +# random-bytes + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Generate strong pseudo-random bytes. + +This module is a simple wrapper around the Node.js core `crypto.randomBytes` API, +with the following additions: + + * A `Promise` interface for environments with promises. + * For Node.js versions that do not wait for the PRNG to be seeded, this module + will wait a bit. + +## Installation + +```sh +$ npm install random-bytes +``` + +## API + +```js +var randomBytes = require('random-bytes') +``` + +### randomBytes(size, callback) + +Generates strong pseudo-random bytes. The `size` argument is a number indicating +the number of bytes to generate. + +```js +randomBytes(12, function (error, bytes) { + if (error) throw error + // do something with the bytes +}) +``` + +### randomBytes(size) + +Generates strong pseudo-random bytes and return a `Promise`. The `size` argument is +a number indicating the number of bytes to generate. + +**Note**: To use promises in Node.js _prior to 0.12_, promises must be +"polyfilled" using `global.Promise = require('bluebird')`. + +```js +randomBytes(18).then(function (string) { + // do something with the string +}) +``` + +### randomBytes.sync(size) + +A synchronous version of above. + +```js +var bytes = randomBytes.sync(18) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/random-bytes.svg +[npm-url]: https://npmjs.org/package/random-bytes +[node-version-image]: https://img.shields.io/node/v/random-bytes.svg +[node-version-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/crypto-utils/random-bytes/master.svg +[travis-url]: https://travis-ci.org/crypto-utils/random-bytes +[coveralls-image]: https://img.shields.io/coveralls/crypto-utils/random-bytes/master.svg +[coveralls-url]: https://coveralls.io/r/crypto-utils/random-bytes?branch=master +[downloads-image]: https://img.shields.io/npm/dm/random-bytes.svg +[downloads-url]: https://npmjs.org/package/random-bytes diff --git a/node_modules/random-bytes/index.js b/node_modules/random-bytes/index.js new file mode 100644 index 0000000..9ad930f --- /dev/null +++ b/node_modules/random-bytes/index.js @@ -0,0 +1,101 @@ +/*! + * random-bytes + * Copyright(c) 2016 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var crypto = require('crypto') + +/** + * Module variables. + * @private + */ + +var generateAttempts = crypto.randomBytes === crypto.pseudoRandomBytes ? 1 : 3 + +/** + * Module exports. + * @public + */ + +module.exports = randomBytes +module.exports.sync = randomBytesSync + +/** + * Generates strong pseudo-random bytes. + * + * @param {number} size + * @param {function} [callback] + * @return {Promise} + * @public + */ + +function randomBytes(size, callback) { + // validate callback is a function, if provided + if (callback !== undefined && typeof callback !== 'function') { + throw new TypeError('argument callback must be a function') + } + + // require the callback without promises + if (!callback && !global.Promise) { + throw new TypeError('argument callback is required') + } + + if (callback) { + // classic callback style + return generateRandomBytes(size, generateAttempts, callback) + } + + return new Promise(function executor(resolve, reject) { + generateRandomBytes(size, generateAttempts, function onRandomBytes(err, str) { + if (err) return reject(err) + resolve(str) + }) + }) +} + +/** + * Generates strong pseudo-random bytes sync. + * + * @param {number} size + * @return {Buffer} + * @public + */ + +function randomBytesSync(size) { + var err = null + + for (var i = 0; i < generateAttempts; i++) { + try { + return crypto.randomBytes(size) + } catch (e) { + err = e + } + } + + throw err +} + +/** + * Generates strong pseudo-random bytes. + * + * @param {number} size + * @param {number} attempts + * @param {function} callback + * @private + */ + +function generateRandomBytes(size, attempts, callback) { + crypto.randomBytes(size, function onRandomBytes(err, buf) { + if (!err) return callback(null, buf) + if (!--attempts) return callback(err) + setTimeout(generateRandomBytes.bind(null, size, attempts, callback), 10) + }) +} diff --git a/node_modules/random-bytes/package.json b/node_modules/random-bytes/package.json new file mode 100644 index 0000000..c67e0e8 --- /dev/null +++ b/node_modules/random-bytes/package.json @@ -0,0 +1,36 @@ +{ + "name": "random-bytes", + "description": "URL and cookie safe UIDs", + "version": "1.0.0", + "contributors": [ + "Douglas Christopher Wilson <doug@somethingdoug.com>" + ], + "license": "MIT", + "repository": "crypto-utils/random-bytes", + "devDependencies": { + "bluebird": "3.1.1", + "istanbul": "0.4.2", + "mocha": "2.3.4", + "proxyquire": "1.2.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "test": "mocha --trace-deprecation --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --trace-deprecation --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --trace-deprecation --reporter spec --check-leaks test/" + }, + "keywords": [ + "bytes", + "generator", + "random", + "safe" + ] +} diff --git a/node_modules/uid-safe/HISTORY.md b/node_modules/uid-safe/HISTORY.md new file mode 100644 index 0000000..3ec249f --- /dev/null +++ b/node_modules/uid-safe/HISTORY.md @@ -0,0 +1,61 @@ +2.1.5 / 2017-08-02 +================== + + * perf: remove only trailing `=` + +2.1.4 / 2017-03-02 +================== + + * Remove `base64-url` dependency + +2.1.3 / 2016-10-30 +================== + + * deps: base64-url@1.3.3 + +2.1.2 / 2016-08-15 +================== + + * deps: base64-url@1.3.2 + +2.1.1 / 2016-05-04 +================== + + * deps: base64-url@1.2.2 + +2.1.0 / 2016-01-17 +================== + + * Use `random-bytes` for byte source + +2.0.0 / 2015-05-08 +================== + + * Use global `Promise` when returning a promise + +1.1.0 / 2015-02-01 +================== + + * Use `crypto.randomBytes`, if available + * deps: base64-url@1.2.1 + +1.0.3 / 2015-01-31 +================== + + * Fix error branch that would throw + * deps: base64-url@1.2.0 + +1.0.2 / 2015-01-08 +================== + + * Remove dependency on `mz` + +1.0.1 / 2014-06-18 +================== + + * Remove direct `bluebird` dependency + +1.0.0 / 2014-06-18 +================== + + * Initial release diff --git a/node_modules/uid-safe/LICENSE b/node_modules/uid-safe/LICENSE new file mode 100644 index 0000000..c4b8a49 --- /dev/null +++ b/node_modules/uid-safe/LICENSE @@ -0,0 +1,22 @@ +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong <me@jongleberry.com> +Copyright (c) 2015-2017 Douglas Christopher Wilson <doug@somethingdoug.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/uid-safe/README.md b/node_modules/uid-safe/README.md new file mode 100644 index 0000000..fa02be8 --- /dev/null +++ b/node_modules/uid-safe/README.md @@ -0,0 +1,77 @@ +# uid-safe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +URL and cookie safe UIDs + +Create cryptographically secure UIDs safe for both cookie and URL usage. +This is in contrast to modules such as [rand-token](https://www.npmjs.com/package/rand-token) +and [uid2](https://www.npmjs.com/package/uid2) whose UIDs are actually skewed +due to the use of `%` and unnecessarily truncate the UID. +Use this if you could still use UIDs with `-` and `_` in them. + +## Installation + +```sh +$ npm install uid-safe +``` + +## API + +```js +var uid = require('uid-safe') +``` + +### uid(byteLength, callback) + +Asynchronously create a UID with a specific byte length. Because `base64` +encoding is used underneath, this is not the string length. For example, +to create a UID of length 24, you want a byte length of 18. + +```js +uid(18, function (err, string) { + if (err) throw err + // do something with the string +}) +``` + +### uid(byteLength) + +Asynchronously create a UID with a specific byte length and return a +`Promise`. + +**Note**: To use promises in Node.js _prior to 0.12_, promises must be +"polyfilled" using `global.Promise = require('bluebird')`. + +```js +uid(18).then(function (string) { + // do something with the string +}) +``` + +### uid.sync(byteLength) + +A synchronous version of above. + +```js +var string = uid.sync(18) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/uid-safe.svg +[npm-url]: https://npmjs.org/package/uid-safe +[node-version-image]: https://img.shields.io/node/v/uid-safe.svg +[node-version-url]: https://nodejs.org/en/download/ +[travis-image]: https://img.shields.io/travis/crypto-utils/uid-safe/master.svg +[travis-url]: https://travis-ci.org/crypto-utils/uid-safe +[coveralls-image]: https://img.shields.io/coveralls/crypto-utils/uid-safe/master.svg +[coveralls-url]: https://coveralls.io/r/crypto-utils/uid-safe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/uid-safe.svg +[downloads-url]: https://npmjs.org/package/uid-safe diff --git a/node_modules/uid-safe/index.js b/node_modules/uid-safe/index.js new file mode 100644 index 0000000..18e8492 --- /dev/null +++ b/node_modules/uid-safe/index.js @@ -0,0 +1,107 @@ +/*! + * uid-safe + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var randomBytes = require('random-bytes') + +/** + * Module variables. + * @private + */ + +var EQUAL_END_REGEXP = /=+$/ +var PLUS_GLOBAL_REGEXP = /\+/g +var SLASH_GLOBAL_REGEXP = /\//g + +/** + * Module exports. + * @public + */ + +module.exports = uid +module.exports.sync = uidSync + +/** + * Create a unique ID. + * + * @param {number} length + * @param {function} [callback] + * @return {Promise} + * @public + */ + +function uid (length, callback) { + // validate callback is a function, if provided + if (callback !== undefined && typeof callback !== 'function') { + throw new TypeError('argument callback must be a function') + } + + // require the callback without promises + if (!callback && !global.Promise) { + throw new TypeError('argument callback is required') + } + + if (callback) { + // classic callback style + return generateUid(length, callback) + } + + return new Promise(function executor (resolve, reject) { + generateUid(length, function onUid (err, str) { + if (err) return reject(err) + resolve(str) + }) + }) +} + +/** + * Create a unique ID sync. + * + * @param {number} length + * @return {string} + * @public + */ + +function uidSync (length) { + return toString(randomBytes.sync(length)) +} + +/** + * Generate a unique ID string. + * + * @param {number} length + * @param {function} callback + * @private + */ + +function generateUid (length, callback) { + randomBytes(length, function (err, buf) { + if (err) return callback(err) + callback(null, toString(buf)) + }) +} + +/** + * Change a Buffer into a string. + * + * @param {Buffer} buf + * @return {string} + * @private + */ + +function toString (buf) { + return buf.toString('base64') + .replace(EQUAL_END_REGEXP, '') + .replace(PLUS_GLOBAL_REGEXP, '-') + .replace(SLASH_GLOBAL_REGEXP, '_') +} diff --git a/node_modules/uid-safe/package.json b/node_modules/uid-safe/package.json new file mode 100644 index 0000000..9d9ea4c --- /dev/null +++ b/node_modules/uid-safe/package.json @@ -0,0 +1,46 @@ +{ + "name": "uid-safe", + "description": "URL and cookie safe UIDs", + "version": "2.1.5", + "contributors": [ + "Douglas Christopher Wilson <doug@somethingdoug.com>", + "Jonathan Ong <me@jongleberry.com> (http://jongleberry.com)" + ], + "license": "MIT", + "repository": "crypto-utils/uid-safe", + "dependencies": { + "random-bytes": "~1.0.0" + }, + "devDependencies": { + "bluebird": "3.5.0", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "README.md", + "index.js" + ], + "engines": { + "node": ">= 0.8" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --trace-deprecation --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --trace-deprecation --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --trace-deprecation --reporter spec --check-leaks test/" + }, + "keywords": [ + "random", + "generator", + "uid", + "safe" + ] +} diff --git a/package-lock.json b/package-lock.json index 6cb65fc..b038004 100644 --- a/package-lock.json +++ b/package-lock.json @@ -10,8 +10,11 @@ "license": "ISC", "dependencies": { "bcrypt": "^5.1.1", + "bcryptjs": "^3.0.2", + "connect-mongo": "^5.1.0", "ejs": "^3.1.10", "express": "^4.21.2", + "express-session": "^1.18.1", "mongoose": "^8.12.1", "nodemon": "^3.1.9" } @@ -177,6 +180,18 @@ "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg==", "license": "MIT" }, + "node_modules/asn1.js": { + "version": "5.4.1", + "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz", + "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==", + "license": "MIT", + "dependencies": { + "bn.js": "^4.0.0", + "inherits": "^2.0.1", + "minimalistic-assert": "^1.0.0", + "safer-buffer": "^2.1.0" + } + }, "node_modules/async": { "version": "3.2.6", "resolved": "https://registry.npmjs.org/async/-/async-3.2.6.tgz", @@ -203,6 +218,15 @@ "node": ">= 10.0.0" } }, + "node_modules/bcryptjs": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/bcryptjs/-/bcryptjs-3.0.2.tgz", + "integrity": "sha512-k38b3XOZKv60C4E2hVsXTolJWfkGRMbILBIe2IBITXciy5bOsTKot5kDrf3ZfufQtQOUN5mXceUEpU1rTl9Uog==", + "license": "BSD-3-Clause", + "bin": { + "bcrypt": "bin/bcrypt" + } + }, "node_modules/binary-extensions": { "version": "2.3.0", "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", @@ -215,6 +239,12 @@ "url": "https://github.com/sponsors/sindresorhus" } }, + "node_modules/bn.js": { + "version": "4.12.1", + "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.1.tgz", + "integrity": "sha512-k8TVBiPkPJT9uHLdOKfFpqcfprwBFOAAXXozRubr7R7PfIuKvQlzcI4M0pALeqXN09vdaMbUdUj+pass+uULAg==", + "license": "MIT" + }, "node_modules/body-parser": { "version": "1.20.3", "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz", @@ -390,6 +420,46 @@ "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", "license": "MIT" }, + "node_modules/connect-mongo": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/connect-mongo/-/connect-mongo-5.1.0.tgz", + "integrity": "sha512-xT0vxQLqyqoUTxPLzlP9a/u+vir0zNkhiy9uAdHjSCcUUf7TS5b55Icw8lVyYFxfemP3Mf9gdwUOgeF3cxCAhw==", + "license": "MIT", + "dependencies": { + "debug": "^4.3.1", + "kruptein": "^3.0.0" + }, + "engines": { + "node": ">=12.9.0" + }, + "peerDependencies": { + "express-session": "^1.17.1", + "mongodb": ">= 5.1.0 < 7" + } + }, + "node_modules/connect-mongo/node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "license": "MIT", + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/connect-mongo/node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "license": "MIT" + }, "node_modules/console-control-strings": { "version": "1.1.0", "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", @@ -616,6 +686,40 @@ "url": "https://opencollective.com/express" } }, + "node_modules/express-session": { + "version": "1.18.1", + "resolved": "https://registry.npmjs.org/express-session/-/express-session-1.18.1.tgz", + "integrity": "sha512-a5mtTqEaZvBCL9A9aqkrtfz+3SMDhOVUnjafjo+s7A9Txkq+SVX2DLvSp1Zrv4uCXa3lMSK3viWnh9Gg07PBUA==", + "license": "MIT", + "dependencies": { + "cookie": "0.7.2", + "cookie-signature": "1.0.7", + "debug": "2.6.9", + "depd": "~2.0.0", + "on-headers": "~1.0.2", + "parseurl": "~1.3.3", + "safe-buffer": "5.2.1", + "uid-safe": "~2.1.5" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/express-session/node_modules/cookie": { + "version": "0.7.2", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.2.tgz", + "integrity": "sha512-yki5XnKuf750l50uGTllt6kKILY4nQ1eNIQatoXEByZ5dWgnKqbnqmTrBE5B4N7lrMJKQ2ytWMiTO2o0v6Ew/w==", + "license": "MIT", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/express-session/node_modules/cookie-signature": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.7.tgz", + "integrity": "sha512-NXdYc3dLr47pBkpUCHtKSwIOQXLVn8dZEuywboCOJY/osA0wFSLlSawr3KN8qXJEyX66FcONTH8EIlVuK0yyFA==", + "license": "MIT" + }, "node_modules/filelist": { "version": "1.0.4", "resolved": "https://registry.npmjs.org/filelist/-/filelist-1.0.4.tgz", @@ -1063,6 +1167,18 @@ "node": ">=12.0.0" } }, + "node_modules/kruptein": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/kruptein/-/kruptein-3.0.7.tgz", + "integrity": "sha512-vTftnEjfbqFHLqxDUMQCj6gBo5lKqjV4f0JsM8rk8rM3xmvFZ2eSy4YALdaye7E+cDKnEj7eAjFR3vwh8a4PgQ==", + "license": "MIT", + "dependencies": { + "asn1.js": "^5.4.1" + }, + "engines": { + "node": ">8" + } + }, "node_modules/make-dir": { "version": "3.1.0", "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", @@ -1162,6 +1278,12 @@ "node": ">= 0.6" } }, + "node_modules/minimalistic-assert": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz", + "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A==", + "license": "ISC" + }, "node_modules/minimatch": { "version": "3.1.2", "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", @@ -1553,6 +1675,15 @@ "node": ">= 0.8" } }, + "node_modules/on-headers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz", + "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, "node_modules/once": { "version": "1.4.0", "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", @@ -1641,6 +1772,15 @@ "url": "https://github.com/sponsors/ljharb" } }, + "node_modules/random-bytes": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/random-bytes/-/random-bytes-1.0.0.tgz", + "integrity": "sha512-iv7LhNVO047HzYR3InF6pUcUsPQiHTM1Qal51DcGSuZFBil1aBBWG5eHPNek7bvILMaYJ/8RU1e8w1AMdHmLQQ==", + "license": "MIT", + "engines": { + "node": ">= 0.8" + } + }, "node_modules/range-parser": { "version": "1.2.1", "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", @@ -2044,6 +2184,18 @@ "node": ">= 0.6" } }, + "node_modules/uid-safe": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-2.1.5.tgz", + "integrity": "sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA==", + "license": "MIT", + "dependencies": { + "random-bytes": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, "node_modules/undefsafe": { "version": "2.0.5", "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz", diff --git a/package.json b/package.json index 4905ffc..c5cc368 100644 --- a/package.json +++ b/package.json @@ -11,8 +11,11 @@ "description": "", "dependencies": { "bcrypt": "^5.1.1", + "bcryptjs": "^3.0.2", + "connect-mongo": "^5.1.0", "ejs": "^3.1.10", "express": "^4.21.2", + "express-session": "^1.18.1", "mongoose": "^8.12.1", "nodemon": "^3.1.9" } diff --git a/src/index.js b/src/index.js index fde6425..aa81c9a 100644 --- a/src/index.js +++ b/src/index.js @@ -1,9 +1,24 @@ const express = require('express'); const pasth = require('path'); const bcrypt = require('bcrypt'); +const bcrypt2 = require('bcryptjs'); const collection=require("./config"); const app = express(); +const session = require("express-session"); +const MongoStore = require("connect-mongo"); + +app.use(session({ + secret: "tuClaveSecreta", // Cambia esto por una clave segura + resave: false, + saveUninitialized: false, + store: MongoStore.create({ + mongoUrl: 'mongodb://localhost:27017/Login', // Tu conexión a MongoDB + collectionName: "sessions" + }), + cookie: { maxAge: 1000 * 60 * 60 * 24 } // 1 dÃa +})); + //Convert data into json format app.use(express.json()); @@ -52,27 +67,82 @@ if(existingUser){ //Login User -app.post("/login", async (req, res)=>{ -try{ - const check = await collection.findOne({name: data.username}); - if(!check){ - res.send("user cannot be found") +app.post("/login", async (req, res) => { + try { + const { username, password } = req.body; + const user = await collection.findOne({ name: username }); + + if (!user) { + return res.send("Usuario no encontrado"); + } + // Asegúrate de que tasks sea un array vacÃo si no existe + if (!user.tasks) { + user.tasks = []; + } + + const isPasswordMatch = await bcrypt.compare(password, user.password); + if (!isPasswordMatch) { + return res.send("Contraseña incorrecta"); + } + + // Guardar el ID del usuario en la sesión + req.session.userId = user._id; + + console.log("Sesión después de asignar userId:", req.session); + + // Redirigir al To-Do List (home.ejs) + res.render("home", { tasks: user.tasks }); + + } catch (error) { + console.error("Error en login:", error); + res.status(500).send("Error en el servidor."); } - //compare the hash password from the database with the plain text - const isPasswordMatch = await bcrypt.compare(req.body.password, check.password); - if(isPasswordMatch){ - res.render("home"); - }else{ - req.send("wrong password") +}); + + + + +// PARTE TODO LIST + +app.get("/todo", async (req, res) => { + if (!req.session.userId) { + return res.redirect("/"); // Redirigir si no está logueado } -}catch{ - res.send("wrong detail") + const user = await collection.findById(req.session.userId); + res.render("index", { tasks: user.tasks }); +}); + +//agregar tareas +app.post("/add", async (req, res) => { + if (!req.session.userId) return res.redirect("/"); -} -}) + const user = await collection.findById(req.session.userId); + user.tasks.push({ text: req.body.task }); + await user.save(); + + res.redirect("/todo"); +}); + +//eliminar tareas +app.post("/delete", async (req, res) => { + if (!req.session.userId) return res.redirect("/"); + const user = await collection.findById(req.session.userId); + user.tasks = user.tasks.filter(task => task._id.toString() !== req.body.taskId); + await user.save(); + res.redirect("/todo"); +}); + + +// Cerrar sesion + +app.get("/logout", (req, res) => { + req.session.destroy(() => { + res.redirect("/"); + }); +}); diff --git a/views/home.ejs b/views/home.ejs index be77b34..9902e34 100644 --- a/views/home.ejs +++ b/views/home.ejs @@ -1,5 +1,5 @@ <!DOCTYPE html> -<html lang="en"> +<html lang="es"> <head> <meta charset="UTF-8"> <meta name="viewport" content="width=device-width, initial-scale=1.0"> @@ -7,7 +7,25 @@ </head> <body> - <h1 style="text-align:center">Welcome to home page</h1> + <h1>Tu Lista de Tareas</h1> + + <% if (tasks && tasks.length > 0) { %> + <ul> + <% tasks.forEach(task => { %> + <li><%= task.text %></li> + <% }); %> + </ul> + <% } else { %> + <p>No tienes tareas aún.</p> + <% } %> + + <form action="/add" method="POST"> + <input type="text" name="task" placeholder="Nueva tarea" required> + <button type="submit">Agregar</button> + </form> + + <a href="/logout">Cerrar Sesión</a> + </body> -</html> \ No newline at end of file +</html> -- GitLab